fcoin/lib/bcoin/tx.js
2016-01-17 19:57:34 -08:00

1399 lines
32 KiB
JavaScript

/**
* tx.js - transaction object for bcoin
* Copyright (c) 2014-2015, Fedor Indutny (MIT License)
* https://github.com/indutny/bcoin
*/
var bn = require('bn.js');
var bcoin = require('../bcoin');
var utils = bcoin.utils;
var assert = utils.assert;
var constants = bcoin.protocol.constants;
/**
* TX
*/
function TX(data, block) {
if (!(this instanceof TX))
return new TX(data, block);
this.type = 'tx';
if (!data)
data = {};
this.version = data.version || 1;
this.inputs = [];
this.outputs = [];
this.lock = data.lock || 0;
this.ts = data.ts || 0;
this.block = null;
this._hash = null;
this._raw = data._raw || null;
this._size = data._size || 0;
this.network = data.network || false;
this.relayedBy = data.relayedBy || '0.0.0.0';
this._chain = data.chain;
this._lock = this.lock;
if (data.inputs) {
data.inputs.forEach(function(input) {
this.input(input, null);
}, this);
}
if (data.outputs) {
data.outputs.forEach(function(out) {
this.out(out, null);
}, this);
}
if (block && block.subtype === 'merkleblock') {
if (!data.ts && block && block.hasTX(this.hash('hex'))) {
this.ts = block.ts;
this.block = block.hash('hex');
}
}
this.hardFee = data.hardFee || null;
this.changeAddress = data.changeAddress || null;
this.changeIndex = data.changeIndex != null ? data.changeIndex : -1;
// ps = Pending Since
this.ps = this.ts === 0 ? utils.now() : 0;
}
TX.prototype.clone = function clone() {
return new TX(this);
};
TX.prototype.hash = function hash(enc, force) {
var h = utils.dsha256(this.render(force));
return enc === 'hex' ? utils.toHex(h) : h;
};
TX.prototype.render = function render(force) {
if (!force && this.network && this._raw)
return this._raw.slice();
return bcoin.protocol.framer.tx(this);
};
TX.prototype.size = function size() {
return this._size || this.render().length;
};
TX.prototype.input = function input(i, index) {
this._input(i, index);
return this;
};
TX.prototype._input = function _input(obj, index) {
var options, hash, input, ex, i;
if (obj instanceof TX)
options = { tx: obj, index: index };
else if (typeof obj === 'string' || utils.isBuffer(obj))
options = { hash: obj, index: index };
else
options = obj;
if (options.tx)
hash = options.tx.hash('hex');
else if (options.out)
hash = options.out.hash;
else
hash = options.hash;
if (typeof hash !== 'string')
hash = utils.toHex(hash);
input = bcoin.input({
tx: this,
out: {
tx: options.out ? options.out.tx : options.tx,
hash: hash,
index: options.out ? options.out.index : options.index
},
script: options.script,
seq: options.seq
});
// Try modifying existing input first
i = this._inputIndex(input.out.hash, input.out.index);
if (i !== -1) {
ex = this.inputs[i];
input.out.tx = input.out.tx || ex.out.tx;
input.seq = input.seq || ex.seq;
input.script = input.script.length ? input.script : ex.script;
this.inputs[i] = input;
} else {
this.inputs.push(input);
i = this.inputs.length - 1;
}
return i;
};
TX.prototype._inputIndex = function _inputIndex(hash, index) {
var i, ex;
if (hash instanceof TX)
hash = hash.hash('hex');
for (i = 0; i < this.inputs.length; i++) {
ex = this.inputs[i];
if (ex.out.hash === hash && ex.out.index === index)
return i;
}
return -1;
};
TX.prototype.scriptInput = function scriptInput(index, pub, redeem) {
var input, s, n, i;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
// Get the input
input = this.inputs[index];
assert(input);
// We should have previous outputs by now.
assert(input.out.tx);
// Already has a script template (at least)
if (input.script.length)
return;
// Get the previous output's subscript
s = input.out.tx.getSubscript(input.out.index);
// P2SH
if (bcoin.script.isScripthash(s)) {
assert(redeem);
s = bcoin.script.subscript(bcoin.script.decode(redeem));
} else {
redeem = null;
}
if (bcoin.script.isPubkey(s)) {
// P2PK
input.script = [ [] ];
} else if (bcoin.script.isPubkeyhash(s)) {
// P2PKH
input.script = [ [], pub ];
} else if (bcoin.script.isMultisig(s)) {
// Multisig
// Technically we should create m signature slots,
// but we create n signature slots so we can order
// the signatures properly.
input.script = [ [] ];
// Grab `n` value (number of keys).
n = s[s.length - 2];
// Fill script with `n` signature slots.
for (i = 0; i < n; i++)
input.script[i + 1] = [];
} else {
// Likely a non-standard scripthash multisig
// input. Just set up the empty array. Also,
// only allow nonstandard types for scripthash.
if (redeem)
input.script = [ [] ];
}
// P2SH requires the redeem script after signatures
if (redeem) {
input.script.push(redeem);
// The fee can be calculated more accurately
// now that the redeem script is available.
this._recalculateFee();
}
};
TX.prototype.signature = function signature(index, key, type) {
var input, s, hash, signature;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
if (type == null)
type = 'all';
if (typeof type === 'string')
type = constants.hashType[type];
// Get the input
input = this.inputs[index];
assert(input);
// We should have previous outputs by now.
assert(input.out.tx);
// Get the previous output's subscript
s = input.out.tx.getSubscript(input.out.index);
// We need to grab the redeem script when
// signing p2sh transactions.
if (bcoin.script.isScripthash(s)) {
s = bcoin.script.decode(input.script[input.script.length - 1]);
s = bcoin.script.subscript(s);
}
// Get the hash of the current tx, minus the other
// inputs, plus the sighash type.
hash = this.signatureHash(index, s, type);
// Sign the transaction with our one input
signature = bcoin.script.sign(hash, key);
// Something is broken if this doesn't work:
assert(bcoin.script.checksig(hash, signature, key));
// Add the sighash as a single byte to the signature
signature = signature.concat(type);
return signature;
};
// Sign the now-built scriptSigs
TX.prototype.signInput = function signInput(index, key, type) {
var input, s, hash, signature;
var len, m, n, keys, pub, pkh, ki, signatures, i;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
// Get the input
input = this.inputs[index];
assert(input);
// We should have previous outputs by now.
assert(input.out.tx);
// Create our signature.
signature = this.signature(index, key, type);
// Get the previous output's subscript
s = input.out.tx.getSubscript(input.out.index);
// Script length, needed for multisig
len = input.script.length;
// We need to grab the redeem script when
// signing p2sh transactions.
if (bcoin.script.isScripthash(s)) {
s = bcoin.script.decode(input.script[input.script.length - 1]);
s = bcoin.script.subscript(s);
// Decrement `len` to avoid the redeem script
len--;
}
// Get pubkey and pubkey hash.
pub = key.getPublic(true, 'array');
pkh = bcoin.wallet.key2hash(pub);
// Add signatures.
if (bcoin.script.isPubkey(s)) {
// P2PK
// Something is wrong. Abort.
if (!Array.isArray(input.script[0]))
return false;
// Already signed.
if (input.script[0].length)
return true;
// Make sure the pubkey is ours.
if (!utils.isEqual(pub, s[0]))
return false;
input.script[0] = signature;
return true;
}
if (bcoin.script.isPubkeyhash(s)) {
// P2PKH
// Something is wrong. Abort.
if (!Array.isArray(input.script[0]))
return false;
// Already signed.
if (input.script[0].length)
return true;
// Make sure the pubkey hash is ours.
if (!utils.isEqual(pkh, s[2]))
return false;
input.script[0] = signature;
return true;
}
if (bcoin.script.isMultisig(s)) {
// Multisig
// Grab the redeem script's keys to figure
// out where our key should go.
keys = s.slice(1, -2);
// Grab `m` value (number of sigs required).
m = s[0];
// Grab `n` value (number of keys).
n = s[s.length - 2];
} else {
// Only allow non-standard signing for
// scripthash.
if (len !== input.script.length - 1)
return false;
keys = [];
for (i = 0; i < s.length; i++) {
if (bcoin.script.isKey(s[i]))
keys.push(s[i]);
}
n = keys.length;
m = n;
}
// Something is very wrong here. Abort.
if (len - 1 > n)
return false;
// Count the number of current signatures.
signatures = 0;
for (i = 1; i < len; i++) {
if (bcoin.script.isSignature(input.script[i]))
signatures++;
}
// Signatures are already finalized.
if (signatures === m && len - 1 === m)
return true;
// This can happen in a case where another
// implementation adds signatures willy-nilly
// or by `m`. Add some signature slots for
// us to use.
while (len - 1 < n) {
input.script.splice(len, 0, []);
len++;
}
// Find the key index so we can place
// the signature in the same index.
for (ki = 0; ki < keys.length; ki++) {
if (utils.isEqual(pub, keys[ki]))
break;
}
// Our public key is not in the prev_out
// script. We tried to sign a transaction
// that is not redeemable by us.
if (ki === keys.length)
return false;
// Offset key index by one to turn it into
// "sig index". Accounts for OP_0 byte at
// the start.
ki++;
// Add our signature to the correct slot
// and increment the total number of
// signatures.
if (ki < len && signatures < m) {
if (bcoin.script.isEmpty(input.script[ki])) {
input.script[ki] = signature;
signatures++;
}
}
// All signatures added. Finalize.
if (signatures >= m) {
// Remove empty slots left over.
for (i = len - 1; i >= 1; i--) {
if (bcoin.script.isEmpty(input.script[i])) {
input.script.splice(i, 1);
len--;
}
}
// Remove signatures which are not required.
// This should never happen except when dealing
// with implementations that potentially handle
// signature slots differently.
while (signatures > m) {
input.script.splice(len - 1, 1);
signatures--;
len--;
}
// Sanity checks.
assert.equal(signatures, m);
assert.equal(len - 1, m);
}
return signatures === m;
};
TX.prototype.scriptSig = function scriptSig(index, key, pub, redeem, type) {
var input;
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
// Get the input
input = this.inputs[index];
assert(input);
// Build script for input
this.scriptInput(index, pub, redeem);
// Sign input
this.signInput(index, key, type);
return input.script;
};
TX.prototype.output = function output(obj, value) {
var options, output;
if (obj instanceof bcoin.wallet)
obj = obj.getAddress();
if (typeof obj === 'string') {
options = {
address: obj,
value: value
};
} else {
options = obj;
}
output = bcoin.output({
tx: this,
value: options.value,
script: options.script
});
this.outputs.push(output);
this.scriptOutput(this.outputs.length - 1, options);
return this;
};
TX.prototype.out = TX.prototype.output;
TX.prototype.scriptOutput = function scriptOutput(index, options) {
var output, script, keys, m, n, hash, flags;
if (typeof index !== 'number')
index = this.outputs.indexOf(index);
output = this.outputs[index];
assert(output);
if (!options)
options = output;
script = output.script;
if (options instanceof bcoin.output) {
options = Object.keys(options).reduce(function(out, key) {
out[key] = options[key];
return out;
}, {});
}
if (options.addr) {
options.address = options.addr;
delete options.addr;
}
if (Array.isArray(options.address)) {
options.keys = options.address.map(function(address) {
return bcoin.wallet.addr2hash(address, 'pubkeyhash');
});
delete options.address;
}
if (options.minSignatures) {
options.m = options.minSignatures;
delete options.minSignatures;
}
if (options.color) {
options.flags = options.color;
delete options.color;
}
if (Array.isArray(options.keys)) {
// Bare Multisig Transaction
// https://github.com/bitcoin/bips/blob/master/bip-0010.mediawiki
// https://github.com/bitcoin/bips/blob/master/bip-0011.mediawiki
// https://github.com/bitcoin/bips/blob/master/bip-0019.mediawiki
// m [key1] [key2] ... n checkmultisig
keys = options.keys.map(utils.toBuffer);
m = options.m || keys.length;
n = options.n || keys.length;
if (!(m >= 1 && m <= n))
return;
if (!(n >= 1 && n <= (options.scripthash ? 15 : 3)))
return;
script = bcoin.script.createMultisig(keys, m, n);
} else if (bcoin.wallet.validateAddress(options.address, 'scripthash')) {
// P2SH Transaction
// https://github.com/bitcoin/bips/blob/master/bip-0016.mediawiki
// hash160 [20-byte-redeemscript-hash] equal
script = [
'hash160',
bcoin.wallet.addr2hash(options.address, 'scripthash'),
'equal'
];
} else if (options.address) {
// P2PKH Transaction
// dup hash160 [pubkey-hash] equalverify checksig
script = [
'dup',
'hash160',
bcoin.wallet.addr2hash(options.address, 'pubkeyhash'),
'equalverify',
'checksig'
];
} else if (options.key) {
// P2PK Transaction
// [pubkey] checksig
script = [
utils.toBuffer(options.key),
'checksig'
];
} else if (options.flags) {
// Nulldata Transaction
// return [data]
flags = options.flags;
if (typeof flags === 'string')
flags = utils.ascii2array(flags);
assert(utils.isBuffer(flags));
assert(flags.length <= constants.script.maxOpReturn);
script = [
'return',
flags
];
}
// P2SH Transaction
// hash160 [hash] eq
if (options.scripthash) {
if (options.lock != null) {
script = [
bcoin.script.array(options.lock),
'checklocktimeverify',
'drop',
'codeseparator'
].concat(script);
}
hash = utils.ripesha(bcoin.script.encode(script));
script = [
'hash160',
hash,
'equal'
];
}
output.script = script;
};
TX.prototype.getSubscript = function getSubscript(index) {
var script = this.outputs[index].script;
return bcoin.script.subscript(script);
};
TX.prototype.signatureHash = function signatureHash(index, s, type) {
var copy = this.clone();
var i, msg, hash;
if (!Array.isArray(s)) {
type = s;
s = this.inputs[index].out.tx.getSubscript(this.inputs[index].out.index);
if (bcoin.script.isScripthash(s)) {
s = this.inputs[index].script[this.inputs[index.script.length - 1]];
s = bcoin.script.subscript(bcoin.script.decode(s));
}
}
if (typeof index !== 'number')
index = this.inputs.indexOf(index);
if (typeof type === 'string')
type = constants.hashType[type];
assert(index >= 0 && index < copy.inputs.length)
assert(Array.isArray(s));
assert(utils.isFinite(type));
// Remove code separators.
// s = script.subscript(s);
// Remove all signatures.
for (i = 0; i < copy.inputs.length; i++)
copy.inputs[i].script = [];
// Set our input to previous output's script
copy.inputs[index].script = s;
if ((type & 0x1f) === constants.hashType.none) {
// Drop all outputs. We don't want to sign them.
copy.outputs = [];
// Allow input sequence updates for other inputs.
for (i = 0; i < copy.inputs.length; i++) {
if (i !== index)
copy.inputs[i].seq = 0;
}
} else if ((type & 0x1f) === constants.hashType.single) {
// Bitcoind used to return 1 as an error code:
// it ended up being treated like a hash.
if (index >= copy.outputs.length)
return constants.oneHash.slice();
// Drop all the outputs after the input index.
copy.outputs.length = index + 1;
// Null outputs that are not the at current input index.
for (i = 0; i < copy.outputs.length; i++) {
if (i !== index) {
copy.outputs[i].script = [];
copy.outputs[i].value = new bn('ffffffffffffffff', 'hex');
}
}
// Allow input sequence updates for other inputs.
for (i = 0; i < copy.inputs.length; i++) {
if (i !== index)
copy.inputs[i].seq = 0;
}
}
// Only sign our input. Allows anyone to add inputs.
if (type & constants.hashType.anyonecanpay) {
copy.inputs[0] = copy.inputs[index];
copy.inputs.length = 1;
}
msg = copy.render(true);
utils.writeU32(msg, type, msg.length);
hash = utils.dsha256(msg);
return hash;
};
TX.prototype.tbsHash = function tbsHash(enc, force) {
var copy = this.clone();
var i;
if (this.isCoinbase())
return this.hash(enc);
if (!this._tbsHash || force) {
for (i = 0; i < copy.inputs.length; i++)
copy.inputs[i].script = [];
this._tbsHash = utils.dsha256(copy.render(true));
}
return enc === 'hex'
? utils.toHex(this._tbsHash)
: this._tbsHash.slice();
};
TX.prototype.verify = function verify(index, force, flags) {
// Valid if included in block
if (!force && this.ts !== 0)
return true;
if (this.inputs.length === 0)
return false;
return this.inputs.every(function(input, i) {
var output;
if (index != null && index !== i)
return true;
if (!input.out.tx)
return false;
// Somethis is very wrong if this is
// not the case.
assert.equal(input.out.tx.hash('hex'), input.out.hash);
// Grab the previous output.
output = input.out.tx.outputs[input.out.index];
// Transaction is referencing an output
// that does not exist.
if (!output)
return false;
// Transaction cannot reference itself.
if (input.out.hash === this.hash('hex'))
return false;
return bcoin.script.verify(input.script, output.script, this, i, flags);
}, this);
};
TX.prototype.isCoinbase = function isCoinbase() {
return this.inputs.length === 1 && +this.inputs[0].out.hash === 0;
};
TX.prototype.maxSize = function maxSize() {
var copy = this.clone();
var i, input, total, size, s, m, n;
// Create copy with 0-script inputs
for (i = 0; i < copy.inputs.length; i++)
copy.inputs[i].script = [];
total = copy.render().length;
// Add size for signatures and public keys
for (i = 0; i < copy.inputs.length; i++) {
input = copy.inputs[i];
size = 0;
// Get the previous output's subscript
s = input.out.tx.getSubscript(input.out.index);
// If we have access to the redeem script,
// we can use it to calculate size much easier.
if (this.inputs[i].script.length && bcoin.script.isScripthash(s)) {
s = this.inputs[i].script[this.inputs[i].script.length - 1];
// Need to add the redeem script size
// here since it will be ignored by
// the isMultisig clause.
// OP_PUSHDATA2 [redeem]
size += 3 + s.length;
s = bcoin.script.subscript(bcoin.script.decode(s));
}
if (bcoin.script.isPubkey(s)) {
// P2PK
// OP_PUSHDATA0 [signature]
size += 1 + 73;
} else if (bcoin.script.isPubkeyhash(s)) {
// P2PKH
// OP_PUSHDATA0 [signature]
size += 1 + 73;
// OP_PUSHDATA0 [key]
size += 1 + 65;
} else if (bcoin.script.isMultisig(s)) {
// Bare Multisig
// Get the previous m value:
m = s[0];
// OP_0
size += 1;
// OP_PUSHDATA0 [signature] ...
size += (1 + 73) * m;
} else if (bcoin.script.isScripthash(s)) {
// P2SH Multisig
// This technically won't work well for other
// kinds of P2SH. It will also over-estimate
// the fee by a lot (at least 10000 satoshis
// since we don't have access to the m and n
// values), which will be recalculated later.
// If fee turns out to be smaller later, we
// simply add more of the fee to the change
// output.
// m value
m = 15;
// n value
n = 15;
// OP_0
size += 1;
// OP_PUSHDATA0 [signature] ...
size += (1 + 73) * m;
// OP_PUSHDATA2 [redeem]
size += 3;
// m value
size += 1;
// OP_PUSHDATA0 [key] ...
size += (1 + 65) * n;
// n value
size += 1;
// OP_CHECKMULTISIG
size += 1;
}
// Byte for varint size of input script
if (size < 0xfd)
size += 0;
else if (size <= 0xffff)
size += 2;
else if (size <= 0xffffffff)
size += 4;
else
size += 8;
total += size;
}
return total;
};
TX.prototype.getUnspent = function getUnspent(unspent, address, fee) {
var tx = this.clone();
var cost = tx.funds('out');
var totalkb = 1;
var total = cost.addn(constants.tx.fee);
var inputs = [];
var lastAdded = 0;
var size, newkb, change;
if (fee) {
total = cost.add(fee);
this.hardFee = fee;
}
function addInput(unspent) {
// Add new inputs until TX will have enough
// funds to cover both minimum post cost
// and fee.
var index = tx._input(unspent);
inputs.push(tx.inputs[index]);
lastAdded++;
return tx.funds('in').cmp(total) < 0;
}
// Transfer `total` funds maximum.
unspent.every(addInput);
if (!fee) {
// Add dummy output (for `change`) to
// calculate maximum TX size.
tx.output({
address: address,
value: new bn(0)
});
// Change fee value if it is more than 1024
// bytes (10000 satoshi for every 1024 bytes).
do {
// Calculate max possible size after signing.
size = tx.maxSize();
newkb = Math.ceil(size / 1024) - totalkb;
total.iaddn(newkb * constants.tx.fee);
totalkb += newkb;
// Failed to get enough funds, add more inputs.
if (tx.funds('in').cmp(total) < 0)
unspent.slice(lastAdded).every(addInput);
} while (tx.funds('in').cmp(total) < 0 && lastAdded < unspent.length);
}
if (tx.funds('in').cmp(total) < 0) {
// Still failing to get enough funds.
inputs = null;
} else {
// How much money is left after filling outputs.
change = tx.funds('in').sub(total);
}
// Return necessary inputs and change.
return {
inputs: inputs,
change: change,
cost: cost,
fee: total.sub(cost),
total: total,
kb: totalkb
};
};
TX.prototype.fillUnspent = function fillUnspent(unspent, address, fee) {
var result;
if (address)
this.changeAddress = address;
if (fee)
this.hardFee = fee;
assert(this.changeAddress);
result = this.getUnspent(unspent, this.changeAddress, this.hardFee);
if (!result.inputs)
return result;
result.inputs.forEach(function(input) {
this.input(input);
}, this);
if (result.change.cmpn(constants.tx.dust) < 0) {
// Do nothing. Change is added to fee.
assert.equal(
this.getFee().toNumber(),
result.fee.add(result.change).toNumber()
);
this.changeIndex = -1;
} else {
this.output({
address: this.changeAddress,
value: result.change
});
this.changeIndex = this.outputs.length - 1;
}
return result;
};
TX.prototype._recalculateFee = function recalculateFee() {
var output = this.outputs[this.changeIndex];
var size, real, fee;
if (this.hardFee)
return;
if (!output) {
this.output({
address: this.changeAddress,
value: new bn(0)
});
output = this.outputs[this.outputs.length - 1];
}
size = this.maxSize();
real = Math.ceil(size / 1024) * constants.tx.fee;
fee = this.getFee().toNumber();
if (real === fee) {
if (this.changeIndex === -1)
this.outputs.pop();
return;
}
if (real > fee) {
if (output.value.cmpn(real - fee) < 0) {
this.outputs.pop();
this.changeIndex = -1;
return;
}
output.value.isubn(real - fee);
} else {
output.value.iaddn(fee - real);
}
if (output.value.cmpn(constants.tx.dust) < 0) {
this.outputs.pop();
this.changeIndex = -1;
return;
}
this.changeIndex = this.outputs.indexOf(output);
};
TX.prototype.getFee = function getFee() {
if (this.funds('in').cmp(this.funds('out')) < 0)
return new bn(0);
return this.funds('in').sub(this.funds('out'));
};
TX.prototype.funds = function funds(side) {
var acc = new bn(0);
var inputs;
if (side === 'in') {
inputs = this.inputs.filter(function(input) {
return input.out.tx;
});
if (inputs.length === 0)
return acc;
inputs.reduce(function(acc, input) {
return acc.iadd(input.out.tx.outputs[input.out.index].value);
}, acc);
return acc;
}
// Output
if (this.outputs.length === 0)
return acc;
this.outputs.reduce(function(acc, output) {
return acc.iadd(output.value);
}, acc);
return acc;
};
TX.prototype.full = function full() {
if (this.inputs.length === 0)
return false;
return this.inputs.every(function(input) {
return !!input.out.tx;
});
};
TX.prototype.fill = function fill(txs) {
var inputs;
if (txs instanceof bcoin.txPool)
txs = txs._all;
else if (txs instanceof bcoin.wallet)
txs = txs.tx._all;
if (Array.isArray(txs)) {
txs = txs.reduce(function(out, tx) {
out[tx.hash('hex')] = tx;
return out;
}, {});
}
inputs = this.inputs.filter(function(input) {
if (!input.out.tx && txs[input.out.hash])
input.out.tx = txs[input.out.hash];
return !!input.out.tx;
}, this);
return inputs.length === this.inputs.length;
};
// Used for verifyContext/ContextualBlockCheck and miner isFinalTx call.
// BIP113 will require that time-locked transactions have nLockTime set to
// less than the median time of the previous block they're contained in.
TX.prototype.isFinalBlock = function isFinalBlock(block, prev, useMedian) {
var height = prev.height + 1;
var ts = useMedian ? prev.getMedianTime() : block.ts;
return this.isFinal(height, ts);
};
// Used in AcceptToMemoryPool
TX.prototype.isFinalMempool = function isFinalMempool(useMedian) {
var height, ts;
if (!this.chain)
return true;
height = this.chain.height() + 1;
ts = useMedian
? this.chain.getTip().getMedianTime()
: utils.now();
return this.isFinal(height, ts);
};
// Used in the original bitcoind code for AcceptBlock
TX.prototype.isFinalLegacy = function isFinalLegacy(block) {
var ts, height;
if (!this.chain)
return true;
ts = block ? block.ts : utils.now();
height = this.chain.height();
return this.isFinal(height, ts);
};
TX.prototype.isFinal = function isFinal(height, ts) {
var threshold = constants.locktimeThreshold;
var i;
if (!this.chain)
return true;
if (this.lock === 0)
return true;
if (this.lock < (this.lock < threshold ? height : ts))
return true;
for (i = 0; i < this.inputs.length; i++) {
if (this.inputs[i].seq !== 0xffffffff)
return false;
}
return true;
};
TX.prototype.sigops = function sigops(scripthash, accurate) {
var n = 0;
this.inputs.forEach(function(input) {
n += bcoin.script.sigops(input.script, accurate);
if (scripthash && !this.isCoinbase())
n += bcoin.script.sigopsScripthash(input.script);
}, this);
this.outputs.forEach(function(output) {
n += bcoin.script.sigops(output.script, accurate);
}, this);
return n;
};
TX.prototype.isStandard = function isStandard() {
var i, input, output, type;
var nulldata = 0;
if (this.version > constants.tx.version || this.version < 1)
return false;
if (this.size() > constants.tx.maxSize)
return false;
for (i = 0; i < this.inputs.length; i++) {
input = this.inputs[i];
if (script.size(input.script) > 1650)
return false;
if (!bcoin.script.pushOnly(input.script))
return false;
}
for (i = 0; i < this.outputs.length; i++) {
output = this.outputs[i];
type = bcoin.script.standard(output.script);
if (!bcoin.script.isStandard(output.script))
return false;
if (!type)
return false;
if (type === 'nulldata') {
nulldata++;
continue;
}
if (type === 'multisig' && !constants.tx.bareMultisig)
return false;
if (output.value.cmpn(constants.tx.dust) < 0)
return false;
}
if (nulldata > 1)
return false;
return true;
};
TX.prototype.isStandardInputs = function isStandardInputs(flags) {
var i, input, prev, args, stack, res, s, targs;
if (this.isCoinbase())
return true;
for (i = 0; i < this.inputs.length; i++) {
input = this.inputs[i];
if (!input.out.tx)
return false;
prev = input.out.tx[input.out.index];
if (!prev)
return false;
args = bcoin.script.args(prev.script);
if (args < 0)
return false;
stack = [];
res = bcoin.script.execute(input.script, stack, this, i, flags);
if (!res)
return false;
if (bcoin.script.isScripthash(prev.script)) {
if (stack.length === 0)
return false;
s = stack[stack.length - 1];
if (!Array.isArray(s))
return false;
s = bcoin.script.subscript(bcoin.script.decode(s));
if (bcoin.script.standard(s)) {
targs = bcoin.script.args(s);
if (targs < 0)
return false;
args += targs;
} else {
return script.sigops(s, true) <= constants.script.maxScripthashSigops;
}
}
if (stack.length !== args)
return false;
}
return true;
};
TX.prototype.getHeight = function getHeight() {
if (!this.chain)
return -1;
return this.block ? this.chain.getHeight(this.block) : -1;
};
TX.prototype.getConfirmations = function getConfirmations() {
var top, height;
if (!this.chain)
return 0;
top = this.chain.height();
height = this.getHeight();
if (height === -1)
return 0;
return top - height + 1;
};
TX.prototype.__defineGetter__('chain', function() {
return this._chain || bcoin.chain.global;
});
TX.prototype.__defineGetter__('rblock', function() {
return this.block
? utils.revHex(this.block)
: null;
});
TX.prototype.__defineGetter__('rhash', function() {
return utils.revHex(this.hash('hex'));
});
TX.prototype.__defineGetter__('fee', function() {
return this.getFee();
});
TX.prototype.__defineGetter__('value', function() {
return this.funds('out');
});
TX.prototype.__defineGetter__('height', function() {
return this.getHeight();
});
TX.prototype.__defineGetter__('confirmations', function() {
return this.getConfirmations();
});
TX.prototype.inspect = function inspect() {
var copy = bcoin.tx(this);
copy.__proto__ = null;
if (this.block)
copy.block = this.block;
delete copy._raw;
delete copy._chain;
copy.hash = this.hash('hex');
copy.rhash = this.rhash;
copy.rblock = this.rblock;
copy.value = utils.btc(this.value);
copy.fee = utils.btc(this.fee);
copy.height = this.height;
copy.confirmations = this.confirmations;
copy.date = new Date((copy.ts || 0) * 1000).toISOString();
return copy;
};
TX.prototype.toJSON = function toJSON() {
// Compact representation
return {
v: '1',
type: 'tx',
ts: this.ts,
ps: this.ps,
block: this.block,
network: this.network,
relayedBy: this.relayedBy,
changeAddress: this.changeAddress,
changeIndex: this.changeIndex,
hardFee: this.hardFee ? utils.btc(this.hardFee) : null,
tx: utils.toHex(this.render())
};
};
TX.fromJSON = function fromJSON(json) {
var raw, data, tx;
assert.equal(json.v, 1);
assert.equal(json.type, 'tx');
raw = utils.toArray(json.tx, 'hex');
data = new bcoin.protocol.parser().parseTX(raw);
data.network = json.network;
data.relayedBy = json.relayedBy;
data.changeAddress = json.changeAddress;
data.changeIndex = json.changeIndex;
if (json.hardFee)
data.hardFee = utils.satoshi(json.hardFee);
data._raw = raw;
data._size = raw.length;
tx = new TX(data);
tx.ts = json.ts;
tx.block = json.block || null;
tx.ps = json.ps;
return tx;
};
TX.prototype.toRaw = function toRaw(enc) {
var raw = this.render();
if (enc === 'hex')
return utils.toHex(raw);
return raw;
};
TX.fromRaw = function fromRaw(raw, enc) {
if (enc === 'hex')
raw = utils.toArray(raw, 'hex');
return new bcoin.tx(new bcoin.protocol.parser().parseTX(raw));
};
/**
* Expose
*/
module.exports = TX;