1087 lines
26 KiB
JavaScript
1087 lines
26 KiB
JavaScript
/**
|
|
* mtx.js - mutable transaction object for bcoin
|
|
* Copyright (c) 2014-2015, Fedor Indutny (MIT License)
|
|
* https://github.com/indutny/bcoin
|
|
*/
|
|
|
|
var bn = require('bn.js');
|
|
|
|
var bcoin = require('../bcoin');
|
|
var utils = require('./utils');
|
|
var assert = utils.assert;
|
|
var constants = bcoin.protocol.constants;
|
|
var network = bcoin.protocol.network;
|
|
var Script = bcoin.script;
|
|
var Witness = bcoin.script.witness;
|
|
var opcodes = constants.opcodes;
|
|
|
|
/**
|
|
* MTX
|
|
*/
|
|
|
|
function MTX(options) {
|
|
if (!(this instanceof MTX))
|
|
return new MTX(options);
|
|
|
|
if (!options)
|
|
options = {};
|
|
|
|
this.options = options;
|
|
|
|
this.type = 'tx';
|
|
this.version = options.version || 1;
|
|
this.inputs = [];
|
|
this.outputs = [];
|
|
this.locktime = 0;
|
|
this.ts = 0;
|
|
this.block = null;
|
|
this.index = -1;
|
|
this.ps = this.ts === 0 ? utils.now() : 0;
|
|
this.changeIndex = options.changeIndex != null ? options.changeIndex : -1;
|
|
|
|
this._hash = null;
|
|
this._whash = null;
|
|
this._raw = null;
|
|
this._size = 0;
|
|
this._witnessSize = 0;
|
|
|
|
this.height = -1;
|
|
|
|
if (options.inputs) {
|
|
options.inputs.forEach(function(input) {
|
|
this.addInput(input);
|
|
}, this);
|
|
}
|
|
|
|
if (options.outputs) {
|
|
options.outputs.forEach(function(output) {
|
|
this.addOutput(output);
|
|
}, this);
|
|
}
|
|
}
|
|
|
|
utils.inherits(MTX, bcoin.tx);
|
|
|
|
MTX.prototype.clone = function clone() {
|
|
return new MTX(this);
|
|
};
|
|
|
|
MTX.prototype.hash = function hash(enc) {
|
|
var hash = utils.dsha256(this.renderNormal());
|
|
return enc === 'hex' ? utils.toHex(hash) : hash;
|
|
};
|
|
|
|
MTX.prototype.witnessHash = function witnessHash(enc) {
|
|
var hash;
|
|
|
|
if (this.isCoinbase()) {
|
|
return enc === 'hex'
|
|
? utils.toHex(constants.zeroHash)
|
|
: new Buffer(constants.zeroHash);
|
|
}
|
|
|
|
if (!this.hasWitness())
|
|
return this.hash(enc);
|
|
|
|
hash = utils.dsha256(this.renderWitness());
|
|
|
|
return enc === 'hex' ? utils.toHex(hash) : hash;
|
|
};
|
|
|
|
MTX.prototype.render = function render() {
|
|
return this.getRaw();
|
|
};
|
|
|
|
MTX.prototype.renderNormal = function renderNormal() {
|
|
return bcoin.protocol.framer.tx(this);
|
|
};
|
|
|
|
MTX.prototype.renderWitness = function renderWitness() {
|
|
return bcoin.protocol.framer.witnessTX(this);
|
|
};
|
|
|
|
MTX.prototype.getRaw = function getRaw() {
|
|
if (this.hasWitness())
|
|
return bcoin.protocol.framer.witnessTX(this);
|
|
|
|
return bcoin.protocol.framer.tx(this);
|
|
};
|
|
|
|
MTX.prototype.getSize = function getSize() {
|
|
return this.getRaw().length;
|
|
};
|
|
|
|
MTX.prototype.getVirtualSize = function getVirtualSize() {
|
|
var raw = this.getRaw();
|
|
var size = raw.length;
|
|
var witnessSize = raw._witnessSize;
|
|
var base = size - witnessSize;
|
|
|
|
return (base * 4 + witnessSize + 3) / 4 | 0;
|
|
};
|
|
|
|
MTX.prototype.addInput = function addInput(options, index) {
|
|
var input;
|
|
|
|
if (options instanceof MTX)
|
|
options = bcoin.coin(options, index);
|
|
|
|
if (options instanceof bcoin.coin) {
|
|
options = {
|
|
prevout: { hash: options.hash, index: options.index },
|
|
coin: options
|
|
};
|
|
}
|
|
|
|
assert(options.prevout);
|
|
|
|
// i = this._inputIndex(options.prevout.hash, options.prevout.index);
|
|
// assert(i === -1);
|
|
|
|
input = bcoin.input(options, this);
|
|
|
|
if (options.script instanceof bcoin.script)
|
|
input.script = options.script.clone();
|
|
|
|
if (options.witness instanceof bcoin.script.witness)
|
|
input.witness = options.witness.clone();
|
|
|
|
this.inputs.push(input);
|
|
|
|
return this;
|
|
};
|
|
|
|
MTX.prototype.scriptInput = function scriptInput(index, addr) {
|
|
var input, prev, n, i, redeemScript, witnessScript, vector, dummy;
|
|
|
|
if (typeof index !== 'number')
|
|
index = this.inputs.indexOf(index);
|
|
|
|
// Get the input
|
|
input = this.inputs[index];
|
|
assert(input);
|
|
|
|
// We should have previous outputs by now.
|
|
assert(input.coin);
|
|
|
|
// Optimization: Don't bother with any below
|
|
// calculation if the output is already templated.
|
|
// Just say this is "our" output.
|
|
if (input.script.code.length || input.witness.items.length)
|
|
return true;
|
|
|
|
// Optimization: test output against the
|
|
// address map to avoid unnecessary calculation.
|
|
// A hash table lookup may be faster than all
|
|
// the nonsense below.
|
|
if (!addr.ownOutput(input.coin))
|
|
return false;
|
|
|
|
// Get the previous output's script
|
|
prev = input.coin.script;
|
|
|
|
// This is easily the hardest part about building a transaction
|
|
// with segwit: figuring out where the redeem script and witness
|
|
// redeem scripts go.
|
|
if (prev.isScripthash()) {
|
|
if (addr.program && utils.isEqual(prev.code[1], addr.programHash)) {
|
|
// Witness program nested in regular P2SH.
|
|
redeemScript = addr.program.encode();
|
|
vector = input.witness.items;
|
|
dummy = new Buffer([]);
|
|
assert(addr.program.code[0] === opcodes.OP_0, 'Non-zero version passed to address.');
|
|
if (addr.program.code[1].length === 32) {
|
|
// P2WSH nested within pay-to-scripthash
|
|
// (it had to be this complicated, didn't it?)
|
|
witnessScript = addr.script.encode();
|
|
prev = addr.script;
|
|
} else if (addr.program.code[1].length === 20) {
|
|
// P2WPKH nested within pay-to-scripthash.
|
|
prev = Script.createPubkeyhash(addr.keyHash);
|
|
} else {
|
|
assert(false, 'Unknown program data length passed to address.');
|
|
}
|
|
} else if (addr.script && utils.isEqual(prev.code[1], addr.scriptHash160)) {
|
|
// Regular P2SH.
|
|
redeemScript = addr.script.encode();
|
|
vector = input.script.code;
|
|
prev = addr.script;
|
|
dummy = opcodes.OP_0;
|
|
} else {
|
|
return false;
|
|
}
|
|
} else if (prev.isWitnessProgram()) {
|
|
// Witness program.
|
|
vector = input.witness.items;
|
|
dummy = new Buffer([]);
|
|
|
|
if (prev.code[0] !== opcodes.OP_0)
|
|
return false;
|
|
|
|
if (prev.code[1].length === 32) {
|
|
// Bare P2WSH.
|
|
if (!addr.script || !utils.isEqual(prev.code[1], addr.scriptHash256))
|
|
return false;
|
|
|
|
witnessScript = addr.script.encode();
|
|
prev = addr.script;
|
|
} else if (prev.code[1].length === 20) {
|
|
// Bare P2WPKH.
|
|
if (!utils.isEqual(prev.code[1], addr.keyHash))
|
|
return false;
|
|
|
|
prev = Script.createPubkeyhash(prev.code[1]);
|
|
} else {
|
|
// Bare... who knows?
|
|
return false;
|
|
}
|
|
} else {
|
|
// Wow, a normal output! Praise be to Jengus and Gord.
|
|
vector = input.script.code;
|
|
dummy = opcodes.OP_0;
|
|
}
|
|
|
|
if (prev.isPubkey()) {
|
|
// P2PK
|
|
if (!utils.isEqual(prev.code[0], addr.publicKey))
|
|
return false;
|
|
|
|
// Already has a script template (at least)
|
|
if (vector.length)
|
|
return true;
|
|
|
|
vector[0] = dummy;
|
|
} else if (prev.isPubkeyhash()) {
|
|
// P2PKH
|
|
if (!utils.isEqual(prev.code[2], addr.keyHash))
|
|
return false;
|
|
|
|
// Already has a script template (at least)
|
|
if (vector.length)
|
|
return true;
|
|
|
|
vector[0] = dummy;
|
|
vector[1] = addr.publicKey;
|
|
} else if (prev.isMultisig()) {
|
|
// Multisig
|
|
if (utils.indexOf(prev.code, addr.publicKey) === -1)
|
|
return false;
|
|
|
|
// Already has a script template (at least)
|
|
if (vector.length)
|
|
return true;
|
|
|
|
// Technically we should create m signature slots,
|
|
// but we create n signature slots so we can order
|
|
// the signatures properly.
|
|
vector[0] = dummy;
|
|
|
|
// Grab `n` value (number of keys).
|
|
n = Script.getSmall(prev.code[prev.code.length - 2]);
|
|
|
|
// Fill script with `n` signature slots.
|
|
for (i = 0; i < n; i++)
|
|
vector[i + 1] = dummy;
|
|
} else {
|
|
if (utils.indexOf(prev.code, addr.publicKey) === -1)
|
|
return false;
|
|
|
|
// Already has a script template (at least)
|
|
if (vector.length)
|
|
return true;
|
|
|
|
// Likely a non-standard scripthash multisig
|
|
// input. Determine n value by counting keys.
|
|
// Also, only allow nonstandard types for
|
|
// scripthash.
|
|
vector[0] = dummy;
|
|
|
|
// Fill script with `n` signature slots.
|
|
for (i = 0; i < prev.code.length; i++) {
|
|
if (Script.isKey(prev.code[i]))
|
|
vector[i + 1] = dummy;
|
|
}
|
|
}
|
|
|
|
// P2SH requires the redeem
|
|
// script after signatures.
|
|
if (redeemScript)
|
|
input.script.code.push(redeemScript);
|
|
|
|
// P2WSH requires the witness
|
|
// script after signatures.
|
|
if (witnessScript)
|
|
input.witness.items.push(witnessScript);
|
|
|
|
return true;
|
|
};
|
|
|
|
MTX.prototype.createSignature = function createSignature(index, prev, key, type, version) {
|
|
var hash, signature;
|
|
|
|
if (typeof index !== 'number')
|
|
index = this.inputs.indexOf(index);
|
|
|
|
if (type == null)
|
|
type = 'all';
|
|
|
|
if (typeof type === 'string')
|
|
type = constants.hashType[type];
|
|
|
|
// Get the hash of the current tx, minus the other
|
|
// inputs, plus the sighash type.
|
|
hash = this.signatureHash(index, prev, type, version);
|
|
|
|
// Sign the transaction with our one input
|
|
signature = Script.sign(hash, key, type);
|
|
|
|
// Something is broken if this doesn't work:
|
|
// assert(Script.checksig(hash, signature, key), 'BUG: Verify failed.');
|
|
|
|
return signature;
|
|
};
|
|
|
|
MTX.prototype.signInput = function signInput(index, addr, type) {
|
|
var input, prev, signature, ki, signatures, i;
|
|
var len, m, n, keys, vector, dummy, version;
|
|
|
|
if (typeof index !== 'number')
|
|
index = this.inputs.indexOf(index);
|
|
|
|
// Get the input
|
|
input = this.inputs[index];
|
|
assert(input);
|
|
|
|
// We should have previous outputs by now.
|
|
assert(input.coin);
|
|
|
|
// Get the previous output's subscript
|
|
prev = input.coin.script;
|
|
|
|
vector = input.script.code;
|
|
len = vector.length;
|
|
dummy = opcodes.OP_0;
|
|
version = 0;
|
|
|
|
// We need to grab the redeem script when
|
|
// signing p2sh transactions.
|
|
if (prev.isScripthash()) {
|
|
prev = input.script.getRedeem();
|
|
len = vector.length - 1;
|
|
}
|
|
|
|
// If the output script is a witness program,
|
|
// we have to switch the vector to the witness
|
|
// and potentially alter the length. Note that
|
|
// witnesses are stack items, so the `dummy`
|
|
// _has_ to be an empty buffer (what OP_0
|
|
// pushes onto the stack).
|
|
if (prev.isWitnessScripthash()) {
|
|
prev = input.witness.getRedeem();
|
|
vector = input.witness.items;
|
|
len = vector.length - 1;
|
|
dummy = new Buffer([]);
|
|
version = 1;
|
|
} else if (prev.isWitnessPubkeyhash()) {
|
|
prev = Script.createPubkeyhash(prev.code[1]);
|
|
vector = input.witness.items;
|
|
len = vector.length;
|
|
dummy = new Buffer([]);
|
|
version = 1;
|
|
}
|
|
|
|
// Create our signature.
|
|
signature = this.createSignature(index, prev, addr.key, type, version);
|
|
|
|
// Add signatures.
|
|
if (prev.isPubkey()) {
|
|
// P2PK
|
|
|
|
// Already signed.
|
|
if (Script.isSignature(vector[0]))
|
|
return true;
|
|
|
|
// Make sure the pubkey is ours.
|
|
if (!utils.isEqual(addr.publicKey, prev.code[0]))
|
|
return false;
|
|
|
|
vector[0] = signature;
|
|
|
|
return true;
|
|
}
|
|
|
|
if (prev.isPubkeyhash()) {
|
|
// P2PKH
|
|
|
|
// Already signed.
|
|
if (Script.isSignature(vector[0]))
|
|
return true;
|
|
|
|
// Make sure the pubkey hash is ours.
|
|
if (!utils.isEqual(addr.keyHash, prev.code[2]))
|
|
return false;
|
|
|
|
vector[0] = signature;
|
|
|
|
return true;
|
|
}
|
|
|
|
if (prev.isMultisig()) {
|
|
// Multisig
|
|
|
|
// Grab the redeem script's keys to figure
|
|
// out where our key should go.
|
|
keys = prev.code.slice(1, -2);
|
|
|
|
// Grab `m` value (number of sigs required).
|
|
m = Script.getSmall(prev.code[0]);
|
|
|
|
// Grab `n` value (number of keys).
|
|
n = Script.getSmall(prev.code[prev.code.length - 2]);
|
|
} else {
|
|
// Only allow non-standard signing for
|
|
// scripthash.
|
|
if (len !== vector.length - 1)
|
|
return false;
|
|
|
|
keys = [];
|
|
|
|
for (i = 0; i < prev.code.length; i++) {
|
|
if (Script.isKey(prev.code[i]))
|
|
keys.push(prev.code[i]);
|
|
}
|
|
|
|
// We don't know what m is, so
|
|
// we can never finalize the signatures.
|
|
m = keys.length;
|
|
n = keys.length;
|
|
}
|
|
|
|
// Something is very wrong here. Abort.
|
|
if (len - 1 > n)
|
|
return false;
|
|
|
|
// Count the number of current signatures.
|
|
signatures = 0;
|
|
for (i = 1; i < len; i++) {
|
|
if (Script.isSignature(vector[i]))
|
|
signatures++;
|
|
}
|
|
|
|
// Signatures are already finalized.
|
|
if (signatures === m && len - 1 === m)
|
|
return true;
|
|
|
|
// This can happen in a case where another
|
|
// implementation adds signatures willy-nilly
|
|
// or by `m`. Add some signature slots for
|
|
// us to use.
|
|
while (len - 1 < n) {
|
|
vector.splice(len, 0, dummy);
|
|
len++;
|
|
}
|
|
|
|
// Find the key index so we can place
|
|
// the signature in the same index.
|
|
ki = utils.indexOf(keys, addr.publicKey);
|
|
|
|
// Our public key is not in the prev_out
|
|
// script. We tried to sign a transaction
|
|
// that is not redeemable by us.
|
|
if (ki === -1)
|
|
return false;
|
|
|
|
// Offset key index by one to turn it into
|
|
// "sig index". Accounts for OP_0 byte at
|
|
// the start.
|
|
ki++;
|
|
|
|
// Add our signature to the correct slot
|
|
// and increment the total number of
|
|
// signatures.
|
|
if (ki < len && signatures < m) {
|
|
if (Script.isZero(vector[ki])) {
|
|
vector[ki] = signature;
|
|
signatures++;
|
|
}
|
|
}
|
|
|
|
// All signatures added. Finalize.
|
|
if (signatures >= m) {
|
|
// Remove empty slots left over.
|
|
for (i = len - 1; i >= 1; i--) {
|
|
if (Script.isZero(vector[i])) {
|
|
vector.splice(i, 1);
|
|
len--;
|
|
}
|
|
}
|
|
|
|
// Remove signatures which are not required.
|
|
// This should never happen except when dealing
|
|
// with implementations that potentially handle
|
|
// signature slots differently.
|
|
while (signatures > m) {
|
|
vector.splice(len - 1, 1);
|
|
signatures--;
|
|
len--;
|
|
}
|
|
|
|
// Sanity checks.
|
|
assert.equal(signatures, m);
|
|
assert.equal(len - 1, m);
|
|
}
|
|
|
|
return signatures === m;
|
|
};
|
|
|
|
MTX.prototype.isSigned = function isSigned(m) {
|
|
var i, input, prev, vector, len, j;
|
|
var total = 0;
|
|
|
|
for (i = 0; i < this.inputs.length; i++) {
|
|
input = this.inputs[i];
|
|
|
|
// We can't check for signatures unless
|
|
// we have the previous output.
|
|
if (!input.coin)
|
|
return false;
|
|
|
|
// Get the prevout's subscript
|
|
prev = input.coin.script;
|
|
|
|
// Script length, needed for multisig
|
|
vector = input.script.code;
|
|
len = vector.length;
|
|
|
|
// We need to grab the redeem script when
|
|
// signing p2sh transactions.
|
|
if (prev.isScripthash()) {
|
|
prev = input.script.getRedeem();
|
|
len = vector.length - 1;
|
|
}
|
|
|
|
// If the output script is a witness program,
|
|
// we have to switch the vector to the witness
|
|
// and potentially alter the length. Note that
|
|
// witnesses are stack items, so the `dummy`
|
|
// _has_ to be an empty buffer (what OP_0
|
|
// pushes onto the stack).
|
|
if (prev.isWitnessScripthash()) {
|
|
prev = input.witness.getRedeem();
|
|
vector = input.witness.items;
|
|
len = vector.length - 1;
|
|
} else if (prev.isWitnessPubkeyhash()) {
|
|
prev = Script.createPubkeyhash(prev.code[1]);
|
|
vector = input.witness.items;
|
|
len = vector.length;
|
|
}
|
|
|
|
if (prev.isPubkey()) {
|
|
if (!Script.isSignature(vector[0]))
|
|
return false;
|
|
} else if (prev.isPubkeyhash()) {
|
|
if (!Script.isSignature(vector[0]))
|
|
return false;
|
|
} else if (prev.isMultisig()) {
|
|
// Grab `m` value (number of required sigs).
|
|
m = Script.getSmall(prev.code[0]);
|
|
|
|
// Ensure all members are signatures.
|
|
for (j = 1; j < len; j++) {
|
|
if (!Script.isSignature(vector[j]))
|
|
return false;
|
|
}
|
|
|
|
// Ensure we have the correct number
|
|
// of required signatures.
|
|
if (len - 1 !== m)
|
|
return false;
|
|
} else {
|
|
for (j = 0; j < vector.length; j++) {
|
|
if (Script.isSignatureEncoding(vector[j]))
|
|
total++;
|
|
}
|
|
|
|
if (total !== m)
|
|
return false;
|
|
}
|
|
}
|
|
|
|
return true;
|
|
};
|
|
|
|
MTX.prototype.sign = function sign(index, addr, type) {
|
|
var input;
|
|
|
|
if (index && typeof index === 'object')
|
|
index = this.inputs.indexOf(index);
|
|
|
|
input = this.inputs[index];
|
|
assert(input);
|
|
|
|
// Build script for input
|
|
if (!this.scriptInput(index, addr))
|
|
return false;
|
|
|
|
// Sign input
|
|
if (!this.signInput(index, addr, type))
|
|
return false;
|
|
|
|
return true;
|
|
};
|
|
|
|
MTX.prototype.addOutput = function addOutput(obj, value) {
|
|
var options, output;
|
|
|
|
if ((obj instanceof bcoin.wallet) || (obj instanceof bcoin.address))
|
|
obj = obj.getAddress();
|
|
|
|
if (typeof obj === 'string') {
|
|
options = {
|
|
address: obj,
|
|
value: value
|
|
};
|
|
} else {
|
|
options = obj;
|
|
}
|
|
|
|
output = bcoin.output(options, this);
|
|
|
|
this.outputs.push(output);
|
|
|
|
this.scriptOutput(this.outputs.length - 1, options);
|
|
|
|
return this;
|
|
};
|
|
|
|
MTX.prototype.scriptOutput = function scriptOutput(index, options) {
|
|
var output;
|
|
|
|
if (options instanceof bcoin.output)
|
|
return;
|
|
|
|
if (typeof index !== 'number')
|
|
index = this.outputs.indexOf(index);
|
|
|
|
output = this.outputs[index];
|
|
assert(output);
|
|
|
|
if (options.script instanceof bcoin.script)
|
|
output.script = options.script.clone();
|
|
else if (options.script)
|
|
output.script = bcoin.script(options.script);
|
|
else
|
|
output.script = Script.createOutputScript(options);
|
|
};
|
|
|
|
MTX.prototype.maxSize = function maxSize(maxM, maxN) {
|
|
var copy = this.clone();
|
|
var i, j, input, total, size, prev, m, n;
|
|
var witness;
|
|
|
|
// Create copy with 0-script inputs
|
|
for (i = 0; i < copy.inputs.length; i++) {
|
|
copy.inputs[i].script = new Script([]);
|
|
copy.inputs[i].witness = new Witness([]);
|
|
}
|
|
|
|
total = copy.render().length;
|
|
|
|
// Add size for signatures and public keys
|
|
for (i = 0; i < copy.inputs.length; i++) {
|
|
input = copy.inputs[i];
|
|
size = 0;
|
|
witness = false;
|
|
|
|
assert(input.coin);
|
|
|
|
// Get the previous output's subscript
|
|
prev = input.coin.script;
|
|
|
|
// If we have access to the redeem script,
|
|
// we can use it to calculate size much easier.
|
|
if (this.inputs[i].script.code.length && prev.isScripthash()) {
|
|
// Need to add the redeem script size
|
|
// here since it will be ignored by
|
|
// the isMultisig clause.
|
|
// OP_PUSHDATA2 [redeem]
|
|
prev = this.inputs[i].script.getRedeem();
|
|
size += utils.sizeVarint(prev.getSize()) + prev.getSize();
|
|
}
|
|
|
|
if (prev.isWitnessProgram()) {
|
|
witness = true;
|
|
// Now calculating vsize. The regular
|
|
// redeem script (if there was one)
|
|
// is now worth 4 points.
|
|
size *= 4;
|
|
if (this.inputs[i].witness.items.length && prev.isWitnessScripthash()) {
|
|
prev = this.inputs[i].witness.getRedeem();
|
|
size += utils.sizeVarint(prev.getSize()) + prev.getSize();
|
|
} else if (prev.isWitnessPubkeyhash()) {
|
|
prev = Script.createPubkeyhash(prev.code[1]);
|
|
}
|
|
}
|
|
|
|
if (prev.isPubkey()) {
|
|
// P2PK
|
|
// OP_PUSHDATA0 [signature]
|
|
size += 1 + 73;
|
|
} else if (prev.isPubkeyhash()) {
|
|
// P2PKH
|
|
// OP_PUSHDATA0 [signature]
|
|
size += 1 + 73;
|
|
// OP_PUSHDATA0 [key]
|
|
size += 1 + 33;
|
|
} else if (prev.isMultisig()) {
|
|
// Bare Multisig
|
|
// Get the previous m value:
|
|
m = Script.getSmall(prev.code[0]);
|
|
// OP_0
|
|
size += 1;
|
|
// OP_PUSHDATA0 [signature] ...
|
|
size += (1 + 73) * m;
|
|
} else if (prev.isScripthash()) {
|
|
// P2SH Multisig
|
|
// This technically won't work well for other
|
|
// kinds of P2SH. It will also over-estimate
|
|
// the fee by a lot (at least 10000 satoshis
|
|
// since we don't have access to the m and n
|
|
// values), which will be recalculated later.
|
|
// If fee turns out to be smaller later, we
|
|
// simply add more of the fee to the change
|
|
// output.
|
|
// m value
|
|
m = maxM || 15;
|
|
// n value
|
|
n = maxN || 15;
|
|
// OP_0
|
|
size += 1;
|
|
// OP_PUSHDATA0 [signature] ...
|
|
size += (1 + 73) * m;
|
|
// OP_PUSHDATA2 [redeem]
|
|
size += 3;
|
|
// m value
|
|
size += 1;
|
|
// OP_PUSHDATA0 [key] ...
|
|
size += (1 + 33) * n;
|
|
// n value
|
|
size += 1;
|
|
// OP_CHECKMULTISIG
|
|
size += 1;
|
|
} else {
|
|
// OP_PUSHDATA0 [signature]
|
|
for (j = 0; j < prev.code.length; j++) {
|
|
if (Script.isKey(prev.code[j]))
|
|
size += 1 + 73;
|
|
}
|
|
}
|
|
|
|
// Byte for varint size of input script.
|
|
size += utils.sizeVarint(size);
|
|
|
|
// Calculate vsize if we're a witness program.
|
|
if (witness)
|
|
size = (size + 3) / 4 | 0;
|
|
|
|
total += size;
|
|
}
|
|
|
|
return total;
|
|
};
|
|
|
|
MTX.prototype.selectCoins = function selectCoins(coins, options) {
|
|
var tx = this.clone();
|
|
var outputValue = tx.getOutputValue();
|
|
var totalkb = 1;
|
|
var chosen = [];
|
|
var lastAdded = 0;
|
|
var minFee = constants.tx.minFee;
|
|
var dustThreshold = constants.tx.dustThreshold;
|
|
var i, size, newkb, change;
|
|
var fee;
|
|
|
|
assert(tx.inputs.length === 0);
|
|
|
|
if (!options || typeof options !== 'object') {
|
|
options = {
|
|
changeAddress: arguments[1],
|
|
fee: arguments[2]
|
|
};
|
|
}
|
|
|
|
if (!options.selection || options.selection === 'age') {
|
|
// Oldest unspents first
|
|
coins = coins.slice().sort(function(a, b) {
|
|
return a.height - b.height;
|
|
});
|
|
} else if (options.selection === 'random' || options.selection === 'all') {
|
|
// Random unspents
|
|
coins = coins.slice().sort(function() {
|
|
return Math.random() > 0.5 ? 1 : -1;
|
|
});
|
|
}
|
|
|
|
function total() {
|
|
if (options.subtractFee)
|
|
return outputValue;
|
|
return outputValue.add(fee);
|
|
}
|
|
|
|
function isFull() {
|
|
return tx.getInputValue().cmp(total()) >= 0;
|
|
}
|
|
|
|
function addCoins() {
|
|
var i, index;
|
|
|
|
for (i = lastAdded; i < coins.length; i++) {
|
|
// Add new inputs until MTX will have enough
|
|
// funds to cover both minimum post cost
|
|
// and fee.
|
|
tx.addInput(coins[i]);
|
|
chosen.push(coins[i]);
|
|
lastAdded++;
|
|
|
|
if (options.wallet)
|
|
options.wallet.scriptInputs(tx, index);
|
|
|
|
if (options.selection === 'all')
|
|
continue;
|
|
|
|
// Stop once we're full.
|
|
if (isFull())
|
|
break;
|
|
}
|
|
}
|
|
|
|
if (options.fee) {
|
|
fee = options.fee;
|
|
|
|
// Transfer `total` funds maximum.
|
|
addCoins();
|
|
} else {
|
|
fee = new bn(minFee);
|
|
|
|
// Transfer `total` funds maximum.
|
|
addCoins();
|
|
|
|
// Add dummy output (for `change`) to
|
|
// calculate maximum MTX size.
|
|
tx.addOutput({
|
|
address: options.changeAddress,
|
|
value: new bn(0)
|
|
});
|
|
|
|
// Change fee value if it is more than 1024
|
|
// bytes (10000 satoshi for every 1024 bytes).
|
|
do {
|
|
// Calculate max possible size after signing.
|
|
size = tx.maxSize(options.m, options.n);
|
|
|
|
if (options.free) {
|
|
if (newkb == null && tx.isFree(null, size)) {
|
|
fee = new bn(0);
|
|
break;
|
|
}
|
|
}
|
|
|
|
if (options.accurate) {
|
|
newkb = size / 1024;
|
|
fee = new bn(newkb * minFee | 0);
|
|
totalkb = newkb;
|
|
} else {
|
|
newkb = Math.ceil(size / 1024) - totalkb;
|
|
fee.iaddn(newkb * minFee);
|
|
totalkb += newkb;
|
|
}
|
|
|
|
// Failed to get enough funds, add more inputs.
|
|
if (!isFull())
|
|
addCoins();
|
|
} while (!isFull() && lastAdded < coins.length);
|
|
}
|
|
|
|
if (!isFull()) {
|
|
// Still failing to get enough funds.
|
|
chosen = null;
|
|
} else {
|
|
// How much money is left after filling outputs.
|
|
change = tx.getInputValue().sub(total());
|
|
|
|
// Attempt to subtract fee.
|
|
if (options.subtractFee != null) {
|
|
if (typeof options.subtractFee === 'number') {
|
|
i = options.subtractFee;
|
|
assert(tx.outputs[i], 'Subtraction index does not exist.');
|
|
if (tx.outputs[i].value.cmp(fee.addn(dustThreshold)) >= 0)
|
|
tx.outputs[i].value.isub(fee);
|
|
else
|
|
chosen = null;
|
|
} else {
|
|
for (i = 0; i < tx.outputs.length; i++) {
|
|
if (tx.outputs[i].value.cmp(fee.addn(dustThreshold)) >= 0) {
|
|
tx.outputs[i].value.isub(fee);
|
|
break;
|
|
}
|
|
}
|
|
// Could not subtract fee
|
|
if (i === tx.outputs.length)
|
|
chosen = null;
|
|
}
|
|
}
|
|
}
|
|
|
|
// Return necessary inputs and change.
|
|
return {
|
|
coins: chosen,
|
|
change: change,
|
|
fee: fee,
|
|
total: total(),
|
|
kb: totalkb
|
|
};
|
|
};
|
|
|
|
MTX.prototype.fill = function fill(coins, options) {
|
|
var self = this;
|
|
var result, err;
|
|
|
|
if (!options || typeof options !== 'object') {
|
|
options = {
|
|
changeAddress: arguments[1],
|
|
fee: arguments[2]
|
|
};
|
|
}
|
|
|
|
assert(coins);
|
|
assert(options.changeAddress, '`changeAddress` is required.');
|
|
|
|
result = this.selectCoins(coins, options);
|
|
|
|
if (!result.coins) {
|
|
err = new Error('Could not fill transaction.');
|
|
err.requiredFunds = result.total;
|
|
throw err;
|
|
}
|
|
|
|
result.coins.forEach(function(coin) {
|
|
self.addInput(coin);
|
|
});
|
|
|
|
if (result.change.cmpn(constants.tx.dustThreshold) < 0) {
|
|
// Do nothing. Change is added to fee.
|
|
assert.equal(
|
|
this.getFee().toNumber(),
|
|
result.fee.add(result.change).toNumber()
|
|
);
|
|
this.changeIndex = -1;
|
|
} else {
|
|
this.addOutput({
|
|
address: options.changeAddress,
|
|
value: result.change
|
|
});
|
|
|
|
this.changeIndex = this.outputs.length - 1;
|
|
|
|
assert.equal(this.getFee().toNumber(), result.fee.toNumber());
|
|
}
|
|
|
|
return result;
|
|
};
|
|
|
|
// https://github.com/bitcoin/bips/blob/master/bip-0069.mediawiki
|
|
MTX.prototype.sortMembers = function sortMembers() {
|
|
var changeOutput;
|
|
|
|
if (this.changeIndex !== -1) {
|
|
changeOutput = this.outputs[this.changeIndex];
|
|
assert(changeOutput);
|
|
}
|
|
|
|
this.inputs = this.inputs.slice().sort(function(a, b) {
|
|
var h1 = new Buffer(a.prevout.hash, 'hex');
|
|
var h2 = new Buffer(b.prevout.hash, 'hex');
|
|
var res = utils.cmp(h1, h2);
|
|
if (res !== 0)
|
|
return res;
|
|
return a.prevout.index - b.prevout.index;
|
|
});
|
|
|
|
this.outputs = this.outputs.slice().sort(function(a, b) {
|
|
var res = a.value.cmp(b.value);
|
|
if (res !== 0)
|
|
return res;
|
|
return utils.cmp(a.encode(), b.encode());
|
|
});
|
|
|
|
if (this.changeIndex !== -1) {
|
|
this.changeIndex = this.outputs.indexOf(changeOutput);
|
|
assert(this.changeIndex !== -1);
|
|
}
|
|
};
|
|
|
|
MTX.prototype.avoidFeeSniping = function avoidFeeSniping(height) {
|
|
if (height == null)
|
|
height = network.height;
|
|
|
|
if (height === -1)
|
|
height = 0;
|
|
|
|
if ((Math.random() * 10 | 0) === 0)
|
|
this.setLocktime(Math.max(0, height - (Math.random() * 100 | 0)));
|
|
else
|
|
this.setLocktime(height);
|
|
};
|
|
|
|
MTX.prototype.setLocktime = function setLocktime(locktime) {
|
|
var i, input;
|
|
|
|
for (i = 0; i < this.inputs.length; i++) {
|
|
input = this.inputs[i];
|
|
if (input.sequence === 0xffffffff)
|
|
input.sequence = 0xffffffff - 1;
|
|
}
|
|
|
|
this.locktime = locktime;
|
|
};
|
|
|
|
MTX._fromJSON = bcoin.tx._fromJSON;
|
|
|
|
MTX.fromJSON = function fromJSON(json) {
|
|
return new MTX(MTX._fromJSON(json));
|
|
};
|
|
|
|
MTX._fromRaw = bcoin.tx._fromRaw;
|
|
|
|
MTX.fromRaw = function fromRaw(data, enc) {
|
|
return new MTX(MTX._fromRaw(data, enc));
|
|
};
|
|
|
|
MTX._fromExtended = bcoin.tx._fromExtended;
|
|
|
|
MTX.fromExtended = function fromExtended(data, enc) {
|
|
return new MTX(MTX._fromExtended(data, enc));
|
|
};
|
|
|
|
MTX.fromTX = function fromTX(tx) {
|
|
return new MTX(tx);
|
|
};
|
|
|
|
MTX.prototype.toTX = function toTX() {
|
|
return new bcoin.tx(this);
|
|
};
|
|
|
|
MTX.isMTX = function isMTX(obj) {
|
|
return obj
|
|
&& Array.isArray(obj.inputs)
|
|
&& typeof obj.ps === 'number'
|
|
&& typeof obj.changeIndex === 'number'
|
|
&& typeof obj.scriptInput === 'function';
|
|
};
|
|
|
|
/**
|
|
* Expose
|
|
*/
|
|
|
|
module.exports = MTX;
|