fcoin/lib/bcoin/script.js
2016-01-12 02:08:07 -08:00

1668 lines
38 KiB
JavaScript

/**
* script.js - script interpreter for bcoin
* Copyright (c) 2014-2015, Fedor Indutny (MIT License)
* https://github.com/indutny/bcoin
*/
var bcoin = require('../bcoin');
var bn = require('bn.js');
var constants = bcoin.protocol.constants;
var utils = bcoin.utils;
var assert = bcoin.utils.assert;
var script = exports;
/**
* Script
*/
script.decode = function decode(s) {
if (!s)
return [];
var opcodes = [];
var i = 0;
var b, opcode, len;
while (i < s.length) {
b = s[i++];
// Next `b` bytes should be pushed to stack
if (b >= 0x01 && b <= 0x4b) {
opcodes.push(s.slice(i, i + b));
i += b;
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
opcode: null,
len: b
});
continue;
}
// Zero
if (b === 0) {
opcodes.push([]);
continue;
}
// Raw number (-1 and 1-16)
if (b === 0x4f || (b >= 0x51 && b <= 0x60)) {
opcodes.push(b - 0x50);
continue;
}
opcode = constants.opcodesByVal[b];
if (i >= s.length) {
opcodes.push(opcode || b);
continue;
}
if (opcode === 'pushdata1') {
len = s[i];
i += 1;
opcodes.push(s.slice(i, i + len));
i += len;
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
opcode: opcode,
len: len
});
} else if (opcode === 'pushdata2') {
len = utils.readU16(s, i);
i += 2;
opcodes.push(s.slice(i, i + len));
i += len;
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
opcode: opcode,
len: len
});
} else if (opcode === 'pushdata4') {
len = utils.readU32(s, i);
i += 4;
opcodes.push(s.slice(i, i + len));
i += len;
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
opcode: opcode,
len: len
});
} else {
opcodes.push(opcode || b);
}
}
utils.hidden(opcodes, '_raw', s);
return opcodes;
};
script.encode = function encode(s) {
if (!s)
return [];
var opcodes = constants.opcodes;
var res = [];
var i = 0;
var instr;
for (i = 0; i < s.length; i++) {
instr = s[i];
// Push value to stack
if (Array.isArray(instr)) {
// Check for nonstandard pushdatas that
// may have been decoded from before.
if (instr.pushdata) {
if (instr.pushdata.opcode === null) {
res = res.concat(instr.pushdata.len, instr);
} else if (instr.pushdata.opcode === 'pushdata1') {
res = res.concat(opcodes.pushdata1, instr.pushdata.len, instr);
} else if (instr.pushdata.opcode === 'pushdata2') {
res.push(opcodes.pushdata2);
utils.writeU16(res, instr.pushdata.len, res.length);
res = res.concat(instr);
} else if (instr.pushdata.opcode === 'pushdata4') {
res.push(opcodes.pushdata4);
utils.writeU32(res, instr.pushdata.len, res.length);
res = res.concat(instr);
}
continue;
}
if (instr.length === 0) {
// OP_FALSE
res.push(0);
} else if (1 <= instr.length && instr.length <= 0x4b) {
res = res.concat(instr.length, instr);
} else if (instr.length <= 0xff) {
res = res.concat(opcodes.pushdata1, instr.length, instr);
} else if (instr.length <= 0xffff) {
res.push(opcodes.pushdata2);
utils.writeU16(res, instr.length, res.length);
res = res.concat(instr);
} else {
res.push(opcodes.pushdata4);
utils.writeU32(res, instr.length, res.length);
res = res.concat(instr);
}
continue;
}
res.push(opcodes[instr] || instr);
}
return res;
};
script.verify = function verify(input, output, tx, i, flags) {
var copy, res, redeem;
var stack = [];
if (!flags)
flags = {};
// Execute the input script
script.execute(input, stack, tx, i, flags);
// Copy the stack for P2SH
if (flags.verifyp2sh !== false)
copy = stack.slice();
// Execute the previous output script
res = script.execute(output, stack, tx, i, flags);
// Verify the script did not fail as well as the stack values
if (!res || stack.length === 0 || new bn(stack.pop()).cmpn(0) === 0)
return false;
// If the script is P2SH, execute the real output script
if (flags.verifyp2sh !== false && script.isScripthash(output)) {
// P2SH can only have push ops in the scriptSig
if (!script.pushOnly(input))
return false;
// Reset the stack
stack = copy;
// Stack should _never_ be empty at this point
assert(stack.length !== 0);
// Grab the real redeem script
redeem = stack.pop();
if (!Array.isArray(redeem))
return false;
redeem = script.decode(redeem);
// Execute the redeem script
res = script.execute(redeem, stack, tx, i, flags);
// Verify the script did not fail as well as the stack values
if (!res || stack.length === 0 || new bn(stack.pop()).cmpn(0) === 0)
return false;
}
// Ensure there is nothing left on the stack
if (flags.cleanstack !== false) {
if (stack.length !== 0)
return false;
}
return true;
};
script.subscript = function subscript(s, lastSep) {
var i, res;
if (!s)
return [];
if (lastSep == null) {
lastSep = -1;
for (i = 0; i < s.length; i++) {
if (s[i] === 'checksig'
|| s[i] === 'checksigverify'
|| s[i] === 'checkmultisig'
|| s[i] === 'checkmultisigverify') {
break;
}
if (s[i] === 'codesep')
lastSep = i;
}
}
res = [];
for (i = lastSep + 1; i < s.length; i++) {
if (s[i] !== 'codesep')
res.push(s[i]);
}
return res;
};
script.checksig = function checksig(hash, sig, pub) {
var k;
try {
k = bcoin.ecdsa.keyPair({ pub: pub });
} catch (e) {
return false;
}
// Points at Infinity make verify() throw.
// This specifically throws on wallet-test.js
// where [1] is concatted to the pubkey.
if (k.getPublic().isInfinity())
return false;
// Use a try catch in case there are
// any uncaught errors for bad inputs in verify().
try {
return bcoin.ecdsa.verify(hash, sig, pub);
} catch (e) {
return false;
}
};
script._next = function _next(to, s, pc) {
var depth = 0;
var o;
while (s[pc]) {
o = s[pc];
if (o === 'if_' || o === 'notif')
depth++;
else if (o === 'else_')
depth--;
else if (o === 'endif')
depth--;
if (depth < 0)
break;
if (depth === 0 && o === to)
return pc;
if (o === 'else_')
depth++;
pc++;
}
return -1;
};
script.execute = function execute(s, stack, tx, index, flags, recurse) {
s = s.slice();
if (!flags)
flags = {};
if (s.length > constants.script.maxOps)
return false;
var lastSep = -1;
var pc = 0;
var o, val;
var if_, else_, endif;
var v, v1, v2, v3, v4;
var n, n1, n2, n3;
var res;
var key, sig, type, subscript, hash;
var keys, i, j, m;
var succ;
var lock, threshold;
var evalScript;
stack.alt = stack.alt || [];
for (pc = 0; pc < s.length; pc++) {
o = s[pc];
if (Array.isArray(o)) {
if (o.length > constants.script.maxPush)
return false;
stack.push(o);
continue;
}
if (o === -1 || (o >= 1 && o <= 16)) {
stack.push([o]);
continue;
}
switch (o) {
case 'nop':
case 'nop3':
case 'nop4':
case 'nop5':
case 'nop6':
case 'nop7':
case 'nop8':
case 'nop9':
case 'nop10': {
break;
}
case 'if_':
case 'notif': {
val = false;
if (stack.length < 1)
return false;
v = stack.pop();
val = new bn(v).cmpn(0) !== 0;
if (o === 'notif')
val = !val;
if_ = pc;
else_ = script._next('else_', s, pc);
endif = script._next('endif', s, pc);
// Splice out the statement blocks we don't need
if (val) {
if (endif === -1)
return false;
if (else_ === -1) {
s.splice(endif, 1);
s.splice(if_, 1);
} else {
s.splice(else_, (endif - else_) + 1);
s.splice(if_, 1);
}
} else {
if (endif === -1)
return false;
if (else_ === -1) {
s.splice(if_, (endif - if_) + 1);
} else {
s.splice(endif, 1);
s.splice(if_, (else_ - if_) + 1);
}
}
// Subtract one since we removed the if/notif opcode
pc--;
break;
}
case 'else_': {
return false;
}
case 'endif': {
return false;
}
case 'verify': {
if (stack.length === 0)
return false;
if (new bn(stack.pop()).cmpn(0) === 0)
return false;
break;
}
case 'ret': {
return false;
}
case 'toaltstack': {
if (stack.length === 0)
return false;
stack.alt.push(stack.pop());
break;
}
case 'fromaltstack': {
if (stack.alt.length === 0)
return false;
stack.push(stack.alt.pop());
break;
}
case 'ifdup': {
if (stack.length === 0)
return false;
if (new bn(stack[stack.length - 1]).cmpn(0) !== 0)
stack.push(new bn(stack[stack.length - 1]).toArray());
break;
}
case 'depth': {
stack.push(new bn(stack.length).toArray());
break;
}
case 'drop': {
if (stack.length === 0)
return false;
stack.pop();
break;
}
case 'dup': {
if (stack.length === 0)
return false;
stack.push(stack[stack.length - 1]);
break;
}
case 'nip': {
if (stack.length < 2)
return false;
stack.splice(stack.length - 2, 1);
break;
}
case 'over': {
if (stack.length < 2)
return false;
stack.push(stack[stack.length - 2]);
break;
}
case 'pick':
case 'roll': {
if (stack.length < 2)
return false;
v = stack.pop();
if (v.length > 6)
return false;
n = new bn(v).toNumber();
if (n < 0 || n >= stack.length)
return false;
v = stack[-n - 1];
if (o === 'roll')
stack.splice(stack.length - n - 1, 1);
stack.push(v);
break;
}
case 'rot': {
if (stack.length < 3)
return false;
v3 = stack[stack.length - 3];
v2 = stack[stack.length - 2];
v1 = stack[stack.length - 1];
stack[stack.length - 3] = v2;
stack[stack.length - 2] = v3;
v2 = stack[stack.length - 2];
stack[stack.length - 2] = v1;
stack[stack.length - 1] = v2;
break;
}
case 'swap': {
if (stack.length < 2)
return false;
v2 = stack[stack.length - 2];
v1 = stack[stack.length - 1];
stack[stack.length - 2] = v1;
stack[stack.length - 1] = v2;
break;
}
case 'tuck': {
if (stack.length < 2)
return false;
stack.splice(stack.length - 2, 0, stack[stack.length - 1]);
break;
}
case 'drop2': {
if (stack.length < 2)
return false;
stack.pop();
stack.pop();
break;
}
case 'dup2': {
if (stack.length < 2)
return false;
v1 = stack[stack.length - 1];
v2 = stack[stack.length - 2];
stack.push(v1);
stack.push(v2);
break;
}
case 'dup3': {
if (stack.length < 3)
return false;
v1 = stack[stack.length - 1];
v2 = stack[stack.length - 2];
v3 = stack[stack.length - 3];
stack.push(v1);
stack.push(v2);
stack.push(v3);
break;
}
case 'over2': {
if (stack.length < 4)
return false;
v1 = stack[stack.length - 4];
v2 = stack[stack.length - 3];
stack.push(v1);
stack.push(v2);
break;
}
case 'rot2': {
if (stack.length < 6)
return false;
v1 = stack[stack.length - 6];
v2 = stack[stack.length - 5];
stack.splice(stack.length - 6, 2);
stack.push(v1);
stack.push(v2);
break;
}
case 'swap2': {
if (stack.length < 4)
return false;
v4 = stack[stack.length - 4];
v3 = stack[stack.length - 3];
v2 = stack[stack.length - 2];
v1 = stack[stack.length - 1];
stack[stack.length - 4] = v2;
stack[stack.length - 2] = v4;
stack[stack.length - 3] = v1;
stack[stack.length - 1] = v3;
break;
}
case 'size': {
if (stack.length < 1)
return false;
stack.push(new bn(stack[stack.length - 1].length || 0).toArray());
break;
}
case 'add1':
case 'sub1':
case 'negate':
case 'abs':
case 'not':
case 'noteq0': {
if (stack.length < 1)
return false;
n = new bn(stack.pop());
switch (o) {
case 'add1':
n.iadd(1);
break;
case 'sub1':
n.isub(1);
break;
case 'negate':
n = n.neg();
break;
case 'abs':
if (n.cmpn(0) < 0)
n = n.neg();
break;
case 'not':
n = n.cmpn(0) === 0;
break;
case 'noteq0':
n = n.cmpn(0) !== 0;
break;
default:
return false;
}
if (typeof n === 'boolean')
n = new bn(+n);
stack.push(n.toArray());
break;
}
case 'add':
case 'sub':
case 'booland':
case 'boolor':
case 'numeq':
case 'numeqverify':
case 'numneq':
case 'lt':
case 'gt':
case 'lte':
case 'gte':
case 'min':
case 'max': {
switch (o) {
case 'add':
case 'sub':
case 'booland':
case 'boolor':
case 'numeq':
case 'numeqverify':
case 'numneq':
case 'lt':
case 'gt':
case 'lte':
case 'gte':
case 'min':
case 'max':
if (stack.length < 2)
return false;
n2 = new bn(stack.pop());
n1 = new bn(stack.pop());
n = new bn(0);
switch (o) {
case 'add':
n = n1.add(n2);
break;
case 'sub':
n = n1.sub(n2);
break;
case 'booland':
n = n1.cmpn(0) !== 0 && n2.cmpn(0) !== 0;
break;
case 'boolor':
n = n1.cmpn(0) !== 0 || n2.cmpn(0) !== 0;
break;
case 'numeq':
n = n1.cmp(n2) === 0;
break;
case 'numeqverify':
n = n1.cmp(n2) === 0;
break;
case 'numneq':
n = n1.cmp(n2) !== 0;
break;
case 'lt':
n = n1.cmp(n2) < 0;
break;
case 'gt':
n = n1.cmp(n2) > 0;
break;
case 'lte':
n = n1.cmp(n2) <= 0;
break;
case 'gte':
n = n1.cmp(n2) >= 0;
break;
case 'min':
n = n1.cmp(n2) < 0 ? n1 : n2;
break;
case 'max':
n = n1.cmp(n2) > 0 ? n1 : n2;
break;
default:
return false;
}
if (typeof n === 'boolean')
n = new bn(+n);
res = n.cmpn(0) !== 0;
if (o === 'numeqverify') {
if (!res)
return false;
} else {
stack.push(n.toArray());
}
break;
case 'within':
if (stack.length < 3)
return false;
n3 = new bn(stack.pop());
n2 = new bn(stack.pop());
n1 = new bn(stack.pop());
val = n2.cmp(n1) <= 0 && n1.cmp(n3) < 0;
stack.push(val.cmpn(0) !== 0 ? [ 1 ] : []);
break;
}
break;
}
case 'codesep': {
lastSep = pc;
break;
}
case 'ripemd160': {
if (stack.length === 0)
return false;
stack.push(utils.ripemd160(stack.pop()));
break;
}
case 'sha1': {
if (stack.length === 0)
return false;
stack.push(utils.sha1(stack.pop()));
break;
}
case 'sha256': {
if (stack.length === 0)
return false;
stack.push(utils.sha256(stack.pop()));
break;
}
case 'hash256': {
if (stack.length === 0)
return false;
stack.push(utils.dsha256(stack.pop()));
break;
}
case 'hash160': {
if (stack.length === 0)
return false;
stack.push(utils.ripesha(stack.pop()));
break;
}
case 'eqverify':
case 'eq': {
if (stack.length < 2)
return false;
res = utils.isEqual(stack.pop(), stack.pop());
if (o === 'eqverify') {
if (!res)
return false;
} else {
stack.push(res ? [ 1 ] : []);
}
break;
}
case 'checksigverify':
case 'checksig': {
if (!tx || stack.length < 2)
return false;
key = stack.pop();
sig = stack.pop();
if (!script.isKey(key))
return false;
if (!script.isSignature(sig))
return false;
if (flags.strictder !== false) {
if (!script.isValidSignature(sig))
return false;
}
type = sig[sig.length - 1];
if (!constants.hashTypeByVal[type & 0x1f])
return false;
subscript = script.subscript(s, lastSep);
hash = tx.signatureHash(index, subscript, type);
res = script.checksig(hash, sig.slice(0, -1), key);
if (o === 'checksigverify') {
if (!res)
return false;
} else {
stack.push(res ? [ 1 ] : []);
}
break;
}
case 'checkmultisigverify':
case 'checkmultisig': {
if (!tx || stack.length < 3)
return false;
n = stack.pop();
if (!Array.isArray(n))
return false;
if (n.length !== 1 || !(n[0] >= 1 && n[0] <= 15))
return false;
n = n[0];
if (stack.length < n + 1)
return false;
keys = [];
for (i = 0; i < n; i++) {
key = stack.pop();
if (!script.isKey(key))
return false;
keys.push(key);
}
m = stack.pop();
if (!Array.isArray(m))
return false;
if (m.length !== 1 || !(m[0] >= 1 && m[0] <= n))
return false;
m = m[0];
if (stack.length < m + 1)
return false;
subscript = script.subscript(s, lastSep);
succ = 0;
for (i = 0, j = 0; i < m && j < n; i++) {
sig = stack.pop();
if (!script.isSignature(sig))
return false;
if (flags.strictder !== false) {
if (!script.isValidSignature(sig))
return false;
}
type = sig[sig.length - 1];
if (!constants.hashTypeByVal[type & 0x1f])
return false;
hash = tx.signatureHash(index, subscript, type);
res = false;
for (; !res && j < n; j++)
res = script.checksig(hash, sig.slice(0, -1), keys[j]);
if (res)
succ++;
}
if (stack.length < 1)
return false;
val = stack.pop();
if (flags.verifynulldummy !== false) {
if (!Array.isArray(val) || val.length > 0)
return false;
}
res = succ >= m;
if (o === 'checkmultisigverify') {
if (!res)
return false;
} else {
stack.push(res ? [ 1 ] : []);
}
break;
}
case 'checklocktimeverify': {
// OP_CHECKLOCKTIMEVERIFY = OP_NOP2
if (flags.cltv === false)
break;
if (!tx || stack.length === 0)
return false;
lock = stack[stack.length - 1];
if (!Array.isArray(lock))
return false;
if (lock.length > 6)
return false;
lock = new bn(lock).toNumber();
if (lock < 0)
return false;
threshold = constants.locktimeThreshold;
if (!(
(tx.lock < threshold && lock < threshold)
|| (tx.lock >= threshold && lock >= threshold)
)) {
return false;
}
if (lock > tx.lock)
return false;
if (!tx.inputs[index] || tx.inputs[index].seq === 0xffffffff)
return false;
break;
}
case 'eval_': {
// OP_EVAL = OP_NOP1
if (!flags.allowEval)
break;
recurse = recurse || 0;
if (recurse++ > 2)
return false;
evalScript = stack.pop();
if (!Array.isArray(evalScript))
return false;
evalScript = script.decode(evalScript);
res = evalScript.some(function(op) {
return op === 'codesep';
});
if (res)
return false;
res = script.execute(evalScript, stack, tx, index, flags, recurse);
if (!res)
return false;
break;
}
default: {
// Unknown operation
return false;
}
}
}
if (stack.length + stack.alt.length > constants.script.maxStack)
return false;
return true;
};
script.redeem = function redeem(keys, m, n) {
if (keys.length !== n)
throw new Error(n + ' keys are required to generate redeem script');
assert(m >= 1 && m <= n);
assert(n >= 1 && n <= 15);
while (keys.length < n)
keys.push([]);
keys = utils.sortKeys(keys);
return [m].concat(
keys,
[n, 'checkmultisig']
);
};
script.standard = function standard(s) {
return (script.isPubkey(s) && 'pubkey')
|| (script.isPubkeyhash(s) && 'pubkeyhash')
|| (script.isMultisig(s) && 'multisig')
|| (script.isScripthash(s) && 'scripthash')
|| (script.isNulldata(s) && 'nulldata')
|| null;
};
script.isStandard = function isStandard(s) {
var type = script.standard(s);
var m, n;
if (type === 'multisig') {
m = new bn(s[0]).toNumber();
n = new bn(s[s.length - 2]).toNumber();
if (n < 1 || n > 3)
return false;
if (m < 1 || m > n)
return false;
} else if (type === 'nulldata') {
if (script.size(s) > constants.script.maxOpReturnBytes)
return false;
}
return type != null;
};
script.size = function size(s) {
if (s._raw)
return s._raw.length;
return bcoin.script.encode(s).length;
};
script.isEncoded = function isEncoded(s) {
return utils.isBytes(s);
};
script.normalize = function normalize(s) {
if (script.isEncoded(s))
s = script.decode(s);
s = script.subscript(s);
if (script.lockTime(s))
s = s.slice(3);
return s;
};
script.lockTime = function lockTime(s) {
var lock = s[0];
var res = s.length > 3
&& Array.isArray(s[0])
&& s[1] === 'checklocktimeverify'
&& s[2] === 'drop';
if (!res)
return false;
// Number can only store 6 & 5/8 bytes
if (lock.length > 6)
lock = lock.slice(0, 6);
return new bn(lock);
};
script.spendable = function spendable(s, lockTime) {
if (!script.standard(s))
return false;
var lock = script.lockTime(s);
if (lock && lock.toNumber() > lockTime)
return false;
return true;
};
script.isPubkey = function isPubkey(s, key) {
var res;
s = script.subscript(s);
if (script.lockTime(s))
s = s.slice(3);
if (s.length !== 2)
return false;
res = Array.isArray(s[0]) && s[1] === 'checksig';
if (!res)
return false;
if (key)
return utils.isEqual(s[0], key);
return true;
};
script.isPubkeyhash = function isPubkeyhash(s, hash) {
var res;
s = script.subscript(s);
if (script.lockTime(s))
s = s.slice(3);
if (s.length !== 5)
return false;
res = s[0] === 'dup'
&& s[1] === 'hash160'
&& Array.isArray(s[2])
&& s[3] === 'eqverify'
&& s[4] === 'checksig';
if (!res)
return false;
if (hash)
return utils.isEqual(s[2], hash);
return true;
};
script.isMultisig = function isMultisig(s, keys) {
var m, n, i, j;
var total = 0;
s = script.subscript(s);
if (script.lockTime(s))
s = s.slice(3);
if (s.length < 4)
return false;
if (s[s.length - 1] !== 'checkmultisig')
return false;
n = s[s.length - 2];
if (Array.isArray(n)) {
if (n.length !== 1)
return false;
n = n[0];
}
if (!(n >= 1 && n <= 15))
return false;
m = s[0];
if (Array.isArray(m)) {
if (m.length !== 1)
return false;
m = m[0];
}
if (!(m >= 1 && m <= n))
return false;
if (n + 3 !== s.length)
return false;
for (i = 1; i < n + 1; i++) {
if (!Array.isArray(s[i]))
return false;
}
if (!keys)
return true;
keys = utils.sortKeys(keys);
for (i = 1; i < n + 1; i++) {
for (j = 0; j < keys.length; j++) {
if (utils.isEqual(s[i], keys[j])) {
total++;
break;
}
}
}
return total === n;
};
script.isScripthash = function isScripthash(s, hash) {
var res;
s = script.subscript(s);
if (script.lockTime(s))
s = s.slice(3);
if (s.length !== 3)
return false;
res = s[0] === 'hash160'
&& Array.isArray(s[1])
&& s[1].length === 20
&& s[2] === 'eq';
if (!res)
return false;
if (hash)
return utils.isEqual(s[1], hash);
return true;
};
script.isNulldata = function isNulldata(s) {
s = script.subscript(s);
if (s.length !== 2)
return false;
return s[0] === 'ret'
&& Array.isArray(s[1])
&& s[1].length <= constants.script.maxOpReturn;
};
script.nulldata = function nulldata(s) {
if (!script.isNulldata(s))
return false;
return script.subscript(s)[1];
};
script.standardInput = function standardInput(s) {
return (script.isPubkeyInput(s) && 'pubkey')
|| (script.isPubkeyhashInput(s) && 'pubkeyhash')
|| (script.isMultisigInput(s) && 'multisig')
|| (script.isScripthashInput(s) && 'scripthash')
|| null;
};
script.isPubkeyInput = function isPubkeyInput(s, key, tx, i) {
s = script.subscript(s);
if (s.length !== 1 || !Array.isArray(s[0]))
return false;
if (!script.isSignature(s[0]))
return false;
// Execute the script against our key's
// checksig script to see if this is our input.
// This will only work if the script verifies.
if (key) {
assert(tx);
assert(i != null);
return script.verify(s, [key, 'checksig'], tx, i);
}
return true;
};
script.isPubkeyhashInput = function isPubkeyhashInput(s, key) {
s = script.subscript(s);
if (s.length !== 2 || !Array.isArray(s[0]) || !Array.isArray(s[1]))
return false;
if (!script.isSignature(s[0]))
return false;
if (!script.isKey(s[1]))
return false;
if (key)
return utils.isEqual(s[1], key);
return true;
};
script.isMultisigInput = function isMultisigInput(s, keys, tx, i) {
var i, o;
// We need to rule out scripthash
// because it may look like multisig
if (script.isScripthashInput(s))
return false;
s = script.subscript(s);
if (s.length < 3)
return false;
if (!Array.isArray(s[0]) || s[0].length !== 0)
return false;
for (i = 1; i < s.length; i++) {
if (!script.isSignature(s[i]))
return false;
}
// Execute the script against our pubkeys'
// redeem script to see if this is our input.
// This will only work if the script verifies.
if (keys) {
assert(keys.length >= 2);
assert(tx);
assert(i != null);
o = script.redeem(keys, s.length - 1, keys.length);
return script.verify(s, o, tx, i);
}
// We also also try to recover the keys from the signatures.
// var recovered = [];
// for (i = 1; i < s.length; i++) {
// var sig = s[i];
// var prev = script.redeem(keys, s.length - 1, keys.length);
// var msg = tx.signatureHash(i, prev, s[s.length - 1]);
// var key = bcoin.ecdsa.recoverPubKey(msg, sig.slice(0, -1), 0).toArray();
// recovered.push(key);
// }
return true;
};
script.isScripthashInput = function isScripthashInput(s, data) {
var raw, redeem;
s = script.subscript(s);
// Grab the raw redeem script.
raw = s[s.length - 1];
// Need at least one data element with
// the redeem script.
if (s.length < 2)
return false;
// Last data element should be an array
// for the redeem script.
if (!Array.isArray(raw))
return false;
// P2SH redeem scripts can be nonstandard: make
// it easier for other functions to parse this.
redeem = script.normalize(raw);
// Get the "real" scriptSig
s = s.slice(0, -1);
// Do some sanity checking on the inputs
if (!script.isPubkeyInput(s)
&& !script.isPubkeyhashInput(s)
&& !script.isMultisigInput(s)) {
return false;
}
// Check data against last array in case
// a raw redeem script was passed in.
if (data && utils.isEqual(data, raw))
return true;
// Test against all other script types
return script.isPubkey(redeem, data)
|| script.isPubkeyhash(redeem, data)
|| script.isMultisig(redeem, data);
};
script.coinbaseBits = function coinbaseBits(s, block) {
var value;
s = s.filter(function(chunk) {
return Array.isArray(chunk) && chunk.length !== 0;
});
if (!Array.isArray(s[0]))
return { type: 'value', value: s[0] };
// Number can only store up to 53 bits (6 & 5/8 bytes)
if (s[0].length > 6)
return { type: 'value', value: s[0] };
value = new bn(s[0].slice().reverse()).toNumber();
// Test for bits and ts
if (block && block.version < 2) {
if (value === block.bits)
return { type: 'bits', value: value };
if (value === block.ts)
return { type: 'ts', value: value };
}
// Test for height
if (block) {
if (block.version < 2)
return { type: 'value', value: value };
} else {
if (value <= 227835)
return { type: 'value', value: value };
}
if (s[0].length < 3)
return { type: 'value', value: value };
return { type: 'height', value: value };
};
script.coinbaseHeight = function coinbaseHeight(s, block) {
var data = script.coinbaseBits(s, block);
if (data.type !== 'height')
return -1;
return data.value;
};
script.coinbase = function coinbase(s, block) {
var coinbase, data, extraNonce, flags;
s = s.filter(function(chunk) {
return Array.isArray(chunk) && chunk.length !== 0;
});
coinbase = {
script: s
};
data = script.coinbaseBits(s, block);
if (Array.isArray(s[1]))
extraNonce = new bn(s[1]);
flags = s.slice(2);
coinbase[data.type] = data.value;
coinbase.extraNonce = extraNonce;
coinbase.flags = flags;
coinbase.text =
flags.map(utils.array2utf8).join('')
.replace(/[\u0000-\u0019\u007f-\u00ff]/g, '');
return coinbase;
};
script.isCoinbase = function isCoinbase(s, block, strict) {
var coinbase = script.coinbase(s, block);
var size = script.size(s);
if (size < 2 || size > 100)
return false;
if (strict) {
if (s.length < 2)
return false;
if (coinbase.value != null)
return false;
if (coinbase.extraNonce == null)
return false;
if (block) {
// The early bitcoind miner (which used the bits
// as the first stack push) had no flags after it.
if (coinbase.bits != null && coinbase.flags.length)
return false;
}
}
return coinbase;
};
script.isKey = function isKey(key) {
if (!utils.isBuffer(key))
return false;
return key.length >= 33 && key.length <= 65;
};
script.isSignature = function isSignature(sig, allowZero) {
if (!utils.isBuffer(sig))
return false;
if (allowZero && sig.length === 0)
return true;
return sig.length >= 9 && sig.length <= 73;
};
// https://github.com/bitcoin/bips/blob/master/bip-0066.mediawiki
/**
* A canonical signature exists of: <30> <total len> <02> <len R> <R> <02> <len S> <S> <hashtype>
* Where R and S are not negative (their first byte has its highest bit not set), and not
* excessively padded (do not start with a 0 byte, unless an otherwise negative number follows,
* in which case a single 0 byte is necessary and even required).
*
* See https://bitcointalk.org/index.php?topic=8392.msg127623#msg127623
*
* This function is consensus-critical since BIP66.
*/
script.isValidSignature = function isValidSignature(sig, allowZero) {
var lenR, lenS;
if (!utils.isBuffer(sig))
return false;
// Empty signature. Not strictly DER encoded, but allowed to provide a
// compact way to provide an invalid signature for use with CHECK(MULTI)SIG
if (allowZero && sig.length === 0)
return true;
// Format: 0x30 [total-length] 0x02 [R-length] [R] 0x02 [S-length] [S] [sighash]
// * total-length: 1-byte length descriptor of everything that follows,
// excluding the sighash byte.
// * R-length: 1-byte length descriptor of the R value that follows.
// * R: arbitrary-length big-endian encoded R value. It must use the shortest
// possible encoding for a positive integers (which means no null bytes at
// the start, except a single one when the next byte has its highest bit set).
// * S-length: 1-byte length descriptor of the S value that follows.
// * S: arbitrary-length big-endian encoded S value. The same rules apply.
// * sighash: 1-byte value indicating what data is hashed (not part of the DER
// signature)
// Minimum and maximum size constraints.
if (sig.length < 9)
return false;
if (sig.length > 73)
return false;
// A signature is of type 0x30 (compound).
if (sig[0] !== 0x30)
return false;
// Make sure the length covers the entire signature.
if (sig[1] !== sig.length - 3)
return false;
// Extract the length of the R element.
lenR = sig[3];
// Make sure the length of the S element is still inside the signature.
if (5 + lenR >= sig.length)
return false;
// Extract the length of the S element.
lenS = sig[5 + lenR];
// Verify that the length of the signature matches the sum of the length
// of the elements.
if (lenR + lenS + 7 !== sig.length)
return false;
// Check whether the R element is an integer.
if (sig[2] !== 0x02)
return false;
// Zero-length integers are not allowed for R.
if (lenR === 0)
return false;
// Negative numbers are not allowed for R.
if (sig[4] & 0x80)
return false;
// Null bytes at the start of R are not allowed, unless R would
// otherwise be interpreted as a negative number.
if (lenR > 1 && (sig[4] === 0x00) && !(sig[5] & 0x80))
return false;
// Check whether the S element is an integer.
if (sig[lenR + 4] !== 0x02)
return false;
// Zero-length integers are not allowed for S.
if (lenS === 0)
return false;
// Negative numbers are not allowed for S.
if (sig[lenR + 6] & 0x80)
return false;
// Null bytes at the start of S are not allowed, unless S would otherwise be
// interpreted as a negative number.
if (lenS > 1 && (sig[lenR + 6] === 0x00) && !(sig[lenR + 7] & 0x80))
return false;
return true;
};
script.format = function format(input, output) {
var scripts = [];
var prev, redeem;
if (Array.isArray(input)) {
scripts.push(input);
} else if (Array.isArray(output)) {
scripts.push(output);
} else if (input) {
scripts.push(input.script);
if (input.out.tx && input.out.tx.outputs[input.out.index]) {
prev = input.out.tx.outputs[input.out.index].script;
scripts.push(prev);
if (script.isScripthash(prev)) {
redeem = script.decode(input.script[input.script.length - 1]);
scripts.push(redeem);
}
}
} else if (output) {
scripts.push(output.script);
}
scripts = scripts.map(function(script) {
return script.map(function(chunk) {
if (Array.isArray(chunk)) {
if (chunk.length === 0)
return 0 + '';
return '[' + utils.toHex(chunk) + ']';
}
if (typeof chunk === 'number')
return chunk + '';
return chunk;
}).join(' ');
});
return scripts;
};
script.pushOnly = function pushOnly(s) {
var i, op;
for (i = 0; i < s.length; i++) {
op = s[i];
if (Array.isArray(op) || (op >= 1 && op <= 16))
continue;
if (constants.opcodes[op] == null)
return false;
return false;
}
return true;
};
script.sigops = function sigops(s, accurate) {
var i, op;
var n = 0;
var lastOp = -1;
for (i = 0; i < s.length; i++) {
op = s[i];
if (Array.isArray(op))
continue;
if (constants.opcodes[op] == null)
return 0;
if (op === 'checksig' || op === 'checksigverify') {
n++;
} else if (op === 'checkmultisig' || op === 'checkmultisigverify') {
if (accurate && lastOp >= 1 && lastOp <= 16) {
n += lastOp;
} else {
n += constants.script.maxPubkeysPerMultisig;
}
}
lastOp = op;
}
return n;
};
script.sigopsScripthash = function sigopsScripthash(s) {
if (!script.isScripthashInput(s))
return 0;
if (!script.pushOnly(s))
return 0;
s = script.decode(s[s.length - 1]);
return script.sigops(s, true);
};
script.args = function args(s) {
var type, keys, m;
s = bcoin.script.subscript(s);
if (script.lockTime(s))
s = s.slice(3);
type = script.standard(s);
if (type === 'pubkey')
return 1;
if (type === 'pubkeyhash')
return 2;
if (type === 'multisig') {
keys = bcoin.script.isMultisig(s);
if (!pub)
return -1;
m = new bn(s[0]).toNumber();
if (keys.length < 1 || m < 1)
return -1;
return m + 1;
}
if (type === 'scripthash')
return 1;
if (type === 'nulldata')
return -1;
return -1;
};