1663 lines
37 KiB
JavaScript
1663 lines
37 KiB
JavaScript
/**
|
|
* script.js - script interpreter for bcoin
|
|
* Copyright (c) 2014-2015, Fedor Indutny (MIT License)
|
|
* https://github.com/indutny/bcoin
|
|
*/
|
|
|
|
var bcoin = require('../bcoin');
|
|
var bn = require('bn.js');
|
|
var constants = bcoin.protocol.constants;
|
|
var utils = bcoin.utils;
|
|
var assert = bcoin.utils.assert;
|
|
var script = exports;
|
|
|
|
/**
|
|
* Script
|
|
*/
|
|
|
|
script.decode = function decode(s) {
|
|
if (!s)
|
|
return [];
|
|
|
|
var opcodes = [];
|
|
var i = 0;
|
|
var b, opcode, len;
|
|
|
|
while (i < s.length) {
|
|
b = s[i++];
|
|
|
|
// Next `b` bytes should be pushed to stack
|
|
if (b >= 0x01 && b <= 0x4b) {
|
|
opcodes.push(s.slice(i, i + b));
|
|
i += b;
|
|
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
|
|
opcode: null,
|
|
len: b
|
|
});
|
|
continue;
|
|
}
|
|
|
|
// Zero
|
|
if (b === 0) {
|
|
opcodes.push([]);
|
|
continue;
|
|
}
|
|
|
|
// Raw number (-1 and 1-16)
|
|
if (b === 0x4f || (b >= 0x51 && b <= 0x60)) {
|
|
opcodes.push(b - 0x50);
|
|
continue;
|
|
}
|
|
|
|
opcode = constants.opcodesByVal[b];
|
|
|
|
if (i >= s.length) {
|
|
opcodes.push(opcode || b);
|
|
continue;
|
|
}
|
|
|
|
if (opcode === 'pushdata1') {
|
|
len = s[i];
|
|
i += 1;
|
|
opcodes.push(s.slice(i, i + len));
|
|
i += len;
|
|
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
|
|
opcode: opcode,
|
|
len: len
|
|
});
|
|
} else if (opcode === 'pushdata2') {
|
|
len = utils.readU16(s, i);
|
|
i += 2;
|
|
opcodes.push(s.slice(i, i + len));
|
|
i += len;
|
|
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
|
|
opcode: opcode,
|
|
len: len
|
|
});
|
|
} else if (opcode === 'pushdata4') {
|
|
len = utils.readU32(s, i);
|
|
i += 4;
|
|
opcodes.push(s.slice(i, i + len));
|
|
i += len;
|
|
utils.hidden(opcodes[opcodes.length - 1], 'pushdata', {
|
|
opcode: opcode,
|
|
len: len
|
|
});
|
|
} else {
|
|
opcodes.push(opcode || b);
|
|
}
|
|
}
|
|
|
|
utils.hidden(opcodes, '_raw', s);
|
|
|
|
return opcodes;
|
|
};
|
|
|
|
script.encode = function encode(s) {
|
|
if (!s)
|
|
return [];
|
|
|
|
var opcodes = constants.opcodes;
|
|
var res = [];
|
|
var i = 0;
|
|
var instr;
|
|
|
|
for (i = 0; i < s.length; i++) {
|
|
instr = s[i];
|
|
|
|
// Push value to stack
|
|
if (Array.isArray(instr)) {
|
|
// Check for nonstandard pushdatas that
|
|
// may have been decoded from before.
|
|
if (instr.pushdata) {
|
|
if (instr.pushdata.opcode === null) {
|
|
res = res.concat(instr.pushdata.len, instr);
|
|
} else if (instr.pushdata.opcode === 'pushdata1') {
|
|
res = res.concat(opcodes.pushdata1, instr.pushdata.len, instr);
|
|
} else if (instr.pushdata.opcode === 'pushdata2') {
|
|
res.push(opcodes.pushdata2);
|
|
utils.writeU16(res, instr.pushdata.len, res.length);
|
|
res = res.concat(instr);
|
|
} else if (instr.pushdata.opcode === 'pushdata4') {
|
|
res.push(opcodes.pushdata4);
|
|
utils.writeU32(res, instr.pushdata.len, res.length);
|
|
res = res.concat(instr);
|
|
}
|
|
continue;
|
|
}
|
|
if (instr.length === 0) {
|
|
// OP_FALSE
|
|
res.push(0);
|
|
} else if (1 <= instr.length && instr.length <= 0x4b) {
|
|
res = res.concat(instr.length, instr);
|
|
} else if (instr.length <= 0xff) {
|
|
res = res.concat(opcodes.pushdata1, instr.length, instr);
|
|
} else if (instr.length <= 0xffff) {
|
|
res.push(opcodes.pushdata2);
|
|
utils.writeU16(res, instr.length, res.length);
|
|
res = res.concat(instr);
|
|
} else {
|
|
res.push(opcodes.pushdata4);
|
|
utils.writeU32(res, instr.length, res.length);
|
|
res = res.concat(instr);
|
|
}
|
|
continue;
|
|
}
|
|
|
|
res.push(opcodes[instr] || instr);
|
|
}
|
|
|
|
return res;
|
|
};
|
|
|
|
script.verify = function verify(input, output, tx, i, flags) {
|
|
var copy, res, redeem;
|
|
var stack = [];
|
|
|
|
if (!flags)
|
|
flags = {};
|
|
|
|
// Execute the input script
|
|
script.execute(input, stack, tx, i, flags);
|
|
|
|
// Copy the stack for P2SH
|
|
if (flags.verifyp2sh !== false)
|
|
copy = stack.slice();
|
|
|
|
// Execute the previous output script
|
|
res = script.execute(output, stack, tx, i, flags);
|
|
|
|
// Verify the script did not fail as well as the stack values
|
|
if (!res || stack.length === 0 || new bn(stack.pop()).cmpn(0) === 0)
|
|
return false;
|
|
|
|
// If the script is P2SH, execute the real output script
|
|
if (flags.verifyp2sh !== false && script.isScripthash(output)) {
|
|
// P2SH can only have push ops in the scriptSig
|
|
if (!script.pushOnly(input))
|
|
return false;
|
|
|
|
// Reset the stack
|
|
stack = copy;
|
|
|
|
// Stack should _never_ be empty at this point
|
|
assert(stack.length !== 0);
|
|
|
|
// Grab the real redeem script
|
|
redeem = stack.pop();
|
|
|
|
if (!Array.isArray(redeem))
|
|
return false;
|
|
|
|
redeem = script.decode(redeem);
|
|
|
|
// Execute the redeem script
|
|
res = script.execute(redeem, stack, tx, i, flags);
|
|
|
|
// Verify the script did not fail as well as the stack values
|
|
if (!res || stack.length === 0 || new bn(stack.pop()).cmpn(0) === 0)
|
|
return false;
|
|
}
|
|
|
|
// Ensure there is nothing left on the stack
|
|
if (flags.cleanstack !== false) {
|
|
if (stack.length !== 0)
|
|
return false;
|
|
}
|
|
|
|
return true;
|
|
};
|
|
|
|
script.subscript = function subscript(s, lastSep) {
|
|
var i, res;
|
|
|
|
if (!s)
|
|
return [];
|
|
|
|
if (lastSep == null) {
|
|
lastSep = -1;
|
|
for (i = 0; i < s.length; i++) {
|
|
if (s[i] === 'checksig'
|
|
|| s[i] === 'checksigverify'
|
|
|| s[i] === 'checkmultisig'
|
|
|| s[i] === 'checkmultisigverify') {
|
|
break;
|
|
}
|
|
if (s[i] === 'codesep')
|
|
lastSep = i;
|
|
}
|
|
}
|
|
|
|
res = [];
|
|
for (i = lastSep + 1; i < s.length; i++) {
|
|
if (s[i] !== 'codesep')
|
|
res.push(s[i]);
|
|
}
|
|
|
|
return res;
|
|
};
|
|
|
|
script.checksig = function checksig(hash, sig, pub) {
|
|
var k;
|
|
|
|
try {
|
|
k = bcoin.ecdsa.keyPair({ pub: pub });
|
|
} catch (e) {
|
|
return false;
|
|
}
|
|
|
|
// Points at Infinity make verify() throw.
|
|
// This specifically throws on wallet-test.js
|
|
// where [1] is concatted to the pubkey.
|
|
if (k.getPublic().isInfinity())
|
|
return false;
|
|
|
|
// Use a try catch in case there are
|
|
// any uncaught errors for bad inputs in verify().
|
|
try {
|
|
return bcoin.ecdsa.verify(hash, sig, pub);
|
|
} catch (e) {
|
|
return false;
|
|
}
|
|
};
|
|
|
|
script._next = function _next(to, s, pc) {
|
|
var depth = 0;
|
|
var o;
|
|
|
|
while (s[pc]) {
|
|
o = s[pc];
|
|
|
|
if (o === 'if_' || o === 'notif')
|
|
depth++;
|
|
else if (o === 'else_')
|
|
depth--;
|
|
else if (o === 'endif')
|
|
depth--;
|
|
|
|
if (depth < 0)
|
|
break;
|
|
|
|
if (depth === 0 && o === to)
|
|
return pc;
|
|
|
|
if (o === 'else_')
|
|
depth++;
|
|
|
|
pc++;
|
|
}
|
|
|
|
return -1;
|
|
};
|
|
|
|
script.execute = function execute(s, stack, tx, index, flags, recurse) {
|
|
s = s.slice();
|
|
|
|
if (!flags)
|
|
flags = {};
|
|
|
|
if (s.length > constants.script.maxOps)
|
|
return false;
|
|
|
|
var lastSep = -1;
|
|
var pc = 0;
|
|
var o, val;
|
|
var if_, else_, endif;
|
|
var v, v1, v2, v3, v4;
|
|
var n, n1, n2, n3;
|
|
var res;
|
|
var key, sig, type, subscript, hash;
|
|
var keys, i, j, m;
|
|
var succ;
|
|
var lock, threshold;
|
|
var evalScript;
|
|
|
|
stack.alt = stack.alt || [];
|
|
|
|
for (pc = 0; pc < s.length; pc++) {
|
|
o = s[pc];
|
|
|
|
if (Array.isArray(o)) {
|
|
if (o.length > constants.script.maxPush)
|
|
return false;
|
|
stack.push(o);
|
|
continue;
|
|
}
|
|
|
|
if (o === -1 || (o >= 1 && o <= 16)) {
|
|
stack.push([o]);
|
|
continue;
|
|
}
|
|
|
|
switch (o) {
|
|
case 'nop':
|
|
case 'nop3':
|
|
case 'nop4':
|
|
case 'nop5':
|
|
case 'nop6':
|
|
case 'nop7':
|
|
case 'nop8':
|
|
case 'nop9':
|
|
case 'nop10': {
|
|
break;
|
|
}
|
|
case 'if_':
|
|
case 'notif': {
|
|
val = false;
|
|
if (stack.length < 1)
|
|
return false;
|
|
v = stack.pop();
|
|
val = new bn(v).cmpn(0) !== 0;
|
|
if (o === 'notif')
|
|
val = !val;
|
|
if_ = pc;
|
|
else_ = script._next('else_', s, pc);
|
|
endif = script._next('endif', s, pc);
|
|
// Splice out the statement blocks we don't need
|
|
if (val) {
|
|
if (endif === -1)
|
|
return false;
|
|
if (else_ === -1) {
|
|
s.splice(endif, 1);
|
|
s.splice(if_, 1);
|
|
} else {
|
|
s.splice(else_, (endif - else_) + 1);
|
|
s.splice(if_, 1);
|
|
}
|
|
} else {
|
|
if (endif === -1)
|
|
return false;
|
|
if (else_ === -1) {
|
|
s.splice(if_, (endif - if_) + 1);
|
|
} else {
|
|
s.splice(endif, 1);
|
|
s.splice(if_, (else_ - if_) + 1);
|
|
}
|
|
}
|
|
// Subtract one since we removed the if/notif opcode
|
|
pc--;
|
|
break;
|
|
}
|
|
case 'else_': {
|
|
return false;
|
|
}
|
|
case 'endif': {
|
|
return false;
|
|
}
|
|
case 'verify': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
if (new bn(stack.pop()).cmpn(0) === 0)
|
|
return false;
|
|
break;
|
|
}
|
|
case 'ret': {
|
|
return false;
|
|
}
|
|
case 'toaltstack': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.alt.push(stack.pop());
|
|
break;
|
|
}
|
|
case 'fromaltstack': {
|
|
if (stack.alt.length === 0)
|
|
return false;
|
|
stack.push(stack.alt.pop());
|
|
break;
|
|
}
|
|
case 'ifdup': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
if (new bn(stack[stack.length - 1]).cmpn(0) !== 0)
|
|
stack.push(new bn(stack[stack.length - 1]).toArray());
|
|
break;
|
|
}
|
|
case 'depth': {
|
|
stack.push(new bn(stack.length).toArray());
|
|
break;
|
|
}
|
|
case 'drop': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.pop();
|
|
break;
|
|
}
|
|
case 'dup': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.push(stack[stack.length - 1]);
|
|
break;
|
|
}
|
|
case 'nip': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
stack.splice(stack.length - 2, 1);
|
|
break;
|
|
}
|
|
case 'over': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
stack.push(stack[stack.length - 2]);
|
|
break;
|
|
}
|
|
case 'pick':
|
|
case 'roll': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
v = stack.pop();
|
|
if (v.length > 6)
|
|
return false;
|
|
n = new bn(v).toNumber();
|
|
if (n < 0 || n >= stack.length)
|
|
return false;
|
|
v = stack[-n - 1];
|
|
if (o === 'roll')
|
|
stack.splice(stack.length - n - 1, 1);
|
|
stack.push(v);
|
|
break;
|
|
}
|
|
case 'rot': {
|
|
if (stack.length < 3)
|
|
return false;
|
|
v3 = stack[stack.length - 3];
|
|
v2 = stack[stack.length - 2];
|
|
v1 = stack[stack.length - 1];
|
|
stack[stack.length - 3] = v2;
|
|
stack[stack.length - 2] = v3;
|
|
v2 = stack[stack.length - 2];
|
|
stack[stack.length - 2] = v1;
|
|
stack[stack.length - 1] = v2;
|
|
break;
|
|
}
|
|
case 'swap': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
v2 = stack[stack.length - 2];
|
|
v1 = stack[stack.length - 1];
|
|
stack[stack.length - 2] = v1;
|
|
stack[stack.length - 1] = v2;
|
|
break;
|
|
}
|
|
case 'tuck': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
stack.splice(stack.length - 2, 0, stack[stack.length - 1]);
|
|
break;
|
|
}
|
|
case 'drop2': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
stack.pop();
|
|
stack.pop();
|
|
break;
|
|
}
|
|
case 'dup2': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
v1 = stack[stack.length - 1];
|
|
v2 = stack[stack.length - 2];
|
|
stack.push(v1);
|
|
stack.push(v2);
|
|
break;
|
|
}
|
|
case 'dup3': {
|
|
if (stack.length < 3)
|
|
return false;
|
|
v1 = stack[stack.length - 1];
|
|
v2 = stack[stack.length - 2];
|
|
v3 = stack[stack.length - 3];
|
|
stack.push(v1);
|
|
stack.push(v2);
|
|
stack.push(v3);
|
|
break;
|
|
}
|
|
case 'over2': {
|
|
if (stack.length < 4)
|
|
return false;
|
|
v1 = stack[stack.length - 4];
|
|
v2 = stack[stack.length - 3];
|
|
stack.push(v1);
|
|
stack.push(v2);
|
|
break;
|
|
}
|
|
case 'rot2': {
|
|
if (stack.length < 6)
|
|
return false;
|
|
v1 = stack[stack.length - 6];
|
|
v2 = stack[stack.length - 5];
|
|
stack.splice(stack.length - 6, 2);
|
|
stack.push(v1);
|
|
stack.push(v2);
|
|
break;
|
|
}
|
|
case 'swap2': {
|
|
if (stack.length < 4)
|
|
return false;
|
|
v4 = stack[stack.length - 4];
|
|
v3 = stack[stack.length - 3];
|
|
v2 = stack[stack.length - 2];
|
|
v1 = stack[stack.length - 1];
|
|
stack[stack.length - 4] = v2;
|
|
stack[stack.length - 2] = v4;
|
|
stack[stack.length - 3] = v1;
|
|
stack[stack.length - 1] = v3;
|
|
break;
|
|
}
|
|
case 'size': {
|
|
if (stack.length < 1)
|
|
return false;
|
|
stack.push(new bn(stack[stack.length - 1].length || 0).toArray());
|
|
break;
|
|
}
|
|
case 'add1':
|
|
case 'sub1':
|
|
case 'negate':
|
|
case 'abs':
|
|
case 'not':
|
|
case 'noteq0': {
|
|
if (stack.length < 1)
|
|
return false;
|
|
n = new bn(stack.pop());
|
|
switch (o) {
|
|
case 'add1':
|
|
n.iadd(1);
|
|
break;
|
|
case 'sub1':
|
|
n.isub(1);
|
|
break;
|
|
case 'negate':
|
|
n = n.neg();
|
|
break;
|
|
case 'abs':
|
|
if (n.cmpn(0) < 0)
|
|
n = n.neg();
|
|
break;
|
|
case 'not':
|
|
n = n.cmpn(0) === 0;
|
|
break;
|
|
case 'noteq0':
|
|
n = n.cmpn(0) !== 0;
|
|
break;
|
|
default:
|
|
return false;
|
|
}
|
|
if (typeof n === 'boolean')
|
|
n = new bn(+n);
|
|
stack.push(n.toArray());
|
|
break;
|
|
}
|
|
case 'add':
|
|
case 'sub':
|
|
case 'booland':
|
|
case 'boolor':
|
|
case 'numeq':
|
|
case 'numeqverify':
|
|
case 'numneq':
|
|
case 'lt':
|
|
case 'gt':
|
|
case 'lte':
|
|
case 'gte':
|
|
case 'min':
|
|
case 'max': {
|
|
switch (o) {
|
|
case 'add':
|
|
case 'sub':
|
|
case 'booland':
|
|
case 'boolor':
|
|
case 'numeq':
|
|
case 'numeqverify':
|
|
case 'numneq':
|
|
case 'lt':
|
|
case 'gt':
|
|
case 'lte':
|
|
case 'gte':
|
|
case 'min':
|
|
case 'max':
|
|
if (stack.length < 2)
|
|
return false;
|
|
n2 = new bn(stack.pop());
|
|
n1 = new bn(stack.pop());
|
|
n = new bn(0);
|
|
switch (o) {
|
|
case 'add':
|
|
n = n1.add(n2);
|
|
break;
|
|
case 'sub':
|
|
n = n1.sub(n2);
|
|
break;
|
|
case 'booland':
|
|
n = n1.cmpn(0) !== 0 && n2.cmpn(0) !== 0;
|
|
break;
|
|
case 'boolor':
|
|
n = n1.cmpn(0) !== 0 || n2.cmpn(0) !== 0;
|
|
break;
|
|
case 'numeq':
|
|
n = n1.cmp(n2) === 0;
|
|
break;
|
|
case 'numeqverify':
|
|
n = n1.cmp(n2) === 0;
|
|
break;
|
|
case 'numneq':
|
|
n = n1.cmp(n2) !== 0;
|
|
break;
|
|
case 'lt':
|
|
n = n1.cmp(n2) < 0;
|
|
break;
|
|
case 'gt':
|
|
n = n1.cmp(n2) > 0;
|
|
break;
|
|
case 'lte':
|
|
n = n1.cmp(n2) <= 0;
|
|
break;
|
|
case 'gte':
|
|
n = n1.cmp(n2) >= 0;
|
|
break;
|
|
case 'min':
|
|
n = n1.cmp(n2) < 0 ? n1 : n2;
|
|
break;
|
|
case 'max':
|
|
n = n1.cmp(n2) > 0 ? n1 : n2;
|
|
break;
|
|
default:
|
|
return false;
|
|
}
|
|
if (typeof n === 'boolean')
|
|
n = new bn(+n);
|
|
res = n.cmpn(0) !== 0;
|
|
if (o === 'numeqverify') {
|
|
if (!res)
|
|
return false;
|
|
} else {
|
|
stack.push(n.toArray());
|
|
}
|
|
break;
|
|
case 'within':
|
|
if (stack.length < 3)
|
|
return false;
|
|
n3 = new bn(stack.pop());
|
|
n2 = new bn(stack.pop());
|
|
n1 = new bn(stack.pop());
|
|
val = n2.cmp(n1) <= 0 && n1.cmp(n3) < 0;
|
|
stack.push(val.cmpn(0) !== 0 ? [ 1 ] : []);
|
|
break;
|
|
}
|
|
|
|
break;
|
|
}
|
|
case 'codesep': {
|
|
lastSep = pc;
|
|
break;
|
|
}
|
|
case 'ripemd160': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.push(utils.ripemd160(stack.pop()));
|
|
break;
|
|
}
|
|
case 'sha1': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.push(utils.sha1(stack.pop()));
|
|
break;
|
|
}
|
|
case 'sha256': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.push(utils.sha256(stack.pop()));
|
|
break;
|
|
}
|
|
case 'hash256': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.push(utils.dsha256(stack.pop()));
|
|
break;
|
|
}
|
|
case 'hash160': {
|
|
if (stack.length === 0)
|
|
return false;
|
|
stack.push(utils.ripesha(stack.pop()));
|
|
break;
|
|
}
|
|
case 'eqverify':
|
|
case 'eq': {
|
|
if (stack.length < 2)
|
|
return false;
|
|
res = utils.isEqual(stack.pop(), stack.pop());
|
|
if (o === 'eqverify') {
|
|
if (!res)
|
|
return false;
|
|
} else {
|
|
stack.push(res ? [ 1 ] : []);
|
|
}
|
|
break;
|
|
}
|
|
case 'checksigverify':
|
|
case 'checksig': {
|
|
if (!tx || stack.length < 2)
|
|
return false;
|
|
|
|
key = stack.pop();
|
|
sig = stack.pop();
|
|
|
|
if (!script.isKey(key))
|
|
return false;
|
|
|
|
if (!script.isSignature(sig))
|
|
return false;
|
|
|
|
if (flags.strictder !== false) {
|
|
if (!script.isValidSignature(sig))
|
|
return false;
|
|
}
|
|
|
|
type = sig[sig.length - 1];
|
|
|
|
if (!constants.hashTypeByVal[type & 0x1f])
|
|
return false;
|
|
|
|
subscript = script.subscript(s, lastSep);
|
|
hash = tx.signatureHash(index, subscript, type);
|
|
|
|
res = script.checksig(hash, sig.slice(0, -1), key);
|
|
if (o === 'checksigverify') {
|
|
if (!res)
|
|
return false;
|
|
} else {
|
|
stack.push(res ? [ 1 ] : []);
|
|
}
|
|
|
|
break;
|
|
}
|
|
case 'checkmultisigverify':
|
|
case 'checkmultisig': {
|
|
if (!tx || stack.length < 3)
|
|
return false;
|
|
|
|
n = stack.pop();
|
|
|
|
if (!Array.isArray(n))
|
|
return false;
|
|
|
|
if (n.length !== 1 || !(n[0] >= 1 && n[0] <= 15))
|
|
return false;
|
|
|
|
n = n[0];
|
|
|
|
if (stack.length < n + 1)
|
|
return false;
|
|
|
|
keys = [];
|
|
for (i = 0; i < n; i++) {
|
|
key = stack.pop();
|
|
if (!script.isKey(key))
|
|
return false;
|
|
|
|
keys.push(key);
|
|
}
|
|
|
|
m = stack.pop();
|
|
|
|
if (!Array.isArray(m))
|
|
return false;
|
|
|
|
if (m.length !== 1 || !(m[0] >= 1 && m[0] <= n))
|
|
return false;
|
|
|
|
m = m[0];
|
|
|
|
if (stack.length < m + 1)
|
|
return false;
|
|
|
|
subscript = script.subscript(s, lastSep);
|
|
|
|
succ = 0;
|
|
for (i = 0, j = 0; i < m && j < n; i++) {
|
|
sig = stack.pop();
|
|
|
|
if (!script.isSignature(sig))
|
|
return false;
|
|
|
|
if (flags.strictder !== false) {
|
|
if (!script.isValidSignature(sig))
|
|
return false;
|
|
}
|
|
|
|
type = sig[sig.length - 1];
|
|
|
|
if (!constants.hashTypeByVal[type & 0x1f])
|
|
return false;
|
|
|
|
hash = tx.signatureHash(index, subscript, type);
|
|
|
|
res = false;
|
|
for (; !res && j < n; j++)
|
|
res = script.checksig(hash, sig.slice(0, -1), keys[j]);
|
|
|
|
if (res)
|
|
succ++;
|
|
}
|
|
|
|
if (stack.length < 1)
|
|
return false;
|
|
|
|
val = stack.pop();
|
|
|
|
if (flags.verifynulldummy !== false) {
|
|
if (!Array.isArray(val) || val.length > 0)
|
|
return false;
|
|
}
|
|
|
|
res = succ >= m;
|
|
if (o === 'checkmultisigverify') {
|
|
if (!res)
|
|
return false;
|
|
} else {
|
|
stack.push(res ? [ 1 ] : []);
|
|
}
|
|
|
|
break;
|
|
}
|
|
case 'checklocktimeverify': {
|
|
// OP_CHECKLOCKTIMEVERIFY = OP_NOP2
|
|
if (flags.cltv === false)
|
|
break;
|
|
|
|
if (!tx || stack.length === 0)
|
|
return false;
|
|
|
|
lock = stack[stack.length - 1];
|
|
|
|
if (!Array.isArray(lock))
|
|
return false;
|
|
|
|
if (lock.length > 6)
|
|
return false;
|
|
|
|
lock = new bn(lock).toNumber();
|
|
|
|
if (lock < 0)
|
|
return false;
|
|
|
|
threshold = constants.locktimeThreshold;
|
|
if (!(
|
|
(tx.lock < threshold && lock < threshold)
|
|
|| (tx.lock >= threshold && lock >= threshold)
|
|
)) {
|
|
return false;
|
|
}
|
|
|
|
if (lock > tx.lock)
|
|
return false;
|
|
|
|
if (!tx.inputs[index] || tx.inputs[index].seq === 0xffffffff)
|
|
return false;
|
|
|
|
break;
|
|
}
|
|
case 'eval_': {
|
|
// OP_EVAL = OP_NOP1
|
|
if (!flags.allowEval)
|
|
break;
|
|
|
|
recurse = recurse || 0;
|
|
|
|
if (recurse++ > 2)
|
|
return false;
|
|
|
|
evalScript = stack.pop();
|
|
|
|
if (!Array.isArray(evalScript))
|
|
return false;
|
|
|
|
evalScript = script.decode(evalScript);
|
|
|
|
res = evalScript.some(function(op) {
|
|
return op === 'codesep';
|
|
});
|
|
|
|
if (res)
|
|
return false;
|
|
|
|
res = script.execute(evalScript, stack, tx, index, flags, recurse);
|
|
if (!res)
|
|
return false;
|
|
|
|
break;
|
|
}
|
|
default: {
|
|
// Unknown operation
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (stack.length + stack.alt.length > constants.script.maxStack)
|
|
return false;
|
|
|
|
return true;
|
|
};
|
|
|
|
script.redeem = function redeem(keys, m, n) {
|
|
if (keys.length !== n)
|
|
throw new Error(n + ' keys are required to generate redeem script');
|
|
|
|
assert(m >= 1 && m <= n);
|
|
assert(n >= 1 && n <= 15);
|
|
|
|
while (keys.length < n)
|
|
keys.push([]);
|
|
|
|
keys = utils.sortKeys(keys);
|
|
|
|
return [m].concat(
|
|
keys,
|
|
[n, 'checkmultisig']
|
|
);
|
|
};
|
|
|
|
script.standard = function standard(s) {
|
|
return (script.isPubkey(s) && 'pubkey')
|
|
|| (script.isPubkeyhash(s) && 'pubkeyhash')
|
|
|| (script.isMultisig(s) && 'multisig')
|
|
|| (script.isScripthash(s) && 'scripthash')
|
|
|| (script.isNulldata(s) && 'nulldata')
|
|
|| null;
|
|
};
|
|
|
|
script.isStandard = function isStandard(s) {
|
|
var type = script.standard(s);
|
|
var m, n;
|
|
|
|
if (type === 'multisig') {
|
|
m = new bn(s[0]).toNumber();
|
|
n = new bn(s[s.length - 2]).toNumber();
|
|
if (n < 1 || n > 3)
|
|
return false;
|
|
if (m < 1 || m > n)
|
|
return false;
|
|
} else if (type === 'nulldata') {
|
|
if (script.size(s) > constants.script.maxOpReturnBytes)
|
|
return false;
|
|
}
|
|
|
|
return type != null;
|
|
};
|
|
|
|
script.size = function size(s) {
|
|
if (s._raw)
|
|
return s._raw.length;
|
|
return bcoin.script.encode(s).length;
|
|
};
|
|
|
|
script.isEncoded = function isEncoded(s) {
|
|
return utils.isBytes(s);
|
|
};
|
|
|
|
script.normalize = function normalize(s) {
|
|
if (script.isEncoded(s))
|
|
s = script.decode(s);
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (script.lockTime(s))
|
|
s = s.slice(3);
|
|
|
|
return s;
|
|
};
|
|
|
|
script.lockTime = function lockTime(s) {
|
|
var lock = s[0];
|
|
var res = s.length > 3
|
|
&& Array.isArray(s[0])
|
|
&& s[1] === 'checklocktimeverify'
|
|
&& s[2] === 'drop';
|
|
|
|
if (!res)
|
|
return false;
|
|
|
|
// Number can only store 6 & 5/8 bytes
|
|
if (lock.length > 6)
|
|
lock = lock.slice(0, 6);
|
|
|
|
return new bn(lock);
|
|
};
|
|
|
|
script.spendable = function spendable(s, lockTime) {
|
|
if (!script.standard(s))
|
|
return false;
|
|
|
|
var lock = script.lockTime(s);
|
|
if (lock && lock.toNumber() > lockTime)
|
|
return false;
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isPubkey = function isPubkey(s, key) {
|
|
var res;
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (script.lockTime(s))
|
|
s = s.slice(3);
|
|
|
|
if (s.length !== 2)
|
|
return false;
|
|
|
|
res = Array.isArray(s[0]) && s[1] === 'checksig';
|
|
|
|
if (!res)
|
|
return false;
|
|
|
|
if (key)
|
|
return utils.isEqual(s[0], key);
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isPubkeyhash = function isPubkeyhash(s, hash) {
|
|
var res;
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (script.lockTime(s))
|
|
s = s.slice(3);
|
|
|
|
if (s.length !== 5)
|
|
return false;
|
|
|
|
res = s[0] === 'dup'
|
|
&& s[1] === 'hash160'
|
|
&& Array.isArray(s[2])
|
|
&& s[3] === 'eqverify'
|
|
&& s[4] === 'checksig';
|
|
|
|
if (!res)
|
|
return false;
|
|
|
|
if (hash)
|
|
return utils.isEqual(s[2], hash);
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isMultisig = function isMultisig(s, keys) {
|
|
var m, n, i, j;
|
|
var total = 0;
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (script.lockTime(s))
|
|
s = s.slice(3);
|
|
|
|
if (s.length < 4)
|
|
return false;
|
|
|
|
if (s[s.length - 1] !== 'checkmultisig')
|
|
return false;
|
|
|
|
m = s[0];
|
|
|
|
if (Array.isArray(m)) {
|
|
if (m.length !== 1)
|
|
return false;
|
|
m = m[0];
|
|
}
|
|
|
|
if (!(m >= 1 && m <= 15))
|
|
return false;
|
|
|
|
n = s[s.length - 2];
|
|
|
|
if (Array.isArray(n)) {
|
|
if (n.length !== 1)
|
|
return false;
|
|
n = n[0];
|
|
}
|
|
|
|
if (!(n >= m && n <= 15))
|
|
return false;
|
|
|
|
if (n + 3 !== s.length)
|
|
return false;
|
|
|
|
for (i = 1; i < n + 1; i++) {
|
|
if (!Array.isArray(s[i]))
|
|
return false;
|
|
}
|
|
|
|
if (!keys)
|
|
return true;
|
|
|
|
keys = utils.sortKeys(keys);
|
|
|
|
for (i = 1; i < n + 1; i++) {
|
|
for (j = 0; j < keys.length; j++) {
|
|
if (utils.isEqual(s[i], keys[j])) {
|
|
total++;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
return total === n;
|
|
};
|
|
|
|
script.isScripthash = function isScripthash(s, hash) {
|
|
var res;
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (script.lockTime(s))
|
|
s = s.slice(3);
|
|
|
|
if (s.length !== 3)
|
|
return false;
|
|
|
|
res = s[0] === 'hash160'
|
|
&& Array.isArray(s[1])
|
|
&& s[1].length === 20
|
|
&& s[2] === 'eq';
|
|
|
|
if (!res)
|
|
return false;
|
|
|
|
if (hash)
|
|
return utils.isEqual(s[1], hash);
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isNulldata = function isNulldata(s) {
|
|
s = script.subscript(s);
|
|
|
|
if (s.length !== 2)
|
|
return false;
|
|
|
|
return s[0] === 'ret'
|
|
&& Array.isArray(s[1])
|
|
&& s[1].length <= constants.script.maxOpReturn;
|
|
};
|
|
|
|
script.nulldata = function nulldata(s) {
|
|
if (!script.isNulldata(s))
|
|
return false;
|
|
|
|
return script.subscript(s)[1];
|
|
};
|
|
|
|
script.standardInput = function standardInput(s) {
|
|
return (script.isPubkeyInput(s) && 'pubkey')
|
|
|| (script.isPubkeyhashInput(s) && 'pubkeyhash')
|
|
|| (script.isMultisigInput(s) && 'multisig')
|
|
|| (script.isScripthashInput(s) && 'scripthash')
|
|
|| null;
|
|
};
|
|
|
|
script.isPubkeyInput = function isPubkeyInput(s, key, tx, i) {
|
|
var res;
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (s.length !== 1 || !Array.isArray(s[0]))
|
|
return false;
|
|
|
|
if (!script.isSignature(s[0]))
|
|
return false;
|
|
|
|
// Execute the script against our key's
|
|
// checksig script to see if this is our input.
|
|
// This will only work if the script verifies.
|
|
if (key) {
|
|
assert(tx);
|
|
assert(i != null);
|
|
return script.verify(s, [key, 'checksig'], tx, i);
|
|
}
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isPubkeyhashInput = function isPubkeyhashInput(s, key) {
|
|
s = script.subscript(s);
|
|
|
|
if (s.length !== 2 || !Array.isArray(s[0]) || !Array.isArray(s[1]))
|
|
return false;
|
|
|
|
if (!script.isSignature(s[0]))
|
|
return false;
|
|
|
|
if (!script.isKey(s[1]))
|
|
return false;
|
|
|
|
if (key)
|
|
return utils.isEqual(s[1], key);
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isMultisigInput = function isMultisigInput(s, keys, tx, i) {
|
|
var i, res, o;
|
|
|
|
// We need to rule out scripthash
|
|
// because it may look like multisig
|
|
if (script.isScripthashInput(s))
|
|
return false;
|
|
|
|
s = script.subscript(s);
|
|
|
|
if (s.length < 3)
|
|
return false;
|
|
|
|
if (!Array.isArray(s[0]) || s[0].length !== 0)
|
|
return false;
|
|
|
|
for (i = 1; i < s.length; i++) {
|
|
if (!script.isSignature(s[i]))
|
|
return false;
|
|
}
|
|
|
|
// Execute the script against our pubkeys'
|
|
// redeem script to see if this is our input.
|
|
// This will only work if the script verifies.
|
|
if (keys) {
|
|
assert(keys.length >= 2);
|
|
assert(tx);
|
|
assert(i != null);
|
|
o = script.redeem(keys, s.length - 1, keys.length);
|
|
return script.verify(s, o, tx, i);
|
|
}
|
|
|
|
return true;
|
|
};
|
|
|
|
script.isScripthashInput = function isScripthashInput(s, data) {
|
|
var raw, redeem;
|
|
|
|
s = script.subscript(s);
|
|
|
|
// Grab the raw redeem script.
|
|
raw = s[s.length - 1];
|
|
|
|
// Need at least one data element with
|
|
// the redeem script.
|
|
if (s.length < 2)
|
|
return false;
|
|
|
|
// Last data element should be an array
|
|
// for the redeem script.
|
|
if (!Array.isArray(raw))
|
|
return false;
|
|
|
|
// P2SH redeem scripts can be nonstandard: make
|
|
// it easier for other functions to parse this.
|
|
redeem = script.decode(raw);
|
|
redeem = script.subscript(redeem);
|
|
if (script.lockTime(redeem))
|
|
redeem = redeem.slice(3);
|
|
|
|
// Get the "real" scriptSig
|
|
s = s.slice(0, -1);
|
|
|
|
// Do some sanity checking on the inputs
|
|
if (!script.isPubkeyInput(s)
|
|
&& !script.isPubkeyhashInput(s)
|
|
&& !script.isMultisigInput(s)) {
|
|
return false;
|
|
}
|
|
|
|
// Check data against last array in case
|
|
// a raw redeem script was passed in.
|
|
if (data && utils.isEqual(data, raw))
|
|
return true;
|
|
|
|
// Test against all other script types
|
|
return script.isPubkey(redeem, data)
|
|
|| script.isPubkeyhash(redeem, data)
|
|
|| script.isMultisig(redeem, data);
|
|
};
|
|
|
|
script.coinbaseBits = function coinbaseBits(s, block) {
|
|
var value;
|
|
|
|
s = s.filter(function(chunk) {
|
|
return Array.isArray(chunk) && chunk.length !== 0;
|
|
});
|
|
|
|
if (!Array.isArray(s[0]))
|
|
return { type: 'value', value: s[0] };
|
|
|
|
// Number can only store up to 53 bits (6 & 5/8 bytes)
|
|
if (s[0].length > 6)
|
|
return { type: 'value', value: s[0] };
|
|
|
|
value = new bn(s[0].slice().reverse()).toNumber();
|
|
|
|
// Test for bits and ts
|
|
if (block && block.version < 2) {
|
|
if (value === block.bits)
|
|
return { type: 'bits', value: value };
|
|
|
|
if (value === block.ts)
|
|
return { type: 'ts', value: value };
|
|
}
|
|
|
|
// Test for height
|
|
if (block) {
|
|
if (block.version < 2)
|
|
return { type: 'value', value: value };
|
|
} else {
|
|
if (value <= 227835)
|
|
return { type: 'value', value: value };
|
|
}
|
|
|
|
if (s[0].length < 3)
|
|
return { type: 'value', value: value };
|
|
|
|
return { type: 'height', value: value };
|
|
};
|
|
|
|
script.coinbaseHeight = function coinbaseHeight(s, block) {
|
|
var data = script.coinbaseBits(s, block);
|
|
if (data.type !== 'height')
|
|
return -1;
|
|
return data.value;
|
|
};
|
|
|
|
script.coinbase = function coinbase(s, block) {
|
|
var coinbase, data, extraNonce, flags;
|
|
|
|
s = s.filter(function(chunk) {
|
|
return Array.isArray(chunk) && chunk.length !== 0;
|
|
});
|
|
|
|
coinbase = {
|
|
script: s
|
|
};
|
|
|
|
data = script.coinbaseBits(s, block);
|
|
|
|
if (Array.isArray(s[1]))
|
|
extraNonce = new bn(s[1]);
|
|
|
|
flags = s.slice(2);
|
|
|
|
coinbase[data.type] = data.value;
|
|
coinbase.extraNonce = extraNonce;
|
|
coinbase.flags = flags;
|
|
coinbase.text =
|
|
flags.map(utils.array2utf8).join('')
|
|
.replace(/[\u0000-\u0019\u007f-\u00ff]/g, '');
|
|
|
|
return coinbase;
|
|
};
|
|
|
|
script.isCoinbase = function isCoinbase(s, block, strict) {
|
|
var coinbase = script.coinbase(s, block);
|
|
var size = script.size(s);
|
|
|
|
if (size < 2 || size > 100)
|
|
return false;
|
|
|
|
if (strict) {
|
|
if (s.length < 2)
|
|
return false;
|
|
|
|
if (coinbase.value != null)
|
|
return false;
|
|
|
|
if (coinbase.extraNonce == null)
|
|
return false;
|
|
|
|
if (block) {
|
|
// The early bitcoind miner (which used the bits
|
|
// as the first stack push) had no flags after it.
|
|
if (coinbase.bits != null && coinbase.flags.length)
|
|
return false;
|
|
}
|
|
}
|
|
|
|
return coinbase;
|
|
};
|
|
|
|
script.isKey = function isKey(key) {
|
|
if (!utils.isBuffer(key))
|
|
return false;
|
|
|
|
return key.length >= 33 && key.length <= 65;
|
|
};
|
|
|
|
script.isSignature = function isSignature(sig, allowZero) {
|
|
if (!utils.isBuffer(sig))
|
|
return false;
|
|
|
|
if (allowZero && sig.length === 0)
|
|
return true;
|
|
|
|
return sig.length >= 9 && sig.length <= 73;
|
|
};
|
|
|
|
// https://github.com/bitcoin/bips/blob/master/bip-0066.mediawiki
|
|
/**
|
|
* A canonical signature exists of: <30> <total len> <02> <len R> <R> <02> <len S> <S> <hashtype>
|
|
* Where R and S are not negative (their first byte has its highest bit not set), and not
|
|
* excessively padded (do not start with a 0 byte, unless an otherwise negative number follows,
|
|
* in which case a single 0 byte is necessary and even required).
|
|
*
|
|
* See https://bitcointalk.org/index.php?topic=8392.msg127623#msg127623
|
|
*
|
|
* This function is consensus-critical since BIP66.
|
|
*/
|
|
script.isValidSignature = function isValidSignature(sig, allowZero) {
|
|
var lenR, lenS;
|
|
|
|
if (!utils.isBuffer(sig))
|
|
return false;
|
|
|
|
// Empty signature. Not strictly DER encoded, but allowed to provide a
|
|
// compact way to provide an invalid signature for use with CHECK(MULTI)SIG
|
|
if (allowZero && sig.length === 0)
|
|
return true;
|
|
|
|
// Format: 0x30 [total-length] 0x02 [R-length] [R] 0x02 [S-length] [S] [sighash]
|
|
// * total-length: 1-byte length descriptor of everything that follows,
|
|
// excluding the sighash byte.
|
|
// * R-length: 1-byte length descriptor of the R value that follows.
|
|
// * R: arbitrary-length big-endian encoded R value. It must use the shortest
|
|
// possible encoding for a positive integers (which means no null bytes at
|
|
// the start, except a single one when the next byte has its highest bit set).
|
|
// * S-length: 1-byte length descriptor of the S value that follows.
|
|
// * S: arbitrary-length big-endian encoded S value. The same rules apply.
|
|
// * sighash: 1-byte value indicating what data is hashed (not part of the DER
|
|
// signature)
|
|
|
|
// Minimum and maximum size constraints.
|
|
if (sig.length < 9)
|
|
return false;
|
|
if (sig.length > 73)
|
|
return false;
|
|
|
|
// A signature is of type 0x30 (compound).
|
|
if (sig[0] !== 0x30)
|
|
return false;
|
|
|
|
// Make sure the length covers the entire signature.
|
|
if (sig[1] !== sig.length - 3)
|
|
return false;
|
|
|
|
// Extract the length of the R element.
|
|
lenR = sig[3];
|
|
|
|
// Make sure the length of the S element is still inside the signature.
|
|
if (5 + lenR >= sig.length)
|
|
return false;
|
|
|
|
// Extract the length of the S element.
|
|
lenS = sig[5 + lenR];
|
|
|
|
// Verify that the length of the signature matches the sum of the length
|
|
// of the elements.
|
|
if (lenR + lenS + 7 !== sig.length)
|
|
return false;
|
|
|
|
// Check whether the R element is an integer.
|
|
if (sig[2] !== 0x02)
|
|
return false;
|
|
|
|
// Zero-length integers are not allowed for R.
|
|
if (lenR === 0)
|
|
return false;
|
|
|
|
// Negative numbers are not allowed for R.
|
|
if (sig[4] & 0x80)
|
|
return false;
|
|
|
|
// Null bytes at the start of R are not allowed, unless R would
|
|
// otherwise be interpreted as a negative number.
|
|
if (lenR > 1 && (sig[4] === 0x00) && !(sig[5] & 0x80))
|
|
return false;
|
|
|
|
// Check whether the S element is an integer.
|
|
if (sig[lenR + 4] !== 0x02)
|
|
return false;
|
|
|
|
// Zero-length integers are not allowed for S.
|
|
if (lenS === 0)
|
|
return false;
|
|
|
|
// Negative numbers are not allowed for S.
|
|
if (sig[lenR + 6] & 0x80)
|
|
return false;
|
|
|
|
// Null bytes at the start of S are not allowed, unless S would otherwise be
|
|
// interpreted as a negative number.
|
|
if (lenS > 1 && (sig[lenR + 6] === 0x00) && !(sig[lenR + 7] & 0x80))
|
|
return false;
|
|
|
|
return true;
|
|
};
|
|
|
|
script.format = function format(input, output) {
|
|
var scripts = [];
|
|
var prev, redeem;
|
|
|
|
if (Array.isArray(input)) {
|
|
scripts.push(input);
|
|
} else if (Array.isArray(output)) {
|
|
scripts.push(output);
|
|
} else if (input) {
|
|
scripts.push(input.script);
|
|
if (input.out.tx && input.out.tx.outputs[input.out.index]) {
|
|
prev = input.out.tx.outputs[input.out.index].script;
|
|
scripts.push(prev);
|
|
if (script.isScripthash(prev)) {
|
|
redeem = script.decode(input.script[input.script.length - 1]);
|
|
scripts.push(redeem);
|
|
}
|
|
}
|
|
} else if (output) {
|
|
scripts.push(output.script);
|
|
}
|
|
|
|
scripts = scripts.map(function(script) {
|
|
return script.map(function(chunk) {
|
|
if (Array.isArray(chunk)) {
|
|
if (chunk.length === 0)
|
|
return 0 + '';
|
|
return '[' + utils.toHex(chunk) + ']';
|
|
}
|
|
if (typeof chunk === 'number')
|
|
return chunk + '';
|
|
return chunk;
|
|
}).join(' ');
|
|
});
|
|
|
|
return scripts;
|
|
};
|
|
|
|
script.pushOnly = function pushOnly(s) {
|
|
var i, op;
|
|
for (i = 0; i < s.length; i++) {
|
|
op = s[i];
|
|
if (Array.isArray(op) || (op >= 1 && op <= 16))
|
|
continue;
|
|
if (constants.opcodes[op] == null)
|
|
return false;
|
|
return false;
|
|
}
|
|
return true;
|
|
};
|
|
|
|
script.sigops = function sigops(s, accurate) {
|
|
var i, op;
|
|
var n = 0;
|
|
var lastOp = -1;
|
|
|
|
for (i = 0; i < s.length; i++) {
|
|
op = s[i];
|
|
if (Array.isArray(op))
|
|
continue;
|
|
if (constants.opcodes[op] == null)
|
|
return 0;
|
|
if (op === 'checksig' || op === 'checksigverify') {
|
|
n++;
|
|
} else if (op === 'checkmultisig' || op === 'checkmultisigverify') {
|
|
if (accurate && lastOp >= 1 && lastOp <= 16) {
|
|
n += lastOp;
|
|
} else {
|
|
n += constants.script.maxPubkeysPerMultisig;
|
|
}
|
|
}
|
|
lastOp = op;
|
|
}
|
|
|
|
return n;
|
|
};
|
|
|
|
script.sigopsScripthash = function sigopsScripthash(s) {
|
|
if (!script.isScripthashInput(s))
|
|
return 0;
|
|
|
|
if (!script.pushOnly(s))
|
|
return 0;
|
|
|
|
s = script.decode(s[s.length - 1]);
|
|
|
|
return script.sigops(s, true);
|
|
};
|
|
|
|
script.args = function args(s) {
|
|
var type, keys, m;
|
|
|
|
s = bcoin.script.subscript(s);
|
|
|
|
if (script.lockTime(s))
|
|
s = s.slice(3);
|
|
|
|
type = script.standard(s);
|
|
|
|
if (type === 'pubkey')
|
|
return 1;
|
|
|
|
if (type === 'pubkeyhash')
|
|
return 2;
|
|
|
|
if (type === 'multisig') {
|
|
keys = bcoin.script.isMultisig(s);
|
|
if (!pub)
|
|
return -1;
|
|
m = new bn(s[0]).toNumber();
|
|
if (keys.length < 1 || m < 1)
|
|
return -1;
|
|
return m + 1;
|
|
}
|
|
|
|
if (type === 'scripthash')
|
|
return 1;
|
|
|
|
if (type === 'nulldata')
|
|
return -1;
|
|
|
|
return -1;
|
|
};
|