/** * tx.js - transaction object for bcoin * Copyright (c) 2014-2015, Fedor Indutny (MIT License) * https://github.com/indutny/bcoin */ var bn = require('bn.js'); var bcoin = require('../bcoin'); var utils = bcoin.utils; var assert = utils.assert; var constants = bcoin.protocol.constants; /** * TX */ function TX(data, block) { if (!(this instanceof TX)) return new TX(data, block); this.type = 'tx'; if (!data) data = {}; this.version = data.version || 1; this.inputs = []; this.outputs = []; this.lock = data.lock || 0; this.ts = data.ts || 0; this.block = null; this._hash = null; this._raw = data._raw || null; this._size = data._size || 0; this.network = data.network || false; this.relayedBy = data.relayedBy || '0.0.0.0'; this.rbf = !!data.rbf; this._chain = data.chain; if (data.inputs) { assert(this.inputs.length === 0); data.inputs.forEach(function(input) { this.inputs.push(bcoin.input(input)); }, this); } if (data.outputs) { assert(this.outputs.length === 0); data.outputs.forEach(function(output) { this.outputs.push(bcoin.output(output)); }, this); } if (block && block.subtype === 'merkleblock') { if (!data.ts && block && block.hasTX(this.hash('hex'))) { this.ts = block.ts; this.block = block.hash('hex'); } } this.hardFee = data.hardFee || null; this.changeAddress = data.changeAddress || null; this.changeIndex = data.changeIndex != null ? data.changeIndex : -1; // ps = Pending Since this.ps = this.ts === 0 ? utils.now() : 0; // Discourage fee snipping a la bitcoind // if (data.lock == null) // this._avoidFeeSnipping(); } TX.prototype.clone = function clone() { return new TX(this); }; TX.prototype.hash = function hash(enc, force) { var h = utils.dsha256(this.render(force)); return enc === 'hex' ? utils.toHex(h) : h; }; TX.prototype.render = function render(force) { if (!force && this.network && this._raw) return this._raw.slice(); return bcoin.protocol.framer.tx(this); }; TX.prototype.size = function size() { return this._size || this.render().length; }; TX.prototype.input = function input(i, index) { this._input(i, index); return this; }; // tx._input(tx, index) // tx._input(hash, index) // tx._input(input) // tx._input({ hash: hash, index: index }) // tx._input({ tx: tx, index: index }) TX.prototype._input = function _input(obj, index) { var options, hash, input, ex, i; if (obj instanceof TX) options = { tx: obj, index: index }; else if (typeof obj === 'string' || utils.isBuffer(obj)) options = { hash: obj, index: index }; else options = obj; if (options.tx) hash = options.tx.hash('hex'); else if (options.out) hash = options.out.hash; else hash = options.hash; if (typeof hash !== 'string') hash = utils.toHex(hash); input = bcoin.input({ tx: this, out: { tx: options.out ? options.out.tx : options.tx, hash: hash, index: options.out ? options.out.index : options.index }, script: options.script, seq: options.seq }); // Try modifying existing input first i = this._inputIndex(input.out.hash, input.out.index); if (i !== -1) { ex = this.inputs[i]; input.out.tx = input.out.tx || ex.out.tx; input.seq = input.seq || ex.seq; input.script = input.script.length ? input.script : ex.script; this.inputs[i] = input; } else { this.inputs.push(input); i = this.inputs.length - 1; } return i; }; TX.prototype._inputIndex = function _inputIndex(hash, index) { var i, ex; if (hash instanceof TX) hash = hash.hash('hex'); for (i = 0; i < this.inputs.length; i++) { ex = this.inputs[i]; if (ex.out.hash === hash && ex.out.index === index) return i; } return -1; }; TX.prototype.scriptInput = function scriptInput(index, pub, redeem) { var input, s, n, i; if (typeof index !== 'number') index = this.inputs.indexOf(index); // Get the input input = this.inputs[index]; assert(input); // We should have previous outputs by now. assert(input.out.tx); // Already has a script template (at least) if (input.script.length) return; // Get the previous output's subscript s = input.out.tx.getSubscript(input.out.index); // P2SH if (bcoin.script.isScripthash(s)) { assert(redeem); s = bcoin.script.subscript(bcoin.script.decode(redeem)); } else { redeem = null; } if (bcoin.script.isPubkey(s)) { // P2PK input.script = [ [] ]; } else if (bcoin.script.isPubkeyhash(s)) { // P2PKH input.script = [ [], pub ]; } else if (bcoin.script.isMultisig(s)) { // Multisig // Technically we should create m signature slots, // but we create n signature slots so we can order // the signatures properly. input.script = [ [] ]; // Grab `n` value (number of keys). n = s[s.length - 2]; // Fill script with `n` signature slots. for (i = 0; i < n; i++) input.script[i + 1] = []; } else { // Likely a non-standard scripthash multisig // input. Just set up the empty array. Also, // only allow nonstandard types for scripthash. if (redeem) input.script = [ [] ]; } // P2SH requires the redeem script after signatures if (redeem) { input.script.push(redeem); // The fee can be calculated more accurately // now that the redeem script is available. this._recalculateFee(); } }; TX.prototype.signature = function signature(index, key, type) { var input, s, hash, signature; if (typeof index !== 'number') index = this.inputs.indexOf(index); if (type == null) type = 'all'; if (typeof type === 'string') type = constants.hashType[type]; // Get the input input = this.inputs[index]; assert(input); // We should have previous outputs by now. assert(input.out.tx); // Get the previous output's subscript s = input.out.tx.getSubscript(input.out.index); // We need to grab the redeem script when // signing p2sh transactions. if (bcoin.script.isScripthash(s)) { s = bcoin.script.decode(input.script[input.script.length - 1]); s = bcoin.script.subscript(s); } // Get the hash of the current tx, minus the other // inputs, plus the sighash type. hash = this.signatureHash(index, s, type); // Sign the transaction with our one input signature = bcoin.script.sign(hash, key, type); // Something is broken if this doesn't work: assert(bcoin.script.checksig(hash, signature, key)); return signature; }; // Sign the now-built scriptSigs TX.prototype.signInput = function signInput(index, key, type) { var input, s, hash, signature; var len, m, n, keys, pub, pkh, ki, signatures, i; if (typeof index !== 'number') index = this.inputs.indexOf(index); // Get the input input = this.inputs[index]; assert(input); // We should have previous outputs by now. assert(input.out.tx); // Create our signature. signature = this.signature(index, key, type); // Get the previous output's subscript s = input.out.tx.getSubscript(input.out.index); // Script length, needed for multisig len = input.script.length; // We need to grab the redeem script when // signing p2sh transactions. if (bcoin.script.isScripthash(s)) { s = bcoin.script.decode(input.script[input.script.length - 1]); s = bcoin.script.subscript(s); // Decrement `len` to avoid the redeem script len--; } // Get pubkey and pubkey hash. pub = key.getPublic(true, 'array'); pkh = bcoin.wallet.key2hash(pub); // Add signatures. if (bcoin.script.isPubkey(s)) { // P2PK // Something is wrong. Abort. if (!Array.isArray(input.script[0])) return false; // Already signed. if (input.script[0].length) return true; // Make sure the pubkey is ours. if (!utils.isEqual(pub, s[0])) return false; input.script[0] = signature; return true; } if (bcoin.script.isPubkeyhash(s)) { // P2PKH // Something is wrong. Abort. if (!Array.isArray(input.script[0])) return false; // Already signed. if (input.script[0].length) return true; // Make sure the pubkey hash is ours. if (!utils.isEqual(pkh, s[2])) return false; input.script[0] = signature; return true; } if (bcoin.script.isMultisig(s)) { // Multisig // Grab the redeem script's keys to figure // out where our key should go. keys = s.slice(1, -2); // Grab `m` value (number of sigs required). m = s[0]; // Grab `n` value (number of keys). n = s[s.length - 2]; } else { // Only allow non-standard signing for // scripthash. if (len !== input.script.length - 1) return false; keys = []; for (i = 0; i < s.length; i++) { if (bcoin.script.isKey(s[i])) keys.push(s[i]); } n = keys.length; m = n; } // Something is very wrong here. Abort. if (len - 1 > n) return false; // Count the number of current signatures. signatures = 0; for (i = 1; i < len; i++) { if (bcoin.script.isSignature(input.script[i])) signatures++; } // Signatures are already finalized. if (signatures === m && len - 1 === m) return true; // This can happen in a case where another // implementation adds signatures willy-nilly // or by `m`. Add some signature slots for // us to use. while (len - 1 < n) { input.script.splice(len, 0, []); len++; } // Find the key index so we can place // the signature in the same index. for (ki = 0; ki < keys.length; ki++) { if (utils.isEqual(pub, keys[ki])) break; } // Our public key is not in the prev_out // script. We tried to sign a transaction // that is not redeemable by us. if (ki === keys.length) return false; // Offset key index by one to turn it into // "sig index". Accounts for OP_0 byte at // the start. ki++; // Add our signature to the correct slot // and increment the total number of // signatures. if (ki < len && signatures < m) { if (bcoin.script.isEmpty(input.script[ki])) { input.script[ki] = signature; signatures++; } } // All signatures added. Finalize. if (signatures >= m) { // Remove empty slots left over. for (i = len - 1; i >= 1; i--) { if (bcoin.script.isEmpty(input.script[i])) { input.script.splice(i, 1); len--; } } // Remove signatures which are not required. // This should never happen except when dealing // with implementations that potentially handle // signature slots differently. while (signatures > m) { input.script.splice(len - 1, 1); signatures--; len--; } // Sanity checks. assert.equal(signatures, m); assert.equal(len - 1, m); } return signatures === m; }; TX.prototype.scriptSig = function scriptSig(index, key, pub, redeem, type) { var input; if (typeof index !== 'number') index = this.inputs.indexOf(index); // Get the input input = this.inputs[index]; assert(input); // Build script for input this.scriptInput(index, pub, redeem); // Sign input this.signInput(index, key, type); return input.script; }; TX.prototype.output = function output(obj, value) { var options, output; if (obj instanceof bcoin.wallet) obj = obj.getAddress(); if (typeof obj === 'string') { options = { address: obj, value: value }; } else { options = obj; } output = bcoin.output({ tx: this, value: options.value, script: options.script }); this.outputs.push(output); this.scriptOutput(this.outputs.length - 1, options); return this; }; TX.prototype.out = TX.prototype.output; TX.prototype.scriptOutput = function scriptOutput(index, options) { var output, script, keys, m, n, hash, flags; if (typeof index !== 'number') index = this.outputs.indexOf(index); output = this.outputs[index]; assert(output); if (!options) options = output; script = output.script; if (options instanceof bcoin.output) { options = Object.keys(options).reduce(function(out, key) { out[key] = options[key]; return out; }, {}); } if (options.addr) { options.address = options.addr; delete options.addr; } if (Array.isArray(options.address)) { options.keys = options.address.map(function(address) { return bcoin.wallet.addr2hash(address, 'pubkeyhash'); }); delete options.address; } if (options.minSignatures) { options.m = options.minSignatures; delete options.minSignatures; } if (options.color) { options.flags = options.color; delete options.color; } if (Array.isArray(options.keys)) { // Bare Multisig Transaction // https://github.com/bitcoin/bips/blob/master/bip-0010.mediawiki // https://github.com/bitcoin/bips/blob/master/bip-0011.mediawiki // https://github.com/bitcoin/bips/blob/master/bip-0019.mediawiki // m [key1] [key2] ... n checkmultisig keys = options.keys.map(utils.toBuffer); m = options.m || keys.length; n = options.n || keys.length; if (!(m >= 1 && m <= n)) return; if (!(n >= 1 && n <= (options.scripthash ? 15 : 3))) return; script = bcoin.script.createMultisig(keys, m, n); } else if (bcoin.wallet.validateAddress(options.address, 'scripthash')) { // P2SH Transaction // https://github.com/bitcoin/bips/blob/master/bip-0016.mediawiki // hash160 [20-byte-redeemscript-hash] equal script = [ 'hash160', bcoin.wallet.addr2hash(options.address, 'scripthash'), 'equal' ]; } else if (options.address) { // P2PKH Transaction // dup hash160 [pubkey-hash] equalverify checksig script = [ 'dup', 'hash160', bcoin.wallet.addr2hash(options.address, 'pubkeyhash'), 'equalverify', 'checksig' ]; } else if (options.key) { // P2PK Transaction // [pubkey] checksig script = [ utils.toBuffer(options.key), 'checksig' ]; } else if (options.flags) { // Nulldata Transaction // return [data] flags = options.flags; if (typeof flags === 'string') flags = utils.ascii2array(flags); assert(utils.isBuffer(flags)); assert(flags.length <= constants.script.maxOpReturn); script = [ 'return', flags ]; } // P2SH Transaction // hash160 [hash] eq if (options.scripthash) { if (options.lock != null) { script = [ bcoin.script.array(options.lock), 'checklocktimeverify', 'drop', 'codeseparator' ].concat(script); } hash = utils.ripesha(bcoin.script.encode(script)); script = [ 'hash160', hash, 'equal' ]; } output.script = script; }; TX.prototype.getSubscript = function getSubscript(index) { var script = this.outputs[index].script; return bcoin.script.subscript(script); }; TX.prototype.signatureHash = function signatureHash(index, s, type) { var copy = this.clone(); var i, msg, hash; if (!Array.isArray(s)) { type = s; s = this.inputs[index].out.tx.getSubscript(this.inputs[index].out.index); if (bcoin.script.isScripthash(s)) { s = this.inputs[index].script[this.inputs[index.script.length - 1]]; s = bcoin.script.subscript(bcoin.script.decode(s)); } } if (typeof index !== 'number') index = this.inputs.indexOf(index); if (typeof type === 'string') type = constants.hashType[type]; assert(index >= 0 && index < copy.inputs.length) assert(Array.isArray(s)); // Disable this for now. We allow null hash types // because bitcoind allows empty signatures. On // another note, we allow all weird sighash types // if strictenc is not enabled. // assert(utils.isFinite(type)); // Remove code separators. // s = script.subscript(s); // Remove all signatures. for (i = 0; i < copy.inputs.length; i++) copy.inputs[i].script = []; // Set our input to previous output's script copy.inputs[index].script = s; if ((type & 0x1f) === constants.hashType.none) { // Drop all outputs. We don't want to sign them. copy.outputs = []; // Allow input sequence updates for other inputs. for (i = 0; i < copy.inputs.length; i++) { if (i !== index) copy.inputs[i].seq = 0; } } else if ((type & 0x1f) === constants.hashType.single) { // Bitcoind used to return 1 as an error code: // it ended up being treated like a hash. if (index >= copy.outputs.length) return constants.oneHash.slice(); // Drop all the outputs after the input index. copy.outputs.length = index + 1; // Null outputs that are not the at current input index. for (i = 0; i < copy.outputs.length; i++) { if (i !== index) { copy.outputs[i].script = []; copy.outputs[i].value = new bn('ffffffffffffffff', 'hex'); } } // Allow input sequence updates for other inputs. for (i = 0; i < copy.inputs.length; i++) { if (i !== index) copy.inputs[i].seq = 0; } } // Only sign our input. Allows anyone to add inputs. if (type & constants.hashType.anyonecanpay) { copy.inputs[0] = copy.inputs[index]; copy.inputs.length = 1; } msg = copy.render(true); utils.writeU32(msg, type, msg.length); hash = utils.dsha256(msg); return hash; }; TX.prototype.tbsHash = function tbsHash(enc, force) { var copy = this.clone(); var i; if (this.isCoinbase()) return this.hash(enc); if (!this._tbsHash || force) { for (i = 0; i < copy.inputs.length; i++) copy.inputs[i].script = []; this._tbsHash = utils.dsha256(copy.render(true)); } return enc === 'hex' ? utils.toHex(this._tbsHash) : this._tbsHash.slice(); }; TX.prototype.verify = function verify(index, force, flags) { // Valid if included in block if (!force && this.ts !== 0) return true; if (this.inputs.length === 0) return false; return this.inputs.every(function(input, i) { var output; if (index != null && index !== i) return true; if (!input.out.tx) return false; // Somethis is very wrong if this is // not the case. assert.equal(input.out.tx.hash('hex'), input.out.hash); // Grab the previous output. output = input.out.tx.outputs[input.out.index]; // Transaction is referencing an output // that does not exist. if (!output) return false; // Transaction cannot reference itself. if (input.out.hash === this.hash('hex')) return false; return bcoin.script.verify(input.script, output.script, this, i, flags); }, this); }; TX.prototype.isCoinbase = function isCoinbase() { return this.inputs.length === 1 && +this.inputs[0].out.hash === 0; }; TX.prototype.maxSize = function maxSize() { var copy = this.clone(); var i, input, total, size, s, m, n; // Create copy with 0-script inputs for (i = 0; i < copy.inputs.length; i++) copy.inputs[i].script = []; total = copy.render().length; // Add size for signatures and public keys for (i = 0; i < copy.inputs.length; i++) { input = copy.inputs[i]; size = 0; // Get the previous output's subscript s = input.out.tx.getSubscript(input.out.index); // If we have access to the redeem script, // we can use it to calculate size much easier. if (this.inputs[i].script.length && bcoin.script.isScripthash(s)) { s = this.inputs[i].script[this.inputs[i].script.length - 1]; // Need to add the redeem script size // here since it will be ignored by // the isMultisig clause. // OP_PUSHDATA2 [redeem] size += 3 + s.length; s = bcoin.script.subscript(bcoin.script.decode(s)); } if (bcoin.script.isPubkey(s)) { // P2PK // OP_PUSHDATA0 [signature] size += 1 + 73; } else if (bcoin.script.isPubkeyhash(s)) { // P2PKH // OP_PUSHDATA0 [signature] size += 1 + 73; // OP_PUSHDATA0 [key] size += 1 + 65; } else if (bcoin.script.isMultisig(s)) { // Bare Multisig // Get the previous m value: m = s[0]; // OP_0 size += 1; // OP_PUSHDATA0 [signature] ... size += (1 + 73) * m; } else if (bcoin.script.isScripthash(s)) { // P2SH Multisig // This technically won't work well for other // kinds of P2SH. It will also over-estimate // the fee by a lot (at least 10000 satoshis // since we don't have access to the m and n // values), which will be recalculated later. // If fee turns out to be smaller later, we // simply add more of the fee to the change // output. // m value m = 15; // n value n = 15; // OP_0 size += 1; // OP_PUSHDATA0 [signature] ... size += (1 + 73) * m; // OP_PUSHDATA2 [redeem] size += 3; // m value size += 1; // OP_PUSHDATA0 [key] ... size += (1 + 65) * n; // n value size += 1; // OP_CHECKMULTISIG size += 1; } // Byte for varint size of input script if (size < 0xfd) size += 0; else if (size <= 0xffff) size += 2; else if (size <= 0xffffffff) size += 4; else size += 8; total += size; } return total; }; TX.prototype.getUnspent = function getUnspent(unspent, address, fee) { var tx = this.clone(); var cost = tx.funds('out'); var totalkb = 1; var total = cost.addn(constants.tx.fee); var inputs = []; var lastAdded = 0; var size, newkb, change; if (fee) { total = cost.add(fee); this.hardFee = fee; } function addInput(unspent) { // Add new inputs until TX will have enough // funds to cover both minimum post cost // and fee. var index = tx._input(unspent); inputs.push(tx.inputs[index]); lastAdded++; return tx.funds('in').cmp(total) < 0; } // Transfer `total` funds maximum. unspent.every(addInput); if (!fee) { // Add dummy output (for `change`) to // calculate maximum TX size. tx.output({ address: address, value: new bn(0) }); // Change fee value if it is more than 1024 // bytes (10000 satoshi for every 1024 bytes). do { // Calculate max possible size after signing. size = tx.maxSize(); newkb = Math.ceil(size / 1024) - totalkb; total.iaddn(newkb * constants.tx.fee); totalkb += newkb; // Failed to get enough funds, add more inputs. if (tx.funds('in').cmp(total) < 0) unspent.slice(lastAdded).every(addInput); } while (tx.funds('in').cmp(total) < 0 && lastAdded < unspent.length); } if (tx.funds('in').cmp(total) < 0) { // Still failing to get enough funds. inputs = null; } else { // How much money is left after filling outputs. change = tx.funds('in').sub(total); } // Return necessary inputs and change. return { inputs: inputs, change: change, cost: cost, fee: total.sub(cost), total: total, kb: totalkb }; }; TX.prototype.fillUnspent = function fillUnspent(unspent, address, fee) { var result; if (unspent) this.unspent = unspent; if (address) this.changeAddress = address; if (fee) this.hardFee = fee; assert(this.changeAddress); result = this.getUnspent(this.unspent, this.changeAddress, this.hardFee); if (!result.inputs) return result; result.inputs.forEach(function(input) { this.input(input); }, this); if (result.change.cmpn(constants.tx.dust) < 0) { // Do nothing. Change is added to fee. assert.equal( this.getFee().toNumber(), result.fee.add(result.change).toNumber() ); this.changeIndex = -1; } else { this.output({ address: this.changeAddress, value: result.change }); this.changeIndex = this.outputs.length - 1; } return result; }; TX.prototype._recalculateFee = function recalculateFee() { var output = this.outputs[this.changeIndex]; var size, real, fee; if (this.hardFee) return; if (!output) { this.output({ address: this.changeAddress, value: new bn(0) }); output = this.outputs[this.outputs.length - 1]; } size = this.maxSize(); real = Math.ceil(size / 1024) * constants.tx.fee; fee = this.getFee().toNumber(); // if (this.hardFee) // real = this.hardFee; if (real === fee) { if (this.changeIndex === -1) this.outputs.pop(); return; } if (real > fee) { if (output.value.cmpn(real - fee) < 0) { this.outputs.pop(); this.changeIndex = -1; return; } output.value.isubn(real - fee); } else { output.value.iaddn(fee - real); } if (output.value.cmpn(constants.tx.dust) < 0) { this.outputs.pop(); this.changeIndex = -1; return; } this.changeIndex = this.outputs.indexOf(output); }; TX.prototype.getFee = function getFee() { if (this.funds('in').cmp(this.funds('out')) < 0) return new bn(0); return this.funds('in').sub(this.funds('out')); }; TX.prototype.funds = function funds(side) { var acc = new bn(0); var inputs; if (side === 'in') { inputs = this.inputs.filter(function(input) { return input.out.tx; }); if (inputs.length === 0) return acc; inputs.reduce(function(acc, input) { return acc.iadd(input.out.tx.outputs[input.out.index].value); }, acc); return acc; } // Output if (this.outputs.length === 0) return acc; this.outputs.reduce(function(acc, output) { return acc.iadd(output.value); }, acc); return acc; }; TX.prototype._avoidFeeSnipping = function _avoidFeeSnipping() { if (!this.chain) return; this.lock = this.chain.height(); if ((Math.random() * 10 | 0) === 0) this.lock = Math.max(0, this.lock - (Math.random() * 100 | 0)); }; TX.prototype.setLockTime = function setLockTime(lock) { var i, input; this.lock = lock; for (i = 0; i < this.inputs.length; i++) { input = this.inputs[i]; if (input.seq === 0xffffffff) input.seq = 0; } }; TX.prototype.increaseFee = function increaseFee(fee) { var i, input; this.hardFee = fee || this.getFee().add(new bn(10000)); this.fillUnspent(); for (i = 0; i < this.inputs.length; i++) { input = this.inputs[i]; input.seq = 0xffffffff - 1; } }; TX.prototype.full = function full() { if (this.inputs.length === 0) return false; return this.inputs.every(function(input) { return !!input.out.tx; }); }; TX.prototype.fill = function fill(txs) { var inputs; if (txs instanceof bcoin.txPool) txs = txs._all; else if (txs instanceof bcoin.wallet) txs = txs.tx._all; if (Array.isArray(txs)) { txs = txs.reduce(function(out, tx) { out[tx.hash('hex')] = tx; return out; }, {}); } inputs = this.inputs.filter(function(input) { if (!input.out.tx && txs[input.out.hash]) input.out.tx = txs[input.out.hash]; return !!input.out.tx; }, this); return inputs.length === this.inputs.length; }; // Used for verifyContext/ContextualBlockCheck and miner isFinalTx call. // BIP113 will require that time-locked transactions have nLockTime set to // less than the median time of the previous block they're contained in. TX.prototype.isFinalBlock = function isFinalBlock(block, prev, useMedian) { var height = prev.height + 1; var ts = useMedian ? prev.getMedianTime() : block.ts; return this.isFinal(height, ts); }; // Used in AcceptToMemoryPool TX.prototype.isFinalMempool = function isFinalMempool(useMedian) { var height, ts; if (!this.chain) return true; height = this.chain.height() + 1; ts = useMedian ? this.chain.getTip().getMedianTime() : utils.now(); return this.isFinal(height, ts); }; // Used in the original bitcoind code for AcceptBlock TX.prototype.isFinalLegacy = function isFinalLegacy(block) { var ts, height; if (!this.chain) return true; ts = block ? block.ts : utils.now(); height = this.chain.height(); return this.isFinal(height, ts); }; TX.prototype.isFinal = function isFinal(height, ts) { var threshold = constants.locktimeThreshold; var i; if (!this.chain) return true; if (this.lock === 0) return true; if (this.lock < (this.lock < threshold ? height : ts)) return true; for (i = 0; i < this.inputs.length; i++) { if (this.inputs[i].seq !== 0xffffffff) return false; } return true; }; TX.prototype.sigops = function sigops(scripthash, accurate) { var n = 0; this.inputs.forEach(function(input) { n += bcoin.script.sigops(input.script, accurate); if (scripthash && !this.isCoinbase()) n += bcoin.script.sigopsScripthash(input.script); }, this); this.outputs.forEach(function(output) { n += bcoin.script.sigops(output.script, accurate); }, this); return n; }; TX.prototype.isStandard = function isStandard() { var i, input, output, type; var nulldata = 0; if (this.version > constants.tx.version || this.version < 1) return false; if (this.size() > constants.tx.maxSize) return false; for (i = 0; i < this.inputs.length; i++) { input = this.inputs[i]; if (script.size(input.script) > 1650) return false; if (!bcoin.script.pushOnly(input.script)) return false; } for (i = 0; i < this.outputs.length; i++) { output = this.outputs[i]; type = bcoin.script.standard(output.script); if (!bcoin.script.isStandard(output.script)) return false; if (!type) return false; if (type === 'nulldata') { nulldata++; continue; } if (type === 'multisig' && !constants.tx.bareMultisig) return false; if (output.value.cmpn(constants.tx.dust) < 0) return false; } if (nulldata > 1) return false; return true; }; TX.prototype.isStandardInputs = function isStandardInputs(flags) { var i, input, prev, args, stack, res, s, targs; if (this.isCoinbase()) return true; for (i = 0; i < this.inputs.length; i++) { input = this.inputs[i]; if (!input.out.tx) return false; prev = input.out.tx[input.out.index]; if (!prev) return false; args = bcoin.script.args(prev.script); if (args < 0) return false; stack = []; res = bcoin.script.execute(input.script, stack, this, i, flags); if (!res) return false; if (bcoin.script.isScripthash(prev.script)) { if (stack.length === 0) return false; s = stack[stack.length - 1]; if (!Array.isArray(s)) return false; s = bcoin.script.subscript(bcoin.script.decode(s)); if (bcoin.script.standard(s)) { targs = bcoin.script.args(s); if (targs < 0) return false; args += targs; } else { return script.sigops(s, true) <= constants.script.maxScripthashSigops; } } if (stack.length !== args) return false; } return true; }; TX.prototype.getHeight = function getHeight() { if (!this.chain) return -1; return this.block ? this.chain.getHeight(this.block) : -1; }; TX.prototype.getConfirmations = function getConfirmations() { var top, height; if (!this.chain) return 0; top = this.chain.height(); height = this.getHeight(); if (height === -1) return 0; return top - height + 1; }; TX.prototype.__defineGetter__('chain', function() { return this._chain || bcoin.chain.global; }); TX.prototype.__defineGetter__('rblock', function() { return this.block ? utils.revHex(this.block) : null; }); TX.prototype.__defineGetter__('rhash', function() { return utils.revHex(this.hash('hex')); }); TX.prototype.__defineGetter__('fee', function() { return this.getFee(); }); TX.prototype.__defineGetter__('value', function() { return this.funds('out'); }); TX.prototype.__defineGetter__('height', function() { return this.getHeight(); }); TX.prototype.__defineGetter__('confirmations', function() { return this.getConfirmations(); }); TX.prototype.inspect = function inspect() { var copy = bcoin.tx(this); copy.__proto__ = null; if (this.block) copy.block = this.block; delete copy._raw; delete copy._chain; copy.hash = this.hash('hex'); copy.rhash = this.rhash; copy.rblock = this.rblock; copy.value = utils.btc(this.value); copy.fee = utils.btc(this.fee); copy.height = this.height; copy.confirmations = this.confirmations; copy.date = new Date((copy.ts || 0) * 1000).toISOString(); return copy; }; TX.prototype.toJSON = function toJSON() { // Compact representation return { v: '1', type: 'tx', ts: this.ts, ps: this.ps, block: this.block, network: this.network, relayedBy: this.relayedBy, changeAddress: this.changeAddress, changeIndex: this.changeIndex, hardFee: this.hardFee ? utils.btc(this.hardFee) : null, tx: utils.toHex(this.render()) }; }; TX.fromJSON = function fromJSON(json) { var raw, data, tx; assert.equal(json.v, 1); assert.equal(json.type, 'tx'); raw = utils.toArray(json.tx, 'hex'); data = new bcoin.protocol.parser().parseTX(raw); data.network = json.network; data.relayedBy = json.relayedBy; data.changeAddress = json.changeAddress; data.changeIndex = json.changeIndex; if (json.hardFee) data.hardFee = utils.satoshi(json.hardFee); data._raw = raw; data._size = raw.length; tx = new TX(data); tx.ts = json.ts; tx.block = json.block || null; tx.ps = json.ps; return tx; }; TX.prototype.toRaw = function toRaw(enc) { var raw = this.render(); if (enc === 'hex') return utils.toHex(raw); return raw; }; TX.fromRaw = function fromRaw(raw, enc) { if (enc === 'hex') raw = utils.toArray(raw, 'hex'); return new bcoin.tx(new bcoin.protocol.parser().parseTX(raw)); }; /** * Expose */ module.exports = TX;