fcoin/lib/bcoin/mtx.js
Christopher Jeffrey 00e7fcc1ad script parsing.
2016-03-29 15:21:48 -07:00

1087 lines
26 KiB
JavaScript

/**
* mtx.js - mutable transaction object for bcoin
* Copyright (c) 2014-2015, Fedor Indutny (MIT License)
* https://github.com/indutny/bcoin
*/
var bn = require('bn.js');
var bcoin = require('../bcoin');
var utils = require('./utils');
var assert = utils.assert;
var constants = bcoin.protocol.constants;
var network = bcoin.protocol.network;
var Script = bcoin.script;
var Witness = bcoin.script.witness;
var opcodes = constants.opcodes;
/**
* MTX
*/
function MTX(options) {
if (!(this instanceof MTX))
return new MTX(options);
if (!options)
options = {};
this.options = options;
this.type = 'tx';
this.version = options.version || 1;
this.inputs = [];
this.outputs = [];
this.locktime = 0;
this.ts = 0;
this.block = null;
this.index = -1;
this.ps = this.ts === 0 ? utils.now() : 0;
this.changeIndex = options.changeIndex != null ? options.changeIndex : -1;
this._hash = null;
this._whash = null;
this._raw = null;
this._size = 0;
this._witnessSize = 0;
this.height = -1;
if (options.inputs) {
options.inputs.forEach(function(input) {
this.addInput(input);
}, this);
}
if (options.outputs) {
options.outputs.forEach(function(output) {
this.addOutput(output);
}, this);
}
}
utils.inherits(MTX, bcoin.tx);
MTX.prototype.clone = function clone() {
return new MTX(this);
};
MTX.prototype.hash = function hash(enc) {
var hash = utils.dsha256(this.renderNormal());
return enc === 'hex' ? utils.toHex(hash) : hash;
};
MTX.prototype.witnessHash = function witnessHash(enc) {
var hash;
if (this.isCoinbase()) {
return enc === 'hex'
? utils.toHex(constants.zeroHash)
: new Buffer(constants.zeroHash);
}
if (!this.hasWitness())
return this.hash(enc);
hash = utils.dsha256(this.renderWitness());
return enc === 'hex' ? utils.toHex(hash) : hash;
};
MTX.prototype.render = function render() {
return this.getRaw();
};
MTX.prototype.renderNormal = function renderNormal() {
return bcoin.protocol.framer.tx(this);
};
MTX.prototype.renderWitness = function renderWitness() {
return bcoin.protocol.framer.witnessTX(this);
};
MTX.prototype.getRaw = function getRaw() {
if (this.hasWitness())
return bcoin.protocol.framer.witnessTX(this);
return bcoin.protocol.framer.tx(this);
};
MTX.prototype.getSize = function getSize() {
return this.getRaw().length;
};
MTX.prototype.getVirtualSize = function getVirtualSize() {
var raw = this.getRaw();
var size = raw.length;
var witnessSize = raw._witnessSize;
var base = size - witnessSize;
return (base * 4 + witnessSize + 3) / 4 | 0;
};
MTX.prototype.addInput = function addInput(options, index) {
var input;
if (options instanceof MTX)
options = bcoin.coin(options, index);
if (options instanceof bcoin.coin) {
options = {
prevout: { hash: options.hash, index: options.index },
coin: options
};
}
assert(options.prevout);
// i = this._inputIndex(options.prevout.hash, options.prevout.index);
// assert(i === -1);
input = bcoin.input(options, this);
if (options.script instanceof bcoin.script)
input.script = options.script.clone();
if (options.witness instanceof bcoin.script.witness)
input.witness = options.witness.clone();
this.inputs.push(input);
return this;
};
MTX.prototype.scriptInput = function scriptInput(index, addr) {
var input, prev, n, i, redeemScript, witnessScript, vector, dummy;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
// Get the input
input = this.inputs[index];
assert(input);
// We should have previous outputs by now.
assert(input.coin);
// Optimization: Don't bother with any below
// calculation if the output is already templated.
// Just say this is "our" output.
if (input.script.code.length || input.witness.items.length)
return true;
// Optimization: test output against the
// address map to avoid unnecessary calculation.
// A hash table lookup may be faster than all
// the nonsense below.
if (!addr.ownOutput(input.coin))
return false;
// Get the previous output's script
prev = input.coin.script;
// This is easily the hardest part about building a transaction
// with segwit: figuring out where the redeem script and witness
// redeem scripts go.
if (prev.isScripthash()) {
if (addr.program && utils.isEqual(prev.code[1], addr.programHash)) {
// Witness program nested in regular P2SH.
redeemScript = addr.program.encode();
vector = input.witness.items;
dummy = new Buffer([]);
assert(addr.program.code[0] === opcodes.OP_0, 'Non-zero version passed to address.');
if (addr.program.code[1].length === 32) {
// P2WSH nested within pay-to-scripthash
// (it had to be this complicated, didn't it?)
witnessScript = addr.script.encode();
prev = addr.script;
} else if (addr.program.code[1].length === 20) {
// P2WPKH nested within pay-to-scripthash.
prev = Script.createPubkeyhash(addr.keyHash);
} else {
assert(false, 'Unknown program data length passed to address.');
}
} else if (addr.script && utils.isEqual(prev.code[1], addr.scriptHash160)) {
// Regular P2SH.
redeemScript = addr.script.encode();
vector = input.script.code;
prev = addr.script;
dummy = opcodes.OP_0;
} else {
return false;
}
} else if (prev.isWitnessProgram()) {
// Witness program.
vector = input.witness.items;
dummy = new Buffer([]);
if (prev.code[0] !== opcodes.OP_0)
return false;
if (prev.code[1].length === 32) {
// Bare P2WSH.
if (!addr.script || !utils.isEqual(prev.code[1], addr.scriptHash256))
return false;
witnessScript = addr.script.encode();
prev = addr.script;
} else if (prev.code[1].length === 20) {
// Bare P2WPKH.
if (!utils.isEqual(prev.code[1], addr.keyHash))
return false;
prev = Script.createPubkeyhash(prev.code[1]);
} else {
// Bare... who knows?
return false;
}
} else {
// Wow, a normal output! Praise be to Jengus and Gord.
vector = input.script.code;
dummy = opcodes.OP_0;
}
if (prev.isPubkey()) {
// P2PK
if (!utils.isEqual(prev.code[0], addr.publicKey))
return false;
// Already has a script template (at least)
if (vector.length)
return true;
vector[0] = dummy;
} else if (prev.isPubkeyhash()) {
// P2PKH
if (!utils.isEqual(prev.code[2], addr.keyHash))
return false;
// Already has a script template (at least)
if (vector.length)
return true;
vector[0] = dummy;
vector[1] = addr.publicKey;
} else if (prev.isMultisig()) {
// Multisig
if (utils.indexOf(prev.code, addr.publicKey) === -1)
return false;
// Already has a script template (at least)
if (vector.length)
return true;
// Technically we should create m signature slots,
// but we create n signature slots so we can order
// the signatures properly.
vector[0] = dummy;
// Grab `n` value (number of keys).
n = Script.getSmall(prev.code[prev.code.length - 2]);
// Fill script with `n` signature slots.
for (i = 0; i < n; i++)
vector[i + 1] = dummy;
} else {
if (utils.indexOf(prev.code, addr.publicKey) === -1)
return false;
// Already has a script template (at least)
if (vector.length)
return true;
// Likely a non-standard scripthash multisig
// input. Determine n value by counting keys.
// Also, only allow nonstandard types for
// scripthash.
vector[0] = dummy;
// Fill script with `n` signature slots.
for (i = 0; i < prev.code.length; i++) {
if (Script.isKey(prev.code[i]))
vector[i + 1] = dummy;
}
}
// P2SH requires the redeem
// script after signatures.
if (redeemScript)
input.script.code.push(redeemScript);
// P2WSH requires the witness
// script after signatures.
if (witnessScript)
input.witness.items.push(witnessScript);
return true;
};
MTX.prototype.createSignature = function createSignature(index, prev, key, type, version) {
var hash, signature;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
if (type == null)
type = 'all';
if (typeof type === 'string')
type = constants.hashType[type];
// Get the hash of the current tx, minus the other
// inputs, plus the sighash type.
hash = this.signatureHash(index, prev, type, version);
// Sign the transaction with our one input
signature = Script.sign(hash, key, type);
// Something is broken if this doesn't work:
// assert(Script.checksig(hash, signature, key), 'BUG: Verify failed.');
return signature;
};
MTX.prototype.signInput = function signInput(index, addr, type) {
var input, prev, signature, ki, signatures, i;
var len, m, n, keys, vector, dummy, version;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
// Get the input
input = this.inputs[index];
assert(input);
// We should have previous outputs by now.
assert(input.coin);
// Get the previous output's subscript
prev = input.coin.script;
vector = input.script.code;
len = vector.length;
dummy = opcodes.OP_0;
version = 0;
// We need to grab the redeem script when
// signing p2sh transactions.
if (prev.isScripthash()) {
prev = input.script.getRedeem();
len = vector.length - 1;
}
// If the output script is a witness program,
// we have to switch the vector to the witness
// and potentially alter the length. Note that
// witnesses are stack items, so the `dummy`
// _has_ to be an empty buffer (what OP_0
// pushes onto the stack).
if (prev.isWitnessScripthash()) {
prev = input.witness.getRedeem();
vector = input.witness.items;
len = vector.length - 1;
dummy = new Buffer([]);
version = 1;
} else if (prev.isWitnessPubkeyhash()) {
prev = Script.createPubkeyhash(prev.code[1]);
vector = input.witness.items;
len = vector.length;
dummy = new Buffer([]);
version = 1;
}
// Create our signature.
signature = this.createSignature(index, prev, addr.key, type, version);
// Add signatures.
if (prev.isPubkey()) {
// P2PK
// Already signed.
if (Script.isSignature(vector[0]))
return true;
// Make sure the pubkey is ours.
if (!utils.isEqual(addr.publicKey, prev.code[0]))
return false;
vector[0] = signature;
return true;
}
if (prev.isPubkeyhash()) {
// P2PKH
// Already signed.
if (Script.isSignature(vector[0]))
return true;
// Make sure the pubkey hash is ours.
if (!utils.isEqual(addr.keyHash, prev.code[2]))
return false;
vector[0] = signature;
return true;
}
if (prev.isMultisig()) {
// Multisig
// Grab the redeem script's keys to figure
// out where our key should go.
keys = prev.code.slice(1, -2);
// Grab `m` value (number of sigs required).
m = Script.getSmall(prev.code[0]);
// Grab `n` value (number of keys).
n = Script.getSmall(prev.code[prev.code.length - 2]);
} else {
// Only allow non-standard signing for
// scripthash.
if (len !== vector.length - 1)
return false;
keys = [];
for (i = 0; i < prev.code.length; i++) {
if (Script.isKey(prev.code[i]))
keys.push(prev.code[i]);
}
// We don't know what m is, so
// we can never finalize the signatures.
m = keys.length;
n = keys.length;
}
// Something is very wrong here. Abort.
if (len - 1 > n)
return false;
// Count the number of current signatures.
signatures = 0;
for (i = 1; i < len; i++) {
if (Script.isSignature(vector[i]))
signatures++;
}
// Signatures are already finalized.
if (signatures === m && len - 1 === m)
return true;
// This can happen in a case where another
// implementation adds signatures willy-nilly
// or by `m`. Add some signature slots for
// us to use.
while (len - 1 < n) {
vector.splice(len, 0, dummy);
len++;
}
// Find the key index so we can place
// the signature in the same index.
ki = utils.indexOf(keys, addr.publicKey);
// Our public key is not in the prev_out
// script. We tried to sign a transaction
// that is not redeemable by us.
if (ki === -1)
return false;
// Offset key index by one to turn it into
// "sig index". Accounts for OP_0 byte at
// the start.
ki++;
// Add our signature to the correct slot
// and increment the total number of
// signatures.
if (ki < len && signatures < m) {
if (Script.isZero(vector[ki])) {
vector[ki] = signature;
signatures++;
}
}
// All signatures added. Finalize.
if (signatures >= m) {
// Remove empty slots left over.
for (i = len - 1; i >= 1; i--) {
if (Script.isZero(vector[i])) {
vector.splice(i, 1);
len--;
}
}
// Remove signatures which are not required.
// This should never happen except when dealing
// with implementations that potentially handle
// signature slots differently.
while (signatures > m) {
vector.splice(len - 1, 1);
signatures--;
len--;
}
// Sanity checks.
assert.equal(signatures, m);
assert.equal(len - 1, m);
}
return signatures === m;
};
MTX.prototype.isSigned = function isSigned(m) {
var i, input, prev, vector, len, j;
var total = 0;
for (i = 0; i < this.inputs.length; i++) {
input = this.inputs[i];
// We can't check for signatures unless
// we have the previous output.
if (!input.coin)
return false;
// Get the prevout's subscript
prev = input.coin.script;
// Script length, needed for multisig
vector = input.script.code;
len = vector.length;
// We need to grab the redeem script when
// signing p2sh transactions.
if (prev.isScripthash()) {
prev = input.script.getRedeem();
len = vector.length - 1;
}
// If the output script is a witness program,
// we have to switch the vector to the witness
// and potentially alter the length. Note that
// witnesses are stack items, so the `dummy`
// _has_ to be an empty buffer (what OP_0
// pushes onto the stack).
if (prev.isWitnessScripthash()) {
prev = input.witness.getRedeem();
vector = input.witness.items;
len = vector.length - 1;
} else if (prev.isWitnessPubkeyhash()) {
prev = Script.createPubkeyhash(prev.code[1]);
vector = input.witness.items;
len = vector.length;
}
if (prev.isPubkey()) {
if (!Script.isSignature(vector[0]))
return false;
} else if (prev.isPubkeyhash()) {
if (!Script.isSignature(vector[0]))
return false;
} else if (prev.isMultisig()) {
// Grab `m` value (number of required sigs).
m = Script.getSmall(prev.code[0]);
// Ensure all members are signatures.
for (j = 1; j < len; j++) {
if (!Script.isSignature(vector[j]))
return false;
}
// Ensure we have the correct number
// of required signatures.
if (len - 1 !== m)
return false;
} else {
for (j = 0; j < vector.length; j++) {
if (Script.isSignatureEncoding(vector[j]))
total++;
}
if (total !== m)
return false;
}
}
return true;
};
MTX.prototype.sign = function sign(index, addr, type) {
var input;
if (index && typeof index === 'object')
index = this.inputs.indexOf(index);
input = this.inputs[index];
assert(input);
// Build script for input
if (!this.scriptInput(index, addr))
return false;
// Sign input
if (!this.signInput(index, addr, type))
return false;
return true;
};
MTX.prototype.addOutput = function addOutput(obj, value) {
var options, output;
if ((obj instanceof bcoin.wallet) || (obj instanceof bcoin.address))
obj = obj.getAddress();
if (typeof obj === 'string') {
options = {
address: obj,
value: value
};
} else {
options = obj;
}
output = bcoin.output(options, this);
this.outputs.push(output);
this.scriptOutput(this.outputs.length - 1, options);
return this;
};
MTX.prototype.scriptOutput = function scriptOutput(index, options) {
var output;
if (options instanceof bcoin.output)
return;
if (typeof index !== 'number')
index = this.outputs.indexOf(index);
output = this.outputs[index];
assert(output);
if (options.script instanceof bcoin.script)
output.script = options.script.clone();
else if (options.script)
output.script = bcoin.script(options.script);
else
output.script = Script.createOutputScript(options);
};
MTX.prototype.maxSize = function maxSize(maxM, maxN) {
var copy = this.clone();
var i, j, input, total, size, prev, m, n;
var witness;
// Create copy with 0-script inputs
for (i = 0; i < copy.inputs.length; i++) {
copy.inputs[i].script = new Script([]);
copy.inputs[i].witness = new Witness([]);
}
total = copy.render().length;
// Add size for signatures and public keys
for (i = 0; i < copy.inputs.length; i++) {
input = copy.inputs[i];
size = 0;
witness = false;
assert(input.coin);
// Get the previous output's subscript
prev = input.coin.script;
// If we have access to the redeem script,
// we can use it to calculate size much easier.
if (this.inputs[i].script.code.length && prev.isScripthash()) {
// Need to add the redeem script size
// here since it will be ignored by
// the isMultisig clause.
// OP_PUSHDATA2 [redeem]
prev = this.inputs[i].script.getRedeem();
size += utils.sizeVarint(prev.getSize()) + prev.getSize();
}
if (prev.isWitnessProgram()) {
witness = true;
// Now calculating vsize. The regular
// redeem script (if there was one)
// is now worth 4 points.
size *= 4;
if (this.inputs[i].witness.items.length && prev.isWitnessScripthash()) {
prev = this.inputs[i].witness.getRedeem();
size += utils.sizeVarint(prev.getSize()) + prev.getSize();
} else if (prev.isWitnessPubkeyhash()) {
prev = Script.createPubkeyhash(prev.code[1]);
}
}
if (prev.isPubkey()) {
// P2PK
// OP_PUSHDATA0 [signature]
size += 1 + 73;
} else if (prev.isPubkeyhash()) {
// P2PKH
// OP_PUSHDATA0 [signature]
size += 1 + 73;
// OP_PUSHDATA0 [key]
size += 1 + 33;
} else if (prev.isMultisig()) {
// Bare Multisig
// Get the previous m value:
m = Script.getSmall(prev.code[0]);
// OP_0
size += 1;
// OP_PUSHDATA0 [signature] ...
size += (1 + 73) * m;
} else if (prev.isScripthash()) {
// P2SH Multisig
// This technically won't work well for other
// kinds of P2SH. It will also over-estimate
// the fee by a lot (at least 10000 satoshis
// since we don't have access to the m and n
// values), which will be recalculated later.
// If fee turns out to be smaller later, we
// simply add more of the fee to the change
// output.
// m value
m = maxM || 15;
// n value
n = maxN || 15;
// OP_0
size += 1;
// OP_PUSHDATA0 [signature] ...
size += (1 + 73) * m;
// OP_PUSHDATA2 [redeem]
size += 3;
// m value
size += 1;
// OP_PUSHDATA0 [key] ...
size += (1 + 33) * n;
// n value
size += 1;
// OP_CHECKMULTISIG
size += 1;
} else {
// OP_PUSHDATA0 [signature]
for (j = 0; j < prev.code.length; j++) {
if (Script.isKey(prev.code[j]))
size += 1 + 73;
}
}
// Byte for varint size of input script.
size += utils.sizeVarint(size);
// Calculate vsize if we're a witness program.
if (witness)
size = (size + 3) / 4 | 0;
total += size;
}
return total;
};
MTX.prototype.selectCoins = function selectCoins(coins, options) {
var tx = this.clone();
var outputValue = tx.getOutputValue();
var totalkb = 1;
var chosen = [];
var lastAdded = 0;
var minFee = constants.tx.minFee;
var dustThreshold = constants.tx.dustThreshold;
var i, size, newkb, change;
var fee;
assert(tx.inputs.length === 0);
if (!options || typeof options !== 'object') {
options = {
changeAddress: arguments[1],
fee: arguments[2]
};
}
if (!options.selection || options.selection === 'age') {
// Oldest unspents first
coins = coins.slice().sort(function(a, b) {
return a.height - b.height;
});
} else if (options.selection === 'random' || options.selection === 'all') {
// Random unspents
coins = coins.slice().sort(function() {
return Math.random() > 0.5 ? 1 : -1;
});
}
function total() {
if (options.subtractFee)
return outputValue;
return outputValue.add(fee);
}
function isFull() {
return tx.getInputValue().cmp(total()) >= 0;
}
function addCoins() {
var i, index;
for (i = lastAdded; i < coins.length; i++) {
// Add new inputs until MTX will have enough
// funds to cover both minimum post cost
// and fee.
tx.addInput(coins[i]);
chosen.push(coins[i]);
lastAdded++;
if (options.wallet)
options.wallet.scriptInputs(tx, index);
if (options.selection === 'all')
continue;
// Stop once we're full.
if (isFull())
break;
}
}
if (options.fee) {
fee = options.fee;
// Transfer `total` funds maximum.
addCoins();
} else {
fee = new bn(minFee);
// Transfer `total` funds maximum.
addCoins();
// Add dummy output (for `change`) to
// calculate maximum MTX size.
tx.addOutput({
address: options.changeAddress,
value: new bn(0)
});
// Change fee value if it is more than 1024
// bytes (10000 satoshi for every 1024 bytes).
do {
// Calculate max possible size after signing.
size = tx.maxSize(options.m, options.n);
if (options.free) {
if (newkb == null && tx.isFree(null, size)) {
fee = new bn(0);
break;
}
}
if (options.accurate) {
newkb = size / 1024;
fee = new bn(newkb * minFee | 0);
totalkb = newkb;
} else {
newkb = Math.ceil(size / 1024) - totalkb;
fee.iaddn(newkb * minFee);
totalkb += newkb;
}
// Failed to get enough funds, add more inputs.
if (!isFull())
addCoins();
} while (!isFull() && lastAdded < coins.length);
}
if (!isFull()) {
// Still failing to get enough funds.
chosen = null;
} else {
// How much money is left after filling outputs.
change = tx.getInputValue().sub(total());
// Attempt to subtract fee.
if (options.subtractFee != null) {
if (typeof options.subtractFee === 'number') {
i = options.subtractFee;
assert(tx.outputs[i], 'Subtraction index does not exist.');
if (tx.outputs[i].value.cmp(fee.addn(dustThreshold)) >= 0)
tx.outputs[i].value.isub(fee);
else
chosen = null;
} else {
for (i = 0; i < tx.outputs.length; i++) {
if (tx.outputs[i].value.cmp(fee.addn(dustThreshold)) >= 0) {
tx.outputs[i].value.isub(fee);
break;
}
}
// Could not subtract fee
if (i === tx.outputs.length)
chosen = null;
}
}
}
// Return necessary inputs and change.
return {
coins: chosen,
change: change,
fee: fee,
total: total(),
kb: totalkb
};
};
MTX.prototype.fill = function fill(coins, options) {
var self = this;
var result, err;
if (!options || typeof options !== 'object') {
options = {
changeAddress: arguments[1],
fee: arguments[2]
};
}
assert(coins);
assert(options.changeAddress, '`changeAddress` is required.');
result = this.selectCoins(coins, options);
if (!result.coins) {
err = new Error('Could not fill transaction.');
err.requiredFunds = result.total;
throw err;
}
result.coins.forEach(function(coin) {
self.addInput(coin);
});
if (result.change.cmpn(constants.tx.dustThreshold) < 0) {
// Do nothing. Change is added to fee.
assert.equal(
this.getFee().toNumber(),
result.fee.add(result.change).toNumber()
);
this.changeIndex = -1;
} else {
this.addOutput({
address: options.changeAddress,
value: result.change
});
this.changeIndex = this.outputs.length - 1;
assert.equal(this.getFee().toNumber(), result.fee.toNumber());
}
return result;
};
// https://github.com/bitcoin/bips/blob/master/bip-0069.mediawiki
MTX.prototype.sortMembers = function sortMembers() {
var changeOutput;
if (this.changeIndex !== -1) {
changeOutput = this.outputs[this.changeIndex];
assert(changeOutput);
}
this.inputs = this.inputs.slice().sort(function(a, b) {
var h1 = new Buffer(a.prevout.hash, 'hex');
var h2 = new Buffer(b.prevout.hash, 'hex');
var res = utils.cmp(h1, h2);
if (res !== 0)
return res;
return a.prevout.index - b.prevout.index;
});
this.outputs = this.outputs.slice().sort(function(a, b) {
var res = a.value.cmp(b.value);
if (res !== 0)
return res;
return utils.cmp(a.encode(), b.encode());
});
if (this.changeIndex !== -1) {
this.changeIndex = this.outputs.indexOf(changeOutput);
assert(this.changeIndex !== -1);
}
};
MTX.prototype.avoidFeeSniping = function avoidFeeSniping(height) {
if (height == null)
height = network.height;
if (height === -1)
height = 0;
if ((Math.random() * 10 | 0) === 0)
this.setLocktime(Math.max(0, height - (Math.random() * 100 | 0)));
else
this.setLocktime(height);
};
MTX.prototype.setLocktime = function setLocktime(locktime) {
var i, input;
for (i = 0; i < this.inputs.length; i++) {
input = this.inputs[i];
if (input.sequence === 0xffffffff)
input.sequence = 0xffffffff - 1;
}
this.locktime = locktime;
};
MTX._fromJSON = bcoin.tx._fromJSON;
MTX.fromJSON = function fromJSON(json) {
return new MTX(MTX._fromJSON(json));
};
MTX._fromRaw = bcoin.tx._fromRaw;
MTX.fromRaw = function fromRaw(data, enc) {
return new MTX(MTX._fromRaw(data, enc));
};
MTX._fromExtended = bcoin.tx._fromExtended;
MTX.fromExtended = function fromExtended(data, enc) {
return new MTX(MTX._fromExtended(data, enc));
};
MTX.fromTX = function fromTX(tx) {
return new MTX(tx);
};
MTX.prototype.toTX = function toTX() {
return new bcoin.tx(this);
};
MTX.isMTX = function isMTX(obj) {
return obj
&& Array.isArray(obj.inputs)
&& typeof obj.ps === 'number'
&& typeof obj.changeIndex === 'number'
&& typeof obj.scriptInput === 'function';
};
/**
* Expose
*/
module.exports = MTX;