/** * mtx.js - mutable transaction object for bcoin * Copyright (c) 2014-2015, Fedor Indutny (MIT License) * https://github.com/indutny/bcoin */ var bn = require('bn.js'); var bcoin = require('../bcoin'); var utils = require('./utils'); var assert = utils.assert; var constants = bcoin.protocol.constants; var network = bcoin.protocol.network; var Script = bcoin.script; var Witness = bcoin.script.witness; var opcodes = constants.opcodes; /** * MTX */ function MTX(options) { if (!(this instanceof MTX)) return new MTX(options); if (!options) options = {}; this.options = options; this.type = 'tx'; this.version = options.version || 1; this.inputs = []; this.outputs = []; this.locktime = 0; this.ts = 0; this.block = null; this.index = -1; this.ps = this.ts === 0 ? utils.now() : 0; this.changeIndex = options.changeIndex != null ? options.changeIndex : -1; this._hash = null; this._whash = null; this._raw = null; this._size = 0; this._witnessSize = 0; this.height = -1; if (options.inputs) { options.inputs.forEach(function(input) { this.addInput(input); }, this); } if (options.outputs) { options.outputs.forEach(function(output) { this.addOutput(output); }, this); } } utils.inherits(MTX, bcoin.tx); MTX.prototype.clone = function clone() { return new MTX(this); }; MTX.prototype.hash = function hash(enc) { var hash = utils.dsha256(this.renderNormal()); return enc === 'hex' ? utils.toHex(hash) : hash; }; MTX.prototype.witnessHash = function witnessHash(enc) { var hash; if (this.isCoinbase()) { return enc === 'hex' ? utils.toHex(constants.zeroHash) : new Buffer(constants.zeroHash); } if (!this.hasWitness()) return this.hash(enc); hash = utils.dsha256(this.renderWitness()); return enc === 'hex' ? utils.toHex(hash) : hash; }; MTX.prototype.render = function render() { return this.getRaw(); }; MTX.prototype.renderNormal = function renderNormal() { return bcoin.protocol.framer.tx(this); }; MTX.prototype.renderWitness = function renderWitness() { return bcoin.protocol.framer.witnessTX(this); }; MTX.prototype.getRaw = function getRaw() { if (this.hasWitness()) return bcoin.protocol.framer.witnessTX(this); return bcoin.protocol.framer.tx(this); }; MTX.prototype.getSize = function getSize() { return this.getRaw().length; }; MTX.prototype.getVirtualSize = function getVirtualSize() { var raw = this.getRaw(); var size = raw.length; var witnessSize = raw._witnessSize; var base = size - witnessSize; return (base * 4 + witnessSize + 3) / 4 | 0; }; MTX.prototype.addInput = function addInput(options, index) { var input; if (options instanceof MTX) options = bcoin.coin(options, index); if (options instanceof bcoin.coin) { options = { prevout: { hash: options.hash, index: options.index }, coin: options }; } assert(options.prevout); // i = this._inputIndex(options.prevout.hash, options.prevout.index); // assert(i === -1); input = bcoin.input(options, this); if (options.script instanceof bcoin.script) input.script = options.script.clone(); if (options.witness instanceof bcoin.script.witness) input.witness = options.witness.clone(); this.inputs.push(input); return this; }; MTX.prototype.scriptInput = function scriptInput(index, addr) { var input, prev, n, i, redeemScript, witnessScript, vector, dummy; if (typeof index !== 'number') index = this.inputs.indexOf(index); // Get the input input = this.inputs[index]; assert(input); // We should have previous outputs by now. assert(input.coin); // Optimization: Don't bother with any below // calculation if the output is already templated. // Just say this is "our" output. if (input.script.code.length || input.witness.items.length) return true; // Optimization: test output against the // address map to avoid unnecessary calculation. // A hash table lookup may be faster than all // the nonsense below. if (!addr.ownOutput(input.coin)) return false; // Get the previous output's script prev = input.coin.script; // This is easily the hardest part about building a transaction // with segwit: figuring out where the redeem script and witness // redeem scripts go. if (prev.isScripthash()) { if (addr.program && utils.isEqual(prev.code[1], addr.programHash)) { // Witness program nested in regular P2SH. redeemScript = addr.program.encode(); vector = input.witness.items; dummy = new Buffer([]); assert(addr.program.code[0] === opcodes.OP_0, 'Non-zero version passed to address.'); if (addr.program.code[1].length === 32) { // P2WSH nested within pay-to-scripthash // (it had to be this complicated, didn't it?) witnessScript = addr.script.encode(); prev = addr.script; } else if (addr.program.code[1].length === 20) { // P2WPKH nested within pay-to-scripthash. prev = Script.createPubkeyhash(addr.keyHash); } else { assert(false, 'Unknown program data length passed to address.'); } } else if (addr.script && utils.isEqual(prev.code[1], addr.scriptHash160)) { // Regular P2SH. redeemScript = addr.script.encode(); vector = input.script.code; prev = addr.script; dummy = opcodes.OP_0; } else { return false; } } else if (prev.isWitnessProgram()) { // Witness program. vector = input.witness.items; dummy = new Buffer([]); if (prev.code[0] !== opcodes.OP_0) return false; if (prev.code[1].length === 32) { // Bare P2WSH. if (!addr.script || !utils.isEqual(prev.code[1], addr.scriptHash256)) return false; witnessScript = addr.script.encode(); prev = addr.script; } else if (prev.code[1].length === 20) { // Bare P2WPKH. if (!utils.isEqual(prev.code[1], addr.keyHash)) return false; prev = Script.createPubkeyhash(prev.code[1]); } else { // Bare... who knows? return false; } } else { // Wow, a normal output! Praise be to Jengus and Gord. vector = input.script.code; dummy = opcodes.OP_0; } if (prev.isPubkey()) { // P2PK if (!utils.isEqual(prev.code[0], addr.publicKey)) return false; // Already has a script template (at least) if (vector.length) return true; vector[0] = dummy; } else if (prev.isPubkeyhash()) { // P2PKH if (!utils.isEqual(prev.code[2], addr.keyHash)) return false; // Already has a script template (at least) if (vector.length) return true; vector[0] = dummy; vector[1] = addr.publicKey; } else if (prev.isMultisig()) { // Multisig if (utils.indexOf(prev.code, addr.publicKey) === -1) return false; // Already has a script template (at least) if (vector.length) return true; // Technically we should create m signature slots, // but we create n signature slots so we can order // the signatures properly. vector[0] = dummy; // Grab `n` value (number of keys). n = Script.getSmall(prev.code[prev.code.length - 2]); // Fill script with `n` signature slots. for (i = 0; i < n; i++) vector[i + 1] = dummy; } else { if (utils.indexOf(prev.code, addr.publicKey) === -1) return false; // Already has a script template (at least) if (vector.length) return true; // Likely a non-standard scripthash multisig // input. Determine n value by counting keys. // Also, only allow nonstandard types for // scripthash. vector[0] = dummy; // Fill script with `n` signature slots. for (i = 0; i < prev.code.length; i++) { if (Script.isKey(prev.code[i])) vector[i + 1] = dummy; } } // P2SH requires the redeem // script after signatures. if (redeemScript) input.script.code.push(redeemScript); // P2WSH requires the witness // script after signatures. if (witnessScript) input.witness.items.push(witnessScript); return true; }; MTX.prototype.createSignature = function createSignature(index, prev, key, type, version) { var hash, signature; if (typeof index !== 'number') index = this.inputs.indexOf(index); if (type == null) type = 'all'; if (typeof type === 'string') type = constants.hashType[type]; // Get the hash of the current tx, minus the other // inputs, plus the sighash type. hash = this.signatureHash(index, prev, type, version); // Sign the transaction with our one input signature = Script.sign(hash, key, type); // Something is broken if this doesn't work: // assert(Script.checksig(hash, signature, key), 'BUG: Verify failed.'); return signature; }; MTX.prototype.signInput = function signInput(index, addr, type) { var input, prev, signature, ki, signatures, i; var len, m, n, keys, vector, dummy, version; if (typeof index !== 'number') index = this.inputs.indexOf(index); // Get the input input = this.inputs[index]; assert(input); // We should have previous outputs by now. assert(input.coin); // Get the previous output's subscript prev = input.coin.script; vector = input.script.code; len = vector.length; dummy = opcodes.OP_0; version = 0; // We need to grab the redeem script when // signing p2sh transactions. if (prev.isScripthash()) { prev = input.script.getRedeem(); len = vector.length - 1; } // If the output script is a witness program, // we have to switch the vector to the witness // and potentially alter the length. Note that // witnesses are stack items, so the `dummy` // _has_ to be an empty buffer (what OP_0 // pushes onto the stack). if (prev.isWitnessScripthash()) { prev = input.witness.getRedeem(); vector = input.witness.items; len = vector.length - 1; dummy = new Buffer([]); version = 1; } else if (prev.isWitnessPubkeyhash()) { prev = Script.createPubkeyhash(prev.code[1]); vector = input.witness.items; len = vector.length; dummy = new Buffer([]); version = 1; } // Create our signature. signature = this.createSignature(index, prev, addr.key, type, version); // Add signatures. if (prev.isPubkey()) { // P2PK // Already signed. if (Script.isSignature(vector[0])) return true; // Make sure the pubkey is ours. if (!utils.isEqual(addr.publicKey, prev.code[0])) return false; vector[0] = signature; return true; } if (prev.isPubkeyhash()) { // P2PKH // Already signed. if (Script.isSignature(vector[0])) return true; // Make sure the pubkey hash is ours. if (!utils.isEqual(addr.keyHash, prev.code[2])) return false; vector[0] = signature; return true; } if (prev.isMultisig()) { // Multisig // Grab the redeem script's keys to figure // out where our key should go. keys = prev.code.slice(1, -2); // Grab `m` value (number of sigs required). m = Script.getSmall(prev.code[0]); // Grab `n` value (number of keys). n = Script.getSmall(prev.code[prev.code.length - 2]); } else { // Only allow non-standard signing for // scripthash. if (len !== vector.length - 1) return false; keys = []; for (i = 0; i < prev.code.length; i++) { if (Script.isKey(prev.code[i])) keys.push(prev.code[i]); } // We don't know what m is, so // we can never finalize the signatures. m = keys.length; n = keys.length; } // Something is very wrong here. Abort. if (len - 1 > n) return false; // Count the number of current signatures. signatures = 0; for (i = 1; i < len; i++) { if (Script.isSignature(vector[i])) signatures++; } // Signatures are already finalized. if (signatures === m && len - 1 === m) return true; // This can happen in a case where another // implementation adds signatures willy-nilly // or by `m`. Add some signature slots for // us to use. while (len - 1 < n) { vector.splice(len, 0, dummy); len++; } // Find the key index so we can place // the signature in the same index. ki = utils.indexOf(keys, addr.publicKey); // Our public key is not in the prev_out // script. We tried to sign a transaction // that is not redeemable by us. if (ki === -1) return false; // Offset key index by one to turn it into // "sig index". Accounts for OP_0 byte at // the start. ki++; // Add our signature to the correct slot // and increment the total number of // signatures. if (ki < len && signatures < m) { if (Script.isZero(vector[ki])) { vector[ki] = signature; signatures++; } } // All signatures added. Finalize. if (signatures >= m) { // Remove empty slots left over. for (i = len - 1; i >= 1; i--) { if (Script.isZero(vector[i])) { vector.splice(i, 1); len--; } } // Remove signatures which are not required. // This should never happen except when dealing // with implementations that potentially handle // signature slots differently. while (signatures > m) { vector.splice(len - 1, 1); signatures--; len--; } // Sanity checks. assert.equal(signatures, m); assert.equal(len - 1, m); } return signatures === m; }; MTX.prototype.isSigned = function isSigned(m) { var i, input, prev, vector, len, j; var total = 0; for (i = 0; i < this.inputs.length; i++) { input = this.inputs[i]; // We can't check for signatures unless // we have the previous output. if (!input.coin) return false; // Get the prevout's subscript prev = input.coin.script; // Script length, needed for multisig vector = input.script.code; len = vector.length; // We need to grab the redeem script when // signing p2sh transactions. if (prev.isScripthash()) { prev = input.script.getRedeem(); len = vector.length - 1; } // If the output script is a witness program, // we have to switch the vector to the witness // and potentially alter the length. Note that // witnesses are stack items, so the `dummy` // _has_ to be an empty buffer (what OP_0 // pushes onto the stack). if (prev.isWitnessScripthash()) { prev = input.witness.getRedeem(); vector = input.witness.items; len = vector.length - 1; } else if (prev.isWitnessPubkeyhash()) { prev = Script.createPubkeyhash(prev.code[1]); vector = input.witness.items; len = vector.length; } if (prev.isPubkey()) { if (!Script.isSignature(vector[0])) return false; } else if (prev.isPubkeyhash()) { if (!Script.isSignature(vector[0])) return false; } else if (prev.isMultisig()) { // Grab `m` value (number of required sigs). m = Script.getSmall(prev.code[0]); // Ensure all members are signatures. for (j = 1; j < len; j++) { if (!Script.isSignature(vector[j])) return false; } // Ensure we have the correct number // of required signatures. if (len - 1 !== m) return false; } else { for (j = 0; j < vector.length; j++) { if (Script.isSignatureEncoding(vector[j])) total++; } if (total !== m) return false; } } return true; }; MTX.prototype.sign = function sign(index, addr, type) { var input; if (index && typeof index === 'object') index = this.inputs.indexOf(index); input = this.inputs[index]; assert(input); // Build script for input if (!this.scriptInput(index, addr)) return false; // Sign input if (!this.signInput(index, addr, type)) return false; return true; }; MTX.prototype.addOutput = function addOutput(obj, value) { var options, output; if ((obj instanceof bcoin.wallet) || (obj instanceof bcoin.address)) obj = obj.getAddress(); if (typeof obj === 'string') { options = { address: obj, value: value }; } else { options = obj; } output = bcoin.output(options, this); this.outputs.push(output); this.scriptOutput(this.outputs.length - 1, options); return this; }; MTX.prototype.scriptOutput = function scriptOutput(index, options) { var output; if (options instanceof bcoin.output) return; if (typeof index !== 'number') index = this.outputs.indexOf(index); output = this.outputs[index]; assert(output); if (options.script instanceof bcoin.script) output.script = options.script.clone(); else if (options.script) output.script = bcoin.script(options.script); else output.script = Script.createOutputScript(options); }; MTX.prototype.maxSize = function maxSize(maxM, maxN) { var copy = this.clone(); var i, j, input, total, size, prev, m, n; var witness; // Create copy with 0-script inputs for (i = 0; i < copy.inputs.length; i++) { copy.inputs[i].script = new Script([]); copy.inputs[i].witness = new Witness([]); } total = copy.render().length; // Add size for signatures and public keys for (i = 0; i < copy.inputs.length; i++) { input = copy.inputs[i]; size = 0; witness = false; assert(input.coin); // Get the previous output's subscript prev = input.coin.script; // If we have access to the redeem script, // we can use it to calculate size much easier. if (this.inputs[i].script.code.length && prev.isScripthash()) { // Need to add the redeem script size // here since it will be ignored by // the isMultisig clause. // OP_PUSHDATA2 [redeem] prev = this.inputs[i].script.getRedeem(); size += utils.sizeVarint(prev.getSize()) + prev.getSize(); } if (prev.isWitnessProgram()) { witness = true; // Now calculating vsize. The regular // redeem script (if there was one) // is now worth 4 points. size *= 4; if (this.inputs[i].witness.items.length && prev.isWitnessScripthash()) { prev = this.inputs[i].witness.getRedeem(); size += utils.sizeVarint(prev.getSize()) + prev.getSize(); } else if (prev.isWitnessPubkeyhash()) { prev = Script.createPubkeyhash(prev.code[1]); } } if (prev.isPubkey()) { // P2PK // OP_PUSHDATA0 [signature] size += 1 + 73; } else if (prev.isPubkeyhash()) { // P2PKH // OP_PUSHDATA0 [signature] size += 1 + 73; // OP_PUSHDATA0 [key] size += 1 + 33; } else if (prev.isMultisig()) { // Bare Multisig // Get the previous m value: m = Script.getSmall(prev.code[0]); // OP_0 size += 1; // OP_PUSHDATA0 [signature] ... size += (1 + 73) * m; } else if (prev.isScripthash()) { // P2SH Multisig // This technically won't work well for other // kinds of P2SH. It will also over-estimate // the fee by a lot (at least 10000 satoshis // since we don't have access to the m and n // values), which will be recalculated later. // If fee turns out to be smaller later, we // simply add more of the fee to the change // output. // m value m = maxM || 15; // n value n = maxN || 15; // OP_0 size += 1; // OP_PUSHDATA0 [signature] ... size += (1 + 73) * m; // OP_PUSHDATA2 [redeem] size += 3; // m value size += 1; // OP_PUSHDATA0 [key] ... size += (1 + 33) * n; // n value size += 1; // OP_CHECKMULTISIG size += 1; } else { // OP_PUSHDATA0 [signature] for (j = 0; j < prev.code.length; j++) { if (Script.isKey(prev.code[j])) size += 1 + 73; } } // Byte for varint size of input script. size += utils.sizeVarint(size); // Calculate vsize if we're a witness program. if (witness) size = (size + 3) / 4 | 0; total += size; } return total; }; MTX.prototype.selectCoins = function selectCoins(coins, options) { var tx = this.clone(); var outputValue = tx.getOutputValue(); var totalkb = 1; var chosen = []; var lastAdded = 0; var minFee = constants.tx.minFee; var dustThreshold = constants.tx.dustThreshold; var i, size, newkb, change; var fee; assert(tx.inputs.length === 0); if (!options || typeof options !== 'object') { options = { changeAddress: arguments[1], fee: arguments[2] }; } if (!options.selection || options.selection === 'age') { // Oldest unspents first coins = coins.slice().sort(function(a, b) { return a.height - b.height; }); } else if (options.selection === 'random' || options.selection === 'all') { // Random unspents coins = coins.slice().sort(function() { return Math.random() > 0.5 ? 1 : -1; }); } function total() { if (options.subtractFee) return outputValue; return outputValue.add(fee); } function isFull() { return tx.getInputValue().cmp(total()) >= 0; } function addCoins() { var i, index; for (i = lastAdded; i < coins.length; i++) { // Add new inputs until MTX will have enough // funds to cover both minimum post cost // and fee. tx.addInput(coins[i]); chosen.push(coins[i]); lastAdded++; if (options.wallet) options.wallet.scriptInputs(tx, index); if (options.selection === 'all') continue; // Stop once we're full. if (isFull()) break; } } if (options.fee) { fee = options.fee; // Transfer `total` funds maximum. addCoins(); } else { fee = new bn(minFee); // Transfer `total` funds maximum. addCoins(); // Add dummy output (for `change`) to // calculate maximum MTX size. tx.addOutput({ address: options.changeAddress, value: new bn(0) }); // Change fee value if it is more than 1024 // bytes (10000 satoshi for every 1024 bytes). do { // Calculate max possible size after signing. size = tx.maxSize(options.m, options.n); if (options.free) { if (newkb == null && tx.isFree(null, size)) { fee = new bn(0); break; } } if (options.accurate) { newkb = size / 1024; fee = new bn(newkb * minFee | 0); totalkb = newkb; } else { newkb = Math.ceil(size / 1024) - totalkb; fee.iaddn(newkb * minFee); totalkb += newkb; } // Failed to get enough funds, add more inputs. if (!isFull()) addCoins(); } while (!isFull() && lastAdded < coins.length); } if (!isFull()) { // Still failing to get enough funds. chosen = null; } else { // How much money is left after filling outputs. change = tx.getInputValue().sub(total()); // Attempt to subtract fee. if (options.subtractFee != null) { if (typeof options.subtractFee === 'number') { i = options.subtractFee; assert(tx.outputs[i], 'Subtraction index does not exist.'); if (tx.outputs[i].value.cmp(fee.addn(dustThreshold)) >= 0) tx.outputs[i].value.isub(fee); else chosen = null; } else { for (i = 0; i < tx.outputs.length; i++) { if (tx.outputs[i].value.cmp(fee.addn(dustThreshold)) >= 0) { tx.outputs[i].value.isub(fee); break; } } // Could not subtract fee if (i === tx.outputs.length) chosen = null; } } } // Return necessary inputs and change. return { coins: chosen, change: change, fee: fee, total: total(), kb: totalkb }; }; MTX.prototype.fill = function fill(coins, options) { var self = this; var result, err; if (!options || typeof options !== 'object') { options = { changeAddress: arguments[1], fee: arguments[2] }; } assert(coins); assert(options.changeAddress, '`changeAddress` is required.'); result = this.selectCoins(coins, options); if (!result.coins) { err = new Error('Could not fill transaction.'); err.requiredFunds = result.total; throw err; } result.coins.forEach(function(coin) { self.addInput(coin); }); if (result.change.cmpn(constants.tx.dustThreshold) < 0) { // Do nothing. Change is added to fee. assert.equal( this.getFee().toNumber(), result.fee.add(result.change).toNumber() ); this.changeIndex = -1; } else { this.addOutput({ address: options.changeAddress, value: result.change }); this.changeIndex = this.outputs.length - 1; assert.equal(this.getFee().toNumber(), result.fee.toNumber()); } return result; }; // https://github.com/bitcoin/bips/blob/master/bip-0069.mediawiki MTX.prototype.sortMembers = function sortMembers() { var changeOutput; if (this.changeIndex !== -1) { changeOutput = this.outputs[this.changeIndex]; assert(changeOutput); } this.inputs = this.inputs.slice().sort(function(a, b) { var h1 = new Buffer(a.prevout.hash, 'hex'); var h2 = new Buffer(b.prevout.hash, 'hex'); var res = utils.cmp(h1, h2); if (res !== 0) return res; return a.prevout.index - b.prevout.index; }); this.outputs = this.outputs.slice().sort(function(a, b) { var res = a.value.cmp(b.value); if (res !== 0) return res; return utils.cmp(a.encode(), b.encode()); }); if (this.changeIndex !== -1) { this.changeIndex = this.outputs.indexOf(changeOutput); assert(this.changeIndex !== -1); } }; MTX.prototype.avoidFeeSniping = function avoidFeeSniping(height) { if (height == null) height = network.height; if (height === -1) height = 0; if ((Math.random() * 10 | 0) === 0) this.setLocktime(Math.max(0, height - (Math.random() * 100 | 0))); else this.setLocktime(height); }; MTX.prototype.setLocktime = function setLocktime(locktime) { var i, input; for (i = 0; i < this.inputs.length; i++) { input = this.inputs[i]; if (input.sequence === 0xffffffff) input.sequence = 0xffffffff - 1; } this.locktime = locktime; }; MTX._fromJSON = bcoin.tx._fromJSON; MTX.fromJSON = function fromJSON(json) { return new MTX(MTX._fromJSON(json)); }; MTX._fromRaw = bcoin.tx._fromRaw; MTX.fromRaw = function fromRaw(data, enc) { return new MTX(MTX._fromRaw(data, enc)); }; MTX._fromExtended = bcoin.tx._fromExtended; MTX.fromExtended = function fromExtended(data, enc) { return new MTX(MTX._fromExtended(data, enc)); }; MTX.fromTX = function fromTX(tx) { return new MTX(tx); }; MTX.prototype.toTX = function toTX() { return new bcoin.tx(this); }; MTX.isMTX = function isMTX(obj) { return obj && Array.isArray(obj.inputs) && typeof obj.ps === 'number' && typeof obj.changeIndex === 'number' && typeof obj.scriptInput === 'function'; }; /** * Expose */ module.exports = MTX;