/** * script.js - script interpreter for bcoin * Copyright (c) 2014-2015, Fedor Indutny (MIT License) * https://github.com/indutny/bcoin */ var bcoin = require('../bcoin'); var bn = require('bn.js'); var constants = bcoin.protocol.constants; var utils = bcoin.utils; var assert = bcoin.utils.assert; var script = exports; /** * Script */ script.decode = function decode(s) { if (!s) return []; var opcodes = []; var i = 0; var b, opcode, len; while (i < s.length) { b = s[i++]; // Next `b` bytes should be pushed to stack if (b >= 0x01 && b <= 0x4b) { opcodes.push(s.slice(i, i + b)); i += b; utils.hidden(opcodes[opcodes.length - 1], 'pushdata', { opcode: null, len: b }); continue; } // Zero if (b === 0) { opcodes.push([]); continue; } // Raw number (-1 and 1-16) if (b === 0x4f || (b >= 0x51 && b <= 0x60)) { opcodes.push(b - 0x50); continue; } opcode = constants.opcodesByVal[b]; if (i >= s.length) { opcodes.push(opcode || b); continue; } if (opcode === 'pushdata1') { len = s[i]; i += 1; opcodes.push(s.slice(i, i + len)); i += len; utils.hidden(opcodes[opcodes.length - 1], 'pushdata', { opcode: opcode, len: len }); } else if (opcode === 'pushdata2') { len = utils.readU16(s, i); i += 2; opcodes.push(s.slice(i, i + len)); i += len; utils.hidden(opcodes[opcodes.length - 1], 'pushdata', { opcode: opcode, len: len }); } else if (opcode === 'pushdata4') { len = utils.readU32(s, i); i += 4; opcodes.push(s.slice(i, i + len)); i += len; utils.hidden(opcodes[opcodes.length - 1], 'pushdata', { opcode: opcode, len: len }); } else { opcodes.push(opcode || b); } } utils.hidden(opcodes, '_raw', s); return opcodes; }; script.encode = function encode(s) { if (!s) return []; var opcodes = constants.opcodes; var res = []; var i = 0; var instr; for (i = 0; i < s.length; i++) { instr = s[i]; // Push value to stack if (Array.isArray(instr)) { // Check for nonstandard pushdatas that // may have been decoded from before. if (instr.pushdata) { if (instr.pushdata.opcode === null) { res = res.concat(instr.pushdata.len, instr); } else if (instr.pushdata.opcode === 'pushdata1') { res = res.concat(opcodes.pushdata1, instr.pushdata.len, instr); } else if (instr.pushdata.opcode === 'pushdata2') { res.push(opcodes.pushdata2); utils.writeU16(res, instr.pushdata.len, res.length); res = res.concat(instr); } else if (instr.pushdata.opcode === 'pushdata4') { res.push(opcodes.pushdata4); utils.writeU32(res, instr.pushdata.len, res.length); res = res.concat(instr); } continue; } if (instr.length === 0) { // OP_FALSE res.push(0); } else if (1 <= instr.length && instr.length <= 0x4b) { res = res.concat(instr.length, instr); } else if (instr.length <= 0xff) { res = res.concat(opcodes.pushdata1, instr.length, instr); } else if (instr.length <= 0xffff) { res.push(opcodes.pushdata2); utils.writeU16(res, instr.length, res.length); res = res.concat(instr); } else { res.push(opcodes.pushdata4); utils.writeU32(res, instr.length, res.length); res = res.concat(instr); } continue; } res.push(opcodes[instr] || instr); } return res; }; script.verify = function verify(input, output, tx, i, flags) { var copy, res, redeem; var stack = []; if (!flags) flags = {}; // Execute the input script script.execute(input, stack, tx, i, flags); // Copy the stack for P2SH if (flags.verifyp2sh !== false) copy = stack.slice(); // Execute the previous output script res = script.execute(output, stack, tx, i, flags); // Verify the script did not fail as well as the stack values if (!res || stack.length === 0 || new bn(stack.pop()).cmpn(0) === 0) return false; // If the script is P2SH, execute the real output script if (flags.verifyp2sh !== false && script.isScripthash(output)) { // P2SH can only have push ops in the scriptSig if (!script.pushOnly(input)) return false; // Reset the stack stack = copy; // Stack should _never_ be empty at this point assert(stack.length !== 0); // Grab the real redeem script redeem = stack.pop(); if (!Array.isArray(redeem)) return false; redeem = script.decode(redeem); // Execute the redeem script res = script.execute(redeem, stack, tx, i, flags); // Verify the script did not fail as well as the stack values if (!res || stack.length === 0 || new bn(stack.pop()).cmpn(0) === 0) return false; } // Ensure there is nothing left on the stack if (flags.cleanstack !== false) { if (stack.length !== 0) return false; } return true; }; script.subscript = function subscript(s, lastSep) { var i, res; if (!s) return []; if (lastSep == null) { lastSep = -1; for (i = 0; i < s.length; i++) { if (s[i] === 'checksig' || s[i] === 'checksigverify' || s[i] === 'checkmultisig' || s[i] === 'checkmultisigverify') { break; } if (s[i] === 'codesep') lastSep = i; } } res = []; for (i = lastSep + 1; i < s.length; i++) { if (s[i] !== 'codesep') res.push(s[i]); } return res; }; script.checksig = function checksig(hash, sig, pub) { var k; try { k = bcoin.ecdsa.keyPair({ pub: pub }); } catch (e) { return false; } // Points at Infinity make verify() throw. // This specifically throws on wallet-test.js // where [1] is concatted to the pubkey. if (k.getPublic().isInfinity()) return false; // Use a try catch in case there are // any uncaught errors for bad inputs in verify(). try { return bcoin.ecdsa.verify(hash, sig, pub); } catch (e) { return false; } }; script._next = function _next(to, s, pc) { var depth = 0; var o; while (s[pc]) { o = s[pc]; if (o === 'if_' || o === 'notif') depth++; else if (o === 'else_') depth--; else if (o === 'endif') depth--; if (depth < 0) break; if (depth === 0 && o === to) return pc; if (o === 'else_') depth++; pc++; } return -1; }; script.execute = function execute(s, stack, tx, index, flags, recurse) { s = s.slice(); if (!flags) flags = {}; if (s.length > constants.script.maxOps) return false; var lastSep = -1; var pc = 0; var o, val; var if_, else_, endif; var v, v1, v2, v3, v4; var n, n1, n2, n3; var res; var key, sig, type, subscript, hash; var keys, i, j, m; var succ; var lock, threshold; var evalScript; stack.alt = stack.alt || []; for (pc = 0; pc < s.length; pc++) { o = s[pc]; if (Array.isArray(o)) { if (o.length > constants.script.maxPush) return false; stack.push(o); continue; } if (o === -1 || (o >= 1 && o <= 16)) { stack.push([o]); continue; } switch (o) { case 'nop1': case 'nop3': case 'nop4': case 'nop5': case 'nop6': case 'nop7': case 'nop8': case 'nop9': case 'nop10': { break; } case 'if_': case 'notif': { val = false; if (stack.length < 1) return false; v = stack.pop(); val = new bn(v).cmpn(0) !== 0; if (o === 'notif') val = !val; if_ = pc; else_ = script._next('else_', s, pc); endif = script._next('endif', s, pc); // Splice out the statement blocks we don't need if (val) { if (endif === -1) return false; if (else_ === -1) { s.splice(endif, 1); s.splice(if_, 1); } else { s.splice(else_, (endif - else_) + 1); s.splice(if_, 1); } } else { if (endif === -1) return false; if (else_ === -1) { s.splice(if_, (endif - if_) + 1); } else { s.splice(endif, 1); s.splice(if_, (else_ - if_) + 1); } } // Subtract one since we removed the if/notif opcode pc--; break; } case 'else_': { return false; } case 'endif': { return false; } case 'verify': { if (stack.length === 0) return false; if (new bn(stack.pop()).cmpn(0) === 0) return false; break; } case 'ret': { return false; } case 'toaltstack': { if (stack.length === 0) return false; stack.alt.push(stack.pop()); break; } case 'fromaltstack': { if (stack.alt.length === 0) return false; stack.push(stack.alt.pop()); break; } case 'ifdup': { if (stack.length === 0) return false; if (new bn(stack[stack.length - 1]).cmpn(0) !== 0) stack.push(new bn(stack[stack.length - 1]).toArray()); break; } case 'depth': { stack.push(new bn(stack.length).toArray()); break; } case 'drop': { if (stack.length === 0) return false; stack.pop(); break; } case 'dup': { if (stack.length === 0) return false; stack.push(stack[stack.length - 1]); break; } case 'nip': { if (stack.length < 2) return false; stack.splice(stack.length - 2, 1); break; } case 'over': { if (stack.length < 2) return false; stack.push(stack[stack.length - 2]); break; } case 'pick': case 'roll': { if (stack.length < 2) return false; v = stack.pop(); if (v.length > 6) return false; n = new bn(v).toNumber(); if (n < 0 || n >= stack.length) return false; v = stack[-n - 1]; if (o === 'roll') stack.splice(stack.length - n - 1, 1); stack.push(v); break; } case 'rot': { if (stack.length < 3) return false; v3 = stack[stack.length - 3]; v2 = stack[stack.length - 2]; v1 = stack[stack.length - 1]; stack[stack.length - 3] = v2; stack[stack.length - 2] = v3; v2 = stack[stack.length - 2]; stack[stack.length - 2] = v1; stack[stack.length - 1] = v2; break; } case 'swap': { if (stack.length < 2) return false; v2 = stack[stack.length - 2]; v1 = stack[stack.length - 1]; stack[stack.length - 2] = v1; stack[stack.length - 1] = v2; break; } case 'tuck': { if (stack.length < 2) return false; stack.splice(stack.length - 2, 0, stack[stack.length - 1]); break; } case 'drop2': { if (stack.length < 2) return false; stack.pop(); stack.pop(); break; } case 'dup2': { if (stack.length < 2) return false; v1 = stack[stack.length - 1]; v2 = stack[stack.length - 2]; stack.push(v1); stack.push(v2); break; } case 'dup3': { if (stack.length < 3) return false; v1 = stack[stack.length - 1]; v2 = stack[stack.length - 2]; v3 = stack[stack.length - 3]; stack.push(v1); stack.push(v2); stack.push(v3); break; } case 'over2': { if (stack.length < 4) return false; v1 = stack[stack.length - 4]; v2 = stack[stack.length - 3]; stack.push(v1); stack.push(v2); break; } case 'rot2': { if (stack.length < 6) return false; v1 = stack[stack.length - 6]; v2 = stack[stack.length - 5]; stack.splice(stack.length - 6, 2); stack.push(v1); stack.push(v2); break; } case 'swap2': { if (stack.length < 4) return false; v4 = stack[stack.length - 4]; v3 = stack[stack.length - 3]; v2 = stack[stack.length - 2]; v1 = stack[stack.length - 1]; stack[stack.length - 4] = v2; stack[stack.length - 2] = v4; stack[stack.length - 3] = v1; stack[stack.length - 1] = v3; break; } case 'size': { if (stack.length < 1) return false; stack.push(new bn(stack[stack.length - 1].length || 0).toArray()); break; } case 'add1': case 'sub1': case 'negate': case 'abs': case 'not': case 'noteq0': { if (stack.length < 1) return false; n = new bn(stack.pop()); switch (o) { case 'add1': n.iadd(1); break; case 'sub1': n.isub(1); break; case 'negate': n = n.neg(); break; case 'abs': if (n.cmpn(0) < 0) n = n.neg(); break; case 'not': n = n.cmpn(0) === 0; break; case 'noteq0': n = n.cmpn(0) !== 0; break; default: return false; } if (typeof n === 'boolean') n = new bn(+n); stack.push(n.toArray()); break; } case 'add': case 'sub': case 'booland': case 'boolor': case 'numeq': case 'numeqverify': case 'numneq': case 'lt': case 'gt': case 'lte': case 'gte': case 'min': case 'max': { switch (o) { case 'add': case 'sub': case 'booland': case 'boolor': case 'numeq': case 'numeqverify': case 'numneq': case 'lt': case 'gt': case 'lte': case 'gte': case 'min': case 'max': if (stack.length < 2) return false; n2 = new bn(stack.pop()); n1 = new bn(stack.pop()); n = new bn(0); switch (o) { case 'add': n = n1.add(n2); break; case 'sub': n = n1.sub(n2); break; case 'booland': n = n1.cmpn(0) !== 0 && n2.cmpn(0) !== 0; break; case 'boolor': n = n1.cmpn(0) !== 0 || n2.cmpn(0) !== 0; break; case 'numeq': n = n1.cmp(n2) === 0; break; case 'numeqverify': n = n1.cmp(n2) === 0; break; case 'numneq': n = n1.cmp(n2) !== 0; break; case 'lt': n = n1.cmp(n2) < 0; break; case 'gt': n = n1.cmp(n2) > 0; break; case 'lte': n = n1.cmp(n2) <= 0; break; case 'gte': n = n1.cmp(n2) >= 0; break; case 'min': n = n1.cmp(n2) < 0 ? n1 : n2; break; case 'max': n = n1.cmp(n2) > 0 ? n1 : n2; break; default: return false; } if (typeof n === 'boolean') n = new bn(+n); res = n.cmpn(0) !== 0; if (o === 'numeqverify') { if (!res) return false; } else { stack.push(n.toArray()); } break; case 'within': if (stack.length < 3) return false; n3 = new bn(stack.pop()); n2 = new bn(stack.pop()); n1 = new bn(stack.pop()); val = n2.cmp(n1) <= 0 && n1.cmp(n3) < 0; stack.push(val.cmpn(0) !== 0 ? [ 1 ] : []); break; } break; } case 'codesep': { lastSep = pc; break; } case 'ripemd160': { if (stack.length === 0) return false; stack.push(utils.ripemd160(stack.pop())); break; } case 'sha1': { if (stack.length === 0) return false; stack.push(utils.sha1(stack.pop())); break; } case 'sha256': { if (stack.length === 0) return false; stack.push(utils.sha256(stack.pop())); break; } case 'hash256': { if (stack.length === 0) return false; stack.push(utils.dsha256(stack.pop())); break; } case 'hash160': { if (stack.length === 0) return false; stack.push(utils.ripesha(stack.pop())); break; } case 'eqverify': case 'eq': { if (stack.length < 2) return false; res = utils.isEqual(stack.pop(), stack.pop()); if (o === 'eqverify') { if (!res) return false; } else { stack.push(res ? [ 1 ] : []); } break; } case 'checksigverify': case 'checksig': { if (!tx || stack.length < 2) return false; key = stack.pop(); sig = stack.pop(); if (!script.isKey(key)) return false; if (flags.strictder !== false) { if (!script.isValidSig(sig)) return false; } else { if (!script.isSig(sig)) return false; } type = sig[sig.length - 1]; if (!constants.hashTypeByVal[type & 0x1f]) return false; subscript = script.subscript(s, lastSep); hash = tx.signatureHash(index, subscript, type); res = script.checksig(hash, sig.slice(0, -1), key); if (o === 'checksigverify') { if (!res) return false; } else { stack.push(res ? [ 1 ] : []); } break; } case 'checkmultisigverify': case 'checkmultisig': { if (!tx || stack.length < 3) return false; n = stack.pop(); if (n.length !== 1 || !(1 <= n[0] && n[0] <= 15)) return false; n = n[0] || 0; if (stack.length < n + 1) return false; keys = []; for (i = 0; i < n; i++) { key = stack.pop(); if (!script.isKey(key)) return false; keys.push(key); } m = stack.pop(); if (m.length !== 1 || !(1 <= m[0] && m[0] <= n)) return false; m = m[0] || 0; if (stack.length < m + 1) return false; subscript = script.subscript(s, lastSep); // Get signatures succ = 0; for (i = 0, j = 0; i < m && j < n; i++) { sig = stack.pop(); if (flags.strictder !== false) { if (!script.isValidSig(sig)) return false; } else { if (!script.isSig(sig)) return false; } type = sig[sig.length - 1]; if (!constants.hashTypeByVal[type & 0x1f]) return false; hash = tx.signatureHash(index, subscript, type); res = false; for (; !res && j < n; j++) res = script.checksig(hash, sig.slice(0, -1), keys[j]); if (res) succ++; } // Extra value if (stack.length < 1) return false; val = stack.pop(); if (flags.verifynulldummy !== false) { if (!Array.isArray(val) || val.length > 0) return false; } res = succ >= m; if (o === 'checkmultisigverify') { if (!res) return false; } else { stack.push(res ? [ 1 ] : []); } break; } case 'checklocktimeverify': { // OP_CHECKLOCKTIMEVERIFY = OP_NOP2 if (flags.cltv === false) break; if (!tx || stack.length === 0) return false; lock = stack[stack.length - 1]; if (!Array.isArray(lock)) return false; if (lock.length > 6) return false; lock = new bn(lock).toNumber(); if (lock < 0) return false; threshold = constants.locktimeThreshold; if (!( (tx.lock < threshold && lock < threshold) || (tx.lock >= threshold && lock >= threshold) )) { return false; } if (lock > tx.lock) return false; if (!tx.inputs[index] || tx.inputs[index].seq === 0xffffffff) return false; break; } case 'eval_': { // OP_EVAL = OP_NOP1 if (!flags.allowEval) break; recurse = recurse || 0; if (recurse++ > 2) return false; evalScript = stack.pop(); if (!Array.isArray(evalScript)) return false; evalScript = script.decode(evalScript); res = evalScript.some(function(op) { return op === 'codesep'; }); if (res) return false; res = script.execute(evalScript, stack, tx, index, flags, recurse); if (!res) return false; break; } default: { // Unknown operation return false; } } } if (stack.length + stack.alt.length > constants.script.maxStack) return false; return true; }; script.redeem = function redeem(keys, m, n) { if (keys.length !== n) throw new Error(n + ' keys are required to generate redeem script'); assert(m >= 1 && m <= n); assert(n >= 1 && n <= 15); while (keys.length < n) keys.push([]); keys = utils.sortKeys(keys); return [m].concat( keys, [n, 'checkmultisig'] ); }; script.standard = function standard(s) { return (script.isPubkey(s) && 'pubkey') || (script.isPubkeyhash(s) && 'pubkeyhash') || (script.isMultisig(s) && 'multisig') || (script.isScripthash(s) && 'scripthash') || (script.isNulldata(s) && 'nulldata') || null; }; script.isStandard = function isStandard(s) { var type = script.standard(s); var m, n; if (type === 'multisig') { m = new bn(s[0]).toNumber(); n = new bn(s[s.length - 2]).toNumber(); if (n < 1 || n > 3) return false; if (m < 1 || m > n) return false; } else if (type === 'nulldata') { if (script.size(s) > constants.script.maxOpReturnBytes) return false; } return type != null; }; script.size = function size(s) { if (s._raw) return s._raw.length; return bcoin.script.encode(s).length; }; script.isEncoded = function(s) { for (var i = 0; i < s.length; i++) { if (typeof s[i] !== 'number') return false; } return true; }; script.normalize = function normalize(s) { if (script.isEncoded(s)) s = script.decode(s); s = script.subscript(s); if (script.lockTime(s)) s = s.slice(3); return s; }; script.lockTime = function lockTime(s) { var lock = s[0]; var res = s.length > 3 && Array.isArray(s[0]) && s[1] === 'checklocktimeverify' && s[2] === 'drop'; if (!res) return false; // Number can only store 6 & 5/8 bytes if (lock.length > 6) lock = lock.slice(0, 6); return new bn(lock); }; script.spendable = function spendable(s, lockTime) { if (!script.standard(s)) return false; var lock = script.lockTime(s); if (lock && lock.toNumber() > lockTime) return false; return true; }; script.isPubkey = function isPubkey(s, key) { var res; s = script.subscript(s); if (script.lockTime(s)) s = s.slice(3); if (s.length !== 2) return false; res = Array.isArray(s[0]) && s[1] === 'checksig'; if (!res) return false; if (key) return utils.isEqual(s[0], key); return true; }; script.isPubkeyhash = function isPubkeyhash(s, hash) { var res; s = script.subscript(s); if (script.lockTime(s)) s = s.slice(3); if (s.length !== 5) return false; res = s[0] === 'dup' && s[1] === 'hash160' && Array.isArray(s[2]) && s[3] === 'eqverify' && s[4] === 'checksig'; if (!res) return false; if (hash) return utils.isEqual(s[2], hash); return true; }; script.isMultisig = function isMultisig(s, pubs) { var m, n, keys, total; s = script.subscript(s); if (script.lockTime(s)) s = s.slice(3); if (s.length < 4) return false; // compat if (pubs && !utils.isBuffer(pubs[0])) pubs = [pubs]; m = s[0]; if (typeof m === 'number' && m >= 1 && m <= 15) m = [m]; if (!Array.isArray(m) || m.length !== 1) return false; m = m[0] || 0; if (s[s.length - 1] !== 'checkmultisig') return false; n = s[s.length - 2]; if (typeof n === 'number' && n >= 1 && n <= 15) n = [n]; if (!Array.isArray(n) || n.length !== 1) return false; n = n[0] || 0; if (n + 3 !== s.length) return false; keys = s.slice(1, 1 + n); if (!keys.every(Array.isArray)) return false; if (!pubs) return true; total = keys.filter(function(k) { return pubs.some(function(pub) { return utils.isEqual(k, pub); }); }).length; return total === n; }; script.isScripthash = function isScripthash(s, hash) { var res; s = script.subscript(s); if (script.lockTime(s)) s = s.slice(3); if (s.length !== 3) return false; res = s[0] === 'hash160' && Array.isArray(s[1]) && s[1].length === 20 && s[2] === 'eq'; if (!res) return false; if (hash) return utils.isEqual(s[1], hash); return true; }; script.isNulldata = function isNulldata(s) { s = script.subscript(s); if (s.length !== 2) return false; return s[0] === 'ret' && Array.isArray(s[1]) && s[1].length <= constants.script.maxOpReturn; }; script.nulldata = function nulldata(s) { if (!script.isNulldata(s)) return false; return script.subscript(s)[1]; }; script.standardInput = function standardInput(s) { return (script.isPubkeyInput(s) && 'pubkey') || (script.isPubkeyhashInput(s) && 'pubkeyhash') || (script.isMultisigInput(s) && 'multisig') || (script.isScripthashInput(s) && 'scripthash') || null; }; script.isPubkeyInput = function isPubkeyInput(s, key, tx, i) { var res; s = script.subscript(s); if (s.length !== 1 || !Array.isArray(s[0])) return false; if (!script.isSig(s[0])) return false; // Execute the script against our key's // checksig script to see if this is our input. // This will only work if the script verifies. if (key) return script.verify(s, [key, 'checksig'], tx, i); return true; }; script.isPubkeyhashInput = function isPubkeyhashInput(s, key) { s = script.subscript(s); if (s.length !== 2 || !Array.isArray(s[0]) || !Array.isArray(s[1])) return false; if (!script.isSig(s[0])) return false; if (!script.isKey(s[1])) return false; if (key) return utils.isEqual(s[1], key); return true; }; script.isMultisigInput = function isMultisigInput(s, keys, tx, i) { var i, res, o; // We need to rule out scripthash // because it may look like multisig if (script.isScripthashInput(s)) return false; s = script.subscript(s); if (s.length < 3) return false; if (!Array.isArray(s[0]) || s[0].length !== 0) return false; for (i = 1; i < s.length; i++) { if (!script.isSig(s[i])) return false; } // Execute the script against our pubkeys' // redeem script to see if this is our input. // This will only work if the script verifies. if (keys && keys.length >= 2) { o = script.redeem(keys, s.length - 1, keys.length); return script.verify(s, o, tx, i); } return true; }; script.isScripthashInput = function isScripthashInput(s, data) { var raw, redeem; s = script.subscript(s); // Grab the raw redeem script. raw = s[s.length - 1]; // Need at least one data element with // the redeem script. if (s.length < 2) return false; // Last data element should be an array // for the redeem script. if (!Array.isArray(raw)) return false; // P2SH redeem scripts can be nonstandard: make // it easier for other functions to parse this. redeem = script.decode(raw); redeem = script.subscript(redeem); if (script.lockTime(redeem)) redeem = redeem.slice(3); // Get the "real" scriptSig s = s.slice(0, -1); // Do some sanity checking on the inputs if (!script.isPubkeyInput(s) && !script.isPubkeyhashInput(s) && !script.isMultisigInput(s)) { return false; } // Check data against last array in case // a raw redeem script was passed in. if (data && utils.isEqual(data, raw)) return true; // Test against all other script types return script.isPubkey(redeem, data) || script.isPubkeyhash(redeem, data) || script.isMultisig(redeem, data); }; script.coinbaseBits = function coinbaseBits(s, block) { var value; s = s.filter(function(chunk) { return Array.isArray(chunk) && chunk.length !== 0; }); if (!Array.isArray(s[0])) return { type: 'value', value: s[0] }; // Number can only store up to 53 bits (6 & 5/8 bytes) if (s[0].length > 6) return { type: 'value', value: s[0] }; value = new bn(s[0].slice().reverse()).toNumber(); // Test for bits and ts if (block && block.version < 2) { if (value === block.bits) return { type: 'bits', value: value }; if (value === block.ts) return { type: 'ts', value: value }; } // Test for height if (block) { if (block.version < 2) return { type: 'value', value: value }; } else { if (value <= 227835) return { type: 'value', value: value }; } if (s[0].length < 3) return { type: 'value', value: value }; return { type: 'height', value: value }; }; script.coinbaseHeight = function coinbaseHeight(s, block) { var data = script.coinbaseBits(s, block); if (data.type !== 'height') return -1; return data.value; }; script.coinbase = function coinbase(s, block) { var coinbase, data, extraNonce, flags; s = s.filter(function(chunk) { return Array.isArray(chunk) && chunk.length !== 0; }); coinbase = { script: s }; data = script.coinbaseBits(s, block); if (Array.isArray(s[1])) extraNonce = new bn(s[1]); flags = s.slice(2); coinbase[data.type] = data.value; coinbase.extraNonce = extraNonce; coinbase.flags = flags; coinbase.text = flags.map(utils.array2utf8).join('') .replace(/[\u0000-\u0019\u007f-\u00ff]/g, ''); return coinbase; }; script.isCoinbase = function isCoinbase(s, block, strict) { var coinbase = script.coinbase(s, block); var size = script.size(s); if (size < 2 || size > 100) return false; if (strict) { if (s.length < 2) return false; if (coinbase.value != null) return false; if (coinbase.extraNonce == null) return false; if (block) { // The early bitcoind miner (which used the bits // as the first stack push) had no flags after it. if (coinbase.bits != null && coinbase.flags.length) return false; } } return coinbase; }; script.isKey = function isKey(key) { if (!utils.isBuffer(key)) return false; return key.length >= 33 && key.length <= 65; }; script.isSig = function isSig(sig, allowZero) { if (!utils.isBuffer(sig)) return false; if (allowZero && sig.length === 0) return true; return sig.length >= 9 && sig.length <= 73; }; // https://github.com/bitcoin/bips/blob/master/bip-0066.mediawiki /** * A canonical signature exists of: <30> <02> <02> * Where R and S are not negative (their first byte has its highest bit not set), and not * excessively padded (do not start with a 0 byte, unless an otherwise negative number follows, * in which case a single 0 byte is necessary and even required). * * See https://bitcointalk.org/index.php?topic=8392.msg127623#msg127623 * * This function is consensus-critical since BIP66. */ script.isValidSig = function isValidSig(sig, allowZero) { var lenR, lenS; if (!utils.isBuffer(sig)) return false; // Empty signature. Not strictly DER encoded, but allowed to provide a // compact way to provide an invalid signature for use with CHECK(MULTI)SIG if (allowZero && sig.length === 0) return true; // Format: 0x30 [total-length] 0x02 [R-length] [R] 0x02 [S-length] [S] [sighash] // * total-length: 1-byte length descriptor of everything that follows, // excluding the sighash byte. // * R-length: 1-byte length descriptor of the R value that follows. // * R: arbitrary-length big-endian encoded R value. It must use the shortest // possible encoding for a positive integers (which means no null bytes at // the start, except a single one when the next byte has its highest bit set). // * S-length: 1-byte length descriptor of the S value that follows. // * S: arbitrary-length big-endian encoded S value. The same rules apply. // * sighash: 1-byte value indicating what data is hashed (not part of the DER // signature) // Minimum and maximum size constraints. if (sig.length < 9) return false; if (sig.length > 73) return false; // A signature is of type 0x30 (compound). if (sig[0] !== 0x30) return false; // Make sure the length covers the entire signature. if (sig[1] !== sig.length - 3) return false; // Extract the length of the R element. lenR = sig[3]; // Make sure the length of the S element is still inside the signature. if (5 + lenR >= sig.length) return false; // Extract the length of the S element. lenS = sig[5 + lenR]; // Verify that the length of the signature matches the sum of the length // of the elements. if (lenR + lenS + 7 !== sig.length) return false; // Check whether the R element is an integer. if (sig[2] !== 0x02) return false; // Zero-length integers are not allowed for R. if (lenR === 0) return false; // Negative numbers are not allowed for R. if (sig[4] & 0x80) return false; // Null bytes at the start of R are not allowed, unless R would // otherwise be interpreted as a negative number. if (lenR > 1 && (sig[4] === 0x00) && !(sig[5] & 0x80)) return false; // Check whether the S element is an integer. if (sig[lenR + 4] !== 0x02) return false; // Zero-length integers are not allowed for S. if (lenS === 0) return false; // Negative numbers are not allowed for S. if (sig[lenR + 6] & 0x80) return false; // Null bytes at the start of S are not allowed, unless S would otherwise be // interpreted as a negative number. if (lenS > 1 && (sig[lenR + 6] === 0x00) && !(sig[lenR + 7] & 0x80)) return false; return true; }; script.format = function format(input, output) { var scripts = []; var prev, redeem; if (Array.isArray(input)) { scripts.push(input); } else if (Array.isArray(output)) { scripts.push(output); } else if (input) { scripts.push(input.script); if (input.out.tx && input.out.tx.outputs[input.out.index]) { prev = input.out.tx.outputs[input.out.index].script; scripts.push(prev); if (script.isScripthash(prev)) { redeem = script.decode(input.script[input.script.length - 1]); scripts.push(redeem); } } } else if (output) { scripts.push(output.script); } scripts = scripts.map(function(script) { return script.map(function(chunk) { if (Array.isArray(chunk)) { if (chunk.length === 0) return 0 + ''; return '[' + utils.toHex(chunk) + ']'; } if (typeof chunk === 'number') return chunk + ''; return chunk; }).join(' '); }); return scripts; }; script.pushOnly = function pushOnly(s) { var i, op; for (i = 0; i < s.length; i++) { op = s[i]; if (Array.isArray(op) || (op >= 1 && op <= 16)) continue; if (constants.opcodes[op] == null) return false; return false; } return true; }; script.sigops = function sigops(s, accurate) { var i, op; var n = 0; var lastOp = -1; for (i = 0; i < s.length; i++) { op = s[i]; if (Array.isArray(op)) continue; if (constants.opcodes[op] == null) return 0; if (op === 'checksig' || op === 'checksigverify') { n++; } else if (op === 'checkmultisig' || op === 'checkmultisigverify') { if (accurate && lastOp >= 1 && lastOp <= 16) { n += lastOp; } else { n += constants.script.maxPubkeysPerMultisig; } } lastOp = op; } return n; }; script.sigopsScripthash = function sigopsScripthash(s) { if (!script.isScripthashInput(s)) return 0; if (!script.pushOnly(s)) return 0; s = script.decode(s[s.length - 1]); return script.sigops(s, true); }; script.args = function args(s) { var type, keys, m; s = bcoin.script.subscript(s); if (script.lockTime(s)) s = s.slice(3); type = script.standard(s); if (type === 'pubkey') return 1; if (type === 'pubkeyhash') return 2; if (type === 'multisig') { keys = bcoin.script.isMultisig(s); if (!pub) return -1; m = new bn(s[0]).toNumber(); if (keys.length < 1 || m < 1) return -1; return m + 1; } if (type === 'scripthash') return 1; if (type === 'nulldata') return -1; return -1; };