diff --git a/public/include/classes/statistics.class.php b/public/include/classes/statistics.class.php index f6863c59..3f17c2bf 100644 --- a/public/include/classes/statistics.class.php +++ b/public/include/classes/statistics.class.php @@ -98,25 +98,25 @@ class Statistics { * @param none * @return data object Return our hashrateas an object **/ - public function getCurrentHashrate() { + public function getCurrentHashrate($interval=600) { $this->debug->append("STA " . __METHOD__, 4); if ($this->getGetCache() && $data = $this->memcache->get(__FUNCTION__)) return $data; $stmt = $this->mysqli->prepare(" SELECT ( ( - SELECT IFNULL(ROUND(COUNT(id) * POW(2, " . $this->config['difficulty'] . ")/600/1000), 0) AS hashrate + SELECT IFNULL(ROUND(COUNT(id) * POW(2, " . $this->config['difficulty'] . ") / ? / 1000), 0) AS hashrate FROM " . $this->share->getTableName() . " - WHERE time > DATE_SUB(now(), INTERVAL 10 MINUTE) + WHERE time > DATE_SUB(now(), INTERVAL ? SECOND) ) + ( - SELECT IFNULL(ROUND(COUNT(id) * POW(2, " . $this->config['difficulty'] . ")/600/1000), 0) AS hashrate + SELECT IFNULL(ROUND(COUNT(id) * POW(2, " . $this->config['difficulty'] . ") / ? / 1000), 0) AS hashrate FROM " . $this->share->getArchiveTableName() . " - WHERE time > DATE_SUB(now(), INTERVAL 10 MINUTE) + WHERE time > DATE_SUB(now(), INTERVAL ? SECOND) ) ) AS hashrate FROM DUAL"); // Catchall - if ($this->checkStmt($stmt) && $stmt->execute() && $result = $stmt->get_result() ) return $this->memcache->setCache(__FUNCTION__, $result->fetch_object()->hashrate); + if ($this->checkStmt($stmt) && $stmt->bind_param('iiii', $interval, $interval, $interval, $interval) && $stmt->execute() && $result = $stmt->get_result() ) return $this->memcache->setCache(__FUNCTION__, $result->fetch_object()->hashrate); $this->debug->append("Failed to get hashrate: " . $this->mysqli->error); return false; } @@ -246,28 +246,28 @@ class Statistics { * @param account_id integer User ID * @return data integer Current Hashrate in khash/s **/ - public function getUserHashrate($account_id) { + public function getUserHashrate($account_id, $interval=600) { $this->debug->append("STA " . __METHOD__, 4); - if ($data = $this->memcache->get(__FUNCTION__ . $account_id)) return $data; + if ($this->getGetCache() && $data = $this->memcache->get(__FUNCTION__ . $account_id)) return $data; $stmt = $this->mysqli->prepare(" SELECT ( - SELECT IFNULL(ROUND(COUNT(s.id) * POW(2, " . $this->config['difficulty'] . ") / 600 / 1000), 0) AS hashrate + SELECT IFNULL(ROUND(COUNT(s.id) * POW(2, " . $this->config['difficulty'] . ") / ? / 1000), 0) AS hashrate FROM " . $this->share->getTableName() . " AS s, " . $this->user->getTableName() . " AS u WHERE u.username = SUBSTRING_INDEX( s.username, '.', 1 ) - AND s.time > DATE_SUB(now(), INTERVAL 10 MINUTE) + AND s.time > DATE_SUB(now(), INTERVAL ? SECOND) AND u.id = ? ) + ( - SELECT IFNULL(ROUND(COUNT(s.id) * POW(2, " . $this->config['difficulty'] . ") / 600 / 1000), 0) AS hashrate + SELECT IFNULL(ROUND(COUNT(s.id) * POW(2, " . $this->config['difficulty'] . ") / ? / 1000), 0) AS hashrate FROM " . $this->share->getArchiveTableName() . " AS s, " . $this->user->getTableName() . " AS u WHERE u.username = SUBSTRING_INDEX( s.username, '.', 1 ) - AND s.time > DATE_SUB(now(), INTERVAL 10 MINUTE) + AND s.time > DATE_SUB(now(), INTERVAL ? SECOND) AND u.id = ? ) AS hashrate FROM DUAL"); - if ($this->checkStmt($stmt) && $stmt->bind_param("ii", $account_id, $account_id) && $stmt->execute() && $result = $stmt->get_result() ) + if ($this->checkStmt($stmt) && $stmt->bind_param("iiiiii", $interval, $interval, $account_id, $interval, $interval, $account_id) && $stmt->execute() && $result = $stmt->get_result() ) return $this->memcache->setCache(__FUNCTION__ . $account_id, $result->fetch_object()->hashrate); // Catchall $this->debug->append("Failed to fetch hashrate: " . $this->mysqli->error); @@ -279,17 +279,17 @@ class Statistics { * @param account_id integer User ID * @return data integer Current Sharerate in shares/s **/ - public function getUserSharerate($account_id) { + public function getUserSharerate($account_id, $interval=600) { $this->debug->append("STA " . __METHOD__, 4); - if ($data = $this->memcache->get(__FUNCTION__ . $account_id)) return $data; + if ($this->getGetCache() && $data = $this->memcache->get(__FUNCTION__ . $account_id)) return $data; $stmt = $this->mysqli->prepare(" - SELECT COUNT(s.id)/600 AS sharerate + SELECT COUNT(s.id) / ? AS sharerate FROM " . $this->share->getTableName() . " AS s, " . $this->user->getTableName() . " AS u WHERE u.username = SUBSTRING_INDEX( s.username, '.', 1 ) - AND s.time > DATE_SUB(now(), INTERVAL 10 MINUTE) + AND s.time > DATE_SUB(now(), INTERVAL ? SECOND) AND u.id = ?"); - if ($this->checkStmt($stmt) && $stmt->bind_param("i", $account_id) && $stmt->execute() && $result = $stmt->get_result() ) + if ($this->checkStmt($stmt) && $stmt->bind_param("iii", $interval, $interval, $account_id) && $stmt->execute() && $result = $stmt->get_result() ) return $this->memcache->setCache(__FUNCTION__ . $account_id, $result->fetch_object()->sharerate); // Catchall $this->debug->append("Failed to fetch sharerate: " . $this->mysqli->error); diff --git a/public/include/pages/api/getpoolhashrate.inc.php b/public/include/pages/api/getpoolhashrate.inc.php index 5546d321..3c80f426 100644 --- a/public/include/pages/api/getpoolhashrate.inc.php +++ b/public/include/pages/api/getpoolhashrate.inc.php @@ -10,7 +10,16 @@ $api->isActive(); $id = $user->checkApiKey($_REQUEST['api_key']); // Output JSON format -echo json_encode(array('getpoolhashrate' => $statistics->getCurrentHashrate())); +$statistics->setGetCache(false); +$start = microtime(true); +$dPoolHashrate = $statistics->getCurrentHashrate(300); +$end = microtime(true); +$runtime = ($end - $start) * 1000; +$statistics->setGetCache(true); +echo json_encode(array('getpoolhashrate' => array( + 'runtime' => $runtime, + 'hashrate' => $dPoolHashrate, +))); // Supress master template $supress_master = 1; diff --git a/public/include/pages/api/getuserhashrate.inc.php b/public/include/pages/api/getuserhashrate.inc.php new file mode 100644 index 00000000..99ac2de9 --- /dev/null +++ b/public/include/pages/api/getuserhashrate.inc.php @@ -0,0 +1,51 @@ +isActive(); + +// Check user token +$user_id = $user->checkApiKey($_REQUEST['api_key']); + +/** + * This check will ensure the user can do the following: + * Admin: Check any user via request id + * Regular: Check your own status + * Other: Deny access via checkApiKey + **/ +if ( ! $user->isAdmin($user_id) && ($_REQUEST['id'] != $user_id && !empty($_REQUEST['id']))) { + // User is admin and tries to access an ID that is not their own + header("HTTP/1.1 401 Unauthorized"); + die("Access denied"); +} else if ($user->isAdmin($user_id)) { + // Admin, so allow any ID passed in request + $id = $_REQUEST['id']; + // Is it a username or a user ID + ctype_digit($_REQUEST['id']) ? $username = $user->getUserName($_REQUEST['id']) : $username = $_REQUEST['id']; + ctype_digit($_REQUEST['id']) ? $id = $_REQUEST['id'] : $id = $user->getUserId($_REQUEST['id']); +} else { + // Not admin, only allow own user ID + $id = $user_id; + $username = $user->getUserName($id); +} + +// Gather un-cached data +$statistics->setGetCache(false); +$start = microtime(true); +$hashrate = $statistics->getUserHashrate($id, 300); +$end = microtime(true); +$runtime = ($end - $start)* 1000; + +// Output JSON format +echo json_encode(array('getuserhashrate' => array( + 'username' => $username, + 'runtime' => $runtime, + 'hashrate' => $hashrate +))); +$statistics->setGetCache(true); + +// Supress master template +$supress_master = 1; +?> diff --git a/public/include/pages/api/getusersharerate.inc.php b/public/include/pages/api/getusersharerate.inc.php new file mode 100644 index 00000000..f64572bf --- /dev/null +++ b/public/include/pages/api/getusersharerate.inc.php @@ -0,0 +1,51 @@ +isActive(); + +// Check user token +$user_id = $user->checkApiKey($_REQUEST['api_key']); + +/** + * This check will ensure the user can do the following: + * Admin: Check any user via request id + * Regular: Check your own status + * Other: Deny access via checkApiKey + **/ +if ( ! $user->isAdmin($user_id) && ($_REQUEST['id'] != $user_id && !empty($_REQUEST['id']))) { + // User is admin and tries to access an ID that is not their own + header("HTTP/1.1 401 Unauthorized"); + die("Access denied"); +} else if ($user->isAdmin($user_id)) { + // Admin, so allow any ID passed in request + $id = $_REQUEST['id']; + // Is it a username or a user ID + ctype_digit($_REQUEST['id']) ? $username = $user->getUserName($_REQUEST['id']) : $username = $_REQUEST['id']; + ctype_digit($_REQUEST['id']) ? $id = $_REQUEST['id'] : $id = $user->getUserId($_REQUEST['id']); +} else { + // Not admin, only allow own user ID + $id = $user_id; + $username = $user->getUserName($id); +} + +// Gather un-cached data +$statistics->setGetCache(false); +$start = microtime(true); +$sharerate = $statistics->getUserSharerate($id, 60); +$end = microtime(true); +$runtime = ($end - $start)* 1000; + +// Output JSON format +echo json_encode(array('getusersharerate' => array( + 'username' => $username, + 'runtime' => $runtime, + 'sharerate' => $sharerate +))); +$statistics->setGetCache(true); + +// Supress master template +$supress_master = 1; +?> diff --git a/public/site_assets/test/css/jquery.jqplot.min.css b/public/site_assets/test/css/jquery.jqplot.min.css new file mode 100644 index 00000000..0f84835b --- /dev/null +++ b/public/site_assets/test/css/jquery.jqplot.min.css @@ -0,0 +1 @@ +.jqplot-target{position:relative;color:#666;font-family:"Trebuchet MS",Arial,Helvetica,sans-serif;font-size:1em}.jqplot-axis{font-size:.75em}.jqplot-xaxis{margin-top:10px}.jqplot-x2axis{margin-bottom:10px}.jqplot-yaxis{margin-right:10px}.jqplot-y2axis,.jqplot-y3axis,.jqplot-y4axis,.jqplot-y5axis,.jqplot-y6axis,.jqplot-y7axis,.jqplot-y8axis,.jqplot-y9axis,.jqplot-yMidAxis{margin-left:10px;margin-right:10px}.jqplot-axis-tick,.jqplot-xaxis-tick,.jqplot-yaxis-tick,.jqplot-x2axis-tick,.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick,.jqplot-yMidAxis-tick{position:absolute;white-space:pre}.jqplot-xaxis-tick{top:0;left:15px;vertical-align:top}.jqplot-x2axis-tick{bottom:0;left:15px;vertical-align:bottom}.jqplot-yaxis-tick{right:0;top:15px;text-align:right}.jqplot-yaxis-tick.jqplot-breakTick{right:-20px;margin-right:0;padding:1px 5px 1px 5px;z-index:2;font-size:1.5em}.jqplot-y2axis-tick,.jqplot-y3axis-tick,.jqplot-y4axis-tick,.jqplot-y5axis-tick,.jqplot-y6axis-tick,.jqplot-y7axis-tick,.jqplot-y8axis-tick,.jqplot-y9axis-tick{left:0;top:15px;text-align:left}.jqplot-yMidAxis-tick{text-align:center;white-space:nowrap}.jqplot-xaxis-label{margin-top:10px;font-size:11pt;position:absolute}.jqplot-x2axis-label{margin-bottom:10px;font-size:11pt;position:absolute}.jqplot-yaxis-label{margin-right:10px;font-size:11pt;position:absolute}.jqplot-yMidAxis-label{font-size:11pt;position:absolute}.jqplot-y2axis-label,.jqplot-y3axis-label,.jqplot-y4axis-label,.jqplot-y5axis-label,.jqplot-y6axis-label,.jqplot-y7axis-label,.jqplot-y8axis-label,.jqplot-y9axis-label{font-size:11pt;margin-left:10px;position:absolute}.jqplot-meterGauge-tick{font-size:.75em;color:#999}.jqplot-meterGauge-label{font-size:1em;color:#999}table.jqplot-table-legend{margin-top:12px;margin-bottom:12px;margin-left:12px;margin-right:12px}table.jqplot-table-legend,table.jqplot-cursor-legend{background-color:rgba(255,255,255,0.6);border:1px solid #ccc;position:absolute;font-size:.75em}td.jqplot-table-legend{vertical-align:middle}td.jqplot-seriesToggle:hover,td.jqplot-seriesToggle:active{cursor:pointer}.jqplot-table-legend .jqplot-series-hidden{text-decoration:line-through}div.jqplot-table-legend-swatch-outline{border:1px solid #ccc;padding:1px}div.jqplot-table-legend-swatch{width:0;height:0;border-top-width:5px;border-bottom-width:5px;border-left-width:6px;border-right-width:6px;border-top-style:solid;border-bottom-style:solid;border-left-style:solid;border-right-style:solid}.jqplot-title{top:0;left:0;padding-bottom:.5em;font-size:1.2em}table.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em}.jqplot-cursor-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,0.5);padding:1px}.jqplot-highlighter-tooltip,.jqplot-canvasOverlay-tooltip{border:1px solid #ccc;font-size:.75em;white-space:nowrap;background:rgba(208,208,208,0.5);padding:1px}.jqplot-point-label{font-size:.75em;z-index:2}td.jqplot-cursor-legend-swatch{vertical-align:middle;text-align:center}div.jqplot-cursor-legend-swatch{width:1.2em;height:.7em}.jqplot-error{text-align:center}.jqplot-error-message{position:relative;top:46%;display:inline-block}div.jqplot-bubble-label{font-size:.8em;padding-left:2px;padding-right:2px;color:rgb(20%,20%,20%)}div.jqplot-bubble-label.jqplot-bubble-label-highlight{background:rgba(90%,90%,90%,0.7)}div.jqplot-noData-container{text-align:center;background-color:rgba(96%,96%,96%,0.3)} \ No newline at end of file diff --git a/public/site_assets/test/js/dist/MIT-LICENSE.txt b/public/site_assets/test/js/dist/MIT-LICENSE.txt new file mode 100644 index 00000000..f8111b9c --- /dev/null +++ b/public/site_assets/test/js/dist/MIT-LICENSE.txt @@ -0,0 +1,21 @@ +Title: MIT License + +Copyright (c) 2009-2013 Chris Leonello + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. \ No newline at end of file diff --git a/public/site_assets/test/js/dist/README.txt b/public/site_assets/test/js/dist/README.txt new file mode 100644 index 00000000..8777a20c --- /dev/null +++ b/public/site_assets/test/js/dist/README.txt @@ -0,0 +1,77 @@ +Title: jqPlot Readme + +Pure JavaScript plotting plugin for jQuery. + +To learn how to use jqPlot, start with the Basic Usage Instructions below. Then read the +usage.txt and jqPlotOptions.txt files included with the distribution. + +The jqPlot home page is at . + +Downloads can be found at . + +The mailing list is at . + +Examples and unit tests are at . + +Documentation is at . + +The project page and source code are at . + +Bugs, issues, feature requests: . + +Basic Usage Instructions: + +jqPlot requires jQuery (1.4+ required for certain features). jQuery 1.9.1 is included in +the distribution. To use jqPlot include jQuery, the jqPlot jQuery plugin, the jqPlot css file and +optionally the excanvas script to support IE version prior to IE 9 in your web page: + +> +> +> +> + +For usage instructions, see in usage.txt. For available options, see + in jqPlotOptions.txt. + +Building from source: + +If you've cloned the repository, you can build a distribution from source. +You need to have ant installed. You can simply +type "ant" from the jqplot directory to build the default "all" target. +There are 6 pertinent targets: clean, dist, min, docs, compress and all. Use: + +> ant -p + +to get a description of the various build targets. + +Legal Notices: + +Copyright (c) 2009-2013 Chris Leonello +jqPlot is currently available for use in all personal or commercial projects +under both the MIT and GPL version 2.0 licenses. This means that you can +choose the license that best suits your project and use it accordingly. + +Although not required, the author would appreciate an email letting him +know of any substantial use of jqPlot. You can reach the author at: +chris at jqplot or see http://www.jqplot.com/info.php . + +If you are feeling kind and generous, consider supporting the project by +making a donation at: http://www.jqplot.com/donate.php . + +jqPlot includes date instance methods and printf/sprintf functions by other authors: + +Date instance methods: + + author Ken Snyder (ken d snyder at gmail dot com) + date 2008-09-10 + version 2.0.2 (http://kendsnyder.com/sandbox/date/) + license Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + +JavaScript printf/sprintf functions. + + version 2007.04.27 + author Ash Searle + http://hexmen.com/blog/2007/03/printf-sprintf/ + http://hexmen.com/js/sprintf.js + The author (Ash Searle) has placed this code in the public domain: + "This code is unrestricted: you are free to use it however you like." diff --git a/public/site_assets/test/js/dist/changes.txt b/public/site_assets/test/js/dist/changes.txt new file mode 100644 index 00000000..ce990eae --- /dev/null +++ b/public/site_assets/test/js/dist/changes.txt @@ -0,0 +1,458 @@ +Title: Change Log + +1.0.8: +* Issue #375: sortMergedLabels does not sort string labels +* Issue #279: Groups > 3 Causes Alignment Issues +* Issue #439: IE can't display a customized legend in Quirks mode +* Issue #482: "Undefined" error message when plotting a chart with no data +* Issue #116: Don't mix spaces and tabs for indentation +* Issue #564: Metergauge renderer not resizable when replotting +* Issue #409: MeterGaugeRenderer replot/redraw offsets center +* Issue #523: Adding rectangles to Canvas Overlay plugin +* Issue #756: jqplot.min files contain non-UTF-8 characters +* Issue #223: fillToZero does not color negative values when crossover point is 0 +* Pull Request #23: Adding rectangles to Canvas Overlay plugin +* Pull Request #28: Cross-over points of 0 will actually change colors +* Pull Request #35: Don't highlight hidden bars or show tooltips for them +* Pull Request #41: Add dutch(nl) and svenska(sv) translations for dates +* Add tooltip support for Pie Charts +* Update to latest YUI compressor + +1.0.7: +* Issue #726: Bug in sprintf %p, sometimes it outputs exponential form rather than decimal +* Issue #717: Plot's preDrawHooks not called +* Issue #707: Browser hangs with LogAxisRenderer when value is 0 +* Issue #695: Horizontal Bar Chart Negative Series Colors Not Working +* Issue #670: Examples IE7, IE8 and IE9 multipleBarColors.html failure and fix +* Issue #636: X Axis Date Renderer Single Day Not plotting +* Issue #607: Integration issue +* Issue #571: Decimal numbers not properly formatted +* Issue #552: jqPlot crashes when interval too small +* Issue #536: DateAxisRenderer invalid scaling +* Issue #534: "decimalMark" in the "jqplot.sprintf.js" +* Issue #529: Scientific notation on label values ending in 0 +* Issue #521: invalid JS in meterGaugeRenderer.js +* Issue #516: Including BezierCurveRenderer plugin and initializing jqplot with no options give error +* Issue #500: DateAxisRenderer has timezone related issues +* Issue #452: Including ALL jqPlot plugins causes an Error +* Issue #494: No point when use LogAxisRenderer and a point has a zero value +* Issue #430: getIsoWeek: invalid method call +* Issue #280: jqplot Options +* Issue #179: Spelling/grammar +* Pull Request #18: Implement getTop in CanvasAxisTickRenderer +* Pull Request #21: Performance issue when drawing pointlabels with zeros/null values +* Pull Request #24: Added suggested fix in comment #8 for issue #536 +* Pull Request #29: Removed unbalanced addition of UTC offset +* Pull Request #33: Documentation fixes (issue #179, other changes) +* Pull Request #34: Start of updating jqPlotOptions.txt +* Pull Request #37: Example and suggested fix for issues #552 and issue #536 +* Pull Request #39: Fixed trailing comma which caused issues with IE7 + +1.0.6: +* Add left sidebar navigation to examples +* Update examples for jquery 1.9.1 and jquery ui 1.10.0 +* Add colorpicker.js to distribution +* Fix some problems with examples when viewing with local file system +* Add "minified" copyright notice for minified files, similar to jquery's notice. +* Pull Request #25: jqplot.sprintf.js is no longer the last file in the concatenated jquery.jqplot.js +* Pull Request #17: Fixed bug causing custom pointLabels passed with plot data to be ignored for horizontal bar graphs. +* Pull Request #10: Build error by invalid encoding. +* Issue #714: handle tickColor in meterGaugeRenderer +* Issue #519: jsDate Polish Localization + +1.0.5: +* Updated to jQuery 1.9 + +1.0.0b2: +* Major improvements in memory usage: +** Merged in changes from Timo Besenruether to reuse canvas elements and improve + memory performance. +** Fixed all identifiable DOM leaks. +** Mergged in changes from cguillot for memory improvements in IE < 9. +* Added vertical and dashed vertical line support for canvas overlay. +* Fixed bug where initially hidden plots would not display. +* Fixed bug with point labels and null data points. +* Updated to jQuery 1.6.1. +* Improved pie slice margin calculation and fixed slice margin and pie positioning + with small slices. +* Improved bar renderer so bars always start at 0 if: +** The axis is a linear axis (not log/date). +** There are no other line types besides bars attached to the axis. +** The data on the axis is all >= 0. +** The user has not specified a pad, padMin or forceTickAt0 = true option. +* Modified tick prefix behavious so prefix no added to all ticks, even if format + string is specified. +* Fix to ensure original tick formats are applied when zooming and resetting + zoom. +* Updated auto tick format string so format adjusted when zooming. +* Modified auto tick computation to put less ticks on small plots and more + ticks on large plots. +* Update bubble render to support gradients in IE 9. + +1.0.0b1: +* Much improved tick generation algorithm to get precise rounded + tick values (Thanks Scott Prahl!). +* Auto compute tick format string if none is provided. +* Much better "slicing" of pie charts when using "sliceMargin" option to set + a gap between the slices. +* Expanded canvasOverlay plugin to create arbitrary dashed and solid + horizontal and vertical lines on top of plot. +* Added defaultColors and defaultNegativeColors options to $.jqplot.config. +* Fixed issue #318, highlighter & bar renderer incompatability. +* Improve highlighter tooltip positioning with negative bars. +* Fixed #305, mispelling of jqlotDragStart and jqlotDragStop. MUST NOW BIND + TO jqplotDragStart and jqplotDragStop. +* Fixed #290, some variables left in global scope. +* Fixed #289, OHLC line widths hard coded at 1.5. Now set by lineWidth option. +* Fixed #296 for determining databounds on log axes. +* Updated to jQuery 1.5.1 +* Fixed waterfall plot to ensure first and last bars always fill to zero. +* Added lineJoin and lineCap option to series lines. +* Bar widths now based on width of grid, not plot target for better scaling. +* Added looseZoom option to cursor so zooming can produce well rounded ticks. +* Added forceTickAt0 and forceTickAt100 options to ensure there will always + be a tick at 0 or 100 in the plot. +* Fixed bug where cursor legend didn't honor series showLabel option. + + +1.0.0a: + +* Series can now be moved forward or backward in stack to e.g. bring a line + forward when mousing over a point. +* Can now move outside of grid area while zooming. Can have zoom + constrained to grid area or allow zooming outside. +* Fixed issue #142 with tooltip drawn on top of event canvas, hiding + mouse events. +* Fixed #147 where pie slices with 0 value not rendering properly in IE. +* Fixed #130 where stack data not sorted properly. +* Fixed bug with null values not handled properly in category axes. +* Fixed #156 where pie charts not rendering on QTWebKit. +* Now using feature detection for canvas and canvas text capability + rather than browser version. +* Added enahncedLegendRenderer plugin to allow multi row/column legends + and clickable labels to show/hide series. +* Added fillToValue option to allow filled line plot to fill to an + arbitrary value. +* Added block plot plugin. +* Added funnel type charts. +* Added meter gauge type charts. +* Added plot theming support. +* $.jqplot.config.enablePlugins now false by default. +* Implemented highlighting on bar, pie, donut, funnel, etc. charts. +* Fix to pointlabels plugin to align labels properly on multi series plots. +* Added custom error handling to display error message in plot area. +* Fixed issue where would call to draw grid border of 0 width would + result in a default border being drawn. +* Added options to place legend outside of grid and shrink grid so everything + stays within plot div. +* Fixed bug in color generator so now calls to get() continually cycle + through colors just like next(). +* Added defaultAxisStart option. +* Added gradient fills to bubbles. +* Added bubble charts. +* Added showLabels option to bubble charts. +* Pass bubble radius to event callback in bubble charts. +* Fixed #207, typo in docs. +* Fixed #206 where "value" pie slice data labels were displaying wrong + value. +* Fixed #147 with 0 value slices in IE6. +* Fixed issue #241, disabled varyBarColor option in stacked charts. +* Added dataRenderer option to allow custom processors for JSON, AJAX + and anywhere else you might want to get data. +* Fixed null value handling so plot now properly skip or join over nulls. +* Fixed showTicks and showTickMarks option conflicts. +* Fixed issue #185 where pointLabels plugin incompatibility could crash + pie, donut and other plots. +* Fixed #23 and #143 to obey gridPadding option. +* Fixed #233 with highlighter tooltip separator. +* Fixed #224 where type checking failing on GWT. +* Fixed #272 with pie highlighting not working on replot. +* Memory performance improvements. +* Changes to build script so everything should build when pulled from repo. +* Fixed issue #275, IE 6/7 don't support array indexing of strings. +* Added event listener hooks for mouseUp, mouseDown, etc. to all line plots. +* Fixed bug with highlighter not working when null in data. +* Updated to jQuery 1.4.4 +* Fixed bug where donut plots showed value of radians of slice instead + of actual data. +* Reverted to excanvas r3 so IE8 no longer has to emulate IE7. +* Added tooltipContentEditor option to highlighter, allowing callback + to manipulate tooltip content at run time (thanks Tim Bunce!). +* Fixed bug where axes scale not resetting. +* Fixed bug with date axes where data bounds not properly set. +* Fixed issue where tick marks disappear if grid lines turned off. +* Updated replot method to allow passing in axes options for more control. +* Added experimental support for "broken" axes. +* Fixed bug with pies where pies with 0 valued slices did not draw correctly. +* Added canvasOverlay plugin to allow drawing of arbitrary shapes on a canvas + over the plot. +* Added option to display arbitrary text/html (message, animated gif, etc.) if + plot is constructed without data. Allow a "data loading" indicator to be shown. +* Added resetAxisValues method to manually update axis ticks without + redrawing the plot. +* Fix to labels on negative bars so label postiion of 'n' will be below a negative bar, + just as it is above a positive bar (thanks guigod!). +* Added thousands separator character (') to sprintf formatting (thanks yuichi1004!). +* Re-factored date parsing/formatting to use new jsDate module which does not + extend the Date prototype. + + +0.9.7: + +* Added Mekko chart plot type with enhanced legend and axes support. +* Implemented vertical waterfall charts. Can create waterfall plot as + option to bar chart. See examples folder of distribution. +* Enhanced plot labels for waterfall style. +* Enhanced bar plots so you can now color each bar of a series + independently with the "varyBarColor" option. +* Re-factored series drawing so that each series and series shadow drawn + on its own canvas. Allows series to be redrawn independently of each other. +* Added additional default series colors. +* Added useNegativeColors option to turn off negative color array and use + only seriesColors array to define all bar/filled line colors. +* Fix css for cursor legend. +* Modified shape renderer so rectangles can be stroked and filled. +* Re-factored date methods out of dateAxisRenderer so that date formatter + and methods can be accesses outside of dateAxisRenderer plugin. +* Fixed #132, now trigger series change event on plot target instead of drag canvas. +* Fixes issue #116 where some source files had mix of tabs and spaces + for indentation. Should have been all spaces. +* Fixed issue #126, some links broken in docs section of web site. +* Fixed issue #90, trendline plugin incompatibility with pie renderer. +* Updated samples in examples folder of distribution to include navigation + links if web server is set up to process .html files with php. + + +0.9.6: + +* New, easier to use, replot() method for placing plots in tabs, accordions, + resizable containers or for changing plot parameters programmatically. +* Updated legend renderer for pie charts to draw swatches which will + print correctly. +* Fixed issue #118 with patch from taum so autoscale option will + honor tickInterval and numberTicks options +* Fix to plot diameter calculation for initially hidden plots. +* Added examples for making plots in jQuery UI tabs and accordions. +* Fixed issue #120 where pie chart with single slice not displaying + correctly in IE and Chrome + + +0.9.5.2: + +* Fixed #102 where double clicking on plot that has zoom enabled, but + has not been zoomed resulted in error. +* Fixed bug where candlestick coloring options not working. +* Added option to turn individual series labels off in the legend. + + +0.9.5.1: + +* Fixed bug where tooltip not working with OHLC and candlestick charts. +* Added additional marker styles: plus, X and dash. + + +0.9.5: + +* Implemented "zoomProxy". zoomProxy allows zooming one plot from another + such as an overview plot. +* Zooming can now be constrained to just x or y axis. +* Enhanced cursor plugin with vertical "dataTracking" line. This is a line + at the cursor location with a readout of data points at the line location + which are displayed in the chart legend. +* Changed cursor tooltip format string. Now one format string is used for + entire tooltip. +* Added mechanisms to specify plot size when plot target is hidden or plot + height/width otherwise cannot be determined from markup. +* Added $.jqplot.config object to specify jqplot wide configuration options. + These include enablePlugins to globally set the default plugin state on/off + and defaultHeight/defaultWidth to specify default plot height/width. +* Added fillToZero option which forces filled charts to fill to zero as opposed + to axis minimum. Thus negative filled bar/line values will fill upwards to + zero axis value. +* Added option to disable stacking on individual lines. +* Changed targetId property of the plot object so it now includes a "#" before + the id string. +* Improved tick and body sizing of Open Hi Low Close and candlestick charts. +* Removed lots of web site related files from the repository. This means that, + if working from the sources, user's won't be able to build the jqplot web + site and the docs/tests that are hosted on that site. The minified and + compressed distribution packages will build fine. +* Lots of examples were added to a separate examples directory to better show + functionality of jqPlot for local testing with the distribution. +* Many various bug fixes and other minor enhancements. + + +0.9.4: + +* Implemented axis labels. Labels can be rendered in div tags or as canvas + elements supporting rotated text. +* Improved rotated axis label positioning so labels will start or end at a + tick position. +* Fixed bug where an empty data series would hang plot rendering. +* completed issue #66 for misc. improvements to documentation. +* Fixed issue #64 where the same ID's were assigned to cursor and highlighter + elements. +* Added option to legend to encode special HTML characters. +* Fixed undesirable behavior where point labels for points off the plot + were being rendered. +* Added edgeTolerance option to point label renderer to control rendering of + labels near plot edges. + + +0.9.3: + +* Preliminary support for axis labels. Currently rendered into DIV tags, + so no rotated label support. This feature is currently experimental. +* Fixed bug #52, needed space in tick div tag between style and class declarations + or plot failed in certain application doctypes. +* Fixed issue #54, miter style line join for chart lines causing spikes at steep + changes in slope. Changed miter style to round. +* Added examples for new autoscaling algorithm. +* Fixed bug #57, category axis labels disappear on redraw() +* Improved algorithm which controlled maximum number of labels that would display + on a category axis. +* Fixed bug #45 where null values causing errors in plotData and gridData. +* Fixed issue #60 where seriesColors option was not working. + + +0.9.2: + +* Fixed bug #45 where a plot could crash if series had different numbers of points. +* Fixed issue #50, added option to turn off sorting of series data. +* Fixed issue #31, implemented a better axis autoscaling algorithm and added an autoscale option. + +0.9.1: + +* Fixed bug #40, when axis pad, padMax, padMin set to 0, graph would fail to render. +* Fixed bug #41 where pie and bar charts not rendered correctly on redraw(). +* Fixed bug #11, filled stacked line plots not rendering correctly in IE. +* Fixed bug #42 where stacked charts not rendering with string date axis ticks. +* Fixed bug in redraw() method where axes ticks were not reset. +* Fixed "jqplotPreRedrawEvent" that should have been named "jqplotPostRedraw" event. + +0.9.0: + +* Added Open Hi Low Close charts, Candlestick charts and Hi Low Close charts. +* Added support for arbitrary labels on the data points. +* Enhanced highlighter plugin to allow custom formatting control of entire tooltip. +* Enhanced highlighter to support multiple y values in a data point. +* Fixed bug #38 where series with a single point with a negative value would fail. +* Improvements to examples to show what plugins to include. +* Expanded documentation for some of the plugins. + +0.8.5: + +* Added zooming ability with double click or single click options to reset zoom. +* Modified default tick spacing algorithm for date axes to give more space to ticks. +* Fixed bug #2 where tickInterval wasn't working properly. +* Added neighborThreshold option to control how close mouse must be to + point to trigger neighbor detection. +* Added double click event handler on plot. + +0.8.0: + +* Support for up to 9 y axes. +* Added option to control padding at max/min bounds of axes separately. +* Closed issue #21, added options to control grid line color and width. +* Closed issue #20, added options to filled line charts to stoke above + fill and customize fill color and transparency. +* Improved structure of on line documentation to make usage and options + docs default. +* Added much documentation on options and css styling. + +0.7.1: + +* Bug fix release +* Fixed bug #6, missing semi-colons messing up some javascript compressors. +* Fixed bug #13 where 2D ticks array of [values, labels] would fail to + renderer with DateAxisRenderer. +* Fixes bug #16 where pie renderer overwriting options for all plot types + and crashing non pie plots. +* Fixes bug #17 constrainTo dragable option mispelled as "contstrainTo". + Fixed dragable color issue when used with trend lines. + +0.7.0: + +* Pie chart support +* Enabled tooltipLocation option in highlighter. +* Highlighter Tooltip will account for mark size and highlight size when + positioning itself. +* Added ability to show just x, y or both axes in highlighter tooltip. +* Added customization of separator between axes values in highlighter tooltip. +* Modified how shadows are drawn for lines, bars and markers. Now drawn first, + so they are always behind the object. +* Adjustments to shadow parameters on lines to account for new shadow positioning. +* Added a ColorGenerator class to robustly return next available color + for a plot with wrap around to first color at end. +* Udates to docs about css file. +* Fixed bug with String x values in series and IE error on sorting (Category Axis). +* Added cursor changes in dragable plugin when cursor near dragable point. + +0.6.6b: + +* Added excanvas.js and excanvas.min.js to compressed distributions. +* Added example/test html pages I had locally into repository and to + compressed distributions. + +0.6.6a: + +* Removed absolute positioning from dom element and put back into css file. +* Duplicate of 0.6.6 with a suffix to unambiguously differentiate between + previously posted 0.6.6 release. + +0.6.6: + +* Fixed bug #5, trend line plugin failing when no trend line options specified. +* Added absolute position css spec to axis tick dom element. +* Enhancement to category axes, more intuitive handling of series with + missing data values. + +0.6.5: + +* Fixed bug #4, series of unequal data length not rendering correctly. + This is a bugfix release only. + +0.6.4: + +* Fixed bug (issue #1 in tracker) where flat line data series (all x and/or y + values are euqal) or single value data series would crash. + +0.6.3: + +* Support for stacked line (a.k.a. area) and stacked bar (horizontal and + vertical) charts. +* Refactored barRenderer to use default shape and shadow renderers. +* Added info (contacts & support information) page to web site. + +0.6.2: + +* This is a minor upgrade to docs and build only. No functionality has changed. +* Ant build script generates entire site, examples, tests and distribution. +* Improvements to documentation. + +0.6.1: + +* New sprintf implementation from Ash Searle that implements %g. +* Fix to sprintf e/f formats. +* Created new format specifier, %p and %P to preserve significance. +* Modified p/P format to better display larger numbers. +* Fixed and simplified significant digits calculation for sprintf. +* Added option to have cursor tooltip follow the mouse or not. +* Added options to change size of highlight. +* Updates to handle dates like '6-May-09'. +* Mods to improve look of web site. +* Updates to documentation. +* Added license and copyright statement to source files. + +0.6.0: + +* Added rotated text support. Uses native canvas text functionality in + browsers that support it or draws text on canvas with Hershey font +* metrics for non-supporting browsers. +* Removed lots of lint in js code. +* Moved tick css from js code into css file. +* Fix to tick positioning css. y axis ticks were positioned to wrong side of axis div. +* Re-factored axis tick renderer instantiation into the axes renderers themselves. + + +For changes prior to 0.6.0 release, please see change log at http://bitbucket.org/cleonello/jqplot/changesets/ diff --git a/public/site_assets/test/js/dist/copyright.txt b/public/site_assets/test/js/dist/copyright.txt new file mode 100644 index 00000000..86d4c408 --- /dev/null +++ b/public/site_assets/test/js/dist/copyright.txt @@ -0,0 +1,56 @@ +/** + * jqPlot + * Pure JavaScript plotting plugin using jQuery + * + * Version: @VERSION + * + * Copyright (c) 2009-2013 Chris Leonello + * jqPlot is currently available for use in all personal or commercial projects + * under both the MIT (http://www.opensource.org/licenses/mit-license.php) and GPL + * version 2.0 (http://www.gnu.org/licenses/gpl-2.0.html) licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * Although not required, the author would appreciate an email letting him + * know of any substantial use of jqPlot. You can reach the author at: + * chris at jqplot dot com or see http://www.jqplot.com/info.php . + * + * If you are feeling kind and generous, consider supporting the project by + * making a donation at: http://www.jqplot.com/donate.php . + * + * sprintf functions contained in jqplot.sprintf.js by Ash Searle: + * + * version 2007.04.27 + * author Ash Searle + * http://hexmen.com/blog/2007/03/printf-sprintf/ + * http://hexmen.com/js/sprintf.js + * The author (Ash Searle) has placed this code in the public domain: + * "This code is unrestricted: you are free to use it however you like." + * + * included jsDate library by Chris Leonello: + * + * Copyright (c) 2010-2013 Chris Leonello + * + * jsDate is currently available for use in all personal or commercial projects + * under both the MIT and GPL version 2.0 licenses. This means that you can + * choose the license that best suits your project and use it accordingly. + * + * jsDate borrows many concepts and ideas from the Date Instance + * Methods by Ken Snyder along with some parts of Ken's actual code. + * + * Ken's origianl Date Instance Methods and copyright notice: + * + * Ken Snyder (ken d snyder at gmail dot com) + * 2008-09-10 + * version 2.0.2 (http://kendsnyder.com/sandbox/date/) + * Creative Commons Attribution License 3.0 (http://creativecommons.org/licenses/by/3.0/) + * + * jqplotToImage function based on Larry Siden's export-jqplot-to-png.js. + * Larry has generously given permission to adapt his code for inclusion + * into jqPlot. + * + * Larry's original code can be found here: + * + * https://github.com/lsiden/export-jqplot-to-png + * + * + */ diff --git a/public/site_assets/test/js/dist/docs/files/MIT-LICENSE-txt.html b/public/site_assets/test/js/dist/docs/files/MIT-LICENSE-txt.html new file mode 100644 index 00000000..4a36c991 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/MIT-LICENSE-txt.html @@ -0,0 +1,39 @@ + + +MIT License + + + + + + + + + +

Copyright © 2009-2013 Chris Leonello

Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the “Software”), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:

The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.

THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.  IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

+ +
+ + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/changes-txt.html b/public/site_assets/test/js/dist/docs/files/changes-txt.html new file mode 100644 index 00000000..93e1154c --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/changes-txt.html @@ -0,0 +1,39 @@ + + +Change Log + + + + + + + + + +

1.0.8

  • Issue #375: sortMergedLabels does not sort string labels
  • Issue #279: Groups > 3 Causes Alignment Issues
  • Issue #439: IE can’t display a customized legend in Quirks mode
  • Issue #482: “Undefined” error message when plotting a chart with no data
  • Issue #116: Don’t mix spaces and tabs for indentation
  • Issue #564: Metergauge renderer not resizable when replotting
  • Issue #409: MeterGaugeRenderer replot/redraw offsets center
  • Issue #523: Adding rectangles to Canvas Overlay plugin
  • Issue #756: jqplot.min files contain non-UTF-8 characters
  • Issue #223: fillToZero does not color negative values when crossover point is 0
  • Pull Request #23: Adding rectangles to Canvas Overlay plugin
  • Pull Request #28: Cross-over points of 0 will actually change colors
  • Pull Request #35: Don’t highlight hidden bars or show tooltips for them
  • Pull Request #41: Add dutch(nl) and svenska(sv) translations for dates
  • Add tooltip support for Pie Charts
  • Update to latest YUI compressor

1.0.7

  • Issue #726: Bug in sprintf %p, sometimes it outputs exponential form rather than decimal
  • Issue #717: Plot’s preDrawHooks not called
  • Issue #707: Browser hangs with LogAxisRenderer when value is 0
  • Issue #695: Horizontal Bar Chart Negative Series Colors Not Working
  • Issue #670: Examples IE7, IE8 and IE9 multipleBarColors.html failure and fix
  • Issue #636: X Axis Date Renderer Single Day Not plotting
  • Issue #607: Integration issue
  • Issue #571: Decimal numbers not properly formatted
  • Issue #552: jqPlot crashes when interval too small
  • Issue #536: DateAxisRenderer invalid scaling
  • Issue #534: “decimalMark” in the “jqplot.sprintf.js”
  • Issue #529: Scientific notation on label values ending in 0
  • Issue #521: invalid JS in meterGaugeRenderer.js
  • Issue #516: Including BezierCurveRenderer plugin and initializing jqplot with no options give error
  • Issue #500: DateAxisRenderer has timezone related issues
  • Issue #452: Including ALL jqPlot plugins causes an Error
  • Issue #494: No point when use LogAxisRenderer and a point has a zero value
  • Issue #430: getIsoWeek: invalid method call
  • Issue #280: jqplot Options
  • Issue #179: Spelling/grammar
  • Pull Request #18: Implement getTop in CanvasAxisTickRenderer
  • Pull Request #21: Performance issue when drawing pointlabels with zeros/null values
  • Pull Request #24: Added suggested fix in comment #8 for issue #536
  • Pull Request #29: Removed unbalanced addition of UTC offset
  • Pull Request #33: Documentation fixes (issue #179, other changes)
  • Pull Request #34: Start of updating jqPlotOptions.txt
  • Pull Request #37: Example and suggested fix for issues #552 and issue #536
  • Pull Request #39: Fixed trailing comma which caused issues with IE7

1.0.6

  • Add left sidebar navigation to examples
  • Update examples for jquery 1.9.1 and jquery ui 1.10.0
  • Add colorpicker.js to distribution
  • Fix some problems with examples when viewing with local file system
  • Add “minified” copyright notice for minified files, similar to jquery’s notice.
  • Pull Request #25: jqplot.sprintf.js is no longer the last file in the concatenated jquery.jqplot.js
  • Pull Request #17: Fixed bug causing custom pointLabels passed with plot data to be ignored for horizontal bar graphs.
  • Pull Request #10: Build error by invalid encoding.
  • Issue #714: handle tickColor in meterGaugeRenderer
  • Issue #519: jsDate Polish Localization

1.0.5

  • Updated to jQuery 1.9

1.0.0b2

  • Major improvements in memory usage: ** Merged in changes from Timo Besenruether to reuse canvas elements and improve memory performance.  ** Fixed all identifiable DOM leaks.  ** Mergged in changes from cguillot for memory improvements in IE < 9.
  • Added vertical and dashed vertical line support for canvas overlay.
  • Fixed bug where initially hidden plots would not display.
  • Fixed bug with point labels and null data points.
  • Updated to jQuery 1.6.1.
  • Improved pie slice margin calculation and fixed slice margin and pie positioning with small slices.
  • Improved bar renderer so bars always start at 0 if: ** The axis is a linear axis (not log/date).  ** There are no other line types besides bars attached to the axis.  ** The data on the axis is all >= 0.  ** The user has not specified a pad, padMin or forceTickAt0 = true option.
  • Modified tick prefix behavious so prefix no added to all ticks, even if format string is specified.
  • Fix to ensure original tick formats are applied when zooming and resetting zoom.
  • Updated auto tick format string so format adjusted when zooming.
  • Modified auto tick computation to put less ticks on small plots and more ticks on large plots.
  • Update bubble render to support gradients in IE 9.

1.0.0b1

  • Much improved tick generation algorithm to get precise rounded tick values (Thanks Scott Prahl!).
  • Auto compute tick format string if none is provided.
  • Much better “slicing” of pie charts when using “sliceMargin” option to set a gap between the slices.
  • Expanded canvasOverlay plugin to create arbitrary dashed and solid horizontal and vertical lines on top of plot.
  • Added defaultColors and defaultNegativeColors options to $.jqplot.config.
  • Fixed issue #318, highlighter & bar renderer incompatability.
  • Improve highlighter tooltip positioning with negative bars.
  • Fixed #305, mispelling of jqlotDragStart and jqlotDragStop.  MUST NOW BIND TO jqplotDragStart and jqplotDragStop.
  • Fixed #290, some variables left in global scope.
  • Fixed #289, OHLC line widths hard coded at 1.5.  Now set by lineWidth option.
  • Fixed #296 for determining databounds on log axes.
  • Updated to jQuery 1.5.1
  • Fixed waterfall plot to ensure first and last bars always fill to zero.
  • Added lineJoin and lineCap option to series lines.
  • Bar widths now based on width of grid, not plot target for better scaling.
  • Added looseZoom option to cursor so zooming can produce well rounded ticks.
  • Added forceTickAt0 and forceTickAt100 options to ensure there will always be a tick at 0 or 100 in the plot.
  • Fixed bug where cursor legend didn’t honor series showLabel option.

1.0.0a

  • Series can now be moved forward or backward in stack to e.g. bring a line forward when mousing over a point.
  • Can now move outside of grid area while zooming.  Can have zoom constrained to grid area or allow zooming outside.
  • Fixed issue #142 with tooltip drawn on top of event canvas, hiding mouse events.
  • Fixed #147 where pie slices with 0 value not rendering properly in IE.
  • Fixed #130 where stack data not sorted properly.
  • Fixed bug with null values not handled properly in category axes.
  • Fixed #156 where pie charts not rendering on QTWebKit.
  • Now using feature detection for canvas and canvas text capability rather than browser version.
  • Added enahncedLegendRenderer plugin to allow multi row/column legends and clickable labels to show/hide series.
  • Added fillToValue option to allow filled line plot to fill to an arbitrary value.
  • Added block plot plugin.
  • Added funnel type charts.
  • Added meter gauge type charts.
  • Added plot theming support.
  • $.jqplot.config.enablePlugins now false by default.
  • Implemented highlighting on bar, pie, donut, funnel, etc. charts.
  • Fix to pointlabels plugin to align labels properly on multi series plots.
  • Added custom error handling to display error message in plot area.
  • Fixed issue where would call to draw grid border of 0 width would result in a default border being drawn.
  • Added options to place legend outside of grid and shrink grid so everything stays within plot div.
  • Fixed bug in color generator so now calls to get() continually cycle through colors just like next().
  • Added defaultAxisStart option.
  • Added gradient fills to bubbles.
  • Added bubble charts.
  • Added showLabels option to bubble charts.
  • Pass bubble radius to event callback in bubble charts.
  • Fixed #207, typo in docs.
  • Fixed #206 where “value” pie slice data labels were displaying wrong value.
  • Fixed #147 with 0 value slices in IE6.
  • Fixed issue #241, disabled varyBarColor option in stacked charts.
  • Added dataRenderer option to allow custom processors for JSON, AJAX and anywhere else you might want to get data.
  • Fixed null value handling so plot now properly skip or join over nulls.
  • Fixed showTicks and showTickMarks option conflicts.
  • Fixed issue #185 where pointLabels plugin incompatibility could crash pie, donut and other plots.
  • Fixed #23 and #143 to obey gridPadding option.
  • Fixed #233 with highlighter tooltip separator.
  • Fixed #224 where type checking failing on GWT.
  • Fixed #272 with pie highlighting not working on replot.
  • Memory performance improvements.
  • Changes to build script so everything should build when pulled from repo.
  • Fixed issue #275, IE 6/7 don’t support array indexing of strings.
  • Added event listener hooks for mouseUp, mouseDown, etc. to all line plots.
  • Fixed bug with highlighter not working when null in data.
  • Updated to jQuery 1.4.4
  • Fixed bug where donut plots showed value of radians of slice instead of actual data.
  • Reverted to excanvas r3 so IE8 no longer has to emulate IE7.
  • Added tooltipContentEditor option to highlighter, allowing callback to manipulate tooltip content at run time (thanks Tim Bunce!).
  • Fixed bug where axes scale not resetting.
  • Fixed bug with date axes where data bounds not properly set.
  • Fixed issue where tick marks disappear if grid lines turned off.
  • Updated replot method to allow passing in axes options for more control.
  • Added experimental support for “broken” axes.
  • Fixed bug with pies where pies with 0 valued slices did not draw correctly.
  • Added canvasOverlay plugin to allow drawing of arbitrary shapes on a canvas over the plot.
  • Added option to display arbitrary text/html (message, animated gif, etc.) if plot is constructed without data.  Allow a “data loading” indicator to be shown.
  • Added resetAxisValues method to manually update axis ticks without redrawing the plot.
  • Fix to labels on negative bars so label postiion of ‘n’ will be below a negative bar, just as it is above a positive bar (thanks guigod!).
  • Added thousands separator character (‘) to sprintf formatting (thanks yuichi1004!).
  • Re-factored date parsing/formatting to use new jsDate module which does not extend the Date prototype.

0.9.7

  • Added Mekko chart plot type with enhanced legend and axes support.
  • Implemented vertical waterfall charts.  Can create waterfall plot as option to bar chart.  See examples folder of distribution.
  • Enhanced plot labels for waterfall style.
  • Enhanced bar plots so you can now color each bar of a series independently with the “varyBarColor” option.
  • Re-factored series drawing so that each series and series shadow drawn on its own canvas.  Allows series to be redrawn independently of each other.
  • Added additional default series colors.
  • Added useNegativeColors option to turn off negative color array and use only seriesColors array to define all bar/filled line colors.
  • Fix css for cursor legend.
  • Modified shape renderer so rectangles can be stroked and filled.
  • Re-factored date methods out of dateAxisRenderer so that date formatter and methods can be accesses outside of dateAxisRenderer plugin.
  • Fixed #132, now trigger series change event on plot target instead of drag canvas.
  • Fixes issue #116 where some source files had mix of tabs and spaces for indentation.  Should have been all spaces.
  • Fixed issue #126, some links broken in docs section of web site.
  • Fixed issue #90, trendline plugin incompatibility with pie renderer.
  • Updated samples in examples folder of distribution to include navigation links if web server is set up to process .html files with php.

0.9.6

  • New, easier to use, replot() method for placing plots in tabs, accordions, resizable containers or for changing plot parameters programmatically.
  • Updated legend renderer for pie charts to draw swatches which will print correctly.
  • Fixed issue #118 with patch from taum so autoscale option will honor tickInterval and numberTicks options
  • Fix to plot diameter calculation for initially hidden plots.
  • Added examples for making plots in jQuery UI tabs and accordions.
  • Fixed issue #120 where pie chart with single slice not displaying correctly in IE and Chrome

0.9.5.2

  • Fixed #102 where double clicking on plot that has zoom enabled, but has not been zoomed resulted in error.
  • Fixed bug where candlestick coloring options not working.
  • Added option to turn individual series labels off in the legend.

0.9.5.1

  • Fixed bug where tooltip not working with OHLC and candlestick charts.
  • Added additional marker styles: plus, X and dash.

0.9.5

  • Implemented “zoomProxy”.  zoomProxy allows zooming one plot from another such as an overview plot.
  • Zooming can now be constrained to just x or y axis.
  • Enhanced cursor plugin with vertical “dataTracking” line.  This is a line at the cursor location with a readout of data points at the line location which are displayed in the chart legend.
  • Changed cursor tooltip format string.  Now one format string is used for entire tooltip.
  • Added mechanisms to specify plot size when plot target is hidden or plot height/width otherwise cannot be determined from markup.
  • Added $.jqplot.config object to specify jqplot wide configuration options.  These include enablePlugins to globally set the default plugin state on/off and defaultHeight/defaultWidth to specify default plot height/width.
  • Added fillToZero option which forces filled charts to fill to zero as opposed to axis minimum.  Thus negative filled bar/line values will fill upwards to zero axis value.
  • Added option to disable stacking on individual lines.
  • Changed targetId property of the plot object so it now includes a “#” before the id string.
  • Improved tick and body sizing of Open Hi Low Close and candlestick charts.
  • Removed lots of web site related files from the repository.  This means that, if working from the sources, user’s won’t be able to build the jqplot web site and the docs/tests that are hosted on that site.  The minified and compressed distribution packages will build fine.
  • Lots of examples were added to a separate examples directory to better show functionality of jqPlot for local testing with the distribution.
  • Many various bug fixes and other minor enhancements.

0.9.4

  • Implemented axis labels.  Labels can be rendered in div tags or as canvas elements supporting rotated text.
  • Improved rotated axis label positioning so labels will start or end at a tick position.
  • Fixed bug where an empty data series would hang plot rendering.
  • completed issue #66 for misc. improvements to documentation.
  • Fixed issue #64 where the same ID’s were assigned to cursor and highlighter elements.
  • Added option to legend to encode special HTML characters.
  • Fixed undesirable behavior where point labels for points off the plot were being rendered.
  • Added edgeTolerance option to point label renderer to control rendering of labels near plot edges.

0.9.3

  • Preliminary support for axis labels.  Currently rendered into DIV tags, so no rotated label support.  This feature is currently experimental.
  • Fixed bug #52, needed space in tick div tag between style and class declarations or plot failed in certain application doctypes.
  • Fixed issue #54, miter style line join for chart lines causing spikes at steep changes in slope.  Changed miter style to round.
  • Added examples for new autoscaling algorithm.
  • Fixed bug #57, category axis labels disappear on redraw()
  • Improved algorithm which controlled maximum number of labels that would display on a category axis.
  • Fixed bug #45 where null values causing errors in plotData and gridData.
  • Fixed issue #60 where seriesColors option was not working.

0.9.2

  • Fixed bug #45 where a plot could crash if series had different numbers of points.
  • Fixed issue #50, added option to turn off sorting of series data.
  • Fixed issue #31, implemented a better axis autoscaling algorithm and added an autoscale option.

0.9.1

  • Fixed bug #40, when axis pad, padMax, padMin set to 0, graph would fail to render.
  • Fixed bug #41 where pie and bar charts not rendered correctly on redraw().
  • Fixed bug #11, filled stacked line plots not rendering correctly in IE.
  • Fixed bug #42 where stacked charts not rendering with string date axis ticks.
  • Fixed bug in redraw() method where axes ticks were not reset.
  • Fixed “jqplotPreRedrawEvent” that should have been named “jqplotPostRedraw” event.

0.9.0

  • Added Open Hi Low Close charts, Candlestick charts and Hi Low Close charts.
  • Added support for arbitrary labels on the data points.
  • Enhanced highlighter plugin to allow custom formatting control of entire tooltip.
  • Enhanced highlighter to support multiple y values in a data point.
  • Fixed bug #38 where series with a single point with a negative value would fail.
  • Improvements to examples to show what plugins to include.
  • Expanded documentation for some of the plugins.

0.8.5

  • Added zooming ability with double click or single click options to reset zoom.
  • Modified default tick spacing algorithm for date axes to give more space to ticks.
  • Fixed bug #2 where tickInterval wasn’t working properly.
  • Added neighborThreshold option to control how close mouse must be to point to trigger neighbor detection.
  • Added double click event handler on plot.

0.8.0

  • Support for up to 9 y axes.
  • Added option to control padding at max/min bounds of axes separately.
  • Closed issue #21, added options to control grid line color and width.
  • Closed issue #20, added options to filled line charts to stoke above fill and customize fill color and transparency.
  • Improved structure of on line documentation to make usage and options docs default.
  • Added much documentation on options and css styling.

0.7.1

  • Bug fix release
  • Fixed bug #6, missing semi-colons messing up some javascript compressors.
  • Fixed bug #13 where 2D ticks array of [values, labels] would fail to renderer with DateAxisRenderer.
  • Fixes bug #16 where pie renderer overwriting options for all plot types and crashing non pie plots.
  • Fixes bug #17 constrainTo dragable option mispelled as “contstrainTo”.  Fixed dragable color issue when used with trend lines.

0.7.0

  • Pie chart support
  • Enabled tooltipLocation option in highlighter.
  • Highlighter Tooltip will account for mark size and highlight size when positioning itself.
  • Added ability to show just x, y or both axes in highlighter tooltip.
  • Added customization of separator between axes values in highlighter tooltip.
  • Modified how shadows are drawn for lines, bars and markers.  Now drawn first, so they are always behind the object.
  • Adjustments to shadow parameters on lines to account for new shadow positioning.
  • Added a ColorGenerator class to robustly return next available color for a plot with wrap around to first color at end.
  • Udates to docs about css file.
  • Fixed bug with String x values in series and IE error on sorting (Category Axis).
  • Added cursor changes in dragable plugin when cursor near dragable point.

0.6.6b

  • Added excanvas.js and excanvas.min.js to compressed distributions.
  • Added example/test html pages I had locally into repository and to compressed distributions.

0.6.6a

  • Removed absolute positioning from dom element and put back into css file.
  • Duplicate of 0.6.6 with a suffix to unambiguously differentiate between previously posted 0.6.6 release.

0.6.6

  • Fixed bug #5, trend line plugin failing when no trend line options specified.
  • Added absolute position css spec to axis tick dom element.
  • Enhancement to category axes, more intuitive handling of series with missing data values.

0.6.5

  • Fixed bug #4, series of unequal data length not rendering correctly.  This is a bugfix release only.

0.6.4

  • Fixed bug (issue #1 in tracker) where flat line data series (all x and/or y values are euqal) or single value data series would crash.

0.6.3

  • Support for stacked line (a.k.a. area) and stacked bar (horizontal and vertical) charts.
  • Refactored barRenderer to use default shape and shadow renderers.
  • Added info (contacts & support information) page to web site.

0.6.2

  • This is a minor upgrade to docs and build only.  No functionality has changed.
  • Ant build script generates entire site, examples, tests and distribution.
  • Improvements to documentation.

0.6.1

  • New sprintf implementation from Ash Searle that implements %g.
  • Fix to sprintf e/f formats.
  • Created new format specifier, %p and %P to preserve significance.
  • Modified p/P format to better display larger numbers.
  • Fixed and simplified significant digits calculation for sprintf.
  • Added option to have cursor tooltip follow the mouse or not.
  • Added options to change size of highlight.
  • Updates to handle dates like ‘6-May-09’.
  • Mods to improve look of web site.
  • Updates to documentation.
  • Added license and copyright statement to source files.

0.6.0

  • Added rotated text support.  Uses native canvas text functionality in browsers that support it or draws text on canvas with Hershey font
  • metrics for non-supporting browsers.
  • Removed lots of lint in js code.
  • Moved tick css from js code into css file.
  • Fix to tick positioning css.  y axis ticks were positioned to wrong side of axis div.
  • Re-factored axis tick renderer instantiation into the axes renderers themselves.

For changes prior to 0.6.0 release, please see change log at http://bitbucket.org/cleonello/jqplot/changesets/

+ +
+ + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/gpl-2-0-txt.html b/public/site_assets/test/js/dist/docs/files/gpl-2-0-txt.html new file mode 100644 index 00000000..c71baf32 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/gpl-2-0-txt.html @@ -0,0 +1,39 @@ + + +GPL Version 2 + + + + + + + + + +

GNU GENERAL PUBLIC LICENSE Version 2, June 1991

Copyright © 1989, 1991 Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA Everyone is permitted to copy and distribute verbatim copies of this license document, but changing it is not allowed.

Preamble

The licenses for most software are designed to take away your freedom to share and change it.  By contrast, the GNU General Public License is intended to guarantee your freedom to share and change free software--to make sure the software is free for all its users.  This General Public License applies to most of the Free Software Foundation’s software and to any other program whose authors commit to using it.  (Some other Free Software Foundation software is covered by the GNU Lesser General Public License instead.)  You can apply it to your programs, too.

When we speak of free software, we are referring to freedom, not price.  Our General Public Licenses are designed to make sure that you have the freedom to distribute copies of free software (and charge for this service if you wish), that you receive source code or can get it if you want it, that you can change the software or use pieces of it in new free programs; and that you know you can do these things.

To protect your rights, we need to make restrictions that forbid anyone to deny you these rights or to ask you to surrender the rights.  These restrictions translate to certain responsibilities for you if you distribute copies of the software, or if you modify it.

For example, if you distribute copies of such a program, whether gratis or for a fee, you must give the recipients all the rights that you have.  You must make sure that they, too, receive or can get the source code.  And you must show them these terms so they know their rights.

We protect your rights with two steps: (1) copyright the software, and (2) offer you this license which gives you legal permission to copy, distribute and/or modify the software.

Also, for each author’s protection and ours, we want to make certain that everyone understands that there is no warranty for this free software.  If the software is modified by someone else and passed on, we want its recipients to know that what they have is not the original, so that any problems introduced by others will not reflect on the original authors’ reputations.

Finally, any free program is threatened constantly by software patents.  We wish to avoid the danger that redistributors of a free program will individually obtain patent licenses, in effect making the program proprietary.  To prevent this, we have made it clear that any patent must be licensed for everyone’s free use or not licensed at all.

The precise terms and conditions for copying, distribution and modification follow.

GNU GENERAL PUBLIC LICENSE TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION

0.  This License applies to any program or other work which contains a notice placed by the copyright holder saying it may be distributed under the terms of this General Public License.  The “Program”, below, refers to any such program or work, and a “work based on the Program” means either the Program or any derivative work under copyright law: that is to say, a work containing the Program or a portion of it, either verbatim or with modifications and/or translated into another language.  (Hereinafter, translation is included without limitation in the term “modification”.)  Each licensee is addressed as “you”.

Activities other than copying, distribution and modification are not covered by this License; they are outside its scope.  The act of running the Program is not restricted, and the output from the Program is covered only if its contents constitute a work based on the Program (independent of having been made by running the Program).  Whether that is true depends on what the Program does.

1.  You may copy and distribute verbatim copies of the Program’s source code as you receive it, in any medium, provided that you conspicuously and appropriately publish on each copy an appropriate copyright notice and disclaimer of warranty; keep intact all the notices that refer to this License and to the absence of any warranty; and give any other recipients of the Program a copy of this License along with the Program.

You may charge a fee for the physical act of transferring a copy, and you may at your option offer warranty protection in exchange for a fee.

2.  You may modify your copy or copies of the Program or any portion of it, thus forming a work based on the Program, and copy and distribute such modifications or work under the terms of Section 1 above, provided that you also meet all of these conditions:

a) You must cause the modified files to carry prominent notices stating that you changed the files and the date of any change.

b) You must cause any work that you distribute or publish, that in whole or in part contains or is derived from the Program or any part thereof, to be licensed as a whole at no charge to all third parties under the terms of this License.

c) If the modified program normally reads commands interactively when run, you must cause it, when started running for such interactive use in the most ordinary way, to print or display an announcement including an appropriate copyright notice and a notice that there is no warranty (or else, saying that you provide a warranty) and that users may redistribute the program under these conditions, and telling the user how to view a copy of this License.  (Exception: if the Program itself is interactive but does not normally print such an announcement, your work based on the Program is not required to print an announcement.)

These requirements apply to the modified work as a whole.  If identifiable sections of that work are not derived from the Program, and can be reasonably considered independent and separate works in themselves, then this License, and its terms, do not apply to those sections when you distribute them as separate works.  But when you distribute the same sections as part of a whole which is a work based on the Program, the distribution of the whole must be on the terms of this License, whose permissions for other licensees extend to the entire whole, and thus to each and every part regardless of who wrote it.

Thus, it is not the intent of this section to claim rights or contest your rights to work written entirely by you; rather, the intent is to exercise the right to control the distribution of derivative or collective works based on the Program.

In addition, mere aggregation of another work not based on the Program with the Program (or with a work based on the Program) on a volume of a storage or distribution medium does not bring the other work under the scope of this License.

3.  You may copy and distribute the Program (or a work based on it, under Section 2) in object code or executable form under the terms of Sections 1 and 2 above provided that you also do one of the following:

a) Accompany it with the complete corresponding machine-readable source code, which must be distributed under the terms of Sections 1 and 2 above on a medium customarily used for software interchange; or,

b) Accompany it with a written offer, valid for at least three years, to give any third party, for a charge no more than your cost of physically performing source distribution, a complete machine-readable copy of the corresponding source code, to be distributed under the terms of Sections 1 and 2 above on a medium customarily used for software interchange; or,

c) Accompany it with the information you received as to the offer to distribute corresponding source code.  (This alternative is allowed only for noncommercial distribution and only if you received the program in object code or executable form with such an offer, in accord with Subsection b above.)

The source code for a work means the preferred form of the work for making modifications to it.  For an executable work, complete source code means all the source code for all modules it contains, plus any associated interface definition files, plus the scripts used to control compilation and installation of the executable.  However, as a special exception, the source code distributed need not include anything that is normally distributed (in either source or binary form) with the major components (compiler, kernel, and so on) of the operating system on which the executable runs, unless that component itself accompanies the executable.

If distribution of executable or object code is made by offering access to copy from a designated place, then offering equivalent access to copy the source code from the same place counts as distribution of the source code, even though third parties are not compelled to copy the source along with the object code.

4.  You may not copy, modify, sublicense, or distribute the Program except as expressly provided under this License.  Any attempt otherwise to copy, modify, sublicense or distribute the Program is void, and will automatically terminate your rights under this License.  However, parties who have received copies, or rights, from you under this License will not have their licenses terminated so long as such parties remain in full compliance.

5.  You are not required to accept this License, since you have not signed it.  However, nothing else grants you permission to modify or distribute the Program or its derivative works.  These actions are prohibited by law if you do not accept this License.  Therefore, by modifying or distributing the Program (or any work based on the Program), you indicate your acceptance of this License to do so, and all its terms and conditions for copying, distributing or modifying the Program or works based on it.

6.  Each time you redistribute the Program (or any work based on the Program), the recipient automatically receives a license from the original licensor to copy, distribute or modify the Program subject to these terms and conditions.  You may not impose any further restrictions on the recipients’ exercise of the rights granted herein.  You are not responsible for enforcing compliance by third parties to this License.

7.  If, as a consequence of a court judgment or allegation of patent infringement or for any other reason (not limited to patent issues), conditions are imposed on you (whether by court order, agreement or otherwise) that contradict the conditions of this License, they do not excuse you from the conditions of this License.  If you cannot distribute so as to satisfy simultaneously your obligations under this License and any other pertinent obligations, then as a consequence you may not distribute the Program at all.  For example, if a patent license would not permit royalty-free redistribution of the Program by all those who receive copies directly or indirectly through you, then the only way you could satisfy both it and this License would be to refrain entirely from distribution of the Program.

If any portion of this section is held invalid or unenforceable under any particular circumstance, the balance of the section is intended to apply and the section as a whole is intended to apply in other circumstances.

It is not the purpose of this section to induce you to infringe any patents or other property right claims or to contest validity of any such claims; this section has the sole purpose of protecting the integrity of the free software distribution system, which is implemented by public license practices.  Many people have made generous contributions to the wide range of software distributed through that system in reliance on consistent application of that system; it is up to the author/donor to decide if he or she is willing to distribute software through any other system and a licensee cannot impose that choice.

This section is intended to make thoroughly clear what is believed to be a consequence of the rest of this License.

8.  If the distribution and/or use of the Program is restricted in certain countries either by patents or by copyrighted interfaces, the original copyright holder who places the Program under this License may add an explicit geographical distribution limitation excluding those countries, so that distribution is permitted only in or among countries not thus excluded.  In such case, this License incorporates the limitation as if written in the body of this License.

9.  The Free Software Foundation may publish revised and/or new versions of the General Public License from time to time.  Such new versions will be similar in spirit to the present version, but may differ in detail to address new problems or concerns.

Each version is given a distinguishing version number.  If the Program specifies a version number of this License which applies to it and “any later version”, you have the option of following the terms and conditions either of that version or of any later version published by the Free Software Foundation.  If the Program does not specify a version number of this License, you may choose any version ever published by the Free Software Foundation.

10.  If you wish to incorporate parts of the Program into other free programs whose distribution conditions are different, write to the author to ask for permission.  For software which is copyrighted by the Free Software Foundation, write to the Free Software Foundation; we sometimes make exceptions for this.  Our decision will be guided by the two goals of preserving the free status of all derivatives of our free software and of promoting the sharing and reuse of software generally.

NO WARRANTY

11.  BECAUSE THE PROGRAM IS LICENSED FREE OF CHARGE, THERE IS NO WARRANTY FOR THE PROGRAM, TO THE EXTENT PERMITTED BY APPLICABLE LAW.  EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR OTHER PARTIES PROVIDE THE PROGRAM “AS IS” WITHOUT WARRANTY OF ANY KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE.  THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE PROGRAM IS WITH YOU.  SHOULD THE PROGRAM PROVE DEFECTIVE, YOU ASSUME THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.

12.  IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY AND/OR REDISTRIBUTE THE PROGRAM AS PERMITTED ABOVE, BE LIABLE TO YOU FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE PROGRAM (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A FAILURE OF THE PROGRAM TO OPERATE WITH ANY OTHER PROGRAMS), EVEN IF SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGES.

+ +
+ + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/images/background.jpg b/public/site_assets/test/js/dist/docs/files/images/background.jpg new file mode 100644 index 00000000..c1550529 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/background.jpg differ diff --git a/public/site_assets/test/js/dist/docs/files/images/basicline.png b/public/site_assets/test/js/dist/docs/files/images/basicline.png new file mode 100644 index 00000000..1cc6bc69 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/basicline.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/basiclogaxis.png b/public/site_assets/test/js/dist/docs/files/images/basiclogaxis.png new file mode 100644 index 00000000..7c169633 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/basiclogaxis.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/basiclogoptions.png b/public/site_assets/test/js/dist/docs/files/images/basiclogoptions.png new file mode 100644 index 00000000..d91bf5f6 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/basiclogoptions.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/basicoptions.png b/public/site_assets/test/js/dist/docs/files/images/basicoptions.png new file mode 100644 index 00000000..4ea441c8 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/basicoptions.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/dualaxis.png b/public/site_assets/test/js/dist/docs/files/images/dualaxis.png new file mode 100644 index 00000000..36012b23 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/dualaxis.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/logo.jpg b/public/site_assets/test/js/dist/docs/files/images/logo.jpg new file mode 100644 index 00000000..a12fffcd Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/logo.jpg differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navdocs.png b/public/site_assets/test/js/dist/docs/files/images/navdocs.png new file mode 100644 index 00000000..318ab04e Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navdocs.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navdocsover.png b/public/site_assets/test/js/dist/docs/files/images/navdocsover.png new file mode 100644 index 00000000..4a5b8ec7 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navdocsover.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navdownload.png b/public/site_assets/test/js/dist/docs/files/images/navdownload.png new file mode 100644 index 00000000..41723e77 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navdownload.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navdownloadover.png b/public/site_assets/test/js/dist/docs/files/images/navdownloadover.png new file mode 100644 index 00000000..881bdbf8 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navdownloadover.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navexamples.png b/public/site_assets/test/js/dist/docs/files/images/navexamples.png new file mode 100644 index 00000000..89d1fb4e Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navexamples.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navexamplesover.png b/public/site_assets/test/js/dist/docs/files/images/navexamplesover.png new file mode 100644 index 00000000..0ea75255 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navexamplesover.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navhome.png b/public/site_assets/test/js/dist/docs/files/images/navhome.png new file mode 100644 index 00000000..fd55aa5d Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navhome.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/navhomeover.png b/public/site_assets/test/js/dist/docs/files/images/navhomeover.png new file mode 100644 index 00000000..63bbf7a3 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/navhomeover.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/new.png b/public/site_assets/test/js/dist/docs/files/images/new.png new file mode 100644 index 00000000..3eaba9c8 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/new.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/sample3.png b/public/site_assets/test/js/dist/docs/files/images/sample3.png new file mode 100644 index 00000000..31e644de Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/sample3.png differ diff --git a/public/site_assets/test/js/dist/docs/files/images/samplesm.png b/public/site_assets/test/js/dist/docs/files/images/samplesm.png new file mode 100644 index 00000000..1b7b3ef4 Binary files /dev/null and b/public/site_assets/test/js/dist/docs/files/images/samplesm.png differ diff --git a/public/site_assets/test/js/dist/docs/files/jqPlotCssStyling-txt.html b/public/site_assets/test/js/dist/docs/files/jqPlotCssStyling-txt.html new file mode 100644 index 00000000..48d423ef --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqPlotCssStyling-txt.html @@ -0,0 +1,39 @@ + + +jqPlot CSS Customization + + + + + + + + + +

Much of the styling of jqPlot is done by css.  The jqPlot css file is, unremarkably, jquery.jqplot.css and resides in the same directory as jqPlot itself.

There exist some styling related javascript properties on the plot objects themselves (like fontStyle, fontSize, etc.).  These can be set with the options object at plot creation.  Generally, setting these options is NOT the preferred way to customize the look of the plot.  Use the css file instead.  These options are deprecated and may disappear.  The exceptions are certain background and color options which control attributes of something renderered on a canvas.  This would be line color, grid background, etc.  These must be set by the options object.  For a list of available options, see jqPlot Options.

Objects in the plot that can be customized by css are given a css class like “.jqplot-*”.  For example, the plot title will have a “.jqplot-title” class, the axes “.jqplot-axis”, etc.

Currently assigned classes in jqPlot are as follows:

.jqplot-targetStyles for the plot target div.  These will be cascaded down to all plot elements according to css rules.
.jqplot-axisStyles for all axes
.jqplot-xaxisStyles applied to the primary x axis only.
.jqplot-yaxisStyles applied to the primary y axis only.
.jqplot-x2axis, .jqplot-x3axis, ...Styles applied to the 2nd, 3rd, etc. x axis only.
.jqplot-y2axis, .jqplot-y3axis, ...Styles applied to the 2nd, 3rd, etc.y axis only.
.jqplot-axis-tickStyles applied to all axis ticks
.jqplot-xaxis-tickStyles applied to primary x axis ticks only.
.jqplot-x2axis-tickStyles applied to secondary x axis ticks only.
.jqplot-yaxis-tickStyles applied to primary y axis ticks only.
.jqplot-y2axis-tickStyles applied to secondary y axis ticks only.
table.jqplot-table-legendStyles applied to the legend box table.
.jqplot-titleStyles applied to the title.
.jqplot-cursor-tooltipStyles applied to the cursor tooltip
.jqplot-highlighter-tooltipStyles applied to the highlighter tooltip.
div.jqplot-table-legend-swatchthe div element used for the colored swatch on the legend.

Note that axes will be assigned 2 classes like: class=”.jqplot-axis .jqplot-xaxis”.

+ +
+ + + + + + + + + + +
This document is out of date.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqPlotOptions-txt.html b/public/site_assets/test/js/dist/docs/files/jqPlotOptions-txt.html new file mode 100644 index 00000000..0b006c07 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqPlotOptions-txt.html @@ -0,0 +1,345 @@ + + +jqPlot Options + + + + + + + + + +

This document is out of date.  While the options described here should still be relavent and valid, it has not been updated for many new options.  Sorry for this inconvenience.

This document describes the options available to jqPlot.  These are set with the third argument to the $.jqplot(‘target’, data, options) function.  Options are described using the following convention:

property: default, // notes

This document is not complete!  Not all options are shown!  Further information about the options can be found in the online API documentation.  For details on how the options relate to the API documentation, see the Options Tutorial in the optionsTutorial.txt file.

options =
+{
+    seriesColors: [ "#4bb2c5", "#c5b47f", "#EAA228", "#579575", "#839557", "#958c12",
+        "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc"],  // colors that will
+         // be assigned to the series.  If there are more series than colors, colors
+         // will wrap around and start at the beginning again.
+
+    // when fillToZero is enabled, this sets the colors to use for portions of the line below zero.
+    negativeSeriesColors: [ "#498991", "#C08840", "#9F9274", "#546D61", "#646C4A", "#6F6621",
+                            "#6E3F5F", "#4F64B0", "#A89050", "#C45923", "#187399", "#945381",
+                            "#959E5C", "#C7AF7B", "#478396", "#907294"],
+
+    sortData : true,    // if true, will sort the data passed in by the user.
+    stackSeries: false, // if true, will create a stack plot.
+                        // Currently supported by line and bar graphs.
+
+    title: '',      // Title for the plot.  Can also be specified as an object like:
+
+    title: {
+        text: '',   // title for the plot,
+        show: true,
+    },
+
+    animate : false,        // if true, the series will be animated on initial drawing.
+                            // This support is renderer-dependent; the renderer must support animation.
+    animateReplot : false,  // if true, the series will be animated after every replot() call.
+                            // Use with caution!  Replots can happen very frequently under
+                            // certain circumstances (e.g. resizing, dragging points) and
+                            // animation in these situations can cause problems.
+    captureRightClick : false,   // if true, right-click events are intercepted and a jqplotRightClick
+                                 // event will be fired.  This will also block the context menu.
+    dataRenderer : undefined, // A callable which can be used to preprocess data passed into the plot.
+                              // Will be called with 3 arguments: the plot data, a reference to the plot,
+                              // and the value of dataRendererOptions.
+
+    dataRendererOptions : undefined,    // Options that will be passed to the dataRenderer,
+                                        // if that option is supplied.  Can be of any type.
+
+    gridData : [],  // array of grid coordinates corresponding to the data points;
+                    // normally jqPlot will calculate this for you.
+
+    axesDefaults: {
+        show: false,    // whether or not to render the axis.  Determined automatically.
+        min: null,      // minimum numerical value of the axis.  Determined automatically.
+        max: null,      // maximum numerical value of the axis.  Determined automatically.
+        pad: 1.2,       // a factor multiplied by the data range on the axis to give the
+                        // axis range so that data points don't fall on the edges of the axis.
+        ticks: [],      // a 1D [val1, val2, ...], or 2D [[val, label], [val, label], ...]
+                        // array of ticks to use.  Computed automatically.
+        numberTicks: undefined,
+        renderer: $.jqplot.LinearAxisRenderer,  // renderer to use to draw the axis,
+        rendererOptions: {},    // options to pass to the renderer.  LinearAxisRenderer
+                                // has no options,
+        tickOptions: {
+            mark: 'outside',    // Where to put the tick mark on the axis
+                                // 'outside', 'inside' or 'cross'
+            showMark: true,     // whether or not to show the mark on the axis
+            showGridline: true, // whether to draw a gridline (across the whole grid) at this tick
+            isMinorTick: false, // whether this is a minor tick
+            markSize: 4,        // length the tick will extend beyond the grid in pixels.  For
+                                // 'cross', length will be added above and below the grid boundary
+            show: true,         // whether to show the tick (mark and label)
+            showLabel: true,    // whether to show the text label at the tick
+            prefix: '',         // String to prepend to the tick label.
+                                // Prefix is prepended to the formatted tick label
+            suffix: '',         // String to append to the tick label.
+                                // Suffix is appended to the formatted tick label
+            formatString: '',   // format string to use with the axis tick formatter
+            fontFamily: '',     // css spec for the font-size css attribute
+            fontSize: '',       // css spec for the font-size css attribute
+            textColor: '',      // css spec for the color attribute
+            escapeHTML: false   // true to escape HTML entities in the label
+        }
+        showTicks: true,        // whether or not to show the tick labels,
+        showTickMarks: true,    // whether or not to show the tick marks
+    },
+
+    axes: {
+        xaxis: {
+            // same options as axesDefaults
+        },
+        yaxis: {
+            // same options as axesDefaults
+        },
+        x2axis: {
+            // same options as axesDefaults
+        },
+        y2axis: {
+            // same options as axesDefaults
+        }
+    },
+
+    seriesDefaults: {
+        show: true,     // whether to render the series.
+        xaxis: 'xaxis', // either 'xaxis' or 'x2axis'.
+        yaxis: 'yaxis', // either 'yaxis' or 'y2axis'.
+        label: '',      // label to use in the legend for this line.
+        color: '',      // CSS color spec to use for the line.  Determined automatically.
+        lineWidth: 2.5, // Width of the line in pixels.
+        shadow: true,   // show shadow or not.
+        shadowAngle: 45,    // angle (degrees) of the shadow, clockwise from x axis.
+        shadowOffset: 1.25, // offset from the line of the shadow.
+        shadowDepth: 3,     // Number of strokes to make when drawing shadow.  Each
+                            // stroke offset by shadowOffset from the last.
+        shadowAlpha: 0.1,   // Opacity of the shadow.
+        showLine: true,     // whether to render the line segments or not.
+        showMarker: true,   // render the data point markers or not.
+        fill: false,        // fill under the line,
+        fillAndStroke: false,       // stroke a line at top of fill area.
+        fillColor: undefined,       // custom fill color for filled lines (default is line color).
+        fillAlpha: undefined,       // custom alpha to apply to fillColor.
+        renderer: $.jqplot.LineRenderer],    // renderer used to draw the series.
+        rendererOptions: {}, // options passed to the renderer.  LineRenderer has no options.
+        markerRenderer: $.jqplot.MarkerRenderer,    // renderer to use to draw the data
+                                                    // point markers.
+        markerOptions: {
+            show: true,             // whether to show data point markers.
+            style: 'filledCircle',  // circle, diamond, square, filledCircle.
+                                    // filledDiamond or filledSquare.
+            lineWidth: 2,       // width of the stroke drawing the marker.
+            size: 9,            // size (diameter, edge length, etc.) of the marker.
+            color: '#666666'    // color of marker, set to color of line by default.
+            shadow: true,       // whether to draw shadow on marker or not.
+            shadowAngle: 45,    // angle of the shadow.  Clockwise from x axis.
+            shadowOffset: 1,    // offset from the line of the shadow,
+            shadowDepth: 3,     // Number of strokes to make when drawing shadow.  Each stroke
+                                // offset by shadowOffset from the last.
+            shadowAlpha: 0.07   // Opacity of the shadow
+        }
+    },
+
+    series:[
+        {Each series has same options as seriesDefaults},
+        {You can override each series individually here}
+    ],
+
+    legend: {
+        show: false,
+        location: 'ne',     // compass direction, nw, n, ne, e, se, s, sw, w.
+        xoffset: 12,        // pixel offset of the legend box from the x (or x2) axis.
+        yoffset: 12,        // pixel offset of the legend box from the y (or y2) axis.
+    },
+
+    grid: {
+        drawGridLines: true,        // whether to draw lines across the grid or not.
+        gridLineColor: '#cccccc'    // Color of the grid lines.
+        background: '#fffdf6',      // CSS color spec for background color of grid.
+        borderColor: '#999999',     // CSS color spec for border around grid.
+        borderWidth: 2.0,           // pixel width of border around grid.
+        shadow: true,               // draw a shadow for grid.
+        shadowAngle: 45,            // angle of the shadow.  Clockwise from x axis.
+        shadowOffset: 1.5,          // offset from the line of the shadow.
+        shadowWidth: 3,             // width of the stroke for the shadow.
+        shadowDepth: 3,             // Number of strokes to make when drawing shadow.
+                                    // Each stroke offset by shadowOffset from the last.
+        shadowAlpha: 0.07           // Opacity of the shadow
+        renderer: $.jqplot.CanvasGridRenderer,  // renderer to use to draw the grid.
+        rendererOptions: {}         // options to pass to the renderer.  Note, the default
+                                    // CanvasGridRenderer takes no additional options.
+    },
+
+    // Size of the grid containing the plot.
+    gridDimensions: {
+        height: null,
+        width: null
+    },
+
+    // Padding to apply around the grid containing the plot.
+    gridPadding: {
+        top: null,
+        bottom: null,
+        left: null,
+        right: null
+    },
+
+    noDataIndicator : object, // For setting up a mock plot with a data loading indicator if
+                              // no data is specified.  Must have .show=true, .axes, and a
+                              // .indicator string that will be displayed.
+
+    // Plugin and renderer options.
+
+    // BarRenderer.
+    // With BarRenderer, you can specify additional options in the rendererOptions object
+    // on the series or on the seriesDefaults object.  Note, some options are re-specified
+    // (like shadowDepth) to override lineRenderer defaults from which BarRenderer inherits.
+
+    seriesDefaults: {
+        rendererOptions: {
+            barPadding: 8,      // number of pixels between adjacent bars in the same
+                                // group (same category or bin).
+            barMargin: 10,      // number of pixels between adjacent groups of bars.
+            barDirection: 'vertical', // vertical or horizontal.
+            barWidth: null,     // width of the bars.  null to calculate automatically.
+            shadowOffset: 2,    // offset from the bar edge to stroke the shadow.
+            shadowDepth: 5,     // number of strokes to make for the shadow.
+            shadowAlpha: 0.8,   // transparency of the shadow.
+        }
+    },
+
+    // Cursor
+    // Options are passed to the cursor plugin through the "cursor" object at the top
+    // level of the options object.
+
+    cursor: {
+        style: 'crosshair',     // A CSS spec for the cursor type to change the
+                                // cursor to when over plot.
+        show: true,
+        showTooltip: true,      // show a tooltip showing cursor position.
+        followMouse: false,     // whether tooltip should follow the mouse or be stationary.
+        tooltipLocation: 'se',  // location of the tooltip either relative to the mouse
+                                // (followMouse=true) or relative to the plot.  One of
+                                // the compass directions, n, ne, e, se, etc.
+        tooltipOffset: 6,       // pixel offset of the tooltip from the mouse or the axes.
+        showTooltipGridPosition: false,     // show the grid pixel coordinates of the mouse
+                                            // in the tooltip.
+        showTooltipUnitPosition: true,      // show the coordinates in data units of the mouse
+                                            // in the tooltip.
+        tooltipFormatString: '%.4P',    // sprintf style format string for tooltip values.
+        useAxesFormatters: true,        // whether to use the same formatter and formatStrings
+                                        // as used by the axes, or to use the formatString
+                                        // specified on the cursor with sprintf.
+        tooltipAxesGroups: [],  // show only specified axes groups in tooltip.  Would specify like:
+                                // [['xaxis', 'yaxis'], ['xaxis', 'y2axis']].  By default, all axes
+                                // combinations with for the series in the plot are shown.
+
+    },
+
+    // Dragable
+    // Dragable options are specified with the "dragable" object at the top level
+    // of the options object.
+    // (Note that 'dragable' is the name and spelling used by the plugin, even though
+    // the correct word is 'draggable'.)
+
+    dragable: {
+        color: undefined,       // custom color to use for the dragged point and dragged line
+                                // section. default will use a transparent variant of the line color.
+        constrainTo: 'none',    // Constrain dragging motion to an axis: 'x', 'y', or 'none'.
+    },
+
+    // Highlighter
+    // Highlighter options are specified with the "highlighter" object at the top level
+    // of the options object.
+
+    highlighter: {
+        lineWidthAdjust: 2.5,   // pixels to add to the size line stroking the data point marker
+                                // when showing highlight.  Only affects non filled data point markers.
+        sizeAdjust: 5,          // pixels to add to the size of filled markers when drawing highlight.
+        showTooltip: true,      // show a tooltip with data point values.
+        tooltipLocation: 'nw',  // location of tooltip: n, ne, e, se, s, sw, w, nw.
+        fadeTooltip: true,      // use fade effect to show/hide tooltip.
+        tooltipFadeSpeed: "fast"// slow, def, fast, or a number of milliseconds.
+        tooltipOffset: 2,       // pixel offset of tooltip from the highlight.
+        tooltipAxes: 'both',    // which axis values to display in the tooltip, x, y or both.
+        tooltipSeparator: ', '  // separator between values in the tooltip.
+        useAxesFormatters: true // use the same format string and formatters as used in the axes to
+                                // display values in the tooltip.
+        tooltipFormatString: '%.5P' // sprintf format string for the tooltip.  only used if
+                                    // useAxesFormatters is false.  Will use sprintf formatter with
+                                    // this string, not the axes formatters.
+    },
+
+    // LogAxisRenderer
+    // LogAxisRenderer add 2 options to the axes object.  These options are specified directly on
+    // the axes or axesDefaults object.
+
+    axesDefaults: {
+        base: 10,                   // the logarithmic base.
+        tickDistribution: 'even',   // 'even' or 'power'.  'even' will produce ticks with even visual
+                                    // (pixel) spacing on the axis.  'power' will produce ticks spaced by
+                                    // increasing powers of the log base.
+    },
+
+    // PieRenderer
+    // PieRenderer accepts options from the rendererOptions object of the series or seriesDefaults object.
+
+    seriesDefaults: {
+        rendererOptions: {
+            diameter: undefined, // diameter of pie, auto computed by default.
+            padding: 20,        // padding between pie and neighboring legend or plot margin.
+            sliceMargin: 0,     // gap between slices.
+            fill: true,         // render solid (filled) slices.
+            shadowOffset: 2,    // offset of the shadow from the chart.
+            shadowDepth: 5,     // Number of strokes to make when drawing shadow.  Each stroke is
+                                // offset by shadowOffset from the last.
+            shadowAlpha: 0.07   // Opacity of the shadow
+        }
+    },
+
+    // Trendline
+    // Trendline takes options on the trendline object of the series or seriesDefaults object.
+
+    seriesDefaults: {
+        trendline: {
+            show: true,         // show the trend line
+            color: '#666666',   // CSS color spec for the trend line.
+            label: '',          // label for the trend line.
+            type: 'linear',     // 'linear', 'exponential' or 'exp'
+            shadow: true,       // show the trend line shadow.
+            lineWidth: 1.5,     // width of the trend line.
+            shadowAngle: 45,    // angle of the shadow.  Clockwise from x axis.
+            shadowOffset: 1.5,  // offset from the line of the shadow.
+            shadowDepth: 3,     // Number of strokes to make when drawing shadow.
+                                // Each stroke offset by shadowOffset from the last.
+            shadowAlpha: 0.07   // Opacity of the shadow
+        }
+    }
+}

Options to be described

lineRenderer

.markerOptions? bands fill fillAndStroke fillStyle highlightColor highlightMouseDown highlightMouseOver shadow shadowOffset showLine

shadowRenderer

alpha closePath depth fill fillRect fillStyle isarc lineCap lineJoin linePattern lineWidth offset strokeStyle

shapeRenderer

clearRect closePath fill fillRect fillStyle isarc lineCap lineJoin linePattern lineWidth strokeRect strokeStyle

jqplot.effects

options.duration ; options.complete

LinearAxisRenderer

.min, .max (?) numberTicks tickInternal forceTickAt0 : false, // If true, a tick will always be drawn at 0.

markerRenderer

color fillStyle strokeStyle

canvasGridRenderer

lineWidth

+ +
+ + + + + + + + + + +
This document will help you understand how jqPlot’s options relate to the API documentation and the jqPlot object itself.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-axisLabelRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-axisLabelRenderer-js.html new file mode 100644 index 00000000..95397042 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-axisLabelRenderer-js.html @@ -0,0 +1,47 @@ + + +$.jqplot.AxisLabelRenderer + + + + + + + + + +

Renderer to place labels on the axes.

Summary
$.jqplot.AxisLabelRendererRenderer to place labels on the axes.
Properties
showwhether or not to show the tick (mark and label).
labelThe text or html for the label.
escapeHTMLtrue to escape HTML entities in the label.
+ +

Properties

+ +

show

this.show = true

whether or not to show the tick (mark and label).

+ +

label

this.label = ''

The text or html for the label.

+ +

escapeHTML

this.escapeHTML = false

true to escape HTML entities in the label.

+ +
+ + + + + + + + + + +
this.show = true
whether or not to show the tick (mark and label).
this.label = ''
The text or html for the label.
this.escapeHTML = false
true to escape HTML entities in the label.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-axisTickRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-axisTickRenderer-js.html new file mode 100644 index 00000000..74433846 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-axisTickRenderer-js.html @@ -0,0 +1,73 @@ + + +$.jqplot.AxisTickRenderer + + + + + + + + + +

A “tick” object showing the value of a tick/gridline on the plot.

Summary
$.jqplot.AxisTickRendererA “tick” object showing the value of a tick/gridline on the plot.
Properties
marktick mark on the axis.
showMarkwhether or not to show the mark on the axis.
showGridlinewhether or not to draw the gridline on the grid at this tick.
isMinorTickif this is a minor tick.
sizeLength of the tick beyond the grid in pixels.
markSizeLength of the tick marks in pixels.
showwhether or not to show the tick (mark and label).
showLabelwhether or not to show the label.
formatterA class of a formatter for the tick text.
prefixString to prepend to the tick label.
suffixString to append to the tick label.
formatStringstring passed to the formatter.
fontFamilycss spec for the font-family css attribute.
fontSizecss spec for the font-size css attribute.
textColorcss spec for the color attribute.
escapeHTMLtrue to escape HTML entities in the label.
+ +

Properties

+ +

mark

this.mark = 'outside'

tick mark on the axis.  One of ‘inside’, ‘outside’, ‘cross’, ‘’ or null.

+ +

showMark

this.showMark = true

whether or not to show the mark on the axis.

+ +

showGridline

this.showGridline = true

whether or not to draw the gridline on the grid at this tick.

+ +

isMinorTick

this.isMinorTick = false

if this is a minor tick.

+ +

size

this.size = 4

Length of the tick beyond the grid in pixels.  DEPRECATED: This has been superceeded by markSize

+ +

markSize

this.markSize = 6

Length of the tick marks in pixels.  For ‘cross’ style, length will be stoked above and below axis, so total length will be twice this.

+ +

show

this.show = true

whether or not to show the tick (mark and label).  Setting this to false requires more testing.  It is recommended to set showLabel and showMark to false instead.

+ +

showLabel

this.showLabel = true

whether or not to show the label.

+ +

formatter

this.formatter = $.jqplot.DefaultTickFormatter

A class of a formatter for the tick text.  sprintf by default.

+ +

prefix

this.prefix = ''

String to prepend to the tick label.  Prefix is prepended to the formatted tick label.

+ +

suffix

this.suffix = ''

String to append to the tick label.  Suffix is appended to the formatted tick label.

+ +

formatString

this.formatString = ''

string passed to the formatter.

+ +

fontFamily

this.fontFamily

css spec for the font-family css attribute.

+ +

fontSize

this.fontSize

css spec for the font-size css attribute.

+ +

textColor

this.textColor

css spec for the color attribute.

+ +

escapeHTML

this.escapeHTML = false

true to escape HTML entities in the label.

+ +
+ + + + + + + + + + +
this.mark = 'outside'
tick mark on the axis.
this.showMark = true
whether or not to show the mark on the axis.
this.showGridline = true
whether or not to draw the gridline on the grid at this tick.
this.isMinorTick = false
if this is a minor tick.
this.size = 4
Length of the tick beyond the grid in pixels.
this.markSize = 6
Length of the tick marks in pixels.
this.show = true
whether or not to show the tick (mark and label).
this.showLabel = true
whether or not to show the label.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.prefix = ''
String to prepend to the tick label.
this.suffix = ''
String to append to the tick label.
this.formatString = ''
string passed to the formatter.
this.fontFamily
css spec for the font-family css attribute.
this.fontSize
css spec for the font-size css attribute.
this.textColor
css spec for the color attribute.
this.escapeHTML = false
true to escape HTML entities in the label.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-canvasGridRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-canvasGridRenderer-js.html new file mode 100644 index 00000000..52d25389 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-canvasGridRenderer-js.html @@ -0,0 +1,39 @@ + + +$.jqplot.CanvasGridRenderer + + + + + + + + + +

The default jqPlot grid renderer, creating a grid on a canvas element.  The renderer has no additional options beyond the Grid class.

+ +
+ + + + + + + + + + +
Object representing the grid on which the plot is drawn.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-core-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-core-js.html new file mode 100644 index 00000000..a9a8d313 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-core-js.html @@ -0,0 +1,391 @@ + + +jqPlot Charts + + + + + + + + + +

Pure JavaScript plotting plugin for jQuery.

Summary
jqPlot ChartsPure JavaScript plotting plugin for jQuery.
Versionversion: 1.0.8 revision: 1250
Copyright & LicenseCopyright © 2009-2013 Chris Leonello jqPlot is currently available for use in all personal or commercial projects under both the MIT and GPL version 2.0 licenses.
IntroductionjqPlot requires jQuery (1.4+ required for certain features).
UsageSee jqPlot Usage
Available OptionsSee jqPlot Options for a list of options available thorugh the options object (not complete yet!)
Options UsageSee Options Tutorial
ChangesSee Change Log
$.jqplotjQuery function called by the user to create a plot.
Hooks
jqPlot Pugin Hooks
AxisAn individual axis object.
PropertiesAxes options are specified within an axes object at the top level of the plot options like so:
showWether to display the axis on the graph.
tickRendererA class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
tickOptionsOptions that will be passed to the tickRenderer, see $.jqplot.AxisTickRenderer options.
labelRendererA class of a rendering engine for creating an axis label.
labelOptionsOptions passed to the label renderer.
labelLabel for the axis
showLabeltrue to show the axis label.
minminimum value of the axis (in data units, not pixels).
maxmaximum value of the axis (in data units, not pixels).
autoscaleDEPRECATED the default scaling algorithm produces superior results.
padPadding to extend the range above and below the data bounds.
padMaxPadding to extend the range above data bounds.
padMinPadding to extend the range below data bounds.
ticks1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis.
numberTicksDesired number of ticks.
tickIntervalnumber of units between ticks.
rendererA class of a rendering engine that handles tick generation, scaling input data to pixel grid units and drawing the axis element.
rendererOptionsrenderer specific options.
showTicksWether to show the ticks (both marks and labels) or not.
showTickMarksWether to show the tick marks (line crossing grid) or not.
showMinorTicksWether or not to show minor ticks.
drawMajorGridlinesTrue to draw gridlines for major axis ticks.
drawMinorGridlinesTrue to draw gridlines for minor ticks.
drawMajorTickMarksTrue to draw tick marks for major axis ticks.
drawMinorTickMarksTrue to draw tick marks for minor ticks.
useSeriesColorUse the color of the first series associated with this axis for the tick marks and line bordering this axis.
borderWidthwidth of line stroked at the border of the axis.
borderColorcolor of the border adjacent to the axis.
scaleToHiddenSeriesTrue to include hidden series when computing axes bounds and scaling.
syncTickstrue to try and synchronize tick spacing across multiple axes so that ticks and grid lines line up.
tickSpacingApproximate pixel spacing between ticks on graph.
LegendLegend object.
Properties
showWether to display the legend on the graph.
locationPlacement of the legend.
labelsArray of labels to use.
showLabelstrue to show the label text on the legend.
showSwatchtrue to show the color swatches on the legend.
placement“insideGrid” places legend inside the grid area of the plot.
xoffsetDEPRECATED.
yoffsetDEPRECATED.
bordercss spec for the border around the legend box.
backgroundcss spec for the background of the legend box.
textColorcss color spec for the legend text.
fontFamilycss font-family spec for the legend text.
fontSizecss font-size spec for the legend text.
rowSpacingcss padding-top spec for the rows in the legend.
rendererOptionsrenderer specific options passed to the renderer.
predrawWether to draw the legend before the series or not.
marginTopCSS margin for the legend DOM element.
marginRightCSS margin for the legend DOM element.
marginBottomCSS margin for the legend DOM element.
marginLeftCSS margin for the legend DOM element.
escapeHtmlTrue to escape special characters with their html entity equivalents in legend text.
TitlePlot Title object.
Properties
texttext of the title;
showwhether or not to show the title
fontFamilycss font-family spec for the text.
fontSizecss font-size spec for the text.
textAligncss text-align spec for the text.
textColorcss color spec for the text.
rendererA class for creating a DOM element for the title, see $.jqplot.DivTitleRenderer.
rendererOptionsrenderer specific options passed to the renderer.
escapeHtmlTrue to escape special characters with their html entity equivalents in title text.
SeriesAn individual data series object.
PropertiesProperties will be assigned from a series array at the top level of the options.
showwhether or not to draw the series.
xaxiswhich x axis to use with this series, either ‘xaxis’ or ‘x2axis’.
yaxiswhich y axis to use with this series, either ‘yaxis’ or ‘y2axis’.
rendererA class of a renderer which will draw the series, see $.jqplot.LineRenderer.
rendererOptionsOptions to pass on to the renderer.
labelLine label to use in the legend.
showLabeltrue to show label for this series in the legend.
colorcss color spec for the series
negativeColorcss color spec used for filled (area) plots that are filled to zero and the “useNegativeColors” option is true.
lineWidthwidth of the line in pixels.
lineJoinCanvas lineJoin style between segments of series.
lineCapCanvas lineCap style at ends of line.
linePatternline pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
shadowAngleShadow angle in degrees
shadowOffsetShadow offset from line in pixels
shadowDepthNumber of times shadow is stroked, each stroke offset shadowOffset from the last.
shadowAlphaAlpha channel transparency of shadow.
breakOnNullWether line segments should be be broken at null value.
markerRendererA class of a renderer which will draw marker (e.g.
markerOptionsrenderer specific options to pass to the markerRenderer, see $.jqplot.MarkerRenderer.
showLinewhether to actually draw the line or not.
showMarkerwhether or not to show the markers at the data points.
index0 based index of this series in the plot series array.
filltrue or false, whether to fill under lines or in bars.
fillColorCSS color spec to use for fill under line.
fillAlphaAlpha transparency to apply to the fill under the line.
fillAndStrokeIf true will stroke the line (with color this.color) as well as fill under it.
disableStacktrue to not stack this series with other series in the plot.
neighborThresholdhow close or far (in pixels) the cursor must be from a point marker to detect the point.
fillToZerotrue will force bar and filled series to fill toward zero on the fill Axis.
fillToValuefill a filled series to this value on the fill axis.
fillAxisEither ‘x’ or ‘y’.
useNegativeColorstrue to color negative values differently in filled and bar charts.
GridObject representing the grid on which the plot is drawn.
Properties
drawGridlineswhether to draw the gridlines on the plot.
gridLineColorcolor of the grid lines.
gridLineWidthwidth of the grid lines.
backgroundcss spec for the background color.
borderColorcss spec for the color of the grid border.
borderWidthwidth of the border in pixels.
drawBorderTrue to draw border around grid.
shadowwhether to show a shadow behind the grid.
shadowAngleshadow angle in degrees
shadowOffsetOffset of each shadow stroke from the border in pixels
shadowWidthwidth of the stoke for the shadow
shadowDepthNumber of times shadow is stroked, each stroke offset shadowOffset from the last.
shadowColoran optional css color spec for the shadow in ‘rgba(n, n, n, n)’ form
shadowAlphaAlpha channel transparency of shadow.
rendererInstance of a renderer which will actually render the grid, see $.jqplot.CanvasGridRenderer.
rendererOptionsOptions to pass on to the renderer, see $.jqplot.CanvasGridRenderer.
jqPlotPlot object returned by call to $.jqplot.
PropertiesThese properties are specified at the top of the options object like so:
animateTrue to animate the series on initial plot draw (renderer dependent).
animateReplotTrue to animate series after a call to the replot() method.
axesup to 4 axes are supported, each with its own options, See Axis for axis specific options.
datauser’s data.
dataRendererA callable which can be used to preprocess data passed into the plot.
dataRendererOptionsOptions that will be passed to the dataRenderer.
axesDefaultsdefault options that will be applied to all axes.
seriesDefaultsdefault options that will be applied to all series.
defaultAxisStart1-D data series are internally converted into 2-D [x,y] data point arrays by jqPlot.
fillBetweenFill between 2 line series in a plot.
fontSizecss spec for the font-size attribute.
gridSee Grid for grid specific options.
legendsee <$.jqplot.TableLegendRenderer>
noDataIndicatorOptions to set up a mock plot with a data loading indicator if no data is specified.
negativeSeriesColorscolors to use for portions of the line below zero.
seriesArray of series object options.
seriesColorsAnn array of CSS color specifications that will be applied, in order, to the series in the plot.
sortDatafalse to not sort the data passed in by the user.
stackSeriestrue or false, creates a stack or “mountain” plot.
titleTitle object.
methods
initsets the plot target, checks data and applies user options to plot.
resetAxesScaleReset the specified axes min, max, numberTicks and tickInterval properties to null or reset these properties on all axes if no list of axes is provided.
reInitializereinitialize plot for replotting.
quickInitQuick reinitialization plot for replotting.
destroyReleases all resources occupied by the plot
replotDoes a reinitialization of the plot followed by a redraw.
redrawEmpties the plot target div and redraws the plot.
drawDraws all elements of the plot into the container.
drawSeriesRedraws all or just one series on the plot.
moveSeriesToFrontThis method requires jQuery 1.4+ Moves the specified series canvas in front of all other series canvases.
moveSeriesToBackThis method requires jQuery 1.4+ Moves the specified series canvas behind all other series canvases.
restorePreviousSeriesOrderThis method requires jQuery 1.4+ Restore the series canvas order to its previous state.
restoreOriginalSeriesOrderThis method requires jQuery 1.4+ Restore the series canvas order to its original order when the plot was created.
+ +

Version

version: 1.0.8 revision: 1250

+ +

Copyright & License

Copyright © 2009-2013 Chris Leonello jqPlot is currently available for use in all personal or commercial projects under both the MIT and GPL version 2.0 licenses.  This means that you can choose the license that best suits your project and use it accordingly.

See GPL Version 2 and MIT License contained within this distribution for further information.

The author would appreciate an email letting him know of any substantial use of jqPlot.  You can reach the author at: chris at jqplot dot com or see http://www.jqplot.com/info.php.  This is, of course, not required.

If you are feeling kind and generous, consider supporting the project by making a donation at: http://www.jqplot.com/donate.php.

sprintf functions contained in jqplot.sprintf.js by Ash Searle

version 2007.04.27 author Ash Searle http://hexmen.com/blog/2007/03/printf-sprintf/ http://hexmen.com/js/sprintf.js The author (Ash Searle) has placed this code in the public domain: “This code is unrestricted: you are free to use it however you like.”

+ +

Introduction

jqPlot requires jQuery (1.4+ required for certain features). jQuery 1.4.2 is included in the distribution.  To use jqPlot include jQuery, the jqPlot jQuery plugin, the jqPlot css file and optionally the excanvas script for IE support in your web page:

<!--[if lt IE 9]><script language="javascript" type="text/javascript" src="excanvas.js"></script><![endif]-->
+<script language="javascript" type="text/javascript" src="jquery-1.4.4.min.js"></script>
+<script language="javascript" type="text/javascript" src="jquery.jqplot.min.js"></script>
+<link rel="stylesheet" type="text/css" href="jquery.jqplot.css" />

jqPlot can be customized by overriding the defaults of any of the objects which make up the plot.  The general usage of jqplot is:

chart = $.jqplot('targetElemId', [dataArray,...], {optionsObject});

The options available to jqplot are detailed in jqPlot Options in the jqPlotOptions.txt file.

An actual call to $.jqplot() may look like the examples below:

chart = $.jqplot('chartdiv',  [[[1, 2],[3,5.12],[5,13.1],[7,33.6],[9,85.9],[11,219.9]]]);

or

dataArray = [34,12,43,55,77];
+chart = $.jqplot('targetElemId', [dataArray, ...], {title:'My Plot', axes:{yaxis:{min:20, max:100}}});

For more inforrmation, see jqPlot Usage.

+ +

Usage

+ +

Available Options

See jqPlot Options for a list of options available thorugh the options object (not complete yet!)

+ +

Options Usage

+ +

Changes

+ +

$.jqplot

jQuery function called by the user to create a plot.

Parameters

targetID of target element to render the plot into.
dataan array of data series.
optionsuser defined options object.  See the individual classes for available options.

Properties

configobject to hold configuration information for jqPlot plot object.

attributes

enablePluginsFalse to disable plugins by default.  Plugins must then be explicitly enabled in the individual plot options.  Default: false.  This property sets the “show” property of certain plugins to true or false.  Only plugins that can be immediately active upon loading are affected.  This includes non-renderer plugins like cursor, dragable, highlighter, and trendline.
defaultHeightDefault height for plots where no css height specification exists.  This is a jqplot wide default.
defaultWidthDefault height for plots where no css height specification exists.  This is a jqplot wide default.
+ +

Hooks

+ +

jqPlot Pugin Hooks

$.jqplot.preInitHookscalled before initialization.
$.jqplot.postInitHookscalled after initialization.
$.jqplot.preParseOptionsHookscalled before user options are parsed.
$.jqplot.postParseOptionsHookscalled after user options are parsed.
$.jqplot.preDrawHookscalled before plot draw.
$.jqplot.postDrawHookscalled after plot draw.
$.jqplot.preDrawSeriesHookscalled before each series is drawn.
$.jqplot.postDrawSeriesHookscalled after each series is drawn.
$.jqplot.preDrawLegendHookscalled before the legend is drawn.
$.jqplot.addLegendRowHookscalled at the end of legend draw, so plugins can add rows to the legend table.
$.jqplot.preSeriesInitHookscalled before series is initialized.
$.jqplot.postSeriesInitHookscalled after series is initialized.
$.jqplot.preParseSeriesOptionsHookscalled before series related options are parsed.
$.jqplot.postParseSeriesOptionsHookscalled after series related options are parsed.
$.jqplot.eventListenerHookscalled at the end of plot drawing, binds listeners to the event canvas which lays on top of the grid area.
$.jqplot.preDrawSeriesShadowHookscalled before series shadows are drawn.
$.jqplot.postDrawSeriesShadowHookscalled after series shadows are drawn.
+ +

Axis

An individual axis object.  Cannot be instantiated directly, but created by the Plot object.  Axis properties can be set or overridden by the options passed in from the user.

Summary
PropertiesAxes options are specified within an axes object at the top level of the plot options like so:
showWether to display the axis on the graph.
tickRendererA class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
tickOptionsOptions that will be passed to the tickRenderer, see $.jqplot.AxisTickRenderer options.
labelRendererA class of a rendering engine for creating an axis label.
labelOptionsOptions passed to the label renderer.
labelLabel for the axis
showLabeltrue to show the axis label.
minminimum value of the axis (in data units, not pixels).
maxmaximum value of the axis (in data units, not pixels).
autoscaleDEPRECATED the default scaling algorithm produces superior results.
padPadding to extend the range above and below the data bounds.
padMaxPadding to extend the range above data bounds.
padMinPadding to extend the range below data bounds.
ticks1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis.
numberTicksDesired number of ticks.
tickIntervalnumber of units between ticks.
rendererA class of a rendering engine that handles tick generation, scaling input data to pixel grid units and drawing the axis element.
rendererOptionsrenderer specific options.
showTicksWether to show the ticks (both marks and labels) or not.
showTickMarksWether to show the tick marks (line crossing grid) or not.
showMinorTicksWether or not to show minor ticks.
drawMajorGridlinesTrue to draw gridlines for major axis ticks.
drawMinorGridlinesTrue to draw gridlines for minor ticks.
drawMajorTickMarksTrue to draw tick marks for major axis ticks.
drawMinorTickMarksTrue to draw tick marks for minor ticks.
useSeriesColorUse the color of the first series associated with this axis for the tick marks and line bordering this axis.
borderWidthwidth of line stroked at the border of the axis.
borderColorcolor of the border adjacent to the axis.
scaleToHiddenSeriesTrue to include hidden series when computing axes bounds and scaling.
syncTickstrue to try and synchronize tick spacing across multiple axes so that ticks and grid lines line up.
tickSpacingApproximate pixel spacing between ticks on graph.
+ +

Properties

Axes options are specified within an axes object at the top level of the plot options like so:

{
+   axes: {
+       xaxis: {min: 5},
+       yaxis: {min: 2, max: 8, numberTicks:4},
+       x2axis: {pad: 1.5},
+       y2axis: {ticks:[22, 44, 66, 88]}
+       }
+}

There are 2 x axes, ‘xaxis’ and ‘x2axis’, and 9 yaxes, ‘yaxis’, ‘y2axis’.  ‘y3axis’, ...  Any or all of which may be specified.

+ +

show

this.show = false

Wether to display the axis on the graph.

+ +

tickRenderer

this.tickRenderer = $.jqplot.AxisTickRenderer

A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.

+ +

tickOptions

this.tickOptions = {}

Options that will be passed to the tickRenderer, see $.jqplot.AxisTickRenderer options.

+ +

labelRenderer

this.labelRenderer = $.jqplot.AxisLabelRenderer

A class of a rendering engine for creating an axis label.

+ +

labelOptions

this.labelOptions = {}

Options passed to the label renderer.

+ +

label

this.label = null

Label for the axis

+ +

showLabel

this.showLabel = true

true to show the axis label.

+ +

min

this.min = null

minimum value of the axis (in data units, not pixels).

+ +

max

this.max = null

maximum value of the axis (in data units, not pixels).

+ +

autoscale

this.autoscale = false

DEPRECATED the default scaling algorithm produces superior results.

+ +

pad

this.pad = 1.2

Padding to extend the range above and below the data bounds.  The data range is multiplied by this factor to determine minimum and maximum axis bounds.  A value of 0 will be interpreted to mean no padding, and pad will be set to 1.0.

+ +

padMax

this.padMax = null

Padding to extend the range above data bounds.  The top of the data range is multiplied by this factor to determine maximum axis bounds.  A value of 0 will be interpreted to mean no padding, and padMax will be set to 1.0.

+ +

padMin

this.padMin = null

Padding to extend the range below data bounds.  The bottom of the data range is multiplied by this factor to determine minimum axis bounds.  A value of 0 will be interpreted to mean no padding, and padMin will be set to 1.0.

+ +

ticks

this.ticks = []

1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis.  If no label is specified, the value is formatted into an appropriate label.

+ +

numberTicks

this.numberTicks

Desired number of ticks.  Default is to compute automatically.

+ +

tickInterval

this.tickInterval

number of units between ticks.  Mutually exclusive with numberTicks.

+ +

renderer

this.renderer = $.jqplot.LinearAxisRenderer

A class of a rendering engine that handles tick generation, scaling input data to pixel grid units and drawing the axis element.

+ +

rendererOptions

this.rendererOptions = {}

renderer specific options.  See $.jqplot.LinearAxisRenderer for options.

+ +

showTicks

this.showTicks = true

Wether to show the ticks (both marks and labels) or not.  Will not override showMark and showLabel options if specified on the ticks themselves.

+ +

showTickMarks

this.showTickMarks = true

Wether to show the tick marks (line crossing grid) or not.  Overridden by showTicks and showMark option of tick itself.

+ +

showMinorTicks

this.showMinorTicks = true

Wether or not to show minor ticks.  This is renderer dependent.

+ +

drawMajorGridlines

this.drawMajorGridlines = true

True to draw gridlines for major axis ticks.

+ +

drawMinorGridlines

this.drawMinorGridlines = false

True to draw gridlines for minor ticks.

+ +

drawMajorTickMarks

this.drawMajorTickMarks = true

True to draw tick marks for major axis ticks.

+ +

drawMinorTickMarks

this.drawMinorTickMarks = true

True to draw tick marks for minor ticks.  This is renderer dependent.

+ +

useSeriesColor

this.useSeriesColor = false

Use the color of the first series associated with this axis for the tick marks and line bordering this axis.

+ +

borderWidth

this.borderWidth = null

width of line stroked at the border of the axis.  Defaults to the width of the grid boarder.

+ +

borderColor

this.borderColor = null

color of the border adjacent to the axis.  Defaults to grid border color.

+ +

scaleToHiddenSeries

this.scaleToHiddenSeries = false

True to include hidden series when computing axes bounds and scaling.

+ +

syncTicks

this.syncTicks = null

true to try and synchronize tick spacing across multiple axes so that ticks and grid lines line up.  This has an impact on autoscaling algorithm, however.  In general, autoscaling an individual axis will work better if it does not have to sync ticks.

+ +

tickSpacing

this.tickSpacing = 75

Approximate pixel spacing between ticks on graph.  Used during autoscaling.  This number will be an upper bound, actual spacing will be less.

+ +

Legend

Legend object.  Cannot be instantiated directly, but created by the Plot object.  Legend properties can be set or overridden by the options passed in from the user.

Summary
Properties
showWether to display the legend on the graph.
locationPlacement of the legend.
labelsArray of labels to use.
showLabelstrue to show the label text on the legend.
showSwatchtrue to show the color swatches on the legend.
placement“insideGrid” places legend inside the grid area of the plot.
xoffsetDEPRECATED.
yoffsetDEPRECATED.
bordercss spec for the border around the legend box.
backgroundcss spec for the background of the legend box.
textColorcss color spec for the legend text.
fontFamilycss font-family spec for the legend text.
fontSizecss font-size spec for the legend text.
rowSpacingcss padding-top spec for the rows in the legend.
rendererOptionsrenderer specific options passed to the renderer.
predrawWether to draw the legend before the series or not.
marginTopCSS margin for the legend DOM element.
marginRightCSS margin for the legend DOM element.
marginBottomCSS margin for the legend DOM element.
marginLeftCSS margin for the legend DOM element.
escapeHtmlTrue to escape special characters with their html entity equivalents in legend text.
+ +

Properties

+ +

show

this.show = false

Wether to display the legend on the graph.

+ +

location

this.location = 'ne'

Placement of the legend.  one of the compass directions: nw, n, ne, e, se, s, sw, w

+ +

labels

this.labels = []

Array of labels to use.  By default the renderer will look for labels on the series.  Labels specified in this array will override labels specified on the series.

+ +

showLabels

this.showLabels = true

true to show the label text on the legend.

+ +

showSwatch

this.showSwatches = true

true to show the color swatches on the legend.

+ +

placement

this.placement = "insideGrid"

”insideGrid” places legend inside the grid area of the plot.  “outsideGrid” places the legend outside the grid but inside the plot container, shrinking the grid to accomodate the legend.  “inside” synonym for “insideGrid”, “outside” places the legend ouside the grid area, but does not shrink the grid which can cause the legend to overflow the plot container.

+ +

xoffset

this.xoffset = 0

DEPRECATED.  Set the margins on the legend using the marginTop, marginLeft, etc. properties or via CSS margin styling of the .jqplot-table-legend class.

+ +

yoffset

this.yoffset = 0

DEPRECATED.  Set the margins on the legend using the marginTop, marginLeft, etc. properties or via CSS margin styling of the .jqplot-table-legend class.

+ +

border

this.border

css spec for the border around the legend box.

+ +

background

this.background

css spec for the background of the legend box.

+ +

textColor

this.textColor

css color spec for the legend text.

+ +

fontFamily

this.fontFamily

css font-family spec for the legend text.

+ +

fontSize

this.fontSize

css font-size spec for the legend text.

+ +

rowSpacing

this.rowSpacing = '0.5em'

css padding-top spec for the rows in the legend.

+ +

rendererOptions

this.rendererOptions = {}

renderer specific options passed to the renderer.

+ +

predraw

Wether to draw the legend before the series or not.  Used with series specific legend renderers for pie, donut, mekko charts, etc.

+ +

marginTop

this.marginTop = null

CSS margin for the legend DOM element.  This will set an element CSS style for the margin which will override any style sheet setting.  The default will be taken from the stylesheet.

+ +

marginRight

this.marginRight = null

CSS margin for the legend DOM element.  This will set an element CSS style for the margin which will override any style sheet setting.  The default will be taken from the stylesheet.

+ +

marginBottom

this.marginBottom = null

CSS margin for the legend DOM element.  This will set an element CSS style for the margin which will override any style sheet setting.  The default will be taken from the stylesheet.

+ +

marginLeft

this.marginLeft = null

CSS margin for the legend DOM element.  This will set an element CSS style for the margin which will override any style sheet setting.  The default will be taken from the stylesheet.

+ +

escapeHtml

this.escapeHtml = false

True to escape special characters with their html entity equivalents in legend text.  “<” becomes &lt; and so on, so html tags are not rendered.

+ +

Title

Plot Title object.  Cannot be instantiated directly, but created by the Plot object.  Title properties can be set or overridden by the options passed in from the user.

Parameters

texttext of the title.
Summary
Properties
texttext of the title;
showwhether or not to show the title
fontFamilycss font-family spec for the text.
fontSizecss font-size spec for the text.
textAligncss text-align spec for the text.
textColorcss color spec for the text.
rendererA class for creating a DOM element for the title, see $.jqplot.DivTitleRenderer.
rendererOptionsrenderer specific options passed to the renderer.
escapeHtmlTrue to escape special characters with their html entity equivalents in title text.
+ +

Properties

+ +

text

this.text = text

text of the title;

+ +

show

this.show = true

whether or not to show the title

+ +

fontFamily

this.fontFamily

css font-family spec for the text.

+ +

fontSize

this.fontSize

css font-size spec for the text.

+ +

textAlign

this.textAlign

css text-align spec for the text.

+ +

textColor

this.textColor

css color spec for the text.

+ +

renderer

this.renderer = $.jqplot.DivTitleRenderer

A class for creating a DOM element for the title, see $.jqplot.DivTitleRenderer.

+ +

rendererOptions

this.rendererOptions = {}

renderer specific options passed to the renderer.

+ +

escapeHtml

this.escapeHtml = false

True to escape special characters with their html entity equivalents in title text.  “<” becomes &lt; and so on, so html tags are not rendered.

+ +

Series

An individual data series object.  Cannot be instantiated directly, but created by the Plot object.  Series properties can be set or overridden by the options passed in from the user.

Summary
PropertiesProperties will be assigned from a series array at the top level of the options.
showwhether or not to draw the series.
xaxiswhich x axis to use with this series, either ‘xaxis’ or ‘x2axis’.
yaxiswhich y axis to use with this series, either ‘yaxis’ or ‘y2axis’.
rendererA class of a renderer which will draw the series, see $.jqplot.LineRenderer.
rendererOptionsOptions to pass on to the renderer.
labelLine label to use in the legend.
showLabeltrue to show label for this series in the legend.
colorcss color spec for the series
negativeColorcss color spec used for filled (area) plots that are filled to zero and the “useNegativeColors” option is true.
lineWidthwidth of the line in pixels.
lineJoinCanvas lineJoin style between segments of series.
lineCapCanvas lineCap style at ends of line.
linePatternline pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
shadowAngleShadow angle in degrees
shadowOffsetShadow offset from line in pixels
shadowDepthNumber of times shadow is stroked, each stroke offset shadowOffset from the last.
shadowAlphaAlpha channel transparency of shadow.
breakOnNullWether line segments should be be broken at null value.
markerRendererA class of a renderer which will draw marker (e.g.
markerOptionsrenderer specific options to pass to the markerRenderer, see $.jqplot.MarkerRenderer.
showLinewhether to actually draw the line or not.
showMarkerwhether or not to show the markers at the data points.
index0 based index of this series in the plot series array.
filltrue or false, whether to fill under lines or in bars.
fillColorCSS color spec to use for fill under line.
fillAlphaAlpha transparency to apply to the fill under the line.
fillAndStrokeIf true will stroke the line (with color this.color) as well as fill under it.
disableStacktrue to not stack this series with other series in the plot.
neighborThresholdhow close or far (in pixels) the cursor must be from a point marker to detect the point.
fillToZerotrue will force bar and filled series to fill toward zero on the fill Axis.
fillToValuefill a filled series to this value on the fill axis.
fillAxisEither ‘x’ or ‘y’.
useNegativeColorstrue to color negative values differently in filled and bar charts.
+ +

Properties

Properties will be assigned from a series array at the top level of the options.  If you had two series and wanted to change the color and line width of the first and set the second to use the secondary y axis with no shadow and supply custom labels for each:

{
+   series:[
+       {color: '#ff4466', lineWidth: 5, label:'good line'},
+       {yaxis: 'y2axis', shadow: false, label:'bad line'}
+   ]
+}
+ +

show

this.show = true

whether or not to draw the series.

+ +

xaxis

this.xaxis = 'xaxis'

which x axis to use with this series, either ‘xaxis’ or ‘x2axis’.

+ +

yaxis

this.yaxis = 'yaxis'

which y axis to use with this series, either ‘yaxis’ or ‘y2axis’.

+ +

renderer

this.renderer = $.jqplot.LineRenderer

A class of a renderer which will draw the series, see $.jqplot.LineRenderer.

+ +

rendererOptions

this.rendererOptions = {}

Options to pass on to the renderer.

+ +

label

this.label = ''

Line label to use in the legend.

+ +

showLabel

this.showLabel = true

true to show label for this series in the legend.

+ +

color

this.color

css color spec for the series

+ +

negativeColor

this.negativeColor

css color spec used for filled (area) plots that are filled to zero and the “useNegativeColors” option is true.

+ +

lineWidth

this.lineWidth = 2.5

width of the line in pixels.  May have different meanings depending on renderer.

+ +

lineJoin

this.lineJoin = 'round'

Canvas lineJoin style between segments of series.

+ +

lineCap

this.lineCap = 'round'

Canvas lineCap style at ends of line.

+ +

linePattern

this.linePattern = 'solid'

line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’ characters such as ‘.-.’ or a numerical array like [draw, skip, draw, skip, ...] such as [1, 10] to draw a dotted line, [1, 10, 20, 10] to draw a dot-dash line, and so on.

+ +

shadowAngle

this.shadowAngle = 45

Shadow angle in degrees

+ +

shadowOffset

this.shadowOffset = 1.25

Shadow offset from line in pixels

+ +

shadowDepth

this.shadowDepth = 3

Number of times shadow is stroked, each stroke offset shadowOffset from the last.

+ +

shadowAlpha

this.shadowAlpha = '0.1'

Alpha channel transparency of shadow.  0 = transparent.

+ +

breakOnNull

this.breakOnNull = false

Wether line segments should be be broken at null value.  False will join point on either side of line.

+ +

markerRenderer

this.markerRenderer = $.jqplot.MarkerRenderer

A class of a renderer which will draw marker (e.g. circle, square, ...) at the data points, see $.jqplot.MarkerRenderer.

+ +

markerOptions

this.markerOptions = {}

renderer specific options to pass to the markerRenderer, see $.jqplot.MarkerRenderer.

+ +

showLine

this.showLine = true

whether to actually draw the line or not.  Series will still be renderered, even if no line is drawn.

+ +

showMarker

this.showMarker = true

whether or not to show the markers at the data points.

+ +

index

this.index

0 based index of this series in the plot series array.

+ +

fill

this.fill = false

true or false, whether to fill under lines or in bars.  May not be implemented in all renderers.

+ +

fillColor

this.fillColor

CSS color spec to use for fill under line.  Defaults to line color.

+ +

fillAlpha

this.fillAlpha

Alpha transparency to apply to the fill under the line.  Use this to adjust alpha separate from fill color.

+ +

fillAndStroke

this.fillAndStroke = false

If true will stroke the line (with color this.color) as well as fill under it.  Applies only when fill is true.

+ +

disableStack

this.disableStack = false

true to not stack this series with other series in the plot.  To render properly, non-stacked series must come after any stacked series in the plot’s data series array.  So, the plot’s data series array would look like:

[stackedSeries1, stackedSeries2, ..., nonStackedSeries1, nonStackedSeries2, ...]

disableStack will put a gap in the stacking order of series, and subsequent stacked series will not fill down through the non-stacked series and will most likely not stack properly on top of the non-stacked series.

+ +

neighborThreshold

this.neighborThreshold = 4

how close or far (in pixels) the cursor must be from a point marker to detect the point.

+ +

fillToZero

this.fillToZero = false

true will force bar and filled series to fill toward zero on the fill Axis.

+ +

fillToValue

this.fillToValue = 0

fill a filled series to this value on the fill axis.  Works in conjunction with fillToZero, so that must be true.

+ +

fillAxis

this.fillAxis = 'y'

Either ‘x’ or ‘y’.  Which axis to fill the line toward if fillToZero is true.  ‘y’ means fill up/down to 0 on the y axis for this series.

+ +

useNegativeColors

this.useNegativeColors = true

true to color negative values differently in filled and bar charts.

+ +

Grid

Object representing the grid on which the plot is drawn.  The grid in this context is the area bounded by the axes, the area which will contain the series.  Note, the series are drawn on their own canvas.  The Grid object cannot be instantiated directly, but is created by the Plot object.  Grid properties can be set or overridden by the options passed in from the user.

Summary
Properties
drawGridlineswhether to draw the gridlines on the plot.
gridLineColorcolor of the grid lines.
gridLineWidthwidth of the grid lines.
backgroundcss spec for the background color.
borderColorcss spec for the color of the grid border.
borderWidthwidth of the border in pixels.
drawBorderTrue to draw border around grid.
shadowwhether to show a shadow behind the grid.
shadowAngleshadow angle in degrees
shadowOffsetOffset of each shadow stroke from the border in pixels
shadowWidthwidth of the stoke for the shadow
shadowDepthNumber of times shadow is stroked, each stroke offset shadowOffset from the last.
shadowColoran optional css color spec for the shadow in ‘rgba(n, n, n, n)’ form
shadowAlphaAlpha channel transparency of shadow.
rendererInstance of a renderer which will actually render the grid, see $.jqplot.CanvasGridRenderer.
rendererOptionsOptions to pass on to the renderer, see $.jqplot.CanvasGridRenderer.
+ +

Properties

+ +

drawGridlines

this.drawGridlines = true

whether to draw the gridlines on the plot.

+ +

gridLineColor

this.gridLineColor = '#cccccc'

color of the grid lines.

+ +

gridLineWidth

this.gridLineWidth = 1.0

width of the grid lines.

+ +

background

this.background = '#fffdf6'

css spec for the background color.

+ +

borderColor

this.borderColor = '#999999'

css spec for the color of the grid border.

+ +

borderWidth

this.borderWidth = 2.0

width of the border in pixels.

+ +

drawBorder

this.drawBorder = true

True to draw border around grid.

+ +

shadow

this.shadow = true

whether to show a shadow behind the grid.

+ +

shadowAngle

this.shadowAngle = 45

shadow angle in degrees

+ +

shadowOffset

this.shadowOffset = 1.5

Offset of each shadow stroke from the border in pixels

+ +

shadowWidth

this.shadowWidth = 3

width of the stoke for the shadow

+ +

shadowDepth

this.shadowDepth = 3

Number of times shadow is stroked, each stroke offset shadowOffset from the last.

+ +

shadowColor

this.shadowColor = null

an optional css color spec for the shadow in ‘rgba(n, n, n, n)’ form

+ +

shadowAlpha

this.shadowAlpha = '0.07'

Alpha channel transparency of shadow.  0 = transparent.

+ +

renderer

this.renderer = $.jqplot.CanvasGridRenderer

Instance of a renderer which will actually render the grid, see $.jqplot.CanvasGridRenderer.

+ +

rendererOptions

this.rendererOptions = {}

Options to pass on to the renderer, see $.jqplot.CanvasGridRenderer.

+ +

jqPlot

Plot object returned by call to $.jqplot.  Handles parsing user options, creating sub objects (Axes, legend, title, series) and rendering the plot.

Summary
PropertiesThese properties are specified at the top of the options object like so:
animateTrue to animate the series on initial plot draw (renderer dependent).
animateReplotTrue to animate series after a call to the replot() method.
axesup to 4 axes are supported, each with its own options, See Axis for axis specific options.
datauser’s data.
dataRendererA callable which can be used to preprocess data passed into the plot.
dataRendererOptionsOptions that will be passed to the dataRenderer.
axesDefaultsdefault options that will be applied to all axes.
seriesDefaultsdefault options that will be applied to all series.
defaultAxisStart1-D data series are internally converted into 2-D [x,y] data point arrays by jqPlot.
fillBetweenFill between 2 line series in a plot.
fontSizecss spec for the font-size attribute.
gridSee Grid for grid specific options.
legendsee <$.jqplot.TableLegendRenderer>
noDataIndicatorOptions to set up a mock plot with a data loading indicator if no data is specified.
negativeSeriesColorscolors to use for portions of the line below zero.
seriesArray of series object options.
seriesColorsAnn array of CSS color specifications that will be applied, in order, to the series in the plot.
sortDatafalse to not sort the data passed in by the user.
stackSeriestrue or false, creates a stack or “mountain” plot.
titleTitle object.
methods
initsets the plot target, checks data and applies user options to plot.
resetAxesScaleReset the specified axes min, max, numberTicks and tickInterval properties to null or reset these properties on all axes if no list of axes is provided.
reInitializereinitialize plot for replotting.
quickInitQuick reinitialization plot for replotting.
destroyReleases all resources occupied by the plot
replotDoes a reinitialization of the plot followed by a redraw.
redrawEmpties the plot target div and redraws the plot.
drawDraws all elements of the plot into the container.
drawSeriesRedraws all or just one series on the plot.
moveSeriesToFrontThis method requires jQuery 1.4+ Moves the specified series canvas in front of all other series canvases.
moveSeriesToBackThis method requires jQuery 1.4+ Moves the specified series canvas behind all other series canvases.
restorePreviousSeriesOrderThis method requires jQuery 1.4+ Restore the series canvas order to its previous state.
restoreOriginalSeriesOrderThis method requires jQuery 1.4+ Restore the series canvas order to its original order when the plot was created.
+ +

Properties

These properties are specified at the top of the options object like so:

{
+    axesDefaults:{min:0},
+    series:[{color:'#6633dd'}],
+    title: 'A Plot'
+}
+ +

animate

this.animate = false

True to animate the series on initial plot draw (renderer dependent).  Actual animation functionality must be supported in the renderer.

+ +

animateReplot

this.animateReplot = false

True to animate series after a call to the replot() method.  Use with caution!  Replots can happen very frequently under certain circumstances (e.g. resizing, dragging points) and animation in these situations can cause problems.

+ +

axes

this.axes = {xaxis: new Axis('xaxis'), yaxis: new Axis('yaxis'), x2axis: new Axis('x2axis'), y2axis: new Axis('y2axis'), y3axis: new Axis('y3axis'), y4axis: new Axis('y4axis'), y5axis: new Axis('y5axis'), y6axis: new Axis('y6axis'), y7axis: new Axis('y7axis'), y8axis: new Axis('y8axis'), y9axis: new Axis('y9axis'), yMidAxis: new Axis('yMidAxis')}

up to 4 axes are supported, each with its own options, See Axis for axis specific options.

+ +

data

this.data = []

user’s data.  Data should NOT be specified in the options object, but be passed in as the second argument to the $.jqplot() function.  The data property is described here soley for reference.  The data should be in the form of an array of 2D or 1D arrays like

[ [[x1, y1], [x2, y2],...], [y1, y2, ...] ].
+ +

dataRenderer

this.dataRenderer

A callable which can be used to preprocess data passed into the plot.  Will be called with 3 arguments: the plot data, a reference to the plot, and the value of dataRendererOptions.

+ +

dataRendererOptions

this.dataRendererOptions

Options that will be passed to the dataRenderer.  Can be of any type.

+ +

axesDefaults

default options that will be applied to all axes. see Axis for axes options.

+ +

seriesDefaults

seriesDefaults: {}, series:[] }

default options that will be applied to all series. see Series for series options.

+ +

defaultAxisStart

this.defaultAxisStart = 1

1-D data series are internally converted into 2-D [x,y] data point arrays by jqPlot.  This is the default starting value for the missing x or y value.  The added data will be a monotonically increasing series (e.g.  [1, 2, 3, ...]) starting at this value.

+ +

fillBetween

this.fillBetween = { series1: null, series2: null, color: null, baseSeries: 0, fill: true }

Fill between 2 line series in a plot.  Options object: { series1: first index (0 based) of series in fill series2: second index (0 based) of series in fill color: color of fill [default fillColor of series1] baseSeries: fill will be drawn below this series (0 based index) fill: false to turn off fill [default true].  }

+ +

fontSize

this.fontSize

css spec for the font-size attribute.  Default for the entire plot.

+ +

grid

this.grid = new Grid()

See Grid for grid specific options.

+ +

legend

this.legend = new Legend()

see <$.jqplot.TableLegendRenderer>

+ +

noDataIndicator

this.noDataIndicator = { show: false, indicator: 'Loading Data...', axes: { xaxis: { min: 0, max: 10, tickInterval: 2, show: true }, yaxis: { min: 0, max: 12, tickInterval: 3, show: true } } }

Options to set up a mock plot with a data loading indicator if no data is specified.

+ +

negativeSeriesColors

this.negativeSeriesColors = $.jqplot.config.defaultNegativeColors

colors to use for portions of the line below zero.

+ +

series

this.series = []

Array of series object options. see Series for series specific options.

+ +

seriesColors

this.seriesColors = $.jqplot.config.defaultColors

Ann array of CSS color specifications that will be applied, in order, to the series in the plot.  Colors will wrap around so, if their are more series than colors, colors will be reused starting at the beginning.  For pie charts, this specifies the colors of the slices.

+ +

sortData

this.sortData = true

false to not sort the data passed in by the user.  Many bar, stacked and other graphs as well as many plugins depend on having sorted data.

+ +

stackSeries

this.stackSeries = false

true or false, creates a stack or “mountain” plot.  Not all series renderers may implement this option.

+ +

title

this.title = new Title()

Title object.  See Title for specific options.  As a shortcut, you can specify the title option as just a string like: title: ‘My Plot’ and this will create a new title object with the specified text.

+ +

methods

+ +

init

this.init = function(target,
data,
options)

sets the plot target, checks data and applies user options to plot.

+ +

resetAxesScale

this.resetAxesScale = function(axes,
options)

Reset the specified axes min, max, numberTicks and tickInterval properties to null or reset these properties on all axes if no list of axes is provided.

Parameters

axesBoolean to reset or not reset all axes or an array or object of axis names to reset.
+ +

reInitialize

this.reInitialize = function (data,
opts)

reinitialize plot for replotting. not called directly.

+ +

quickInit

this.quickInit = function ()

Quick reinitialization plot for replotting.  Does not parse options ore recreate axes and series. not called directly.

+ +

destroy

this.destroy = function()

Releases all resources occupied by the plot

+ +

replot

this.replot = function(options)

Does a reinitialization of the plot followed by a redraw.  Method could be used to interactively change plot characteristics and then replot.

Parameters

optionsOptions used for replotting.

Properties

clearfalse to not clear (empty) the plot container before replotting (default: true).
resetAxestrue to reset all axes min, max, numberTicks and tickInterval setting so axes will rescale themselves. optionally pass in list of axes to reset (e.g.  [‘xaxis’, ‘y2axis’]) (default: false).
+ +

redraw

this.redraw = function(clear)

Empties the plot target div and redraws the plot.  This enables plot data and properties to be changed and then to comletely clear the plot and redraw. redraw will not reinitialize any plot elements.  That is, axes will not be autoscaled and defaults will not be reapplied to any plot elements.  redraw is used primarily with zooming.

Parameters

clearfalse to not clear (empty) the plot container before redrawing (default: true).
+ +

draw

this.draw = function()

Draws all elements of the plot into the container.  Does not clear the container before drawing.

+ +

drawSeries

this.drawSeries = function(options,
idx)

Redraws all or just one series on the plot.  No axis scaling is performed and no other elements on the plot are redrawn. options is an options object to pass on to the series renderers.  It can be an empty object {}.  idx is the series index to redraw if only one series is to be redrawn.

+ +

moveSeriesToFront

this.moveSeriesToFront = function (idx)

This method requires jQuery 1.4+ Moves the specified series canvas in front of all other series canvases.  This effectively “draws” the specified series on top of all other series, although it is performed through DOM manipulation, no redrawing is performed.

Parameters

idx0 based index of the series to move.  This will be the index of the series as it was first passed into the jqplot function.
+ +

moveSeriesToBack

this.moveSeriesToBack = function (idx)

This method requires jQuery 1.4+ Moves the specified series canvas behind all other series canvases.

Parameters

idx0 based index of the series to move.  This will be the index of the series as it was first passed into the jqplot function.
+ +

restorePreviousSeriesOrder

this.restorePreviousSeriesOrder = function ()

This method requires jQuery 1.4+ Restore the series canvas order to its previous state.  Useful to put a series back where it belongs after moving it to the front.

+ +

restoreOriginalSeriesOrder

this.restoreOriginalSeriesOrder = function ()

This method requires jQuery 1.4+ Restore the series canvas order to its original order when the plot was created.

+ +
+ + + + + + + + + + +
This document is out of date.
This document will help you understand how jqPlot’s options relate to the API documentation and the jqPlot object itself.
this.show = false
Wether to display the axis on the graph.
this.tickRenderer = $.jqplot.AxisTickRenderer
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
A “tick” object showing the value of a tick/gridline on the plot.
this.tickOptions = {}
Options that will be passed to the tickRenderer, see $.jqplot.AxisTickRenderer options.
this.labelRenderer = $.jqplot.AxisLabelRenderer
A class of a rendering engine for creating an axis label.
this.labelOptions = {}
Options passed to the label renderer.
this.label = null
Label for the axis
this.showLabel = true
true to show the axis label.
this.min = null
minimum value of the axis (in data units, not pixels).
this.max = null
maximum value of the axis (in data units, not pixels).
this.autoscale = false
DEPRECATED the default scaling algorithm produces superior results.
this.pad = 1.2
Padding to extend the range above and below the data bounds.
this.padMax = null
Padding to extend the range above data bounds.
this.padMin = null
Padding to extend the range below data bounds.
this.ticks = []
1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis.
this.numberTicks
Desired number of ticks.
this.tickInterval
number of units between ticks.
this.renderer = $.jqplot.LinearAxisRenderer
A class of a rendering engine that handles tick generation, scaling input data to pixel grid units and drawing the axis element.
this.rendererOptions = {}
renderer specific options.
this.showTicks = true
Wether to show the ticks (both marks and labels) or not.
this.showTickMarks = true
Wether to show the tick marks (line crossing grid) or not.
this.showMinorTicks = true
Wether or not to show minor ticks.
this.drawMajorGridlines = true
True to draw gridlines for major axis ticks.
this.drawMinorGridlines = false
True to draw gridlines for minor ticks.
this.drawMajorTickMarks = true
True to draw tick marks for major axis ticks.
this.drawMinorTickMarks = true
True to draw tick marks for minor ticks.
this.useSeriesColor = false
Use the color of the first series associated with this axis for the tick marks and line bordering this axis.
this.borderWidth = null
width of line stroked at the border of the axis.
this.borderColor = null
color of the border adjacent to the axis.
this.scaleToHiddenSeries = false
True to include hidden series when computing axes bounds and scaling.
this.syncTicks = null
true to try and synchronize tick spacing across multiple axes so that ticks and grid lines line up.
this.tickSpacing = 75
Approximate pixel spacing between ticks on graph.
this.show = false
Wether to display the legend on the graph.
this.location = 'ne'
Placement of the legend.
this.labels = []
Array of labels to use.
this.showLabels = true
true to show the label text on the legend.
this.showSwatches = true
true to show the color swatches on the legend.
this.placement = "insideGrid"
“insideGrid” places legend inside the grid area of the plot.
this.xoffset = 0
DEPRECATED.
this.yoffset = 0
DEPRECATED.
this.border
css spec for the border around the legend box.
this.background
css spec for the background of the legend box.
this.textColor
css color spec for the legend text.
this.fontFamily
css font-family spec for the legend text.
this.fontSize
css font-size spec for the legend text.
this.rowSpacing = '0.5em'
css padding-top spec for the rows in the legend.
this.rendererOptions = {}
renderer specific options passed to the renderer.
this.marginTop = null
CSS margin for the legend DOM element.
this.marginRight = null
CSS margin for the legend DOM element.
this.marginBottom = null
CSS margin for the legend DOM element.
this.marginLeft = null
CSS margin for the legend DOM element.
this.escapeHtml = false
True to escape special characters with their html entity equivalents in legend text.
this.text = text
text of the title;
this.show = true
whether or not to show the title
this.fontFamily
css font-family spec for the text.
this.fontSize
css font-size spec for the text.
this.textAlign
css text-align spec for the text.
this.textColor
css color spec for the text.
this.renderer = $.jqplot.DivTitleRenderer
A class for creating a DOM element for the title, see $.jqplot.DivTitleRenderer.
The default title renderer for jqPlot.
this.rendererOptions = {}
renderer specific options passed to the renderer.
this.escapeHtml = false
True to escape special characters with their html entity equivalents in title text.
this.show = true
whether or not to draw the series.
this.xaxis = 'xaxis'
which x axis to use with this series, either ‘xaxis’ or ‘x2axis’.
this.yaxis = 'yaxis'
which y axis to use with this series, either ‘yaxis’ or ‘y2axis’.
this.renderer = $.jqplot.LineRenderer
A class of a renderer which will draw the series, see $.jqplot.LineRenderer.
The default line renderer for jqPlot, this class has no options beyond the Series class.
this.rendererOptions = {}
Options to pass on to the renderer.
this.label = ''
Line label to use in the legend.
this.showLabel = true
true to show label for this series in the legend.
this.color
css color spec for the series
this.negativeColor
css color spec used for filled (area) plots that are filled to zero and the “useNegativeColors” option is true.
this.lineWidth = 2.5
width of the line in pixels.
this.lineJoin = 'round'
Canvas lineJoin style between segments of series.
this.lineCap = 'round'
Canvas lineCap style at ends of line.
this.linePattern = 'solid'
line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
this.shadowAngle = 45
Shadow angle in degrees
this.shadowOffset = 1.25
Shadow offset from line in pixels
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowAlpha = '0.1'
Alpha channel transparency of shadow.
this.breakOnNull = false
Wether line segments should be be broken at null value.
this.markerRenderer = $.jqplot.MarkerRenderer
A class of a renderer which will draw marker (e.g.
this.markerOptions = {}
renderer specific options to pass to the markerRenderer, see $.jqplot.MarkerRenderer.
The default jqPlot marker renderer, rendering the points on the line.
this.showLine = true
whether to actually draw the line or not.
this.showMarker = true
whether or not to show the markers at the data points.
this.index
0 based index of this series in the plot series array.
this.fill = false
true or false, whether to fill under lines or in bars.
this.fillColor
CSS color spec to use for fill under line.
this.fillAlpha
Alpha transparency to apply to the fill under the line.
this.fillAndStroke = false
If true will stroke the line (with color this.color) as well as fill under it.
this.disableStack = false
true to not stack this series with other series in the plot.
this.neighborThreshold = 4
how close or far (in pixels) the cursor must be from a point marker to detect the point.
this.fillToZero = false
true will force bar and filled series to fill toward zero on the fill Axis.
this.fillToValue = 0
fill a filled series to this value on the fill axis.
this.fillAxis = 'y'
Either ‘x’ or ‘y’.
this.useNegativeColors = true
true to color negative values differently in filled and bar charts.
this.drawGridlines = true
whether to draw the gridlines on the plot.
this.gridLineColor = '#cccccc'
color of the grid lines.
this.gridLineWidth = 1.0
width of the grid lines.
this.background = '#fffdf6'
css spec for the background color.
this.borderColor = '#999999'
css spec for the color of the grid border.
this.borderWidth = 2.0
width of the border in pixels.
this.drawBorder = true
True to draw border around grid.
this.shadow = true
whether to show a shadow behind the grid.
this.shadowAngle = 45
shadow angle in degrees
this.shadowOffset = 1.5
Offset of each shadow stroke from the border in pixels
this.shadowWidth = 3
width of the stoke for the shadow
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowColor = null
an optional css color spec for the shadow in ‘rgba(n, n, n, n)’ form
this.shadowAlpha = '0.07'
Alpha channel transparency of shadow.
this.renderer = $.jqplot.CanvasGridRenderer
Instance of a renderer which will actually render the grid, see $.jqplot.CanvasGridRenderer.
The default jqPlot grid renderer, creating a grid on a canvas element.
this.rendererOptions = {}
Options to pass on to the renderer, see $.jqplot.CanvasGridRenderer.
this.animate = false
True to animate the series on initial plot draw (renderer dependent).
this.animateReplot = false
True to animate series after a call to the replot() method.
this.axes = {xaxis: new Axis('xaxis'), yaxis: new Axis('yaxis'), x2axis: new Axis('x2axis'), y2axis: new Axis('y2axis'), y3axis: new Axis('y3axis'), y4axis: new Axis('y4axis'), y5axis: new Axis('y5axis'), y6axis: new Axis('y6axis'), y7axis: new Axis('y7axis'), y8axis: new Axis('y8axis'), y9axis: new Axis('y9axis'), yMidAxis: new Axis('yMidAxis')}
up to 4 axes are supported, each with its own options, See Axis for axis specific options.
An individual axis object.
this.data = []
user’s data.
this.dataRenderer
A callable which can be used to preprocess data passed into the plot.
this.dataRendererOptions
Options that will be passed to the dataRenderer.
seriesDefaults: {}, series:[] }
default options that will be applied to all series.
this.defaultAxisStart = 1
1-D data series are internally converted into 2-D [x,y] data point arrays by jqPlot.
this.fillBetween = { series1: null, series2: null, color: null, baseSeries: 0, fill: true }
Fill between 2 line series in a plot.
this.fontSize
css spec for the font-size attribute.
this.grid = new Grid()
See Grid for grid specific options.
Object representing the grid on which the plot is drawn.
this.legend = new Legend()
see $.jqplot.TableLegendRenderer
this.noDataIndicator = { show: false, indicator: 'Loading Data...', axes: { xaxis: { min: 0, max: 10, tickInterval: 2, show: true }, yaxis: { min: 0, max: 12, tickInterval: 3, show: true } } }
Options to set up a mock plot with a data loading indicator if no data is specified.
this.negativeSeriesColors = $.jqplot.config.defaultNegativeColors
colors to use for portions of the line below zero.
this.series = []
Array of series object options.
this.seriesColors = $.jqplot.config.defaultColors
Ann array of CSS color specifications that will be applied, in order, to the series in the plot.
this.sortData = true
false to not sort the data passed in by the user.
this.stackSeries = false
true or false, creates a stack or “mountain” plot.
this.title = new Title()
Title object.
this.init = function(target,
data,
options)
sets the plot target, checks data and applies user options to plot.
this.resetAxesScale = function(axes,
options)
Reset the specified axes min, max, numberTicks and tickInterval properties to null or reset these properties on all axes if no list of axes is provided.
this.reInitialize = function (data,
opts)
reinitialize plot for replotting.
this.quickInit = function ()
Quick reinitialization plot for replotting.
this.destroy = function()
Releases all resources occupied by the plot
this.replot = function(options)
Does a reinitialization of the plot followed by a redraw.
this.redraw = function(clear)
Empties the plot target div and redraws the plot.
this.draw = function()
Draws all elements of the plot into the container.
this.drawSeries = function(options,
idx)
Redraws all or just one series on the plot.
this.moveSeriesToFront = function (idx)
This method requires jQuery 1.4+ Moves the specified series canvas in front of all other series canvases.
this.moveSeriesToBack = function (idx)
This method requires jQuery 1.4+ Moves the specified series canvas behind all other series canvases.
this.restorePreviousSeriesOrder = function ()
This method requires jQuery 1.4+ Restore the series canvas order to its previous state.
this.restoreOriginalSeriesOrder = function ()
This method requires jQuery 1.4+ Restore the series canvas order to its original order when the plot was created.
GNU GENERAL PUBLIC LICENSE Version 2, June 1991
Copyright © 2009-2013 Chris Leonello
The default jqPlot axis renderer, creating a numeric axis.
An individual data series object.
Plot Title object.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-divTitleRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-divTitleRenderer-js.html new file mode 100644 index 00000000..40dd10bb --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-divTitleRenderer-js.html @@ -0,0 +1,39 @@ + + +$.jqplot.DivTitleRenderer + + + + + + + + + +

The default title renderer for jqPlot.  This class has no options beyond the Title class.

+ +
+ + + + + + + + + + +
Plot Title object.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-lineRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-lineRenderer-js.html new file mode 100644 index 00000000..8b16254c --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-lineRenderer-js.html @@ -0,0 +1,69 @@ + + +$.jqplot.LineRenderer + + + + + + + + + +

The default line renderer for jqPlot, this class has no options beyond the Series class.  Draws series as a line.

Summary
$.jqplot.LineRendererThe default line renderer for jqPlot, this class has no options beyond the Series class.
Properties
smoothTrue to draw a smoothed (interpolated) line through the data points with automatically computed number of smoothing points.
constrainSmoothingTrue to use a more accurate smoothing algorithm that will not overshoot any data points.
bandDataData used to draw error bands or confidence intervals above/below a line.
bandsBanding around line, e.g error bands or confidence intervals.
showtrue to show the bands.
colorcolor of lines at top and bottom of bands [default: series color].
showLinesTrue to show lines at top and bottom of bands [default: false].
fillTrue to fill area between bands [default: true].
fillColorcss color spec for filled area.
intervalUser specified interval above and below line for bands [default: ‘3%’’].
Properties
highlightMouseOverTrue to highlight area on a filled plot when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over an area on a filled plot.
highlightColorcolor to use when highlighting an area on a filled plot.
+ +

Properties

+ +

smooth

this.renderer.smooth = false

True to draw a smoothed (interpolated) line through the data points with automatically computed number of smoothing points.  Set to an integer number > 2 to specify number of smoothing points to use between each data point.

+ +

constrainSmoothing

this.renderer.constrainSmoothing = true

True to use a more accurate smoothing algorithm that will not overshoot any data points.  False to allow overshoot but produce a smoother looking line.

+ +

bandData

this.renderer.bandData = []

Data used to draw error bands or confidence intervals above/below a line.

bandData can be input in 3 forms.  jqPlot will figure out which is the low band line and which is the high band line for all forms:

A 2 dimensional array like [[yl1, yl2, ...], [yu1, yu2, ...]] where [yl1, yl2, ...] are y values of the lower line and [yu1, yu2, ...] are y values of the upper line.  In this case there must be the same number of y data points as data points in the series and the bands will inherit the x values of the series.

A 2 dimensional array like [[[xl1, yl1], [xl2, yl2], ...], [[xh1, yh1], [xh2, yh2], ...]] where [xl1, yl1] are x,y data points for the lower line and [xh1, yh1] are x,y data points for the high line. x values do not have to correspond to the x values of the series and can be of any arbitrary length.

Can be of form [[yl1, yu1], [yl2, yu2], [yl3, yu3], ...] where there must be 3 or more arrays and there must be the same number of arrays as there are data points in the series.  In this case, [yl1, yu1] specifies the lower and upper y values for the 1st data point and so on.  The bands will inherit the x values from the series.

+ +

bands

Banding around line, e.g error bands or confidence intervals.

+ +

show

true to show the bands.  If bandData or interval is supplied, show will be set to true by default.

+ +

color

color of lines at top and bottom of bands [default: series color].

+ +

showLines

True to show lines at top and bottom of bands [default: false].

+ +

fill

True to fill area between bands [default: true].

+ +

fillColor

css color spec for filled area.  [default: series color].

+ +

interval

interval: '3%' }

User specified interval above and below line for bands [default: ‘3%’’].  Can be a value like 3 or a string like ‘3%’ or an upper/lower array like [1, -2] or [‘2%’, ‘-1.5%’]

+ +

Properties

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight area on a filled plot when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on an area on a filled plot.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over an area on a filled plot.  This will be disabled if highlightMouseOver is true.

+ +

highlightColor

this.highlightColor = null

color to use when highlighting an area on a filled plot.

+ +
+ + + + + + + + + + +
An individual data series object.
this.renderer.smooth = false
True to draw a smoothed (interpolated) line through the data points with automatically computed number of smoothing points.
this.renderer.constrainSmoothing = true
True to use a more accurate smoothing algorithm that will not overshoot any data points.
this.renderer.bandData = []
Data used to draw error bands or confidence intervals above/below a line.
interval: '3%' }
User specified interval above and below line for bands [default: ‘3%’’].
this.highlightMouseOver = true
True to highlight area on a filled plot when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over an area on a filled plot.
this.highlightColor = null
color to use when highlighting an area on a filled plot.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-linearAxisRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-linearAxisRenderer-js.html new file mode 100644 index 00000000..63eecb01 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-linearAxisRenderer-js.html @@ -0,0 +1,61 @@ + + +$.jqplot.LinearAxisRenderer + + + + + + + + + +

The default jqPlot axis renderer, creating a numeric axis.

Summary
$.jqplot.LinearAxisRendererThe default jqPlot axis renderer, creating a numeric axis.
Properties
breakPointsEXPERIMENTAL!! 
breakTickLabelLabel to use at the axis break if breakPoints are specified.
drawBaselineTrue to draw the axis baseline.
baselineWidthwidth of the baseline in pixels.
baselineColorCSS color spec for the baseline.
forceTickAt0This will ensure that there is always a tick mark at 0.
forceTickAt100This will ensure that there is always a tick mark at 100.
tickInsetControls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
minorTicksNumber of ticks to add between “major” ticks.
alignTickstrue to align tick marks across opposed axes such as from the y2axis to yaxis.
+ +

Properties

+ +

breakPoints

this.breakPoints = null

EXPERIMENTAL!!  Use at your own risk!  Works only with linear axes and the default tick renderer.  Array of [start, stop] points to create a broken axis.  Broken axes have a “jump” in them, which is an immediate transition from a smaller value to a larger value.  Currently, axis ticks MUST be manually assigned if using breakPoints by using the axis ticks array option.

+ +

breakTickLabel

this.breakTickLabel = "&asymp

Label to use at the axis break if breakPoints are specified.

+ +

drawBaseline

this.drawBaseline = true

True to draw the axis baseline.

+ +

baselineWidth

this.baselineWidth = null

width of the baseline in pixels.

+ +

baselineColor

this.baselineColor = null

CSS color spec for the baseline.

+ +

forceTickAt0

this.forceTickAt0 = false

This will ensure that there is always a tick mark at 0.  If data range is strictly positive or negative, this will force 0 to be inside the axis bounds unless the appropriate axis pad (pad, padMin or padMax) is set to 0, then this will force an axis min or max value at 0.  This has know effect when any of the following options are set: autoscale, min, max, numberTicks or tickInterval.

+ +

forceTickAt100

this.forceTickAt100 = false

This will ensure that there is always a tick mark at 100.  If data range is strictly above or below 100, this will force 100 to be inside the axis bounds unless the appropriate axis pad (pad, padMin or padMax) is set to 0, then this will force an axis min or max value at 100.  This has know effect when any of the following options are set: autoscale, min, max, numberTicks or tickInterval.

+ +

tickInset

this.tickInset = 0

Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.  0 is no inset, 0.5 is one half a tick interval, 1 is a full tick interval, etc.

+ +

minorTicks

this.minorTicks = 0

Number of ticks to add between “major” ticks.  Major ticks are ticks supplied by user or auto computed.  Minor ticks cannot be created by user.

+ +

alignTicks

this.alignTicks = false

true to align tick marks across opposed axes such as from the y2axis to yaxis.

+ +
+ + + + + + + + + + +
this.breakPoints = null
EXPERIMENTAL!! 
this.breakTickLabel = "&asymp
Label to use at the axis break if breakPoints are specified.
this.drawBaseline = true
True to draw the axis baseline.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineColor = null
CSS color spec for the baseline.
this.forceTickAt0 = false
This will ensure that there is always a tick mark at 0.
this.forceTickAt100 = false
This will ensure that there is always a tick mark at 100.
this.tickInset = 0
Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
this.minorTicks = 0
Number of ticks to add between “major” ticks.
this.alignTicks = false
true to align tick marks across opposed axes such as from the y2axis to yaxis.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-markerRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-markerRenderer-js.html new file mode 100644 index 00000000..e4fe68a2 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-markerRenderer-js.html @@ -0,0 +1,65 @@ + + +$.jqplot.MarkerRenderer + + + + + + + + + +

The default jqPlot marker renderer, rendering the points on the line.

Summary
$.jqplot.MarkerRendererThe default jqPlot marker renderer, rendering the points on the line.
Properties
showwhether or not to show the marker.
styleOne of diamond, circle, square, x, plus, dash, filledDiamond, filledCircle, filledSquare
lineWidthsize of the line for non-filled markers.
sizeSize of the marker (diameter or circle, length of edge of square, etc.)
colorcolor of marker.
shadowwhether or not to draw a shadow on the line
shadowAngleShadow angle in degrees
shadowOffsetShadow offset from line in pixels
shadowDepthNumber of times shadow is stroked, each stroke offset shadowOffset from the last.
shadowAlphaAlpha channel transparency of shadow.
shadowRendererRenderer that will draws the shadows on the marker.
shapeRendererRenderer that will draw the marker.
+ +

Properties

+ +

show

this.show = true

whether or not to show the marker.

+ +

style

this.style = 'filledCircle'

One of diamond, circle, square, x, plus, dash, filledDiamond, filledCircle, filledSquare

+ +

lineWidth

this.lineWidth = 2

size of the line for non-filled markers.

+ +

size

this.size = 9.0

Size of the marker (diameter or circle, length of edge of square, etc.)

+ +

color

this.color = '#666666'

color of marker.  Will be set to color of series by default on init.

+ +

shadow

this.shadow = true

whether or not to draw a shadow on the line

+ +

shadowAngle

this.shadowAngle = 45

Shadow angle in degrees

+ +

shadowOffset

this.shadowOffset = 1

Shadow offset from line in pixels

+ +

shadowDepth

this.shadowDepth = 3

Number of times shadow is stroked, each stroke offset shadowOffset from the last.

+ +

shadowAlpha

this.shadowAlpha = '0.07'

Alpha channel transparency of shadow.  0 = transparent.

+ +

shadowRenderer

this.shadowRenderer = new $.jqplot.ShadowRenderer()

Renderer that will draws the shadows on the marker.

+ +

shapeRenderer

this.shapeRenderer = new $.jqplot.ShapeRenderer()

Renderer that will draw the marker.

+ +
+ + + + + + + + + + +
this.show = true
whether or not to show the marker.
this.style = 'filledCircle'
One of diamond, circle, square, x, plus, dash, filledDiamond, filledCircle, filledSquare
this.lineWidth = 2
size of the line for non-filled markers.
this.size = 9.0
Size of the marker (diameter or circle, length of edge of square, etc.)
this.color = '#666666'
color of marker.
this.shadow = true
whether or not to draw a shadow on the line
this.shadowAngle = 45
Shadow angle in degrees
this.shadowOffset = 1
Shadow offset from line in pixels
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowAlpha = '0.07'
Alpha channel transparency of shadow.
this.shadowRenderer = new $.jqplot.ShadowRenderer()
Renderer that will draws the shadows on the marker.
this.shapeRenderer = new $.jqplot.ShapeRenderer()
Renderer that will draw the marker.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-shadowRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-shadowRenderer-js.html new file mode 100644 index 00000000..788c170a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-shadowRenderer-js.html @@ -0,0 +1,61 @@ + + +$.jqplot.shadowRenderer + + + + + + + + + +

The default jqPlot shadow renderer, rendering shadows behind shapes.

Summary
$.jqplot.shadowRendererThe default jqPlot shadow renderer, rendering shadows behind shapes.
Properties
angleAngle of the shadow in degrees.
offsetPixel offset at the given shadow angle of each shadow stroke from the last stroke.
alphaalpha transparency of shadow stroke.
lineWidthwidth of the shadow line stroke.
lineJoinHow line segments of the shadow are joined.
lineCaphow ends of the shadow line are rendered.
fillwhether to fill the shape.
depthhow many times the shadow is stroked.
isarcwhether the shadow is an arc or not.
drawdraws an transparent black (i.e.
+ +

Properties

+ +

angle

this.angle = 45

Angle of the shadow in degrees.  Measured counter-clockwise from the x axis.

+ +

offset

this.offset = 1

Pixel offset at the given shadow angle of each shadow stroke from the last stroke.

+ +

alpha

this.alpha = 0.07

alpha transparency of shadow stroke.

+ +

lineWidth

this.lineWidth = 1.5

width of the shadow line stroke.

+ +

lineJoin

this.lineJoin = 'miter'

How line segments of the shadow are joined.

+ +

lineCap

this.lineCap = 'round'

how ends of the shadow line are rendered.

+ +

fill

this.fill = false

whether to fill the shape.

+ +

depth

this.depth = 3

how many times the shadow is stroked.  Each stroke will be offset by offset at angle degrees.

+ +

isarc

this.isarc = false

whether the shadow is an arc or not.

+ +

draw

$.jqplot.ShadowRenderer.prototype.draw = function(ctx,
points,
options)

draws an transparent black (i.e. gray) shadow.

ctxcanvas drawing context
pointsarray of points or [x, y, radius, start angle (rad), end angle (rad)]
+ +
+ + + + + + + + + + +
this.angle = 45
Angle of the shadow in degrees.
this.offset = 1
Pixel offset at the given shadow angle of each shadow stroke from the last stroke.
this.alpha = 0.07
alpha transparency of shadow stroke.
this.lineWidth = 1.5
width of the shadow line stroke.
this.lineJoin = 'miter'
How line segments of the shadow are joined.
this.lineCap = 'round'
how ends of the shadow line are rendered.
this.fill = false
whether to fill the shape.
this.depth = 3
how many times the shadow is stroked.
this.isarc = false
whether the shadow is an arc or not.
$.jqplot.ShadowRenderer.prototype.draw = function(ctx,
points,
options)
draws an transparent black (i.e.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-shapeRenderer-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-shapeRenderer-js.html new file mode 100644 index 00000000..c7609dba --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-shapeRenderer-js.html @@ -0,0 +1,65 @@ + + +$.jqplot.shapeRenderer + + + + + + + + + +

The default jqPlot shape renderer.  Given a set of points will plot them and either stroke a line (fill = false) or fill them (fill = true).  If a filled shape is desired, closePath = true must also be set to close the shape.

Summary
$.jqplot.shapeRendererThe default jqPlot shape renderer.
Properties
linePatternline pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
lineJoinHow line segments of the shadow are joined.
lineCaphow ends of the shadow line are rendered.
fillwhether to fill the shape.
isarcwhether the shadow is an arc or not.
fillRecttrue to draw shape as a filled rectangle.
strokeRecttrue to draw shape as a stroked rectangle.
clearRecttrue to cear a rectangle.
strokeStylecss color spec for the stoke style
fillStylecss color spec for the fill style.
Functions
drawdraws the shape.
+ +

Properties

+ +

linePattern

this.linePattern = 'solid'

line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’ characters such as ‘.-.’ or a numerical array like [draw, skip, draw, skip, ...] such as [1, 10] to draw a dotted line, [1, 10, 20, 10] to draw a dot-dash line, and so on.

+ +

lineJoin

this.lineJoin = 'miter'

How line segments of the shadow are joined.

+ +

lineCap

this.lineCap = 'round'

how ends of the shadow line are rendered.

+ +

fill

this.fill = false

whether to fill the shape.

+ +

isarc

this.isarc = false

whether the shadow is an arc or not.

+ +

fillRect

this.fillRect = false

true to draw shape as a filled rectangle.

+ +

strokeRect

this.strokeRect = false

true to draw shape as a stroked rectangle.

+ +

clearRect

this.clearRect = false

true to cear a rectangle.

+ +

strokeStyle

this.strokeStyle = '#999999'

css color spec for the stoke style

+ +

fillStyle

this.fillStyle = '#999999'

css color spec for the fill style.

+ +

Functions

+ +

draw

$.jqplot.ShapeRenderer.prototype.draw = function(ctx,
points,
options)

draws the shape.

ctxcanvas drawing context
pointsarray of points for shapes or [x, y, width, height] for rectangles or [x, y, radius, start angle (rad), end angle (rad)] for circles and arcs.
+ +
+ + + + + + + + + + +
this.linePattern = 'solid'
line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
this.lineJoin = 'miter'
How line segments of the shadow are joined.
this.lineCap = 'round'
how ends of the shadow line are rendered.
this.fill = false
whether to fill the shape.
this.isarc = false
whether the shadow is an arc or not.
this.fillRect = false
true to draw shape as a filled rectangle.
this.strokeRect = false
true to draw shape as a stroked rectangle.
this.clearRect = false
true to cear a rectangle.
this.strokeStyle = '#999999'
css color spec for the stoke style
this.fillStyle = '#999999'
css color spec for the fill style.
$.jqplot.ShapeRenderer.prototype.draw = function(ctx,
points,
options)
draws the shape.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-themeEngine-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-themeEngine-js.html new file mode 100644 index 00000000..7cec80e5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-themeEngine-js.html @@ -0,0 +1,191 @@ + + +$.jqplot.ThemeEngine + + + + + + + + + +

Theme Engine provides a programatic way to change some of the more common jqplot styling options such as fonts, colors and grid options.  A theme engine instance is created with each plot.  The theme engine manages a collection of themes which can be modified, added to, or applied to the plot.

The themeEngine class is not instantiated directly.  When a plot is initialized, the current plot options are scanned an a default theme named “Default” is created.  This theme is used as the basis for other themes added to the theme engine and is always available.

A theme is a simple javascript object with styling parameters for various entities of the plot.  A theme has the form:

{
+    _name:f "Default",
+    target: {
+        backgroundColor: "transparent"
+    },
+    legend: {
+        textColor: null,
+        fontFamily: null,
+        fontSize: null,
+        border: null,
+        background: null
+    },
+    title: {
+        textColor: "rgb(102, 102, 102)",
+        fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif",
+        fontSize: "19.2px",
+        textAlign: "center"
+    },
+    seriesStyles: {},
+    series: [{
+        color: "#4bb2c5",
+        lineWidth: 2.5,
+        linePattern: "solid",
+        shadow: true,
+        fillColor: "#4bb2c5",
+        showMarker: true,
+        markerOptions: {
+            color: "#4bb2c5",
+            show: true,
+            style: 'filledCircle',
+            lineWidth: 1.5,
+            size: 4,
+            shadow: true
+        }
+    }],
+    grid: {
+        drawGridlines: true,
+        gridLineColor: "#cccccc",
+        gridLineWidth: 1,
+        backgroundColor: "#fffdf6",
+        borderColor: "#999999",
+        borderWidth: 2,
+        shadow: true
+    },
+    axesStyles: {
+        label: {},
+        ticks: {}
+    },
+    axes: {
+        xaxis: {
+            borderColor: "#999999",
+            borderWidth: 2,
+            ticks: {
+                show: true,
+                showGridline: true,
+                showLabel: true,
+                showMark: true,
+                size: 4,
+                textColor: "",
+                whiteSpace: "nowrap",
+                fontSize: "12px",
+                fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif"
+            },
+            label: {
+                textColor: "rgb(102, 102, 102)",
+                whiteSpace: "normal",
+                fontSize: "14.6667px",
+                fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif",
+                fontWeight: "400"
+            }
+        },
+        yaxis: {
+            borderColor: "#999999",
+            borderWidth: 2,
+            ticks: {
+                show: true,
+                showGridline: true,
+                showLabel: true,
+                showMark: true,
+                size: 4,
+                textColor: "",
+                whiteSpace: "nowrap",
+                fontSize: "12px",
+                fontFamily: "'Trebuchet MS',Arial,Helvetica,sans-serif"
+            },
+            label: {
+                textColor: null,
+                whiteSpace: null,
+                fontSize: null,
+                fontFamily: null,
+                fontWeight: null
+            }
+        },
+        x2axis: {...
+        },
+        ...
+        y9axis: {...
+        }
+    }
+}

”seriesStyles” is a style object that will be applied to all series in the plot.  It will forcibly override any styles applied on the individual series.  “axesStyles” is a style object that will be applied to all axes in the plot.  It will also forcibly override any styles on the individual axes.

The example shown above has series options for a line series.  Options for other series types are shown below:

Bar Series

{
+    color: "#4bb2c5",
+    seriesColors: ["#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"],
+    lineWidth: 2.5,
+    shadow: true,
+    barPadding: 2,
+    barMargin: 10,
+    barWidth: 15.09375,
+    highlightColors: ["rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)", "rgb(129,201,214)"]
+}

Pie Series

{
+    seriesColors: ["#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"],
+    padding: 20,
+    sliceMargin: 0,
+    fill: true,
+    shadow: true,
+    startAngle: 0,
+    lineWidth: 2.5,
+    highlightColors: ["rgb(129,201,214)", "rgb(240,189,104)", "rgb(214,202,165)", "rgb(137,180,158)", "rgb(168,180,137)", "rgb(180,174,89)", "rgb(180,113,161)", "rgb(129,141,236)", "rgb(227,205,120)", "rgb(255,138,76)", "rgb(76,169,219)", "rgb(215,126,190)", "rgb(220,232,135)", "rgb(200,167,96)", "rgb(103,202,235)", "rgb(208,154,215)"]
+}

Funnel Series

{
+    color: "#4bb2c5",
+    lineWidth: 2,
+    shadow: true,
+    padding: {
+        top: 20,
+        right: 20,
+        bottom: 20,
+        left: 20
+    },
+    sectionMargin: 6,
+    seriesColors: ["#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"],
+    highlightColors: ["rgb(147,208,220)", "rgb(242,199,126)", "rgb(220,210,178)", "rgb(154,191,172)", "rgb(180,191,154)", "rgb(191,186,112)", "rgb(191,133,174)", "rgb(147,157,238)", "rgb(231,212,139)", "rgb(255,154,102)", "rgb(102,181,224)", "rgb(221,144,199)", "rgb(225,235,152)", "rgb(200,167,96)", "rgb(124,210,238)", "rgb(215,169,221)"]
+}
Summary
$.jqplot.ThemeEngineTheme Engine provides a programatic way to change some of the more common jqplot styling options such as fonts, colors and grid options.
Properties
themeshash of themes managed by the theme engine.
activeThemePointer to currently active theme
methods
getGet and return the named theme or the active theme if no name given.
getThemeNamesReturn the list of theme names in this manager in alpha-numerical order.
getThemesReturn a list of themes in alpha-numerical order by name.
removeRemove the given theme from the themeEngine.
newThemeCreate a new theme based on the default theme, adding it the themeEngine.
renameRename a theme.
copyCreate a copy of an existing theme in the themeEngine, adding it the themeEngine.
+ +

Properties

+ +

themes

this.themes = {}

hash of themes managed by the theme engine.  Indexed by theme name.

+ +

activeTheme

this.activeTheme=null

Pointer to currently active theme

+ +

methods

+ +

get

$.jqplot.ThemeEngine.prototype.get = function(name)

Get and return the named theme or the active theme if no name given.

parameter

namename of theme to get.

returns

Theme instance of given name.

+ +

getThemeNames

$.jqplot.ThemeEngine.prototype.getThemeNames = function()

Return the list of theme names in this manager in alpha-numerical order.

parameter

None

returns

A the list of theme names in this manager in alpha-numerical order.

+ +

getThemes

$.jqplot.ThemeEngine.prototype.getThemes = function()

Return a list of themes in alpha-numerical order by name.

parameter

None

returns

A list of themes in alpha-numerical order by name.

+ +

remove

$.jqplot.ThemeEngine.prototype.remove = function(name)

Remove the given theme from the themeEngine.

parameters

namename of the theme to remove.

returns

true on success, false on failure.

+ +

newTheme

$.jqplot.ThemeEngine.prototype.newTheme = function(name,
obj)

Create a new theme based on the default theme, adding it the themeEngine.

parameters

namename of the new theme.
objoptional object of styles to be applied to this new theme.

returns

new Theme object.

+ +

rename

$.jqplot.ThemeEngine.prototype.rename = function (oldName,
newName)

Rename a theme.

parameters

oldNamecurrent name of the theme.
newNamedesired name of the theme.

returns

new Theme object.

+ +

copy

$.jqplot.ThemeEngine.prototype.copy = function (sourceName,
targetName,
obj)

Create a copy of an existing theme in the themeEngine, adding it the themeEngine.

parameters

sourceNamename of the existing theme.
targetNamename of the copy.
objoptional object of style parameter to apply to the new theme.

returns

new Theme object.

+ +
+ + + + + + + + + + +
this.themes = {}
hash of themes managed by the theme engine.
this.activeTheme=null
Pointer to currently active theme
$.jqplot.ThemeEngine.prototype.get = function(name)
Get and return the named theme or the active theme if no name given.
$.jqplot.ThemeEngine.prototype.getThemeNames = function()
Return the list of theme names in this manager in alpha-numerical order.
$.jqplot.ThemeEngine.prototype.getThemes = function()
Return a list of themes in alpha-numerical order by name.
$.jqplot.ThemeEngine.prototype.remove = function(name)
Remove the given theme from the themeEngine.
$.jqplot.ThemeEngine.prototype.newTheme = function(name,
obj)
Create a new theme based on the default theme, adding it the themeEngine.
$.jqplot.ThemeEngine.prototype.rename = function (oldName,
newName)
Rename a theme.
$.jqplot.ThemeEngine.prototype.copy = function (sourceName,
targetName,
obj)
Create a copy of an existing theme in the themeEngine, adding it the themeEngine.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/jqplot-toImage-js.html b/public/site_assets/test/js/dist/docs/files/jqplot-toImage-js.html new file mode 100644 index 00000000..4e97de5d --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/jqplot-toImage-js.html @@ -0,0 +1,39 @@ + + +$.fn + + + + + + + + + +

jQuery namespace to attach functions to jQuery elements.

+ +
+ + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/optionsTutorial-txt.html b/public/site_assets/test/js/dist/docs/files/optionsTutorial-txt.html new file mode 100644 index 00000000..52dfd1e6 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/optionsTutorial-txt.html @@ -0,0 +1,120 @@ + + +Options Tutorial + + + + + + + + + +

This document will help you understand how jqPlot’s options relate to the API documentation and the jqPlot object itself.  For a listing of options available to jqPlot, see jqPlot Options in the jqPlotOptions.txt file.

The key to effectively using jqPlot is understanding jqPlot’s options.  The online documentation is API documentation.  While it explains what attributes and methods various objects possess, it doesn’t explain how to use or set those attributes through options.  This tutorial will help explain that.

Let’s assume you are creating a plot like this:

chart = $.jqplot('chart', dataSeries, optionsObj);

First, note that you shouldn’t try to directly set attributes on the “chart” object (like chart.grid.shadow) after your call to $.jqplot().  At best this won’t do anything **(see below).  You should pass options in via the “optionsObj”.

The optionsObj really represents the plot object (jqPlot object, not to be confused with the $.jqplot function which will create a jqPlot object).  Attributes you specify on that object will be merged with attributes in the jqPlot object.  The axes, legend, series, etc. are attributes on the jqPlot object.  The jqPlot/optionsObj object looks something like (only some attributes shown):

jqPlot-|
+       |-seriesColors
+       |-textColor
+       |-fontFamily
+       |-fontSize
+       |-stackSeries
+       |-series(Array)-|
+       |               |-Series1-|
+       |               |         |-lineWidth
+       |               |         |-linePattern
+       |               |         |-shadow
+       |               |         |-showLine
+       |               |         |-showMarker
+       |               |         |-color
+       |               |-Series2...
+       |               |-...
+       |               |-SeriesN
+       |
+       |-grid(Object)-|
+       |              |-drawGridLines
+       |              |-background
+       |              |-borderColor
+       |              |-borderWidth
+       |              |-shadow
+       |
+       |-title(Object)-|
+       |               |-text
+       |               |-show
+       |               |-fontFamily
+       |               |-fontSize
+       |               |-textAlign
+       |               |-textColor
+       |
+       |-axes(Object)-|
+       |              |-xais-|
+       |              |      |-min
+       |              |      |-max
+       |              |      |-numberTicks
+       |              |      |-showTicks
+       |              |      |-showTickMarks
+       |              |      |-pad
+       |
+       | ... and so on

The optionsObj should follow the same construction as if it were a jqPlot object (with some exceptions/shortcuts I’ll mention in a moment).  So generally, when you see something like “this.drawGridLines” in the grid properties in the docs, just replace “this” with “grid” in your options object.  So it becomes optionsObj.grid.drawGridLines.  Do likewise with the other objects in the plot, replacing “this”, with the respective attribute on the plot like “legend” or “title”.  Series and Axes are handled a little differently, because series is an array and axes has 4 distinct children “xaxis”, “yaxis”, “x2axis” and “y2axis”.

So, to remove the shadow from the grid and change the grid border size you would do:

optionObj = {grid:{shadow:false, borderWidth:9.0}};

To do the same as above but also make all the text in the plot red you would do:

optionObj = {
+   textColor:"#ff0000",
+   grid:{shadow:false, borderWidth:9.0}
+}

Here is a more deeply nested example.  Say you want to specify a min and max on your y axis and use a specific color for your second series.  That would look like:

optionsObj = {
+   axes:{yaxis:{min:5, max:230}},
+   series:[{},{color:"#33ff66"}]
+}

Note that series options are an array in order of the series data you sent in to your plot.  To get to the second series, you have to put an object (even if empty) in place of the first series.

There is a handy shortcut to assign options to all axes or all series at one go.  Use axesDefaults and seriesDefaults.  So, if you wanted both x and y axes to start at 0 and you wanted all series to not show markers, you could do:

optionsObj = {axesDefaults:{min:0}, seriesDefaults:{showMarker:false}}

Another shortcut is for the plot title.  Normally, you would assign options to the title as an object.  If you specify a title option as a string, it will assign that to the title.text property automatically.  So these two are equivalent:

optionsObj = {title:{text:"My Plot"}}

and

optionsObj = {title:"My Plot"}

Where things need more explanation is with renderers, plugins and their options.  Briefly, what’s the difference between a renderer and a plugin.

A renderer is an object that is used to draw something and gets attached to an existing object in the plot in order to draw it.  A plugin does more than just provide drawing functionality to an object; it can calculate a trend line, change the cursor, provide event driven functionality, etc.  I consider renderers plugins, but plugins don’t have to be renderers.

So, how do you use renderers and plugins, and specify their options?  Some common renderers are for bar charts and category axes.  If you want to render your series as a bar chart with each set of bars showing up in a category on the x axis, you do:

optionsObj = {
+   seriesDefaults:{renderer:$.jqplot.BarRenderer},
+   axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer}}
+}

This replaces the default renderer used for all series in the plot with a bar renderer and the x axis default renderer (but not any other axis) with a category renderer.

Now, how would I assign options to those renderers?  The renderer’s attributes may not be present in the pre-existing jqPlot object, they may be specific to the renderer.  This is done through the “rendererOptions” option on the appropriate object.  So, if I wanted my bars to be 25 pixels wide, I would do:

optionsObj = {
+   seriesDefaults:{
+       renderer:$.jqplot.BarRenderer},
+       rendererOptions:{
+           barWidth:25
+       },
+   axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer}}
+}

Again, this is using the “seriesDefaults” option, which will apply options to all series in the plot.  You could do the same on any particular series in the plot through the “series” options array.

Plugins are free to add their own options.  For example, the highlighter plugin has its own set of options that are unique to it.  As a result, it responds to options placed in the “highlighter” attribute of your options object.  So, if I wanted to change the highlighter tooltip to fade in and out slowly and be positioned directly above the point I’m highlighting:

optionsObj = {
+    highlighter:{tooltipFadeSpeed:'slow', tooltipLocation:'n'}
+}

Other plugins, like dragable and trendlines, add their options in with the series.  (Yes, that’s the correct name for the dragable plugin; it doesn’t use the correct spelling of “draggable”.)  This is because both of those plugins can have different options for different series in the plot.  So, if you wanted to specify the color for the dragable plugin and constrain it to drag only on the x axis as well as specify the color of the trend line you could do:

series:[{
+    dragable: {
+        color: '#ff3366',
+        constrainTo: 'x'
+    },
+    trendline: {
+        color: '#cccccc'
+    }
+}]

This would apply those options to the first series only.  If you had 2 series and wanted to turn off dragging and trend lines on the second series, you could do:

series:[{
+    dragable: {
+        color: '#ff3366',
+        constrainTo: 'x'
+    },
+    trendline: {
+        color: '#cccccc'
+    }
+}, {
+   isDragable: false,
+   trendline:{
+       show: false
+   }
+}]

Note, series draggability is turned off with the “isDragable” option directly on the series itself, not with a suboption of “dragable”.  This may be improved in the future.

I hope this is helpful.  A few key points to remember:

  • When you see “this” in the api docs, you generally replace it with the name of the object (in lowercase) you are looking at in your options object.
  • seriesDefaults and axesDefaults are convenient shortcuts.
  • to assign options to a renderer, generally use the “rendererOptions”
  • plugins may add their own options attribute, like “highlighter” or “cursor”.

** Note: you can set attributes after the plot is created (like plot.grid.shadow = false), but you’ll have to issue the appropriate calls to possibly reinitialize and redraw the plot.  jqPlot can definitely handle this to change the plot after creation (this is how the dragable plugin updates the plot data and the trend line plugin recomputes itself when data changes).  This hasn’t been documented yet, however.

+ +
+ + + + + + + + + + +
This document is out of date.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-BezierCurveRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-BezierCurveRenderer-js.html new file mode 100644 index 00000000..dab9e9fa --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-BezierCurveRenderer-js.html @@ -0,0 +1,45 @@ + + +$.jqplot.BezierCurveRenderer.js + + + + + + + + + +

Renderer which draws lines as stacked bezier curves.  Data for the line will not be specified as an array of [x, y] data point values, but as a an array of [start piont, bezier curve] So, the line is specified as: [[xstart, ystart], [cp1x, cp1y, cp2x, cp2y, xend, yend]].

Summary
$.jqplot.BezierCurveRenderer.jsRenderer which draws lines as stacked bezier curves.
Functions
setGridDataconverts the user data values to grid coordinates and stores them in the gridData array.
makeGridDataconverts any arbitrary data values to grid coordinates and returns them.
+ +

Functions

+ +

setGridData

$.jqplot.BezierCurveRenderer.prototype.setGridData = function(plot)

converts the user data values to grid coordinates and stores them in the gridData array.  Called with scope of a series.

+ +

makeGridData

$.jqplot.BezierCurveRenderer.prototype.makeGridData = function(data,
plot)

converts any arbitrary data values to grid coordinates and returns them.  This method exists so that plugins can use a series’ linerenderer to generate grid data points without overwriting the grid data associated with that series.  Called with scope of a series.

+ +
+ + + + + + + + + + +
$.jqplot.BezierCurveRenderer.prototype.setGridData = function(plot)
converts the user data values to grid coordinates and stores them in the gridData array.
$.jqplot.BezierCurveRenderer.prototype.makeGridData = function(data,
plot)
converts any arbitrary data values to grid coordinates and returns them.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-barRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-barRenderer-js.html new file mode 100644 index 00000000..4a856ba5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-barRenderer-js.html @@ -0,0 +1,69 @@ + + +$.jqplot.BarRenderer + + + + + + + + + +

A plugin renderer for jqPlot to draw a bar plot.  Draws series as a line.

Summary
$.jqplot.BarRendererA plugin renderer for jqPlot to draw a bar plot.
Properties
barPaddingNumber of pixels between adjacent bars at the same axis value.
barMarginNumber of pixels between groups of bars at adjacent axis values.
barDirection‘vertical’ = up and down bars, ‘horizontal’ = side to side bars
barWidthWidth of the bar in pixels (auto by devaul).
shadowOffsetoffset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
shadowDepthnumber of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
shadowAlphatransparency of the shadow (0 = transparent, 1 = opaque)
waterfalltrue to enable waterfall plot.
groupsgroup bars into this many groups
varyBarColortrue to color each bar of a series separately rather than have every bar of a given series the same color.
highlightMouseOverTrue to highlight slice when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over a slice.
highlightColorsan array of colors to use when highlighting a bar.
transposedDataNOT IMPLEMENTED YET.
+ +

Properties

+ +

barPadding

this.barPadding = 8

Number of pixels between adjacent bars at the same axis value.

+ +

barMargin

this.barMargin = 10

Number of pixels between groups of bars at adjacent axis values.

+ +

barDirection

this.barDirection = 'vertical'

’vertical’ = up and down bars, ‘horizontal’ = side to side bars

+ +

barWidth

this.barWidth = null

Width of the bar in pixels (auto by devaul).  null = calculated automatically.

+ +

shadowOffset

this.shadowOffset = 2

offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.

+ +

shadowDepth

this.shadowDepth = 5

number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.

+ +

shadowAlpha

this.shadowAlpha = 0.08

transparency of the shadow (0 = transparent, 1 = opaque)

+ +

waterfall

this.waterfall = false

true to enable waterfall plot.

+ +

groups

this.groups = 1

group bars into this many groups

+ +

varyBarColor

this.varyBarColor = false

true to color each bar of a series separately rather than have every bar of a given series the same color.  If used for non-stacked multiple series bar plots, user should specify a separate ‘seriesColors’ array for each series.  Otherwise, each series will set their bars to the same color array.  This option has no Effect for stacked bar charts and is disabled.

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight slice when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on a slice.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over a slice.  This will be disabled if highlightMouseOver is true.

+ +

highlightColors

this.highlightColors = []

an array of colors to use when highlighting a bar.

+ +

transposedData

this.transposedData = true

NOT IMPLEMENTED YET.  True if this is a horizontal bar plot and x and y values are “transposed”.  Tranposed, or “swapped”, data is required prior to rev.  894 builds of jqPlot with horizontal bars.  Allows backward compatability of bar renderer horizontal bars with old style data sets.

+ +
+ + + + + + + + + + +
this.barPadding = 8
Number of pixels between adjacent bars at the same axis value.
this.barMargin = 10
Number of pixels between groups of bars at adjacent axis values.
this.barDirection = 'vertical'
‘vertical’ = up and down bars, ‘horizontal’ = side to side bars
this.barWidth = null
Width of the bar in pixels (auto by devaul).
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowAlpha = 0.08
transparency of the shadow (0 = transparent, 1 = opaque)
this.waterfall = false
true to enable waterfall plot.
this.groups = 1
group bars into this many groups
this.varyBarColor = false
true to color each bar of a series separately rather than have every bar of a given series the same color.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightColors = []
an array of colors to use when highlighting a bar.
this.transposedData = true
NOT IMPLEMENTED YET.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-blockRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-blockRenderer-js.html new file mode 100644 index 00000000..85270823 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-blockRenderer-js.html @@ -0,0 +1,53 @@ + + +$.jqplot.BlockRenderer + + + + + + + + + +

Plugin renderer to draw a x-y block chart.  A Block chart has data points displayed as colored squares with a text label inside.  Data must be supplied in the form:

[[x1, y1, "label 1", {css}], [x2, y2, "label 2", {css}], ...]

The label and css object are optional.  If the label is ommitted, the box will collapse unless a css height and/or width is specified.

The css object is an object specifying css properties such as:

{background:'#4f98a5', border:'3px solid gray', padding:'1px'}

Note that css properties specified with the data point override defaults specified with the series.

Summary
$.jqplot.BlockRendererPlugin renderer to draw a x-y block chart.
Properties
cssdefault css styles that will be applied to all data blocks.
escapeHtmltrue to escape html in the box label.
insertBreakstrue to turn spaces in data block label into html breaks <br />.
varyBlockColorstrue to vary the color of each block in this series according to the seriesColors array.
Methods
moveBlockMoves an individual block.
+ +

Properties

+ +

css

this.css = {padding:'2px', border:'1px solid #999', textAlign:'center'}

default css styles that will be applied to all data blocks. these values will be overridden by css styles supplied with the individulal data points.

+ +

escapeHtml

this.escapeHtml = false

true to escape html in the box label.

+ +

insertBreaks

this.insertBreaks = true

true to turn spaces in data block label into html breaks <br />.

+ +

varyBlockColors

this.varyBlockColors = false

true to vary the color of each block in this series according to the seriesColors array.  False to set each block to the color specified on this series.  This has no effect if a css background color option is specified in the renderer css options.

+ +

Methods

+ +

moveBlock

this.moveBlock = function (idx,
x,
y,
duration)

Moves an individual block.  More efficient than redrawing the whole series by calling plot.drawSeries().  Properties: idx - the 0 based index of the block or point in this series. x - the x coordinate in data units (value on x axis) to move the block to. y - the y coordinate in data units (value on the y axis) to move the block to. duration - optional parameter to create an animated movement.  Can be a number (higher is slower animation) or ‘fast’, ‘normal’ or ‘slow’.  If not provided, the element is moved without any animation.

+ +
+ + + + + + + + + + +
this.css = {padding:'2px', border:'1px solid #999', textAlign:'center'}
default css styles that will be applied to all data blocks.
this.escapeHtml = false
true to escape html in the box label.
this.insertBreaks = true
true to turn spaces in data block label into html breaks br /.
this.varyBlockColors = false
true to vary the color of each block in this series according to the seriesColors array.
this.moveBlock = function (idx,
x,
y,
duration)
Moves an individual block.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-bubbleRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-bubbleRenderer-js.html new file mode 100644 index 00000000..ee64b575 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-bubbleRenderer-js.html @@ -0,0 +1,71 @@ + + +$.jqplot.BubbleRenderer + + + + + + + + + +

Plugin renderer to draw a bubble chart.  A Bubble chart has data points displayed as colored circles with an optional text label inside.  To use the bubble renderer, you must include the bubble renderer like:

<script language="javascript" type="text/javascript" src="../src/plugins/jqplot.bubbleRenderer.js"></script>

Data must be supplied in the form:

[[x1, y1, r1, <label or {label:'text', color:color}>], ...]

where the label or options object is optional.

Note that all bubble colors will be the same unless the “varyBubbleColors” option is set to true.  Colors can be specified in the data array or in the seriesColors array option on the series.  If no colors are defined, the default jqPlot series of 16 colors are used.  Colors are automatically cycled around again if there are more bubbles than colors.

Bubbles are autoscaled by default to fit within the chart area while maintaining relative sizes.  If the “autoscaleBubbles” option is set to false, the r(adius) values in the data array a treated as literal pixel values for the radii of the bubbles.

Properties are passed into the bubble renderer in the rendererOptions object of the series options like:

seriesDefaults: {
+    renderer: $.jqplot.BubbleRenderer,
+    rendererOptions: {
+        bubbleAlpha: 0.7,
+        varyBubbleColors: false
+    }
+}
Summary
$.jqplot.BubbleRendererPlugin renderer to draw a bubble chart.
Properties
varyBubbleColorsTrue to vary the color of each bubble in this series according to the seriesColors array.
autoscaleBubblesTrue to scale the bubble radius based on plot size.
autoscaleMultiplierMultiplier the bubble size if autoscaleBubbles is true.
autoscalePointsFactorFactor which decreases bubble size based on how many bubbles on on the chart.
escapeHtmlTrue to escape html in bubble label text.
highlightMouseOverTrue to highlight bubbles when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over a bubble.
highlightColorsAn array of colors to use when highlighting a slice.
bubbleAlphaAlpha transparency to apply to all bubbles in this series.
highlightAlphaAlpha transparency to apply when highlighting bubble.
bubbleGradientsTrue to color the bubbles with gradient fills instead of flat colors.
showLabelsTrue to show labels on bubbles (if any), false to not show.
+ +

Properties

+ +

varyBubbleColors

this.varyBubbleColors = true

True to vary the color of each bubble in this series according to the seriesColors array.  False to set each bubble to the color specified on this series.  This has no effect if a css background color option is specified in the renderer css options.

+ +

autoscaleBubbles

this.autoscaleBubbles = true

True to scale the bubble radius based on plot size.  False will use the radius value as provided as a raw pixel value for bubble radius.

+ +

autoscaleMultiplier

this.autoscaleMultiplier = 1.0

Multiplier the bubble size if autoscaleBubbles is true.

+ +

autoscalePointsFactor

this.autoscalePointsFactor = -0.07

Factor which decreases bubble size based on how many bubbles on on the chart.  0 means no adjustment for number of bubbles.  Negative values will decrease size of bubbles as more bubbles are added.  Values between 0 and -0.2 should work well.

+ +

escapeHtml

this.escapeHtml = true

True to escape html in bubble label text.

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight bubbles when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on a slice.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over a bubble.  This will be disabled if highlightMouseOver is true.

+ +

highlightColors

this.highlightColors = []

An array of colors to use when highlighting a slice.  Calculated automatically if not supplied.

+ +

bubbleAlpha

this.bubbleAlpha = 1.0

Alpha transparency to apply to all bubbles in this series.

+ +

highlightAlpha

this.highlightAlpha = null

Alpha transparency to apply when highlighting bubble.  Set to value of bubbleAlpha by default.

+ +

bubbleGradients

this.bubbleGradients = false

True to color the bubbles with gradient fills instead of flat colors.  NOT AVAILABLE IN IE due to lack of excanvas support for radial gradient fills. will be ignored in IE.

+ +

showLabels

this.showLabels = true

True to show labels on bubbles (if any), false to not show.

+ +
+ + + + + + + + + + +
this.varyBubbleColors = true
True to vary the color of each bubble in this series according to the seriesColors array.
this.autoscaleBubbles = true
True to scale the bubble radius based on plot size.
this.autoscaleMultiplier = 1.0
Multiplier the bubble size if autoscaleBubbles is true.
this.autoscalePointsFactor = -0.07
Factor which decreases bubble size based on how many bubbles on on the chart.
this.escapeHtml = true
True to escape html in bubble label text.
this.highlightMouseOver = true
True to highlight bubbles when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a bubble.
this.highlightColors = []
An array of colors to use when highlighting a slice.
this.bubbleAlpha = 1.0
Alpha transparency to apply to all bubbles in this series.
this.highlightAlpha = null
Alpha transparency to apply when highlighting bubble.
this.bubbleGradients = false
True to color the bubbles with gradient fills instead of flat colors.
this.showLabels = true
True to show labels on bubbles (if any), false to not show.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasAxisLabelRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasAxisLabelRenderer-js.html new file mode 100644 index 00000000..79a17132 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasAxisLabelRenderer-js.html @@ -0,0 +1,63 @@ + + +$.jqplot.CanvasAxisLabelRenderer + + + + + + + + + +

Renderer to draw axis labels with a canvas element to support advanced featrues such as rotated text.  This renderer uses a separate rendering engine to draw the text on the canvas.  Two modes of rendering the text are available.  If the browser has native font support for canvas fonts (currently Mozila 3.5 and Safari 4), you can enable text rendering with the canvas fillText method.  You do so by setting the “enableFontSupport” option to true.

Browsers lacking native font support will have the text drawn on the canvas using the Hershey font metrics.  Even if the “enableFontSupport” option is true non-supporting browsers will still render with the Hershey font.

Summary
$.jqplot.CanvasAxisLabelRendererRenderer to draw axis labels with a canvas element to support advanced featrues such as rotated text.
Properties
angleangle of text, measured clockwise from x axis.
showwhether or not to show the tick (mark and label).
showLabelwhether or not to show the label.
labellabel for the axis.
fontFamilyCSS spec for the font-family css attribute.
fontSizeCSS spec for font size.
fontWeight
fontStretchMultiplier to condense or expand font width.
textColorcss spec for the color attribute.
enableFontSupporttrue to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
pt2pxPoint to pixel scaling factor, used for computing height of bounding box around a label.
+ +

Properties

+ +

angle

this.angle = 0

angle of text, measured clockwise from x axis.

+ +

show

this.show = true

whether or not to show the tick (mark and label).

+ +

showLabel

this.showLabel = true

whether or not to show the label.

+ +

label

this.label = ''

label for the axis.

+ +

fontFamily

this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'

CSS spec for the font-family css attribute.  Applies only to browsers supporting native font rendering in the canvas tag.  Currently Mozilla 3.5 and Safari 4.

+ +

fontSize

this.fontSize = '11pt'

CSS spec for font size.

+ +

fontWeight

this.fontWeight = 'normal'
CSS spec for fontWeight: normal, bold, bolder, lighter or a number 100900
+ +

fontStretch

this.fontStretch = 1.0

Multiplier to condense or expand font width.  Applies only to browsers which don’t support canvas native font rendering.

+ +

textColor

this.textColor = '#666666'

css spec for the color attribute.

+ +

enableFontSupport

this.enableFontSupport = true

true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.  If true, label will be drawn with canvas tag native support for fonts.  If false, label will be drawn with Hershey font metrics.

+ +

pt2px

this.pt2px = null

Point to pixel scaling factor, used for computing height of bounding box around a label.  The labels text renderer has a default setting of 1.4, which should be suitable for most fonts.  Leave as null to use default.  If tops of letters appear clipped, increase this.  If bounding box seems too big, decrease.  This is an issue only with the native font renderering capabilities of Mozilla 3.5 and Safari 4 since they do not provide a method to determine the font height.

+ +
+ + + + + + + + + + +
this.angle = 0
angle of text, measured clockwise from x axis.
this.show = true
whether or not to show the tick (mark and label).
this.showLabel = true
whether or not to show the label.
this.label = ''
label for the axis.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'
CSS spec for the font-family css attribute.
this.fontSize = '11pt'
CSS spec for font size.
this.fontWeight = 'normal'
this.fontStretch = 1.0
Multiplier to condense or expand font width.
this.textColor = '#666666'
css spec for the color attribute.
this.enableFontSupport = true
true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
this.pt2px = null
Point to pixel scaling factor, used for computing height of bounding box around a label.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasAxisTickRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasAxisTickRenderer-js.html new file mode 100644 index 00000000..77e2e24d --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasAxisTickRenderer-js.html @@ -0,0 +1,79 @@ + + +$.jqplot.CanvasAxisTickRenderer + + + + + + + + + +

Renderer to draw axis ticks with a canvas element to support advanced featrues such as rotated text.  This renderer uses a separate rendering engine to draw the text on the canvas.  Two modes of rendering the text are available.  If the browser has native font support for canvas fonts (currently Mozila 3.5 and Safari 4), you can enable text rendering with the canvas fillText method.  You do so by setting the “enableFontSupport” option to true.

Browsers lacking native font support will have the text drawn on the canvas using the Hershey font metrics.  Even if the “enableFontSupport” option is true non-supporting browsers will still render with the Hershey font.

Summary
$.jqplot.CanvasAxisTickRendererRenderer to draw axis ticks with a canvas element to support advanced featrues such as rotated text.
Properties
marktick mark on the axis.
showMarkwhether or not to show the mark on the axis.
showGridlinewhether or not to draw the gridline on the grid at this tick.
isMinorTickif this is a minor tick.
angleangle of text, measured clockwise from x axis.
markSizeLength of the tick marks in pixels.
showwhether or not to show the tick (mark and label).
showLabelwhether or not to show the label.
labelPosition‘auto’, ‘start’, ‘middle’ or ‘end’.
formatterA class of a formatter for the tick text.
formatStringstring passed to the formatter.
prefixString to prepend to the tick label.
fontFamilycss spec for the font-family css attribute.
fontSizeCSS spec for font size.
fontWeightCSS spec for fontWeight
fontStretchMultiplier to condense or expand font width.
textColorcss spec for the color attribute.
enableFontSupporttrue to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
pt2pxPoint to pixel scaling factor, used for computing height of bounding box around a label.
+ +

Properties

+ +

mark

this.mark = 'outside'

tick mark on the axis.  One of ‘inside’, ‘outside’, ‘cross’, ‘’ or null.

+ +

showMark

this.showMark = true

whether or not to show the mark on the axis.

+ +

showGridline

this.showGridline = true

whether or not to draw the gridline on the grid at this tick.

+ +

isMinorTick

this.isMinorTick = false

if this is a minor tick.

+ +

angle

this.angle = 0

angle of text, measured clockwise from x axis.

+ +

markSize

this.markSize = 4

Length of the tick marks in pixels.  For ‘cross’ style, length will be stoked above and below axis, so total length will be twice this.

+ +

show

this.show = true

whether or not to show the tick (mark and label).

+ +

showLabel

this.showLabel = true

whether or not to show the label.

+ +

labelPosition

this.labelPosition = 'auto'

’auto’, ‘start’, ‘middle’ or ‘end’.  Whether tick label should be positioned so the start, middle, or end of the tick mark.

+ +

formatter

this.formatter = $.jqplot.DefaultTickFormatter

A class of a formatter for the tick text.  The default $.jqplot.DefaultTickFormatter uses sprintf.

+ +

formatString

this.formatString = ''

string passed to the formatter.

+ +

prefix

this.prefix = ''

String to prepend to the tick label.  Prefix is prepended to the formatted tick label.

+ +

fontFamily

this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'

css spec for the font-family css attribute.

+ +

fontSize

this.fontSize = '10pt'

CSS spec for font size.

+ +

fontWeight

this.fontWeight = 'normal'

CSS spec for fontWeight

+ +

fontStretch

this.fontStretch = 1.0

Multiplier to condense or expand font width.  Applies only to browsers which don’t support canvas native font rendering.

+ +

textColor

this.textColor = '#666666'

css spec for the color attribute.

+ +

enableFontSupport

this.enableFontSupport = true

true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.  If true, tick label will be drawn with canvas tag native support for fonts.  If false, tick label will be drawn with Hershey font metrics.

+ +

pt2px

this.pt2px = null

Point to pixel scaling factor, used for computing height of bounding box around a label.  The labels text renderer has a default setting of 1.4, which should be suitable for most fonts.  Leave as null to use default.  If tops of letters appear clipped, increase this.  If bounding box seems too big, decrease.  This is an issue only with the native font renderering capabilities of Mozilla 3.5 and Safari 4 since they do not provide a method to determine the font height.

+ +
+ + + + + + + + + + +
this.mark = 'outside'
tick mark on the axis.
this.showMark = true
whether or not to show the mark on the axis.
this.showGridline = true
whether or not to draw the gridline on the grid at this tick.
this.isMinorTick = false
if this is a minor tick.
this.angle = 0
angle of text, measured clockwise from x axis.
this.markSize = 4
Length of the tick marks in pixels.
this.show = true
whether or not to show the tick (mark and label).
this.showLabel = true
whether or not to show the label.
this.labelPosition = 'auto'
‘auto’, ‘start’, ‘middle’ or ‘end’.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.formatString = ''
string passed to the formatter.
this.prefix = ''
String to prepend to the tick label.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'
css spec for the font-family css attribute.
this.fontSize = '10pt'
CSS spec for font size.
this.fontWeight = 'normal'
CSS spec for fontWeight
this.fontStretch = 1.0
Multiplier to condense or expand font width.
this.textColor = '#666666'
css spec for the color attribute.
this.enableFontSupport = true
true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
this.pt2px = null
Point to pixel scaling factor, used for computing height of bounding box around a label.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasOverlay-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasOverlay-js.html new file mode 100644 index 00000000..5b621f6a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-canvasOverlay-js.html @@ -0,0 +1,117 @@ + + +$.jqplot.CanvasOverlay + + + + + + + + + +
Summary
$.jqplot.CanvasOverlay
Properties
objects
nameOptional name for the overlay object.
showtrue to show (draw), false to not draw.
lineWidthWidth of the line.
lineCapType of ending placed on the line [‘round’, ‘butt’, ‘square’]
colorcolor of the line
shadowwhether or not to draw a shadow on the line
shadowAngleShadow angle in degrees
shadowOffsetShadow offset from line in pixels
shadowDepthNumber of times shadow is stroked, each stroke offset shadowOffset from the last.
shadowAlphaAlpha channel transparency of shadow.
xaxisX axis to use for positioning/scaling the line.
yaxisY axis to use for positioning/scaling the line.
showTooltipShow a tooltip with data point values.
showTooltipPrecisionControls how close to line cursor must be to show tooltip.
tooltipLocationWhere to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
fadeTooltiptrue = fade in/out tooltip, flase = show/hide tooltip
tooltipFadeSpeed‘slow’, ‘def’, ‘fast’, or number of milliseconds.
tooltipOffsetPixel offset of tooltip from the highlight.
tooltipFormatStringFormat string passed the x and y values of the cursor on the line.
xminx value for the start of the line, null to scale to axis min.
xmaxx value for the end of the line, null to scale to axis max.
LineA straight line.
Properties
start[x, y] coordinates for the start of the line.
stop[x, y] coordinates for the end of the line.
HorizontalLineA straight horizontal line.
Properties
yy value to position the line
xminx value for the start of the line, null to scale to axis min.
xmaxx value for the end of the line, null to scale to axis max.
DashedHorizontalLineA straight dashed horizontal line.
Properties
dashPatternArray of line, space settings in pixels.
VerticalLineA straight vertical line.
DashedVerticalLineA straight dashed vertical line.
Properties
dashPatternArray of line, space settings in pixels.
+ +

Properties

+ +

objects

this.objects = []
+ +

name

Optional name for the overlay object.  Can be later used to retrieve the object by name.

+ +

show

true to show (draw), false to not draw.

+ +

lineWidth

Width of the line.

+ +

lineCap

Type of ending placed on the line [‘round’, ‘butt’, ‘square’]

+ +

color

color of the line

+ +

shadow

whether or not to draw a shadow on the line

+ +

shadowAngle

Shadow angle in degrees

+ +

shadowOffset

Shadow offset from line in pixels

+ +

shadowDepth

Number of times shadow is stroked, each stroke offset shadowOffset from the last.

+ +

shadowAlpha

Alpha channel transparency of shadow.  0 = transparent.

+ +

xaxis

X axis to use for positioning/scaling the line.

+ +

yaxis

Y axis to use for positioning/scaling the line.

+ +

showTooltip

Show a tooltip with data point values.

+ +

showTooltipPrecision

Controls how close to line cursor must be to show tooltip.  Higher number = closer to line, lower number = farther from line.  1.0 = cursor must be over line.

+ +

tooltipLocation

Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’

+ +

fadeTooltip

true = fade in/out tooltip, flase = show/hide tooltip

+ +

tooltipFadeSpeed

’slow’, ‘def’, ‘fast’, or number of milliseconds.

+ +

tooltipOffset

Pixel offset of tooltip from the highlight.

+ +

tooltipFormatString

tooltipFormatString: '%d, %d' }

Format string passed the x and y values of the cursor on the line. e.g., ‘Dogs: %.2f, Cats: %d’.

+ +

xmin

x value for the start of the line, null to scale to axis min.

+ +

xmax

x value for the end of the line, null to scale to axis max.

+ +

Line

A straight line.

Summary
Properties
start[x, y] coordinates for the start of the line.
stop[x, y] coordinates for the end of the line.
+ +

Properties

+ +

start

[x, y] coordinates for the start of the line.

+ +

stop

stop: [] }

[x, y] coordinates for the end of the line.

+ +

HorizontalLine

A straight horizontal line.

Summary
Properties
yy value to position the line
xminx value for the start of the line, null to scale to axis min.
xmaxx value for the end of the line, null to scale to axis max.
+ +

Properties

+ +

y

y value to position the line

+ +

xmin

x value for the start of the line, null to scale to axis min.

+ +

xmax

x value for the end of the line, null to scale to axis max.

+ +

DashedHorizontalLine

A straight dashed horizontal line.

Summary
Properties
dashPatternArray of line, space settings in pixels.
+ +

Properties

+ +

dashPattern

dashPattern: [8,8] }

Array of line, space settings in pixels.  Default is 8 pixel of line, 8 pixel of space.  Note, limit to a 2 element array b/c of bug with higher order arrays.

+ +

VerticalLine

A straight vertical line.

+ +

DashedVerticalLine

A straight dashed vertical line.

Summary
Properties
dashPatternArray of line, space settings in pixels.
+ +

Properties

+ +

dashPattern

dashPattern: [8,8] }

Array of line, space settings in pixels.  Default is 8 pixel of line, 8 pixel of space.  Note, limit to a 2 element array b/c of bug with higher order arrays.

+ +
+ + + + + + + + + + +
this.objects = []
tooltipFormatString: '%d, %d' }
Format string passed the x and y values of the cursor on the line.
stop: [] }
[x, y] coordinates for the end of the line.
dashPattern: [8,8] }
Array of line, space settings in pixels.
dashPattern: [8,8] }
Array of line, space settings in pixels.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-categoryAxisRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-categoryAxisRenderer-js.html new file mode 100644 index 00000000..c14f8c21 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-categoryAxisRenderer-js.html @@ -0,0 +1,46 @@ + + +$.jqplot.CategoryAxisRenderer + + + + + + + + + +

A plugin for jqPlot to render a category style axis, with equal pixel spacing between y data values of a series.

To use this renderer, include the plugin in your source

<script type="text/javascript" language="javascript" src="plugins/jqplot.categoryAxisRenderer.js"></script>

and supply the appropriate options to your plot

{axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer}}}
Summary
$.jqplot.CategoryAxisRendererA plugin for jqPlot to render a category style axis, with equal pixel spacing between y data values of a series.
Properties
sortMergedLabelsTrue to sort tick labels when labels are created by merging x axis values from multiple series.
tickRendererA class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
+ +

Properties

+ +

sortMergedLabels

this.sortMergedLabels = false

True to sort tick labels when labels are created by merging x axis values from multiple series.  That is, say you have two series like:

line1 = [[2006, 4],            [2008, 9], [2009, 16]];
+line2 = [[2006, 3], [2007, 7], [2008, 6]];

If no label array is specified, tick labels will be collected from the x values of the series.  With sortMergedLabels set to true, tick labels will be:

[2006, 2007, 2008, 2009]

With sortMergedLabels set to false, tick labels will be:

[2006, 2008, 2009, 2007]

Note, this property is specified on the renderOptions for the axes when creating a plot:

axes:{xaxis:{renderer:$.jqplot.CategoryAxisRenderer, rendererOptions:{sortMergedLabels:true}}}
+ +

tickRenderer

A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer. this.tickRenderer = $.jqplot.AxisTickRenderer; this.labelRenderer = $.jqplot.AxisLabelRenderer;

+ +
+ + + + + + + + + + +
this.sortMergedLabels = false
True to sort tick labels when labels are created by merging x axis values from multiple series.
A “tick” object showing the value of a tick/gridline on the plot.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-ciParser-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-ciParser-js.html new file mode 100644 index 00000000..bfde5bba --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-ciParser-js.html @@ -0,0 +1,39 @@ + + +$.jqplot.ciParser + + + + + + + + + +

Data Renderer function which converts a custom JSON data object into jqPlot data format.  Set this as a callable on the jqplot dataRenderer plot option:

plot = $.jqplot('mychart', [data], { dataRenderer: $.jqplot.ciParser, ... });

Where data is an object in JSON format or a JSON encoded string conforming to the City Index API spec.

Note that calling the renderer function is handled internally by jqPlot.  The user does not have to call the function.  The parameters described below will automatically be passed to the ciParser function.

Parameters

dataJSON encoded string or object.
plotreference to jqPlot Plot object.

Returns

data array in jqPlot format.

+ +
+ + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-cursor-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-cursor-js.html new file mode 100644 index 00000000..bfd61fbf --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-cursor-js.html @@ -0,0 +1,93 @@ + + +$.jqplot.Cursor + + + + + + + + + +

Plugin class representing the cursor as displayed on the plot.

Summary
$.jqplot.CursorPlugin class representing the cursor as displayed on the plot.
Properties
styleCSS spec for cursor style
showwhether to show the cursor or not.
showTooltipshow a cursor position tooltip.
followMouseTooltip follows the mouse, it is not at a fixed location.
tooltipLocationWhere to position tooltip.
tooltipOffsetPixel offset of tooltip from the grid boudaries or cursor center.
showTooltipGridPositionshow the grid pixel coordinates of the mouse.
showTooltipUnitPositionshow the unit (data) coordinates of the mouse.
showTooltipDataPositionUsed with showVerticalLine to show intersecting data points in the tooltip.
tooltipFormatStringsprintf format string for the tooltip.
useAxesFormattersUse the x and y axes formatters to format the text in the tooltip.
tooltipAxisGroupsShow position for the specified axes.
zoomEnable plot zooming.
looseZoomWill expand zoom range to provide more rounded tick values.
clickResetWill reset plot zoom if single click on plot without drag.
dblClickResetWill reset plot zoom if double click on plot without drag.
showVerticalLinedraw a vertical line across the plot which follows the cursor.
showHorizontalLinedraw a horizontal line across the plot which follows the cursor.
constrainZoomTo‘none’, ‘x’ or ‘y’
intersectionThresholdpixel distance from data point or marker to consider cursor lines intersecting with point.
showCursorLegendReplace the plot legend with an enhanced legend displaying intersection information.
cursorLegendFormatStringFormat string used in the cursor legend.
constrainOutsideZoomTrue to limit actual zoom area to edges of grid, even when zooming outside of plot area.
showTooltipOutsideZoomTrue will keep updating the tooltip when zooming of the grid.
methods
$.jqplot.Cursor.zoomProxylinks targetPlot to controllerPlot so that plot zooming of targetPlot will be controlled by zooming on the controllerPlot.
+ +

Properties

+ +

style

this.style = 'crosshair'

CSS spec for cursor style

+ +

show

this.show = $.jqplot.config.enablePlugins

whether to show the cursor or not.

+ +

showTooltip

this.showTooltip = true

show a cursor position tooltip.  Location of the tooltip will be controlled by followMouse and tooltipLocation.

+ +

followMouse

this.followMouse = false

Tooltip follows the mouse, it is not at a fixed location.  Tooltip will show on the grid at the location given by tooltipLocation, offset from the grid edge by tooltipOffset.

+ +

tooltipLocation

this.tooltipLocation = 'se'

Where to position tooltip.  If followMouse is true, this is relative to the cursor, otherwise, it is relative to the grid.  One of ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’

+ +

tooltipOffset

this.tooltipOffset = 6

Pixel offset of tooltip from the grid boudaries or cursor center.

+ +

showTooltipGridPosition

this.showTooltipGridPosition = false

show the grid pixel coordinates of the mouse.

+ +

showTooltipUnitPosition

this.showTooltipUnitPosition = true

show the unit (data) coordinates of the mouse.

+ +

showTooltipDataPosition

this.showTooltipDataPosition = false

Used with showVerticalLine to show intersecting data points in the tooltip.

+ +

tooltipFormatString

this.tooltipFormatString = '%.4P, %.4P'

sprintf format string for the tooltip.  Uses Ash Searle’s javascript sprintf implementation found here: http://hexmen.com/blog/2007/03/printf-sprintf/ See http://perldoc.perl.org/functions/sprintf.html for reference Note, if showTooltipDataPosition is true, the default tooltipFormatString will be set to the cursorLegendFormatString, not the default given here.

+ +

useAxesFormatters

this.useAxesFormatters = true

Use the x and y axes formatters to format the text in the tooltip.

+ +

tooltipAxisGroups

this.tooltipAxisGroups = []

Show position for the specified axes.  This is an array like [[‘xaxis’, ‘yaxis’], [‘xaxis’, ‘y2axis’]] Default is to compute automatically for all visible axes.

+ +

zoom

this.zoom = false

Enable plot zooming.

+ +

looseZoom

this.looseZoom = true

Will expand zoom range to provide more rounded tick values.  Works only with linear, log and date axes.

+ +

clickReset

this.clickReset = false

Will reset plot zoom if single click on plot without drag.

+ +

dblClickReset

this.dblClickReset = true

Will reset plot zoom if double click on plot without drag.

+ +

showVerticalLine

this.showVerticalLine = false

draw a vertical line across the plot which follows the cursor.  When the line is near a data point, a special legend and/or tooltip can be updated with the data values.

+ +

showHorizontalLine

this.showHorizontalLine = false

draw a horizontal line across the plot which follows the cursor.

+ +

constrainZoomTo

this.constrainZoomTo = 'none'

’none’, ‘x’ or ‘y’

+ +

intersectionThreshold

this.intersectionThreshold = 2

pixel distance from data point or marker to consider cursor lines intersecting with point.  If data point markers are not shown, this should be >= 1 or will often miss point intersections.

+ +

showCursorLegend

this.showCursorLegend = false

Replace the plot legend with an enhanced legend displaying intersection information.

+ +

cursorLegendFormatString

this.cursorLegendFormatString = $.jqplot.Cursor.cursorLegendFormatString

Format string used in the cursor legend.  If showTooltipDataPosition is true, this will also be the default format string used by tooltipFormatString.

+ +

constrainOutsideZoom

this.constrainOutsideZoom = true

True to limit actual zoom area to edges of grid, even when zooming outside of plot area.  That is, can’t zoom out by mousing outside plot.

+ +

showTooltipOutsideZoom

this.showTooltipOutsideZoom = false

True will keep updating the tooltip when zooming of the grid.

+ +

methods

+ +

$.jqplot.Cursor.zoomProxy

$.jqplot.Cursor.zoomProxy = function(targetPlot,
controllerPlot)

links targetPlot to controllerPlot so that plot zooming of targetPlot will be controlled by zooming on the controllerPlot. controllerPlot will not actually zoom, but acts as an overview plot.  Note, the zoom options must be set to true for zoomProxy to work.

+ +
+ + + + + + + + + + +
this.style = 'crosshair'
CSS spec for cursor style
this.show = $.jqplot.config.enablePlugins
whether to show the cursor or not.
this.showTooltip = true
show a cursor position tooltip.
this.followMouse = false
Tooltip follows the mouse, it is not at a fixed location.
this.tooltipLocation = 'se'
Where to position tooltip.
this.tooltipOffset = 6
Pixel offset of tooltip from the grid boudaries or cursor center.
this.showTooltipGridPosition = false
show the grid pixel coordinates of the mouse.
this.showTooltipUnitPosition = true
show the unit (data) coordinates of the mouse.
this.showTooltipDataPosition = false
Used with showVerticalLine to show intersecting data points in the tooltip.
this.tooltipFormatString = '%.4P, %.4P'
sprintf format string for the tooltip.
this.useAxesFormatters = true
Use the x and y axes formatters to format the text in the tooltip.
this.tooltipAxisGroups = []
Show position for the specified axes.
this.zoom = false
Enable plot zooming.
this.looseZoom = true
Will expand zoom range to provide more rounded tick values.
this.clickReset = false
Will reset plot zoom if single click on plot without drag.
this.dblClickReset = true
Will reset plot zoom if double click on plot without drag.
this.showVerticalLine = false
draw a vertical line across the plot which follows the cursor.
this.showHorizontalLine = false
draw a horizontal line across the plot which follows the cursor.
this.constrainZoomTo = 'none'
‘none’, ‘x’ or ‘y’
this.intersectionThreshold = 2
pixel distance from data point or marker to consider cursor lines intersecting with point.
this.showCursorLegend = false
Replace the plot legend with an enhanced legend displaying intersection information.
this.cursorLegendFormatString = $.jqplot.Cursor.cursorLegendFormatString
Format string used in the cursor legend.
this.constrainOutsideZoom = true
True to limit actual zoom area to edges of grid, even when zooming outside of plot area.
this.showTooltipOutsideZoom = false
True will keep updating the tooltip when zooming of the grid.
$.jqplot.Cursor.zoomProxy = function(targetPlot,
controllerPlot)
links targetPlot to controllerPlot so that plot zooming of targetPlot will be controlled by zooming on the controllerPlot.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-dateAxisRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-dateAxisRenderer-js.html new file mode 100644 index 00000000..af919345 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-dateAxisRenderer-js.html @@ -0,0 +1,101 @@ + + +$.jqplot.DateAxisRenderer + + + + + + + + + +

A plugin for a jqPlot to render an axis as a series of date values.  This renderer has no options beyond those supplied by the Axis class.  It supplies its own tick formatter, so the tickOptions.formatter option should not be overridden.

Thanks to Ken Synder for his enhanced Date instance methods which are included with this code http://kendsnyder.com/sandbox/date/.

To use this renderer, include the plugin in your source

<script type="text/javascript" language="javascript" src="plugins/jqplot.dateAxisRenderer.js"></script>

and supply the appropriate options to your plot

{axes:{xaxis:{renderer:$.jqplot.DateAxisRenderer}}}

Dates can be passed into the axis in almost any recognizable value and will be parsed.  They will be rendered on the axis in the format specified by tickOptions.formatString.  e.g. tickOptions.formatString = ‘%Y-%m-%d’.

Accecptable format codes are:

Code    Result                  Description
+            == Years ==
+%Y      2008                Four-digit year
+%y      08                  Two-digit year
+            == Months ==
+%m      09                  Two-digit month
+%#m     9                   One or two-digit month
+%B      September           Full month name
+%b      Sep                 Abbreviated month name
+            == Days ==
+%d      05                  Two-digit day of month
+%#d     5                   One or two-digit day of month
+%e      5                   One or two-digit day of month
+%A      Sunday              Full name of the day of the week
+%a      Sun                 Abbreviated name of the day of the week
+%w      0                   Number of the day of the week (0 = Sunday, 6 = Saturday)
+%o      th                  The ordinal suffix string following the day of the month
+            == Hours ==
+%H      23                  Hours in 24-hour format (two digits)
+%#H     3                   Hours in 24-hour integer format (one or two digits)
+%I      11                  Hours in 12-hour format (two digits)
+%#I     3                   Hours in 12-hour integer format (one or two digits)
+%p      PM                  AM or PM
+            == Minutes ==
+%M      09                  Minutes (two digits)
+%#M     9                   Minutes (one or two digits)
+            == Seconds ==
+%S      02                  Seconds (two digits)
+%#S     2                   Seconds (one or two digits)
+%s      1206567625723       Unix timestamp (Seconds past 1970-01-01 00:00:00)
+            == Milliseconds ==
+%N      008                 Milliseconds (three digits)
+%#N     8                   Milliseconds (one to three digits)
+            == Timezone ==
+%O      360                 difference in minutes between local time and GMT
+%Z      Mountain Standard Time  Name of timezone as reported by browser
+%G      -06:00              Hours and minutes between GMT
+            == Shortcuts ==
+%F      2008-03-26          %Y-%m-%d
+%T      05:06:30            %H:%M:%S
+%X      05:06:30            %H:%M:%S
+%x      03/26/08            %m/%d/%y
+%D      03/26/08            %m/%d/%y
+%#c     Wed Mar 26 15:31:00 2008  %a %b %e %H:%M:%S %Y
+%v      3-Sep-2008          %e-%b-%Y
+%R      15:31               %H:%M
+%r      3:31:00 PM          %I:%M:%S %p
+            == Characters ==
+%n      \n                  Newline
+%t      \t                  Tab
+%%      %                   Percent Symbol
Summary
$.jqplot.DateAxisRendererA plugin for a jqPlot to render an axis as a series of date values.
Properties
tickRendererA class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
tickInsetControls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
drawBaselineTrue to draw the axis baseline.
baselineWidthwidth of the baseline in pixels.
baselineColorCSS color spec for the baseline.
+ +

Properties

+ +

tickRenderer

A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer. this.tickRenderer = $.jqplot.AxisTickRenderer; this.labelRenderer = $.jqplot.AxisLabelRenderer;

+ +

tickInset

this.tickInset = 0

Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.  0 is no inset, 0.5 is one half a tick interval, 1 is a full tick interval, etc.

+ +

drawBaseline

this.drawBaseline = true

True to draw the axis baseline.

+ +

baselineWidth

this.baselineWidth = null

width of the baseline in pixels.

+ +

baselineColor

this.baselineColor = null

CSS color spec for the baseline.

+ +
+ + + + + + + + + + +
A “tick” object showing the value of a tick/gridline on the plot.
this.tickInset = 0
Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
this.drawBaseline = true
True to draw the axis baseline.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineColor = null
CSS color spec for the baseline.
An individual axis object.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-donutRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-donutRenderer-js.html new file mode 100644 index 00000000..fcdec3e7 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-donutRenderer-js.html @@ -0,0 +1,98 @@ + + +$.jqplot.DonutRenderer + + + + + + + + + +

Plugin renderer to draw a donut chart. x values, if present, will be used as slice labels. y values give slice size.

To use this renderer, you need to include the donut renderer plugin, for example:

<script type="text/javascript" src="plugins/jqplot.donutRenderer.js"></script>

Properties described here are passed into the $.jqplot function as options on the series renderer.  For example:

plot2 = $.jqplot('chart2', [s1, s2], {
+    seriesDefaults: {
+        renderer:$.jqplot.DonutRenderer,
+        rendererOptions:{
+             sliceMargin: 2,
+             innerDiameter: 110,
+             startAngle: -90
+         }
+     }
+});

A donut plot will trigger events on the plot target according to user interaction.  All events return the event object, the series index, the point (slice) index, and the point data for the appropriate slice.

’jqplotDataMouseOver’triggered when user mouseing over a slice.
’jqplotDataHighlight’triggered the first time user mouses over a slice, if highlighting is enabled.
’jqplotDataUnhighlight’triggered when a user moves the mouse out of a highlighted slice.
’jqplotDataClick’triggered when the user clicks on a slice.
’jqplotDataRightClick’tiggered when the user right clicks on a slice if the “captureRightClick” option is set to true on the plot.
Summary
$.jqplot.DonutRendererPlugin renderer to draw a donut chart.
Properties
diameterOuter diameter of the donut, auto computed by default
innerDiameterInner diameter of the donut, auto calculated by default.
thicknessthickness of the donut, auto computed by default Overridden by if innerDiameter is specified.
paddingpadding between the donut and plot edges, legend, etc.
sliceMarginangular spacing between donut slices in degrees.
ringMarginpixel distance between rings, or multiple series in a donut plot.
filltrue or false, whether to fil the slices.
shadowOffsetoffset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
shadowAlphatransparency of the shadow (0 = transparent, 1 = opaque)
shadowDepthnumber of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
highlightMouseOverTrue to highlight slice when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over a slice.
highlightColorsan array of colors to use when highlighting a slice.
dataLabelsEither ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
showDataLabelstrue to show data labels on slices.
dataLabelFormatStringFormat string for data labels.
dataLabelThreshold
dataLabelPositionFactorA Multiplier (0-1) of the pie radius which controls position of label on slice.
dataLabelNudgeNumber of pixels to slide the label away from (+) or toward (-) the center of the pie.
startAngleAngle to start drawing donut in degrees.
$.jqplot.DonutLegendRendererLegend Renderer specific to donut plots.
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

diameter

this.diameter = null

Outer diameter of the donut, auto computed by default

+ +

innerDiameter

this.innerDiameter = null

Inner diameter of the donut, auto calculated by default.  If specified will override thickness value.

+ +

thickness

this.thickness = null

thickness of the donut, auto computed by default Overridden by if innerDiameter is specified.

+ +

padding

this.padding = 20

padding between the donut and plot edges, legend, etc.

+ +

sliceMargin

this.sliceMargin = 0

angular spacing between donut slices in degrees.

+ +

ringMargin

this.ringMargin = null

pixel distance between rings, or multiple series in a donut plot. null will compute ringMargin based on sliceMargin.

+ +

fill

this.fill = true

true or false, whether to fil the slices.

+ +

shadowOffset

this.shadowOffset = 2

offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.

+ +

shadowAlpha

this.shadowAlpha = 0.07

transparency of the shadow (0 = transparent, 1 = opaque)

+ +

shadowDepth

this.shadowDepth = 5

number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight slice when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on a slice.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over a slice.  This will be disabled if highlightMouseOver is true.

+ +

highlightColors

this.highlightColors = []

an array of colors to use when highlighting a slice.

+ +

dataLabels

this.dataLabels = 'percent'

Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.  Defaults to percentage of each pie slice.

+ +

showDataLabels

this.showDataLabels = false

true to show data labels on slices.

+ +

dataLabelFormatString

this.dataLabelFormatString = null

Format string for data labels.  If none, ‘%s’ is used for “label” and for arrays, ‘%d’ for value and ‘%d%%’ for percentage.

+ +

dataLabelThreshold

this.dataLabelThreshold = 3
Threshhold in percentage (0100) of pie area, below which no label will be displayed.  This applies to all label types, not just to percentage labels.
+ +

dataLabelPositionFactor

this.dataLabelPositionFactor = 0.4

A Multiplier (0-1) of the pie radius which controls position of label on slice.  Increasing will slide label toward edge of pie, decreasing will slide label toward center of pie.

+ +

dataLabelNudge

this.dataLabelNudge = 0

Number of pixels to slide the label away from (+) or toward (-) the center of the pie.

+ +

startAngle

this.startAngle = 0

Angle to start drawing donut in degrees.  According to orientation of canvas coordinate system: 0 = on the positive x axis -90 = on the positive y axis.  90 = on the negaive y axis.  180 or - 180 = on the negative x axis.

+ +

$.jqplot.DonutLegendRenderer

Legend Renderer specific to donut plots.  Set by default when user creates a donut plot.

Summary
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

numberRows

this.numberRows = null

Maximum number of rows in the legend.  0 or null for unlimited.

+ +

numberColumns

this.numberColumns = null

Maximum number of columns in the legend.  0 or null for unlimited.

+ +
+ + + + + + + + + + +
this.diameter = null
Outer diameter of the donut, auto computed by default
this.innerDiameter = null
Inner diameter of the donut, auto calculated by default.
this.thickness = null
thickness of the donut, auto computed by default Overridden by if innerDiameter is specified.
this.padding = 20
padding between the donut and plot edges, legend, etc.
this.sliceMargin = 0
angular spacing between donut slices in degrees.
this.ringMargin = null
pixel distance between rings, or multiple series in a donut plot.
this.fill = true
true or false, whether to fil the slices.
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.showDataLabels = false
true to show data labels on slices.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelThreshold = 3
this.dataLabelPositionFactor = 0.4
A Multiplier (0-1) of the pie radius which controls position of label on slice.
this.dataLabelNudge = 0
Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.startAngle = 0
Angle to start drawing donut in degrees.
this.numberRows = null
Maximum number of rows in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-dragable-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-dragable-js.html new file mode 100644 index 00000000..3fdd16d3 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-dragable-js.html @@ -0,0 +1,45 @@ + + +$.jqplot.Dragable + + + + + + + + + +

Plugin to make plotted points dragable by the user.

Summary
$.jqplot.DragablePlugin to make plotted points dragable by the user.
Properties
colorCSS color spec for the dragged point (and adjacent line segment or bar).
constrainToConstrain dragging motion to an axis or to none.
+ +

Properties

+ +

color

this.color

CSS color spec for the dragged point (and adjacent line segment or bar).

+ +

constrainTo

this.constrainTo = 'none'

Constrain dragging motion to an axis or to none.  Allowable values are ‘none’, ‘x’, ‘y’

+ +
+ + + + + + + + + + +
this.color
CSS color spec for the dragged point (and adjacent line segment or bar).
this.constrainTo = 'none'
Constrain dragging motion to an axis or to none.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-enhancedLegendRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-enhancedLegendRenderer-js.html new file mode 100644 index 00000000..3021fad4 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-enhancedLegendRenderer-js.html @@ -0,0 +1,51 @@ + + +D:\jq\jqplot\build\plugins\jqplot.enhancedLegendRenderer.js + + + + + + + + + +
Summary
jqplot.enhancedLegendRenderer.js
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
seriesTogglefalse to not enable series on/off toggling on the legend.
seriesToggleReplotTrue to replot the chart after toggling series on/off.
disableIEFadingtrue to toggle series with a show/hide method only and not allow fading in/out.
+ +

Properties

+ +

numberRows

this.numberRows = null

Maximum number of rows in the legend.  0 or null for unlimited.

+ +

numberColumns

this.numberColumns = null

Maximum number of columns in the legend.  0 or null for unlimited.

+ +

seriesToggle

this.seriesToggle = 'normal'

false to not enable series on/off toggling on the legend. true or a fadein/fadeout speed (number of milliseconds or ‘fast’, ‘normal’, ‘slow’) to enable show/hide of series on click of legend item.

+ +

seriesToggleReplot

this.seriesToggleReplot = false

True to replot the chart after toggling series on/off.  This will set the series show property to false.  This allows for rescaling or other maniplation of chart.  Set to an options object (e.g.  {resetAxes: true}) for replot options.

+ +

disableIEFading

this.disableIEFading = true

true to toggle series with a show/hide method only and not allow fading in/out.  This is to overcome poor performance of fade in some versions of IE.

+ +
+ + + + + + + + + + +
this.numberRows = null
Maximum number of rows in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.seriesToggle = 'normal'
false to not enable series on/off toggling on the legend.
this.seriesToggleReplot = false
True to replot the chart after toggling series on/off.
this.disableIEFading = true
true to toggle series with a show/hide method only and not allow fading in/out.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-funnelRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-funnelRenderer-js.html new file mode 100644 index 00000000..1e4c7387 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-funnelRenderer-js.html @@ -0,0 +1,87 @@ + + +$.jqplot.FunnelRenderer + + + + + + + + + +

Plugin renderer to draw a funnel chart. x values, if present, will be used as labels. y values give area size.

Funnel charts will draw a single series only.

To use this renderer, you need to include the funnel renderer plugin, for example:

<script type="text/javascript" src="plugins/jqplot.funnelRenderer.js"></script>

Properties described here are passed into the $.jqplot function as options on the series renderer.  For example:

plot2 = $.jqplot('chart2', [s1, s2], {
+    seriesDefaults: {
+        renderer:$.jqplot.FunnelRenderer,
+        rendererOptions:{
+             sectionMargin: 12,
+             widthRatio: 0.3
+         }
+     }
+});

IMPORTANT

The funnel renderer will reorder data in descending order so the largest value in the data set is first and displayed on top of the funnel.  Data will then be displayed in descending order down the funnel.  The area of each funnel section will correspond to the value of each data point relative to the sum of all values.  That is section area is proportional to section value divided by sum of all section values.

If your data is not in descending order when passed into the plot, it will be reordered when stored in the series.data property.  A copy of the unordered data is kept in the series._unorderedData property.

A funnel plot will trigger events on the plot target according to user interaction.  All events return the event object, the series index, the point (section) index, and the point data for the appropriate section.  Note the point index will referr to the ordered data, not the original unordered data.

’jqplotDataMouseOver’triggered when mousing over a section.
’jqplotDataHighlight’triggered the first time user mouses over a section, if highlighting is enabled.
’jqplotDataUnhighlight’triggered when a user moves the mouse out of a highlighted section.
’jqplotDataClick’triggered when the user clicks on a section.
’jqplotDataRightClick’tiggered when the user right clicks on a section if the “captureRightClick” option is set to true on the plot.
Summary
$.jqplot.FunnelRendererPlugin renderer to draw a funnel chart.
Properties
paddingpadding between the funnel and plot edges, legend, etc.
sectionMarginspacing between funnel sections in pixels.
filltrue or false, whether to fill the areas.
shadowOffsetoffset of the shadow from the area and offset of each succesive stroke of the shadow from the last.
shadowAlphatransparency of the shadow (0 = transparent, 1 = opaque)
shadowDepthnumber of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
highlightMouseOverTrue to highlight area when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over a area.
highlightColorsarray of colors to use when highlighting an area.
widthRatioThe ratio of the width of the top of the funnel to the bottom.
lineWidthwidth of line if areas are stroked and not filled.
dataLabelsEither ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
showDataLabelstrue to show data labels on slices.
dataLabelFormatStringFormat string for data labels.
dataLabelThreshold
$.jqplot.FunnelLegendRendererLegend Renderer specific to funnel plots.
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

padding

this.padding = {top: 20, right: 20, bottom: 20, left: 20}

padding between the funnel and plot edges, legend, etc.

+ +

sectionMargin

this.sectionMargin = 6

spacing between funnel sections in pixels.

+ +

fill

this.fill = true

true or false, whether to fill the areas.

+ +

shadowOffset

this.shadowOffset = 2

offset of the shadow from the area and offset of each succesive stroke of the shadow from the last.

+ +

shadowAlpha

this.shadowAlpha = 0.07

transparency of the shadow (0 = transparent, 1 = opaque)

+ +

shadowDepth

this.shadowDepth = 5

number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight area when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on a area.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over a area.  This will be disabled if highlightMouseOver is true.

+ +

highlightColors

this.highlightColors = []

array of colors to use when highlighting an area.

+ +

widthRatio

this.widthRatio = 0.2

The ratio of the width of the top of the funnel to the bottom. a ratio of 0 will make an upside down pyramid.

+ +

lineWidth

this.lineWidth = 2

width of line if areas are stroked and not filled.

+ +

dataLabels

this.dataLabels = 'percent'

Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.  Defaults to percentage of each pie slice.

+ +

showDataLabels

this.showDataLabels = false

true to show data labels on slices.

+ +

dataLabelFormatString

this.dataLabelFormatString = null

Format string for data labels.  If none, ‘%s’ is used for “label” and for arrays, ‘%d’ for value and ‘%d%%’ for percentage.

+ +

dataLabelThreshold

this.dataLabelThreshold = 3
Threshhold in percentage (0100) of pie area, below which no label will be displayed.  This applies to all label types, not just to percentage labels.
+ +

$.jqplot.FunnelLegendRenderer

Legend Renderer specific to funnel plots.  Set by default when the user creates a funnel plot.

Summary
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

numberRows

this.numberRows = null

Maximum number of rows in the legend.  0 or null for unlimited.

+ +

numberColumns

this.numberColumns = null

Maximum number of columns in the legend.  0 or null for unlimited.

+ +
+ + + + + + + + + + +
this.padding = {top: 20, right: 20, bottom: 20, left: 20}
padding between the funnel and plot edges, legend, etc.
this.sectionMargin = 6
spacing between funnel sections in pixels.
this.fill = true
true or false, whether to fill the areas.
this.shadowOffset = 2
offset of the shadow from the area and offset of each succesive stroke of the shadow from the last.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.highlightMouseOver = true
True to highlight area when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a area.
this.highlightColors = []
array of colors to use when highlighting an area.
this.widthRatio = 0.2
The ratio of the width of the top of the funnel to the bottom.
this.lineWidth = 2
width of line if areas are stroked and not filled.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.showDataLabels = false
true to show data labels on slices.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelThreshold = 3
this.numberRows = null
Maximum number of rows in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-highlighter-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-highlighter-js.html new file mode 100644 index 00000000..9b64d3fb --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-highlighter-js.html @@ -0,0 +1,80 @@ + + +$.jqplot.Highlighter + + + + + + + + + +

Plugin which will highlight data points when they are moused over.

To use this plugin, include the js file in your source:

<script type="text/javascript" src="plugins/jqplot.highlighter.js"></script>

A tooltip providing information about the data point is enabled by default.  To disable the tooltip, set “showTooltip” to false.

You can control what data is displayed in the tooltip with various options.  The “tooltipAxes” option controls whether the x, y or both data values are displayed.

Some chart types (e.g. hi-low-close) have more than one y value per data point.  To display the additional values in the tooltip, set the “yvalues” option to the desired number of y values present (3 for a hlc chart).

By default, data values will be formatted with the same formatting specifiers as used to format the axis ticks.  A custom format code can be supplied with the tooltipFormatString option.  This will apply to all values in the tooltip.

For more complete control, the “formatString” option can be set.  This Allows conplete control over tooltip formatting.  Values are passed to the format string in an order determined by the “tooltipAxes” and “yvalues” options.  So, if you have a hi-low-close chart and you just want to display the hi-low-close values in the tooltip, you could set a formatString like:

highlighter: {
+    tooltipAxes: 'y',
+    yvalues: 3,
+    formatString:'<table class="jqplot-highlighter">
+        <tr><td>hi:</td><td>%s</td></tr>
+        <tr><td>low:</td><td>%s</td></tr>
+        <tr><td>close:</td><td>%s</td></tr></table>'
+}
Summary
$.jqplot.HighlighterPlugin which will highlight data points when they are moused over.
Properties
showtrue to show the highlight.
markerRendererRenderer used to draw the marker of the highlighted point.
showMarkertrue to show the marker
lineWidthAdjustPixels to add to the lineWidth of the highlight.
sizeAdjustPixels to add to the overall size of the highlight.
showTooltipShow a tooltip with data point values.
tooltipLocationWhere to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
fadeTooltiptrue = fade in/out tooltip, flase = show/hide tooltip
tooltipFadeSpeed‘slow’, ‘def’, ‘fast’, or number of milliseconds.
tooltipOffsetPixel offset of tooltip from the highlight.
tooltipAxesWhich axes to display in tooltip, ‘x’, ‘y’ or ‘both’, ‘xy’ or ‘yx’ ‘both’ and ‘xy’ are equivalent, ‘yx’ reverses order of labels.
useAxesFormattersUse the x and y axes formatters to format the text in the tooltip.
tooltipFormatStringsprintf format string for the tooltip.
formatStringalternative to tooltipFormatString will format the whole tooltip text, populating with x, y values as indicated by tooltipAxes option.
yvaluesNumber of y values to expect in the data point array.
bringSeriesToFrontThis option requires jQuery 1.4+ True to bring the series of the highlighted point to the front of other series.
+ +

Properties

+ +

show

this.show = $.jqplot.config.enablePlugins

true to show the highlight.

+ +

markerRenderer

this.markerRenderer = new $.jqplot.MarkerRenderer({shadow:false})

Renderer used to draw the marker of the highlighted point.  Renderer will assimilate attributes from the data point being highlighted, so no attributes need set on the renderer directly.  Default is to turn off shadow drawing on the highlighted point.

+ +

showMarker

this.showMarker = true

true to show the marker

+ +

lineWidthAdjust

this.lineWidthAdjust = 2.5

Pixels to add to the lineWidth of the highlight.

+ +

sizeAdjust

this.sizeAdjust = 5

Pixels to add to the overall size of the highlight.

+ +

showTooltip

this.showTooltip = true

Show a tooltip with data point values.

+ +

tooltipLocation

this.tooltipLocation = 'nw'

Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’

+ +

fadeTooltip

this.fadeTooltip = true

true = fade in/out tooltip, flase = show/hide tooltip

+ +

tooltipFadeSpeed

this.tooltipFadeSpeed = "fast"

’slow’, ‘def’, ‘fast’, or number of milliseconds.

+ +

tooltipOffset

this.tooltipOffset = 2

Pixel offset of tooltip from the highlight.

+ +

tooltipAxes

this.tooltipAxes = 'both'

Which axes to display in tooltip, ‘x’, ‘y’ or ‘both’, ‘xy’ or ‘yx’ ‘both’ and ‘xy’ are equivalent, ‘yx’ reverses order of labels.

+ +

useAxesFormatters

this.useAxesFormatters = true

Use the x and y axes formatters to format the text in the tooltip.

+ +

tooltipFormatString

this.tooltipFormatString = '%.5P'

sprintf format string for the tooltip.  Uses Ash Searle’s javascript sprintf implementation found here: http://hexmen.com/blog/2007/03/printf-sprintf/ See http://perldoc.perl.org/functions/sprintf.html for reference.  Additional “p” and “P” format specifiers added by Chris Leonello.

+ +

formatString

this.formatString = null

alternative to tooltipFormatString will format the whole tooltip text, populating with x, y values as indicated by tooltipAxes option.  So, you could have a tooltip like: ‘Date: %s, number of cats: %d’ to format the whole tooltip at one go.  If useAxesFormatters is true, values will be formatted according to Axes formatters and you can populate your tooltip string with %s placeholders.

+ +

yvalues

this.yvalues = 1

Number of y values to expect in the data point array.  Typically this is 1.  Certain plots, like OHLC, will have more y values in each data point array.

+ +

bringSeriesToFront

this.bringSeriesToFront = false

This option requires jQuery 1.4+ True to bring the series of the highlighted point to the front of other series.

+ +
+ + + + + + + + + + +
this.show = $.jqplot.config.enablePlugins
true to show the highlight.
this.markerRenderer = new $.jqplot.MarkerRenderer({shadow:false})
Renderer used to draw the marker of the highlighted point.
this.showMarker = true
true to show the marker
this.lineWidthAdjust = 2.5
Pixels to add to the lineWidth of the highlight.
this.sizeAdjust = 5
Pixels to add to the overall size of the highlight.
this.showTooltip = true
Show a tooltip with data point values.
this.tooltipLocation = 'nw'
Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
this.fadeTooltip = true
true = fade in/out tooltip, flase = show/hide tooltip
this.tooltipFadeSpeed = "fast"
‘slow’, ‘def’, ‘fast’, or number of milliseconds.
this.tooltipOffset = 2
Pixel offset of tooltip from the highlight.
this.tooltipAxes = 'both'
Which axes to display in tooltip, ‘x’, ‘y’ or ‘both’, ‘xy’ or ‘yx’ ‘both’ and ‘xy’ are equivalent, ‘yx’ reverses order of labels.
this.useAxesFormatters = true
Use the x and y axes formatters to format the text in the tooltip.
this.tooltipFormatString = '%.5P'
sprintf format string for the tooltip.
this.formatString = null
alternative to tooltipFormatString will format the whole tooltip text, populating with x, y values as indicated by tooltipAxes option.
this.yvalues = 1
Number of y values to expect in the data point array.
this.bringSeriesToFront = false
This option requires jQuery 1.4+ True to bring the series of the highlighted point to the front of other series.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-logAxisRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-logAxisRenderer-js.html new file mode 100644 index 00000000..17fe6157 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-logAxisRenderer-js.html @@ -0,0 +1,47 @@ + + +$.jqplot.LogAxisRenderer + + + + + + + + + +

A plugin for a jqPlot to render a logarithmic axis.

To use this renderer, include the plugin in your source

<script type="text/javascript" language="javascript" src="plugins/jqplot.logAxisRenderer.js"></script>

and supply the appropriate options to your plot

{axes:{xaxis:{renderer:$.jqplot.LogAxisRenderer}}}
Summary
$.jqplot.LogAxisRendererA plugin for a jqPlot to render a logarithmic axis.
axisDefaultsDefault properties which will be applied directly to the series.
PropertiesProperties
drawBaselineTrue to draw the axis baseline.
minorTicksNumber of ticks to add between “major” ticks.
+ +

axisDefaults

Default properties which will be applied directly to the series.

+ +

Properties

Properties

basethe logarithmic base, commonly 2, 10 or Math.E
tickDistributionDeprecated.  “power” distribution of ticks always used.  Option has no effect.
+ +

drawBaseline

this.drawBaseline = true

True to draw the axis baseline.

+ +

minorTicks

this.minorTicks = 'auto'

Number of ticks to add between “major” ticks.  Major ticks are ticks supplied by user or auto computed.  Minor ticks cannot be created by user.

+ +
+ + + + + + + + + + +
this.drawBaseline = true
True to draw the axis baseline.
this.minorTicks = 'auto'
Number of ticks to add between “major” ticks.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-mekkoAxisRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-mekkoAxisRenderer-js.html new file mode 100644 index 00000000..5962b6a4 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-mekkoAxisRenderer-js.html @@ -0,0 +1,49 @@ + + +$.jqplot.MekkoAxisRenderer + + + + + + + + + +

An axis renderer for a Mekko chart.  Should be used with a Mekko chart where the mekkoRenderer is used on the series.  Displays the Y axis as a range from 0 to 1 (0 to 100%) and the x axis with a tick for each series scaled to the sum of all the y values.

Summary
$.jqplot.MekkoAxisRendererAn axis renderer for a Mekko chart.
Properties
tickModeHow to space the ticks on the axis.
barLabelRendererrenderer to use to draw labels under each bar.
barLabelsarray of labels to put under each bar.
barLabelOptionsoptions object to pass to the bar label renderer.
+ +

Properties

+ +

tickMode

this.tickMode

How to space the ticks on the axis.  ‘bar’ will place a tick at the width of each bar.  This is the default for the x axis.  ‘even’ will place ticks at even intervals.  This is the default for x2 axis and y axis.  y axis cannot be changed.

+ +

barLabelRenderer

this.barLabelRenderer = $.jqplot.AxisLabelRenderer

renderer to use to draw labels under each bar.

+ +

barLabels

this.barLabels = this.barLabels || []

array of labels to put under each bar.

+ +

barLabelOptions

this.barLabelOptions = {}

options object to pass to the bar label renderer.

+ +
+ + + + + + + + + + +
this.tickMode
How to space the ticks on the axis.
this.barLabelRenderer = $.jqplot.AxisLabelRenderer
renderer to use to draw labels under each bar.
this.barLabels = this.barLabels || []
array of labels to put under each bar.
this.barLabelOptions = {}
options object to pass to the bar label renderer.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-mekkoRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-mekkoRenderer-js.html new file mode 100644 index 00000000..6801775b --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-mekkoRenderer-js.html @@ -0,0 +1,62 @@ + + +$.jqplot.MekkoRenderer + + + + + + + + + +

Draws a Mekko style chart which shows 3 dimensional data on a 2 dimensional graph. the $.jqplot.MekkoAxisRenderer should be used with mekko charts.  The mekko renderer overrides the default legend renderer with its own $.jqplot.MekkoLegendRenderer which allows more flexibility to specify number of rows and columns in the legend.

Data is specified per bar in the chart.  You can specify data as an array of y values, or as an array of [label, value] pairs.  Note that labels are used only on the first series.  Labels on subsequent series are ignored:

bar1 = [['shirts', 8],['hats', 14],['shoes', 6],['gloves', 16],['dolls', 12]];
+bar2 = [15,6,9,13,6];
+bar3 = [['grumpy',4],['sneezy',2],['happy',7],['sleepy',9],['doc',7]];

If you want to place labels for each bar under the axis, you use the barLabels option on the axes.  The bar labels can be styled with the “.jqplot-mekko-barLabel” css class.

barLabels = ['Mickey Mouse', 'Donald Duck', 'Goofy'];
+axes:{xaxis:{barLabels:barLabels}}
Summary
$.jqplot.MekkoRendererDraws a Mekko style chart which shows 3 dimensional data on a 2 dimensional graph.
Properties
borderColorcolor of the borders between areas on the chart
showBordersTrue to draw borders lines between areas on the chart.
Functions
setGridDataconverts the user data values to grid coordinates and stores them in the gridData array.
makeGridDataconverts any arbitrary data values to grid coordinates and returns them.
$.jqplot.MekkoLegendRendererLegend renderer used by mekko charts with options for controlling number or rows and columns as well as placement outside of plot area.
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

borderColor

this.borderColor = null

color of the borders between areas on the chart

+ +

showBorders

this.showBorders = true

True to draw borders lines between areas on the chart.  False will draw borders lines with the same color as the area.

+ +

Functions

+ +

setGridData

$.jqplot.MekkoRenderer.prototype.setGridData = function(plot)

converts the user data values to grid coordinates and stores them in the gridData array.  Will convert user data into appropriate rectangles.  Called with scope of a series.

+ +

makeGridData

$.jqplot.MekkoRenderer.prototype.makeGridData = function(data,
plot)

converts any arbitrary data values to grid coordinates and returns them.  This method exists so that plugins can use a series’ linerenderer to generate grid data points without overwriting the grid data associated with that series.  Called with scope of a series.

+ +

$.jqplot.MekkoLegendRenderer

Legend renderer used by mekko charts with options for controlling number or rows and columns as well as placement outside of plot area.

Summary
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

numberRows

this.numberRows = null

Maximum number of rows in the legend.  0 or null for unlimited.

+ +

numberColumns

this.numberColumns = null

Maximum number of columns in the legend.  0 or null for unlimited.

+ +
+ + + + + + + + + + +
this.borderColor = null
color of the borders between areas on the chart
this.showBorders = true
True to draw borders lines between areas on the chart.
$.jqplot.MekkoRenderer.prototype.setGridData = function(plot)
converts the user data values to grid coordinates and stores them in the gridData array.
$.jqplot.MekkoRenderer.prototype.makeGridData = function(data,
plot)
converts any arbitrary data values to grid coordinates and returns them.
this.numberRows = null
Maximum number of rows in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
An axis renderer for a Mekko chart.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-meterGaugeRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-meterGaugeRenderer-js.html new file mode 100644 index 00000000..9806cc13 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-meterGaugeRenderer-js.html @@ -0,0 +1,103 @@ + + +$.jqplot.MeterGaugeRenderer + + + + + + + + + +

Plugin renderer to draw a meter gauge chart.

Data consists of a single series with 1 data point to position the gauge needle.

To use this renderer, you need to include the meter gauge renderer plugin, for example:

<script type="text/javascript" src="plugins/jqplot.meterGaugeRenderer.js"></script>

Properties described here are passed into the $.jqplot function as options on the series renderer.  For example:

plot0 = $.jqplot('chart0',[[18]],{
+    title: 'Network Speed',
+    seriesDefaults: {
+        renderer: $.jqplot.MeterGaugeRenderer,
+        rendererOptions: {
+            label: 'MB/s'
+        }
+    }
+});

A meterGauge plot does not support events.

Summary
$.jqplot.MeterGaugeRendererPlugin renderer to draw a meter gauge chart.
Properties
diameterOuter diameter of the meterGauge, auto computed by default
paddingpadding between the meterGauge and plot edges, auto calculated by default.
shadowOffsetoffset of the shadow from the gauge ring and offset of each succesive stroke of the shadow from the last.
shadowAlphatransparency of the shadow (0 = transparent, 1 = opaque)
shadowDepthnumber of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
backgroundbackground color of the inside of the gauge.
ringColorcolor of the outer ring, hub, and needle of the gauge.
tickColorcolor of the tick marks around the gauge.
ringWidthwidth of the ring around the gauge.
minMinimum value on the gauge.
maxMaximum value on the gauge.
ticksArray of tick values.
showTickstrue to show ticks around gauge.
showTickLabelstrue to show tick labels next to ticks.
labelA gauge label like ‘kph’ or ‘Volts’
labelHeightAdjustNumber of Pixels to offset the label up (-) or down (+) from its default position.
labelPositionWhere to position the label, either ‘inside’ or ‘bottom’.
intervalsArray of ranges to be drawn around the gauge.
intervalColorsArray of colors to use for the intervals.
intervalInnerRadiusRadius of the inner circle of the interval ring.
intervalOuterRadiusRadius of the outer circle of the interval ring.
tickSpacingDegrees between ticks.
hubRadiusRadius of the hub at the bottom center of gauge which the needle attaches to.
tickPaddingpadding of the tick marks to the outer ring and the tick labels to marks.
needleThicknessMaximum thickness the needle.
needlePadPadding between needle and inner edge of the ring when the needle is at the min or max gauge value.
pegNeedleTrue will stop needle just below/above the min/max values if data is below/above min/max, as if the meter is “pegged”.
+ +

Properties

+ +

diameter

this.diameter = null

Outer diameter of the meterGauge, auto computed by default

+ +

padding

this.padding = null

padding between the meterGauge and plot edges, auto calculated by default.

+ +

shadowOffset

this.shadowOffset = 2

offset of the shadow from the gauge ring and offset of each succesive stroke of the shadow from the last.

+ +

shadowAlpha

this.shadowAlpha = 0.07

transparency of the shadow (0 = transparent, 1 = opaque)

+ +

shadowDepth

this.shadowDepth = 4

number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.

+ +

background

this.background = "#efefef"

background color of the inside of the gauge.

+ +

ringColor

this.ringColor = "#BBC6D0"

color of the outer ring, hub, and needle of the gauge.

+ +

tickColor

this.tickColor = "#989898"

color of the tick marks around the gauge.

+ +

ringWidth

this.ringWidth = null

width of the ring around the gauge.  Auto computed by default.

+ +

min

this.min

Minimum value on the gauge.  Auto computed by default

+ +

max

this.max

Maximum value on the gauge.  Auto computed by default

+ +

ticks

this.ticks = []

Array of tick values.  Auto computed by default.

+ +

showTicks

this.showTicks = true

true to show ticks around gauge.

+ +

showTickLabels

this.showTickLabels = true

true to show tick labels next to ticks.

+ +

label

this.label = null

A gauge label like ‘kph’ or ‘Volts’

+ +

labelHeightAdjust

this.labelHeightAdjust = 0

Number of Pixels to offset the label up (-) or down (+) from its default position.

+ +

labelPosition

this.labelPosition = 'inside'

Where to position the label, either ‘inside’ or ‘bottom’.

+ +

intervals

this.intervals = []

Array of ranges to be drawn around the gauge.  Array of form:

[value1, value2, ...]

indicating the values for the first, second, ... intervals.

+ +

intervalColors

this.intervalColors = [ "#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"]

Array of colors to use for the intervals.

+ +

intervalInnerRadius

this.intervalInnerRadius = null

Radius of the inner circle of the interval ring.

+ +

intervalOuterRadius

this.intervalOuterRadius = null

Radius of the outer circle of the interval ring.

+ +

tickSpacing

this.tickSpacing = 30

Degrees between ticks.  This is a target number, if incompatible span and ticks are supplied, a suitable spacing close to this value will be computed.

+ +

hubRadius

this.hubRadius = null

Radius of the hub at the bottom center of gauge which the needle attaches to.  Auto computed by default

+ +

tickPadding

this.tickPadding = null

padding of the tick marks to the outer ring and the tick labels to marks.  Auto computed by default.

+ +

needleThickness

this.needleThickness = null

Maximum thickness the needle.  Auto computed by default.

+ +

needlePad

this.needlePad = 6

Padding between needle and inner edge of the ring when the needle is at the min or max gauge value.

+ +

pegNeedle

this.pegNeedle = true

True will stop needle just below/above the min/max values if data is below/above min/max, as if the meter is “pegged”.

+ +
+ + + + + + + + + + +
this.diameter = null
Outer diameter of the meterGauge, auto computed by default
this.padding = null
padding between the meterGauge and plot edges, auto calculated by default.
this.shadowOffset = 2
offset of the shadow from the gauge ring and offset of each succesive stroke of the shadow from the last.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowDepth = 4
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.background = "#efefef"
background color of the inside of the gauge.
this.ringColor = "#BBC6D0"
color of the outer ring, hub, and needle of the gauge.
this.tickColor = "#989898"
color of the tick marks around the gauge.
this.ringWidth = null
width of the ring around the gauge.
this.min
Minimum value on the gauge.
this.max
Maximum value on the gauge.
this.ticks = []
Array of tick values.
this.showTicks = true
true to show ticks around gauge.
this.showTickLabels = true
true to show tick labels next to ticks.
this.label = null
A gauge label like ‘kph’ or ‘Volts’
this.labelHeightAdjust = 0
Number of Pixels to offset the label up (-) or down (+) from its default position.
this.labelPosition = 'inside'
Where to position the label, either ‘inside’ or ‘bottom’.
this.intervals = []
Array of ranges to be drawn around the gauge.
this.intervalColors = [ "#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"]
Array of colors to use for the intervals.
this.intervalInnerRadius = null
Radius of the inner circle of the interval ring.
this.intervalOuterRadius = null
Radius of the outer circle of the interval ring.
this.tickSpacing = 30
Degrees between ticks.
this.hubRadius = null
Radius of the hub at the bottom center of gauge which the needle attaches to.
this.tickPadding = null
padding of the tick marks to the outer ring and the tick labels to marks.
this.needleThickness = null
Maximum thickness the needle.
this.needlePad = 6
Padding between needle and inner edge of the ring when the needle is at the min or max gauge value.
this.pegNeedle = true
True will stop needle just below/above the min/max values if data is below/above min/max, as if the meter is “pegged”.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-ohlcRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-ohlcRenderer-js.html new file mode 100644 index 00000000..b94d2c15 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-ohlcRenderer-js.html @@ -0,0 +1,65 @@ + + +$.jqplot.OHLCRenderer + + + + + + + + + +

jqPlot Plugin to draw Open Hi Low Close, Candlestick and Hi Low Close charts.

To use this plugin, include the renderer js file in your source:

<script type="text/javascript" src="plugins/jqplot.ohlcRenderer.js"></script>

You will most likely want to use a date axis renderer for the x axis also, so include the date axis render js file also:

<script type="text/javascript" src="plugins/jqplot.dateAxisRenderer.js"></script>

Then you set the renderer in the series options on your plot

series: [{renderer:$.jqplot.OHLCRenderer}]

For OHLC and candlestick charts, data should be specified like so:

dat = [['07/06/2009',138.7,139.68,135.18,135.4], ['06/29/2009',143.46,144.66,139.79,140.02], ...]

If the data array has only 4 values per point instead of 5, the renderer will create a Hi Low Close chart instead.  In that case, data should be supplied like:

dat = [['07/06/2009',139.68,135.18,135.4], ['06/29/2009',144.66,139.79,140.02], ...]

To generate a candlestick chart instead of an OHLC chart, set the “candlestick” option to true:

series: [{renderer:$.jqplot.OHLCRenderer, rendererOptions:{candleStick:true}}],
Summary
$.jqplot.OHLCRendererjqPlot Plugin to draw Open Hi Low Close, Candlestick and Hi Low Close charts.
Properties
candleSticktrue to render chart as candleStick.
tickLengthlength of the line in pixels indicating open and close price.
bodyWidthwidth of the candlestick body in pixels.
openColorcolor of the open price tick mark.
closeColorcolor of the close price tick mark.
wickColorcolor of the hi-lo line thorugh the candlestick body.
fillUpBodytrue to render an “up” day (close price greater than open price) with a filled candlestick body.
fillDownBodytrue to render a “down” day (close price lower than open price) with a filled candlestick body.
upBodyColorColor of candlestick body of an “up” day.
downBodyColorColor of candlestick body on a “down” day.
hlctrue if is a hi-low-close chart (no open price).
lineWidthWidth of the hi-low line and open/close ticks.
+ +

Properties

+ +

candleStick

this.candleStick = false

true to render chart as candleStick.  Must have an open price, cannot be a hlc chart.

+ +

tickLength

this.tickLength = 'auto'

length of the line in pixels indicating open and close price.  Default will auto calculate based on plot width and number of points displayed.

+ +

bodyWidth

this.bodyWidth = 'auto'

width of the candlestick body in pixels.  Default will auto calculate based on plot width and number of candlesticks displayed.

+ +

openColor

this.openColor = null

color of the open price tick mark.  Default is series color.

+ +

closeColor

this.closeColor = null

color of the close price tick mark.  Default is series color.

+ +

wickColor

this.wickColor = null

color of the hi-lo line thorugh the candlestick body.  Default is the series color.

+ +

fillUpBody

this.fillUpBody = false

true to render an “up” day (close price greater than open price) with a filled candlestick body.

+ +

fillDownBody

this.fillDownBody = true

true to render a “down” day (close price lower than open price) with a filled candlestick body.

+ +

upBodyColor

this.upBodyColor = null

Color of candlestick body of an “up” day.  Default is series color.

+ +

downBodyColor

this.downBodyColor = null

Color of candlestick body on a “down” day.  Default is series color.

+ +

hlc

this.hlc = false

true if is a hi-low-close chart (no open price).  This is determined automatically from the series data.

+ +

lineWidth

this.lineWidth = 1.5

Width of the hi-low line and open/close ticks.  Must be set in the rendererOptions for the series.

+ +
+ + + + + + + + + + +
this.candleStick = false
true to render chart as candleStick.
this.tickLength = 'auto'
length of the line in pixels indicating open and close price.
this.bodyWidth = 'auto'
width of the candlestick body in pixels.
this.openColor = null
color of the open price tick mark.
this.closeColor = null
color of the close price tick mark.
this.wickColor = null
color of the hi-lo line thorugh the candlestick body.
this.fillUpBody = false
true to render an “up” day (close price greater than open price) with a filled candlestick body.
this.fillDownBody = true
true to render a “down” day (close price lower than open price) with a filled candlestick body.
this.upBodyColor = null
Color of candlestick body of an “up” day.
this.downBodyColor = null
Color of candlestick body on a “down” day.
this.hlc = false
true if is a hi-low-close chart (no open price).
this.lineWidth = 1.5
Width of the hi-low line and open/close ticks.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pieRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pieRenderer-js.html new file mode 100644 index 00000000..a4cd2a69 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pieRenderer-js.html @@ -0,0 +1,93 @@ + + +$.jqplot.PieRenderer + + + + + + + + + +

Plugin renderer to draw a pie chart. x values, if present, will be used as slice labels. y values give slice size.

To use this renderer, you need to include the pie renderer plugin, for example:

<script type="text/javascript" src="plugins/jqplot.pieRenderer.js"></script>

Properties described here are passed into the $.jqplot function as options on the series renderer.  For example:

plot2 = $.jqplot('chart2', [s1, s2], {
+    seriesDefaults: {
+        renderer:$.jqplot.PieRenderer,
+        rendererOptions:{
+             sliceMargin: 2,
+             startAngle: -90
+         }
+     }
+});

A pie plot will trigger events on the plot target according to user interaction.  All events return the event object, the series index, the point (slice) index, and the point data for the appropriate slice.

’jqplotDataMouseOver’triggered when user mouseing over a slice.
’jqplotDataHighlight’triggered the first time user mouses over a slice, if highlighting is enabled.
’jqplotDataUnhighlight’triggered when a user moves the mouse out of a highlighted slice.
’jqplotDataClick’triggered when the user clicks on a slice.
’jqplotDataRightClick’tiggered when the user right clicks on a slice if the “captureRightClick” option is set to true on the plot.
Summary
$.jqplot.PieRendererPlugin renderer to draw a pie chart.
Properties
diameterOuter diameter of the pie, auto computed by default
paddingpadding between the pie and plot edges, legend, etc.
sliceMarginangular spacing between pie slices in degrees.
filltrue or false, whether to fil the slices.
shadowOffsetoffset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
shadowAlphatransparency of the shadow (0 = transparent, 1 = opaque)
shadowDepthnumber of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
highlightMouseOverTrue to highlight slice when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over a slice.
highlightColorsan array of colors to use when highlighting a slice.
dataLabelsEither ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
showDataLabelstrue to show data labels on slices.
dataLabelFormatStringFormat string for data labels.
dataLabelThresholdThreshhold in percentage (0-100) of pie area, below which no label will be displayed.
dataLabelPositionFactorA Multiplier (0-1) of the pie radius which controls position of label on slice.
dataLabelNudgeNumber of pixels to slide the label away from (+) or toward (-) the center of the pie.
dataLabelCenterOnTrue to center the data label at its position.
startAngleAngle to start drawing pie in degrees.
$.jqplot.PieLegendRendererLegend Renderer specific to pie plots.
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

diameter

this.diameter = null

Outer diameter of the pie, auto computed by default

+ +

padding

this.padding = 20

padding between the pie and plot edges, legend, etc.

+ +

sliceMargin

this.sliceMargin = 0

angular spacing between pie slices in degrees.

+ +

fill

this.fill = true

true or false, whether to fil the slices.

+ +

shadowOffset

this.shadowOffset = 2

offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.

+ +

shadowAlpha

this.shadowAlpha = 0.07

transparency of the shadow (0 = transparent, 1 = opaque)

+ +

shadowDepth

this.shadowDepth = 5

number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight slice when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on a slice.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over a slice.  This will be disabled if highlightMouseOver is true.

+ +

highlightColors

this.highlightColors = []

an array of colors to use when highlighting a slice.

+ +

dataLabels

this.dataLabels = 'percent'

Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.  Defaults to percentage of each pie slice.

+ +

showDataLabels

this.showDataLabels = false

true to show data labels on slices.

+ +

dataLabelFormatString

this.dataLabelFormatString = null

Format string for data labels.  If none, ‘%s’ is used for “label” and for arrays, ‘%d’ for value and ‘%d%%’ for percentage.

+ +

dataLabelThreshold

this.dataLabelThreshold = 3

Threshhold in percentage (0-100) of pie area, below which no label will be displayed.  This applies to all label types, not just to percentage labels.

+ +

dataLabelPositionFactor

this.dataLabelPositionFactor = 0.52

A Multiplier (0-1) of the pie radius which controls position of label on slice.  Increasing will slide label toward edge of pie, decreasing will slide label toward center of pie.

+ +

dataLabelNudge

this.dataLabelNudge = 2

Number of pixels to slide the label away from (+) or toward (-) the center of the pie.

+ +

dataLabelCenterOn

this.dataLabelCenterOn = true

True to center the data label at its position.  False to set the inside facing edge of the label at its position.

+ +

startAngle

this.startAngle = 0

Angle to start drawing pie in degrees.  According to orientation of canvas coordinate system: 0 = on the positive x axis -90 = on the positive y axis.  90 = on the negaive y axis.  180 or - 180 = on the negative x axis.

+ +

$.jqplot.PieLegendRenderer

Legend Renderer specific to pie plots.  Set by default when user creates a pie plot.

Summary
Properties
numberRowsMaximum number of rows in the legend.
numberColumnsMaximum number of columns in the legend.
+ +

Properties

+ +

numberRows

this.numberRows = null

Maximum number of rows in the legend.  0 or null for unlimited.

+ +

numberColumns

this.numberColumns = null

Maximum number of columns in the legend.  0 or null for unlimited.

+ +
+ + + + + + + + + + +
this.diameter = null
Outer diameter of the pie, auto computed by default
this.padding = 20
padding between the pie and plot edges, legend, etc.
this.sliceMargin = 0
angular spacing between pie slices in degrees.
this.fill = true
true or false, whether to fil the slices.
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.showDataLabels = false
true to show data labels on slices.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelThreshold = 3
Threshhold in percentage (0-100) of pie area, below which no label will be displayed.
this.dataLabelPositionFactor = 0.52
A Multiplier (0-1) of the pie radius which controls position of label on slice.
this.dataLabelNudge = 2
Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelCenterOn = true
True to center the data label at its position.
this.startAngle = 0
Angle to start drawing pie in degrees.
this.numberRows = null
Maximum number of rows in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pointLabels-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pointLabels-js.html new file mode 100644 index 00000000..6dcfb105 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pointLabels-js.html @@ -0,0 +1,72 @@ + + +$.jqplot.PointLabels + + + + + + + + + +

Plugin for putting labels at the data points.

To use this plugin, include the js file in your source:

<script type="text/javascript" src="plugins/jqplot.pointLabels.js"></script>

By default, the last value in the data ponit array in the data series is used for the label.  For most series renderers, extra data can be added to the data point arrays and the last value will be used as the label.

For instance, this series:

[[1,4], [3,5], [7,2]]

Would, by default, use the y values in the labels.  Extra data can be added to the series like so:

[[1,4,'mid'], [3 5,'hi'], [7,2,'low']]

And now the point labels would be ‘mid’, ‘low’, and ‘hi’.

Options to the point labels and a custom labels array can be passed into the “pointLabels” option on the series option like so:

series:[{pointLabels:{
+   labels:['mid', 'hi', 'low'],
+   location:'se',
+   ypadding: 12
+   }
+}]

A custom labels array in the options takes precendence over any labels in the series data.  If you have a custom labels array in the options, but still want to use values from the series array as labels, set the “labelsFromSeries” option to true.

By default, html entities (<, >, etc.) are escaped in point labels.  If you want to include actual html markup in the labels, set the “escapeHTML” option to false.

Summary
$.jqplot.PointLabelsPlugin for putting labels at the data points.
Properties
showshow the labels or not.
locationcompass location where to position the label around the point.
labelsFromSeriestrue to use labels within data point arrays.
seriesLabelIndexarray index for location of labels within data point arrays.
labelsarray of arrays of labels, one array for each series.
stackedValuetrue to display value as stacked in a stacked plot.
ypaddingvertical padding in pixels between point and label
xpaddinghorizontal padding in pixels between point and label
escapeHTMLtrue to escape html entities in the labels.
edgeToleranceNumber of pixels that the label must be away from an axis boundary in order to be drawn.
formatterA class of a formatter for the tick text.
formatStringstring passed to the formatter.
hideZerostrue to not show a label for a value which is 0.
+ +

Properties

+ +

show

this.show = $.jqplot.config.enablePlugins

show the labels or not.

+ +

location

this.location = 'n'

compass location where to position the label around the point.  ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’

+ +

labelsFromSeries

this.labelsFromSeries = false

true to use labels within data point arrays.

+ +

seriesLabelIndex

this.seriesLabelIndex = null

array index for location of labels within data point arrays. if null, will use the last element of the data point array.

+ +

labels

this.labels = []

array of arrays of labels, one array for each series.

+ +

stackedValue

this.stackedValue = false

true to display value as stacked in a stacked plot. no effect if labels is specified.

+ +

ypadding

this.ypadding = 6

vertical padding in pixels between point and label

+ +

xpadding

this.xpadding = 6

horizontal padding in pixels between point and label

+ +

escapeHTML

this.escapeHTML = true

true to escape html entities in the labels.  If you want to include markup in the labels, set to false.

+ +

edgeTolerance

this.edgeTolerance = -5

Number of pixels that the label must be away from an axis boundary in order to be drawn.  Negative values will allow overlap with the grid boundaries.

+ +

formatter

this.formatter = $.jqplot.DefaultTickFormatter

A class of a formatter for the tick text.  sprintf by default.

+ +

formatString

this.formatString = ''

string passed to the formatter.

+ +

hideZeros

this.hideZeros = false

true to not show a label for a value which is 0.

+ +
+ + + + + + + + + + +
this.show = $.jqplot.config.enablePlugins
show the labels or not.
this.location = 'n'
compass location where to position the label around the point.
this.labelsFromSeries = false
true to use labels within data point arrays.
this.seriesLabelIndex = null
array index for location of labels within data point arrays.
this.labels = []
array of arrays of labels, one array for each series.
this.stackedValue = false
true to display value as stacked in a stacked plot.
this.ypadding = 6
vertical padding in pixels between point and label
this.xpadding = 6
horizontal padding in pixels between point and label
this.escapeHTML = true
true to escape html entities in the labels.
this.edgeTolerance = -5
Number of pixels that the label must be away from an axis boundary in order to be drawn.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.formatString = ''
string passed to the formatter.
this.hideZeros = false
true to not show a label for a value which is 0.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidAxisRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidAxisRenderer-js.html new file mode 100644 index 00000000..b244ef78 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidAxisRenderer-js.html @@ -0,0 +1,49 @@ + + +D:\jq\jqplot\build\plugins\jqplot.pyramidAxisRenderer.js + + + + + + + + + +
Summary
jqplot.pyramidAxisRenderer.js
Properties
positionPosition of axis.
drawBaselineTrue to draw the axis baseline.
baselineWidthwidth of the baseline in pixels.
baselineColorCSS color spec for the baseline.
+ +

Properties

+ +

position

this.position = null

Position of axis.  Values are: top, bottom , left, center, right.  By default, x and x2 axes are bottom, y axis is center.

+ +

drawBaseline

this.drawBaseline = true

True to draw the axis baseline.

+ +

baselineWidth

this.baselineWidth = null

width of the baseline in pixels.

+ +

baselineColor

this.baselineColor = null

CSS color spec for the baseline.

+ +
+ + + + + + + + + + +
this.position = null
Position of axis.
this.drawBaseline = true
True to draw the axis baseline.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineColor = null
CSS color spec for the baseline.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidGridRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidGridRenderer-js.html new file mode 100644 index 00000000..dbf3d6b2 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidGridRenderer-js.html @@ -0,0 +1,39 @@ + + +$.jqplot.CanvasGridRenderer + + + + + + + + + +

The default jqPlot grid renderer, creating a grid on a canvas element.  The renderer has no additional options beyond the Grid class.

+ +
+ + + + + + + + + + +
Object representing the grid on which the plot is drawn.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidRenderer-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidRenderer-js.html new file mode 100644 index 00000000..e134b735 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-pyramidRenderer-js.html @@ -0,0 +1,55 @@ + + +D:\jq\jqplot\build\plugins\jqplot.pyramidRenderer.js + + + + + + + + + +
Summary
jqplot.pyramidRenderer.js
Properties
barPadding
fillTrue to fill the bars.
highlightMouseOverTrue to highlight slice when moused over.
highlightMouseDownTrue to highlight when a mouse button is pressed over a slice.
highlightColorsan array of colors to use when highlighting a slice.
synchronizeHighlightIndex of another series to highlight when this series is highlighted.
offsetBarsFalse will center bars on their y value.
+ +

Properties

+ +

barPadding

this.barPadding = 10
+ +

fill

this.fill = true

True to fill the bars.

+ +

highlightMouseOver

this.highlightMouseOver = true

True to highlight slice when moused over.  This must be false to enable highlightMouseDown to highlight when clicking on a slice.

+ +

highlightMouseDown

this.highlightMouseDown = false

True to highlight when a mouse button is pressed over a slice.  This will be disabled if highlightMouseOver is true.

+ +

highlightColors

this.highlightColors = []

an array of colors to use when highlighting a slice.

+ +

synchronizeHighlight

this.synchronizeHighlight = false

Index of another series to highlight when this series is highlighted. null or false to not synchronize.

+ +

offsetBars

this.offsetBars = false

False will center bars on their y value.  True will push bars up by 1/2 bar width to fill between their y values.  If true, there needs to be 1 more tick than there are bars.

+ +
+ + + + + + + + + + +
this.barPadding = 10
this.fill = true
True to fill the bars.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.synchronizeHighlight = false
Index of another series to highlight when this series is highlighted.
this.offsetBars = false
False will center bars on their y value.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/plugins/jqplot-trendline-js.html b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-trendline-js.html new file mode 100644 index 00000000..88585d9f --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/plugins/jqplot-trendline-js.html @@ -0,0 +1,67 @@ + + +$.jqplot.Trendline + + + + + + + + + +

Plugin which will automatically compute and draw trendlines for plotted data.

Summary
$.jqplot.TrendlinePlugin which will automatically compute and draw trendlines for plotted data.
Properties
showWether or not to show the trend line.
colorCSS color spec for the trend line.
rendererRenderer to use to draw the trend line.
rendererOptionsOptions to pass to the line renderer.
labelLabel for the trend line to use in the legend.
typeEither ‘exponential’, ‘exp’, or ‘linear’.
shadowtrue or false, whether or not to show the shadow.
markerRendererRenderer to use to draw markers on the line.
lineWidthWidth of the trend line.
shadowAngleAngle of the shadow on the trend line.
shadowOffsetpixel offset for each stroke of the shadow.
shadowAlphaAlpha transparency of the shadow.
shadowDepthnumber of strokes to make of the shadow.
+ +

Properties

+ +

show

this.show = $.jqplot.config.enablePlugins

Wether or not to show the trend line.

+ +

color

this.color = '#666666'

CSS color spec for the trend line.  By default this wil be the same color as the primary line.

+ +

renderer

this.renderer = new $.jqplot.LineRenderer()

Renderer to use to draw the trend line.  The data series that is plotted may not be rendered as a line.  Therefore, we use our own line renderer here to draw a trend line.

+ +

rendererOptions

this.rendererOptions = {marker:{show:false}}

Options to pass to the line renderer.  By default, markers are not shown on trend lines.

+ +

label

this.label = ''

Label for the trend line to use in the legend.

+ +

type

this.type = 'linear'

Either ‘exponential’, ‘exp’, or ‘linear’.

+ +

shadow

this.shadow = true

true or false, whether or not to show the shadow.

+ +

markerRenderer

this.markerRenderer = {show:false}

Renderer to use to draw markers on the line.  I think this is wrong.

+ +

lineWidth

this.lineWidth = 1.5

Width of the trend line.

+ +

shadowAngle

this.shadowAngle = 45

Angle of the shadow on the trend line.

+ +

shadowOffset

this.shadowOffset = 1.0

pixel offset for each stroke of the shadow.

+ +

shadowAlpha

this.shadowAlpha = 0.07

Alpha transparency of the shadow.

+ +

shadowDepth

this.shadowDepth = 3

number of strokes to make of the shadow.

+ +
+ + + + + + + + + + +
this.show = $.jqplot.config.enablePlugins
Wether or not to show the trend line.
this.color = '#666666'
CSS color spec for the trend line.
this.renderer = new $.jqplot.LineRenderer()
Renderer to use to draw the trend line.
this.rendererOptions = {marker:{show:false}}
Options to pass to the line renderer.
this.label = ''
Label for the trend line to use in the legend.
this.type = 'linear'
Either ‘exponential’, ‘exp’, or ‘linear’.
this.shadow = true
true or false, whether or not to show the shadow.
this.markerRenderer = {show:false}
Renderer to use to draw markers on the line.
this.lineWidth = 1.5
Width of the trend line.
this.shadowAngle = 45
Angle of the shadow on the trend line.
this.shadowOffset = 1.0
pixel offset for each stroke of the shadow.
this.shadowAlpha = 0.07
Alpha transparency of the shadow.
this.shadowDepth = 3
number of strokes to make of the shadow.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/files/usage-txt.html b/public/site_assets/test/js/dist/docs/files/usage-txt.html new file mode 100644 index 00000000..addddaa8 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/files/usage-txt.html @@ -0,0 +1,58 @@ + + +jqPlot Usage + + + + + + + + + +

Usage Documentation

Introduction

jqPlot is a jQuery plugin to generate pure client-side javascript charts in your web pages.

The jqPlot home page is at http://www.jqplot.com/.

The project page and downloads are at http://www.bitbucket.org/cleonello/jqplot/.

Below are a few examples to demonstrate jqPlot usage.  These plots are shown as static images.  Many more examples of dynamically rendered plots can be seen on the test and examples pages here: ../../tests/.

Include the Files

jqPlot requires jQuery (1.4+ required for certain features). jQuery is included in the distribution.  To use jqPlot include jquery, the jqPlot jQuery plugin, jqPlot css file and optionally the excanvas script for IE support in your web page.  Note, excanvas is required only for IE versions below 9.  IE 9 includes native support for the canvas element and does not require excanvas:

<!--[if lt IE 9]><script language="javascript" type="text/javascript" src="excanvas.js"></script><![endif]-->
+<script language="javascript" type="text/javascript" src="jquery.min.js"></script>
+<script language="javascript" type="text/javascript" src="jquery.jqplot.min.js"></script>
+<link rel="stylesheet" type="text/css" href="jquery.jqplot.css" />

Add a plot container

Add a container (target) to your web page where you want your plot to show up.  Be sure to give your target a width and a height:

<div id="chartdiv" style="height:400px;width:300px; "></div>

Create a plot

Then, create the actual plot by calling the $.jqplot plugin with the id of your target and some data:

$.jqplot('chartdiv',  [[[1, 2],[3,5.12],[5,13.1],[7,33.6],[9,85.9],[11,219.9]]]);

Which will produce a chart like:

Plot Options

You can customize the plot by passing options to the $.jqplot function.  Options are described in jqPlot Options in the jqPlotOptions.txt file.  An example of options usage:

$.jqplot('chartdiv',  [[[1, 2],[3,5.12],[5,13.1],[7,33.6],[9,85.9],[11,219.9]]],
+{ title:'Exponential Line',
+  axes:{yaxis:{min:-10, max:240}},
+  series:[{color:'#5FAB78'}]
+});

Which will produce a plot like:

Using Plugins

You can use jqPlot plugins (that is, plugins to the jqPlot plugin) by including them in your html after you include the jqPlot plugin.  Here is how to include the log axis plugin:

<link rel="stylesheet" type="text/css" href="jquery.jqplot.css" />
+<!--[if IE]><script language="javascript" type="text/javascript" src="excanvas.js"></script><![endif]-->
+<script language="javascript" type="text/javascript" src="jquery.min.js"></script>
+<script language="javascript" type="text/javascript" src="jquery.jqplot.min.js"></script>
+<script language="javascript" type="text/javascript" src="jqplot.logAxisRenderer.js"></script>

Important note: For jqplot builds r529 and above (0.9.7r529 and higher), you must explicitly enable plugins via either the { show: true } plugin option to the plot or by using the $.jqplot.config.enablePlugins = true; config options set on the page before plot creation.  Only plugins that can be immediately active upon loading are affected.  This includes non-renderer plugins like cursor, dragable, highlighter, and trendline.

Here is the same $.jqplot call but with a log y axis:

$.jqplot('chartdiv',  [[[1, 2],[3,5.12],[5,13.1],[7,33.6],[9,85.9],[11,219.9]]],
+{ title:'Exponential Line',
+  axes:{yaxis:{renderer: $.jqplot.LogAxisRenderer}},
+  series:[{color:'#5FAB78'}]
+});

Which produces a plot like:

You can further customize with options specific to the log axis plugin:

$.jqplot('chartdiv',  [[[1, 2],[3,5.12],[5,13.1],[7,33.6],[9,85.9],[11,219.9]]],
+{ title:'Exponential Line',
+  axes:{yaxis:{renderer: $.jqplot.LogAxisRenderer, tickDistribution:'power'}},
+  series:[{color:'#5FAB78'}]
+});

Which makes a plot like:

For a full list of options, see jqPlot Options in the jqPlotOptions.txt file.

You can add as many plugins as you wish.  Order is generally not important.  Some plugins, like the highlighter plugin which highlights data points near the mouse, don’t need any extra options or setup to function.  Highlighter does have additional options which the user can set.

Other plugins, the barRenderer for example, provide functionality that must be specified in the chart options object.  To render a series as a bar graph with the bar renderer, you would first include the plugin after jqPlot:

<script language="javascript" type="text/javascript" src="plugins/jqplot.barRenderer.min.js"></script>

Then you would create a chart like:

$.jqplot('chartdiv',  [[34.53, 56.32, 25.1, 18.6]], {series:[{renderer:$.jqplot.BarRenderer}]});

Here the default LineRenderer is replaced by a BarRenderer to generate a bar graph for the first (and only) series.

+ +
+ + + + + + + + + + +
This document is out of date.
+ + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index.html b/public/site_assets/test/js/dist/docs/index.html new file mode 100644 index 00000000..295fd4a6 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index.html @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Classes.html b/public/site_assets/test/js/dist/docs/index/Classes.html new file mode 100644 index 00000000..93bf71df --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Classes.html @@ -0,0 +1,70 @@ + + +Class Index + + + + + + + + + +
Class Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
$#!
 $.fn
 $.jqplot
 $.jqplot.AxisLabelRenderer
 $.jqplot.AxisTickRenderer
 $.jqplot.BarRenderer
 $.jqplot.BezierCurveRenderer.js
 $.jqplot.BlockRenderer
 $.jqplot.BubbleRenderer
 $.jqplot.CanvasAxisLabelRenderer
 $.jqplot.CanvasAxisTickRenderer
 $.jqplot.CanvasGridRenderer
 $.jqplot.CanvasOverlay
 $.jqplot.CategoryAxisRenderer
 $.jqplot.ciParser
 $.jqplot.Cursor
 $.jqplot.DateAxisRenderer
 $.jqplot.DivTitleRenderer
 $.jqplot.DonutLegendRenderer
 $.jqplot.DonutRenderer
 $.jqplot.Dragable
 $.jqplot.FunnelLegendRenderer
 $.jqplot.FunnelRenderer
 $.jqplot.Highlighter
 $.jqplot.LinearAxisRenderer
 $.jqplot.LineRenderer
 $.jqplot.LogAxisRenderer
 $.jqplot.MarkerRenderer
 $.jqplot.MekkoAxisRenderer
 $.jqplot.MekkoLegendRenderer
 $.jqplot.MekkoRenderer
 $.jqplot.MeterGaugeRenderer
 $.jqplot.OHLCRenderer
 $.jqplot.PieLegendRenderer
 $.jqplot.PieRenderer
 $.jqplot.PointLabels
 $.jqplot.shadowRenderer
 $.jqplot.shapeRenderer
 $.jqplot.ThemeEngine
 $.jqplot.Trendline
A
 Axis
D
 DashedHorizontalLine
 DashedVerticalLine
G
 Grid
H
 HorizontalLine
J
 jqPlot
L
 Legend
 Line
S
 Series
T
 Title
V
 VerticalLine
+ +
jQuery namespace to attach functions to jQuery elements.
jQuery function called by the user to create a plot.
Renderer to place labels on the axes.
A “tick” object showing the value of a tick/gridline on the plot.
A plugin renderer for jqPlot to draw a bar plot.
Renderer which draws lines as stacked bezier curves.
Plugin renderer to draw a x-y block chart.
Plugin renderer to draw a bubble chart.
Renderer to draw axis labels with a canvas element to support advanced featrues such as rotated text.
Renderer to draw axis ticks with a canvas element to support advanced featrues such as rotated text.
The default jqPlot grid renderer, creating a grid on a canvas element.
A plugin for jqPlot to render a category style axis, with equal pixel spacing between y data values of a series.
Data Renderer function which converts a custom JSON data object into jqPlot data format.
Plugin class representing the cursor as displayed on the plot.
A plugin for a jqPlot to render an axis as a series of date values.
The default title renderer for jqPlot.
Legend Renderer specific to donut plots.
Plugin renderer to draw a donut chart.
Plugin to make plotted points dragable by the user.
Legend Renderer specific to funnel plots.
Plugin renderer to draw a funnel chart.
Plugin which will highlight data points when they are moused over.
The default jqPlot axis renderer, creating a numeric axis.
The default line renderer for jqPlot, this class has no options beyond the Series class.
A plugin for a jqPlot to render a logarithmic axis.
The default jqPlot marker renderer, rendering the points on the line.
An axis renderer for a Mekko chart.
Legend renderer used by mekko charts with options for controlling number or rows and columns as well as placement outside of plot area.
Draws a Mekko style chart which shows 3 dimensional data on a 2 dimensional graph.
Plugin renderer to draw a meter gauge chart.
jqPlot Plugin to draw Open Hi Low Close, Candlestick and Hi Low Close charts.
Legend Renderer specific to pie plots.
Plugin renderer to draw a pie chart.
Plugin for putting labels at the data points.
The default jqPlot shadow renderer, rendering shadows behind shapes.
The default jqPlot shape renderer.
Theme Engine provides a programatic way to change some of the more common jqplot styling options such as fonts, colors and grid options.
Plugin which will automatically compute and draw trendlines for plotted data.
+ + + +
An individual axis object.
+ + + +
A straight dashed horizontal line.
A straight dashed vertical line.
+ + + +
Object representing the grid on which the plot is drawn.
+ + + +
A straight horizontal line.
+ + + +
Plot object returned by call to $.jqplot.
+ + + +
Legend object.
A straight line.
+ + + +
An individual data series object.
+ + + +
Plot Title object.
+ + + +
A straight vertical line.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Files.html b/public/site_assets/test/js/dist/docs/index/Files.html new file mode 100644 index 00000000..0538b0fc --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Files.html @@ -0,0 +1,34 @@ + + +File Index + + + + + + + + + +
File Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
J
 jqplot.enhancedLegendRenderer.js
 jqplot.pyramidAxisRenderer.js
 jqplot.pyramidRenderer.js
+ + + +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Functions.html b/public/site_assets/test/js/dist/docs/index/Functions.html new file mode 100644 index 00000000..b2977bbb --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Functions.html @@ -0,0 +1,70 @@ + + +Function Index + + + + + + + + + +
Function Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
C
 copy, $.jqplot.ThemeEngine
D
 destroy, jqPlot
 draw
 drawSeries, jqPlot
G
 get, $.jqplot.ThemeEngine
 getThemeNames, $.jqplot.ThemeEngine
 getThemes, $.jqplot.ThemeEngine
I
 init, jqPlot
M
 makeGridData
 moveBlock, $.jqplot.BlockRenderer
 moveSeriesToBack, jqPlot
 moveSeriesToFront, jqPlot
N
 newTheme, $.jqplot.ThemeEngine
Q
 quickInit, jqPlot
R
 redraw, jqPlot
 reInitialize, jqPlot
 remove, $.jqplot.ThemeEngine
 rename, $.jqplot.ThemeEngine
 replot, jqPlot
 resetAxesScale, jqPlot
 restoreOriginalSeriesOrder, jqPlot
 restorePreviousSeriesOrder, jqPlot
S
 setGridData
Z
 zoomProxy, $.jqplot.Cursor.$.jqplot.Cursor
+ +
$.jqplot.ThemeEngine.prototype.copy = function (sourceName,
targetName,
obj)
Create a copy of an existing theme in the themeEngine, adding it the themeEngine.
+ + + +
this.destroy = function()
Releases all resources occupied by the plot
$.jqplot.ShadowRenderer.prototype.draw = function(ctx,
points,
options)
draws an transparent black (i.e.
$.jqplot.ShapeRenderer.prototype.draw = function(ctx,
points,
options)
draws the shape.
this.draw = function()
Draws all elements of the plot into the container.
this.drawSeries = function(options,
idx)
Redraws all or just one series on the plot.
+ + + +
$.jqplot.ThemeEngine.prototype.get = function(name)
Get and return the named theme or the active theme if no name given.
$.jqplot.ThemeEngine.prototype.getThemeNames = function()
Return the list of theme names in this manager in alpha-numerical order.
$.jqplot.ThemeEngine.prototype.getThemes = function()
Return a list of themes in alpha-numerical order by name.
+ + + +
this.init = function(target,
data,
options)
sets the plot target, checks data and applies user options to plot.
+ + + +
$.jqplot.BezierCurveRenderer.prototype.makeGridData = function(data,
plot)
converts any arbitrary data values to grid coordinates and returns them.
$.jqplot.MekkoRenderer.prototype.makeGridData = function(data,
plot)
converts any arbitrary data values to grid coordinates and returns them.
this.moveBlock = function (idx,
x,
y,
duration)
Moves an individual block.
this.moveSeriesToBack = function (idx)
This method requires jQuery 1.4+ Moves the specified series canvas behind all other series canvases.
this.moveSeriesToFront = function (idx)
This method requires jQuery 1.4+ Moves the specified series canvas in front of all other series canvases.
+ + + +
$.jqplot.ThemeEngine.prototype.newTheme = function(name,
obj)
Create a new theme based on the default theme, adding it the themeEngine.
+ + + +
this.quickInit = function ()
Quick reinitialization plot for replotting.
+ + + +
this.redraw = function(clear)
Empties the plot target div and redraws the plot.
this.reInitialize = function (data,
opts)
reinitialize plot for replotting.
$.jqplot.ThemeEngine.prototype.remove = function(name)
Remove the given theme from the themeEngine.
$.jqplot.ThemeEngine.prototype.rename = function (oldName,
newName)
Rename a theme.
this.replot = function(options)
Does a reinitialization of the plot followed by a redraw.
this.resetAxesScale = function(axes,
options)
Reset the specified axes min, max, numberTicks and tickInterval properties to null or reset these properties on all axes if no list of axes is provided.
this.restoreOriginalSeriesOrder = function ()
This method requires jQuery 1.4+ Restore the series canvas order to its original order when the plot was created.
this.restorePreviousSeriesOrder = function ()
This method requires jQuery 1.4+ Restore the series canvas order to its previous state.
+ + + +
$.jqplot.BezierCurveRenderer.prototype.setGridData = function(plot)
converts the user data values to grid coordinates and stores them in the gridData array.
$.jqplot.MekkoRenderer.prototype.setGridData = function(plot)
converts the user data values to grid coordinates and stores them in the gridData array.
+ + + +
$.jqplot.Cursor.zoomProxy = function(targetPlot,
controllerPlot)
links targetPlot to controllerPlot so that plot zooming of targetPlot will be controlled by zooming on the controllerPlot.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General.html b/public/site_assets/test/js/dist/docs/index/General.html new file mode 100644 index 00000000..241ce364 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General.html @@ -0,0 +1,42 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
$#!
 $.fn
 $.jqplot
 $.jqplot.AxisLabelRenderer
 $.jqplot.AxisTickRenderer
 $.jqplot.BarRenderer
 $.jqplot.BezierCurveRenderer.js
 $.jqplot.BlockRenderer
 $.jqplot.BubbleRenderer
 $.jqplot.CanvasAxisLabelRenderer
 $.jqplot.CanvasAxisTickRenderer
 $.jqplot.CanvasGridRenderer
 $.jqplot.CanvasOverlay
 $.jqplot.CategoryAxisRenderer
 $.jqplot.ciParser
 $.jqplot.Cursor
 $.jqplot.DateAxisRenderer
 $.jqplot.DivTitleRenderer
 $.jqplot.DonutLegendRenderer
 $.jqplot.DonutRenderer
 $.jqplot.Dragable
 $.jqplot.FunnelLegendRenderer
 $.jqplot.FunnelRenderer
 $.jqplot.Highlighter
 $.jqplot.LinearAxisRenderer
 $.jqplot.LineRenderer
 $.jqplot.LogAxisRenderer
 $.jqplot.MarkerRenderer
 $.jqplot.MekkoAxisRenderer
 $.jqplot.MekkoLegendRenderer
 $.jqplot.MekkoRenderer
 $.jqplot.MeterGaugeRenderer
 $.jqplot.OHLCRenderer
 $.jqplot.PieLegendRenderer
 $.jqplot.PieRenderer
 $.jqplot.PointLabels
 $.jqplot.shadowRenderer
 $.jqplot.shapeRenderer
 $.jqplot.ThemeEngine
 $.jqplot.Trendline
A
 activeTheme, $.jqplot.ThemeEngine
 addLegendRowHooks, $.jqplot.$.jqplot
 alignTicks, $.jqplot.LinearAxisRenderer
 alpha, $.jqplot.shadowRenderer
 angle
 animate, jqPlot
 animateReplot, jqPlot
 autoscale, Axis
 autoscaleBubbles, $.jqplot.BubbleRenderer
 autoscaleMultiplier, $.jqplot.BubbleRenderer
 autoscalePointsFactor, $.jqplot.BubbleRenderer
 Available Options
 axes, jqPlot
 axesDefaults, jqPlot
 Axis
 axisDefaults, $.jqplot.LogAxisRenderer
B
 background
 bandData, $.jqplot.LineRenderer
 bands, $.jqplot.LineRenderer
 barDirection, $.jqplot.BarRenderer
 barLabelOptions, $.jqplot.MekkoAxisRenderer
 barLabelRenderer, $.jqplot.MekkoAxisRenderer
 barLabels, $.jqplot.MekkoAxisRenderer
 barMargin, $.jqplot.BarRenderer
 barPadding
 barWidth, $.jqplot.BarRenderer
 baselineColor
 baselineWidth
 bodyWidth, $.jqplot.OHLCRenderer
 border, Legend
 borderColor
 borderWidth
 breakOnNull, Series
 breakPoints, $.jqplot.LinearAxisRenderer
 breakTickLabel, $.jqplot.LinearAxisRenderer
 bringSeriesToFront, $.jqplot.Highlighter
 bubbleAlpha, $.jqplot.BubbleRenderer
 bubbleGradients, $.jqplot.BubbleRenderer
+ +
jQuery namespace to attach functions to jQuery elements.
jQuery function called by the user to create a plot.
Renderer to place labels on the axes.
A “tick” object showing the value of a tick/gridline on the plot.
A plugin renderer for jqPlot to draw a bar plot.
Renderer which draws lines as stacked bezier curves.
Plugin renderer to draw a x-y block chart.
Plugin renderer to draw a bubble chart.
Renderer to draw axis labels with a canvas element to support advanced featrues such as rotated text.
Renderer to draw axis ticks with a canvas element to support advanced featrues such as rotated text.
The default jqPlot grid renderer, creating a grid on a canvas element.
A plugin for jqPlot to render a category style axis, with equal pixel spacing between y data values of a series.
Data Renderer function which converts a custom JSON data object into jqPlot data format.
Plugin class representing the cursor as displayed on the plot.
A plugin for a jqPlot to render an axis as a series of date values.
The default title renderer for jqPlot.
Legend Renderer specific to donut plots.
Plugin renderer to draw a donut chart.
Plugin to make plotted points dragable by the user.
Legend Renderer specific to funnel plots.
Plugin renderer to draw a funnel chart.
Plugin which will highlight data points when they are moused over.
The default jqPlot axis renderer, creating a numeric axis.
The default line renderer for jqPlot, this class has no options beyond the Series class.
A plugin for a jqPlot to render a logarithmic axis.
The default jqPlot marker renderer, rendering the points on the line.
An axis renderer for a Mekko chart.
Legend renderer used by mekko charts with options for controlling number or rows and columns as well as placement outside of plot area.
Draws a Mekko style chart which shows 3 dimensional data on a 2 dimensional graph.
Plugin renderer to draw a meter gauge chart.
jqPlot Plugin to draw Open Hi Low Close, Candlestick and Hi Low Close charts.
Legend Renderer specific to pie plots.
Plugin renderer to draw a pie chart.
Plugin for putting labels at the data points.
The default jqPlot shadow renderer, rendering shadows behind shapes.
The default jqPlot shape renderer.
Theme Engine provides a programatic way to change some of the more common jqplot styling options such as fonts, colors and grid options.
Plugin which will automatically compute and draw trendlines for plotted data.
+ + + +
this.activeTheme=null
Pointer to currently active theme
called at the end of legend draw, so plugins can add rows to the legend table.
this.alignTicks = false
true to align tick marks across opposed axes such as from the y2axis to yaxis.
this.alpha = 0.07
alpha transparency of shadow stroke.
this.angle = 0
angle of text, measured clockwise from x axis.
this.angle = 0
angle of text, measured clockwise from x axis.
this.angle = 45
Angle of the shadow in degrees.
this.animate = false
True to animate the series on initial plot draw (renderer dependent).
this.animateReplot = false
True to animate series after a call to the replot() method.
this.autoscale = false
DEPRECATED the default scaling algorithm produces superior results.
this.autoscaleBubbles = true
True to scale the bubble radius based on plot size.
this.autoscaleMultiplier = 1.0
Multiplier the bubble size if autoscaleBubbles is true.
this.autoscalePointsFactor = -0.07
Factor which decreases bubble size based on how many bubbles on on the chart.
See jqPlot Options for a list of options available thorugh the options object (not complete yet!)
this.axes = {xaxis: new Axis('xaxis'), yaxis: new Axis('yaxis'), x2axis: new Axis('x2axis'), y2axis: new Axis('y2axis'), y3axis: new Axis('y3axis'), y4axis: new Axis('y4axis'), y5axis: new Axis('y5axis'), y6axis: new Axis('y6axis'), y7axis: new Axis('y7axis'), y8axis: new Axis('y8axis'), y9axis: new Axis('y9axis'), yMidAxis: new Axis('yMidAxis')}
up to 4 axes are supported, each with its own options, See Axis for axis specific options.
default options that will be applied to all axes.
An individual axis object.
Default properties which will be applied directly to the series.
+ + + +
this.background = "#efefef"
background color of the inside of the gauge.
this.background = '#fffdf6'
css spec for the background color.
this.background
css spec for the background of the legend box.
this.renderer.bandData = []
Data used to draw error bands or confidence intervals above/below a line.
Banding around line, e.g error bands or confidence intervals.
this.barDirection = 'vertical'
‘vertical’ = up and down bars, ‘horizontal’ = side to side bars
this.barLabelOptions = {}
options object to pass to the bar label renderer.
this.barLabelRenderer = $.jqplot.AxisLabelRenderer
renderer to use to draw labels under each bar.
this.barLabels = this.barLabels || []
array of labels to put under each bar.
this.barMargin = 10
Number of pixels between groups of bars at adjacent axis values.
this.barPadding = 10
this.barPadding = 8
Number of pixels between adjacent bars at the same axis value.
this.barWidth = null
Width of the bar in pixels (auto by devaul).
this.baselineColor = null
CSS color spec for the baseline.
this.baselineColor = null
CSS color spec for the baseline.
this.baselineColor = null
CSS color spec for the baseline.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineWidth = null
width of the baseline in pixels.
this.bodyWidth = 'auto'
width of the candlestick body in pixels.
this.border
css spec for the border around the legend box.
this.borderColor = null
color of the borders between areas on the chart
this.borderColor = null
color of the border adjacent to the axis.
this.borderColor = '#999999'
css spec for the color of the grid border.
this.borderWidth = null
width of line stroked at the border of the axis.
this.borderWidth = 2.0
width of the border in pixels.
this.breakOnNull = false
Wether line segments should be be broken at null value.
this.breakPoints = null
EXPERIMENTAL!! 
this.breakTickLabel = "&asymp
Label to use at the axis break if breakPoints are specified.
this.bringSeriesToFront = false
This option requires jQuery 1.4+ True to bring the series of the highlighted point to the front of other series.
this.bubbleAlpha = 1.0
Alpha transparency to apply to all bubbles in this series.
this.bubbleGradients = false
True to color the bubbles with gradient fills instead of flat colors.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General2.html b/public/site_assets/test/js/dist/docs/index/General2.html new file mode 100644 index 00000000..6b9bb175 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General2.html @@ -0,0 +1,42 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
C
 candleStick, $.jqplot.OHLCRenderer
 Change Log
 Changes
 clearRect, $.jqplot.shapeRenderer
 clickReset, $.jqplot.Cursor
 closeColor, $.jqplot.OHLCRenderer
 color
 constrainOutsideZoom, $.jqplot.Cursor
 constrainSmoothing, $.jqplot.LineRenderer
 constrainTo, $.jqplot.Dragable
 constrainZoomTo, $.jqplot.Cursor
 copy, $.jqplot.ThemeEngine
 Copyright&License
 css, $.jqplot.BlockRenderer
 cursorLegendFormatString, $.jqplot.Cursor
D
 DashedHorizontalLine
 DashedVerticalLine
 dashPattern
 data, jqPlot
 dataLabelCenterOn, $.jqplot.PieRenderer
 dataLabelFormatString
 dataLabelNudge
 dataLabelPositionFactor
 dataLabels
 dataLabelThreshold
 dataRenderer, jqPlot
 dataRendererOptions, jqPlot
 dblClickReset, $.jqplot.Cursor
 defaultAxisStart, jqPlot
 depth, $.jqplot.shadowRenderer
 destroy, jqPlot
 diameter
 disableIEFading
 disableStack, Series
 downBodyColor, $.jqplot.OHLCRenderer
 draw
 drawBaseline
 drawBorder, Grid
 drawGridlines, Grid
 drawMajorGridlines, Axis
 drawMajorTickMarks, Axis
 drawMinorGridlines, Axis
 drawMinorTickMarks, Axis
 drawSeries, jqPlot
E
 edgeTolerance, $.jqplot.PointLabels
 enableFontSupport
 escapeHtml
 escapeHTML
 eventListenerHooks, $.jqplot.$.jqplot
+ +
this.candleStick = false
true to render chart as candleStick.
See Change Log
this.clearRect = false
true to cear a rectangle.
this.clickReset = false
Will reset plot zoom if single click on plot without drag.
this.closeColor = null
color of the close price tick mark.
color of the line
this.color
CSS color spec for the dragged point (and adjacent line segment or bar).
color of lines at top and bottom of bands [default: series color].
this.color = '#666666'
color of marker.
this.color = '#666666'
CSS color spec for the trend line.
this.color
css color spec for the series
this.constrainOutsideZoom = true
True to limit actual zoom area to edges of grid, even when zooming outside of plot area.
this.renderer.constrainSmoothing = true
True to use a more accurate smoothing algorithm that will not overshoot any data points.
this.constrainTo = 'none'
Constrain dragging motion to an axis or to none.
this.constrainZoomTo = 'none'
‘none’, ‘x’ or ‘y’
$.jqplot.ThemeEngine.prototype.copy = function (sourceName,
targetName,
obj)
Create a copy of an existing theme in the themeEngine, adding it the themeEngine.
Copyright © 2009-2013 Chris Leonello jqPlot is currently available for use in all personal or commercial projects under both the MIT and GPL version 2.0 licenses.
this.css = {padding:'2px', border:'1px solid #999', textAlign:'center'}
default css styles that will be applied to all data blocks.
this.cursorLegendFormatString = $.jqplot.Cursor.cursorLegendFormatString
Format string used in the cursor legend.
+ + + +
A straight dashed horizontal line.
A straight dashed vertical line.
dashPattern: [8,8] }
Array of line, space settings in pixels.
dashPattern: [8,8] }
Array of line, space settings in pixels.
this.data = []
user’s data.
this.dataLabelCenterOn = true
True to center the data label at its position.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelNudge = 0
Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelNudge = 2
Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelPositionFactor = 0.4
A Multiplier (0-1) of the pie radius which controls position of label on slice.
this.dataLabelPositionFactor = 0.52
A Multiplier (0-1) of the pie radius which controls position of label on slice.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.dataLabelThreshold = 3
this.dataLabelThreshold = 3
this.dataLabelThreshold = 3
Threshhold in percentage (0-100) of pie area, below which no label will be displayed.
this.dataRenderer
A callable which can be used to preprocess data passed into the plot.
this.dataRendererOptions
Options that will be passed to the dataRenderer.
this.dblClickReset = true
Will reset plot zoom if double click on plot without drag.
this.defaultAxisStart = 1
1-D data series are internally converted into 2-D [x,y] data point arrays by jqPlot.
this.depth = 3
how many times the shadow is stroked.
this.destroy = function()
Releases all resources occupied by the plot
this.diameter = null
Outer diameter of the donut, auto computed by default
this.diameter = null
Outer diameter of the meterGauge, auto computed by default
this.diameter = null
Outer diameter of the pie, auto computed by default
this.disableIEFading = true
true to toggle series with a show/hide method only and not allow fading in/out.
this.disableStack = false
true to not stack this series with other series in the plot.
this.downBodyColor = null
Color of candlestick body on a “down” day.
$.jqplot.ShadowRenderer.prototype.draw = function(ctx,
points,
options)
draws an transparent black (i.e.
$.jqplot.ShapeRenderer.prototype.draw = function(ctx,
points,
options)
draws the shape.
this.draw = function()
Draws all elements of the plot into the container.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBorder = true
True to draw border around grid.
this.drawGridlines = true
whether to draw the gridlines on the plot.
this.drawMajorGridlines = true
True to draw gridlines for major axis ticks.
this.drawMajorTickMarks = true
True to draw tick marks for major axis ticks.
this.drawMinorGridlines = false
True to draw gridlines for minor ticks.
this.drawMinorTickMarks = true
True to draw tick marks for minor ticks.
this.drawSeries = function(options,
idx)
Redraws all or just one series on the plot.
+ + + +
this.edgeTolerance = -5
Number of pixels that the label must be away from an axis boundary in order to be drawn.
this.enableFontSupport = true
true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
this.enableFontSupport = true
true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
this.escapeHtml = false
true to escape html in the box label.
this.escapeHtml = true
True to escape html in bubble label text.
this.escapeHtml = false
True to escape special characters with their html entity equivalents in legend text.
this.escapeHtml = false
True to escape special characters with their html entity equivalents in title text.
this.escapeHTML = false
true to escape HTML entities in the label.
this.escapeHTML = false
true to escape HTML entities in the label.
this.escapeHTML = true
true to escape html entities in the labels.
called at the end of plot drawing, binds listeners to the event canvas which lays on top of the grid area.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General3.html b/public/site_assets/test/js/dist/docs/index/General3.html new file mode 100644 index 00000000..4c5238ea --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General3.html @@ -0,0 +1,42 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
F
 fadeTooltip
 fill
 fillAlpha, Series
 fillAndStroke, Series
 fillAxis, Series
 fillBetween, jqPlot
 fillColor
 fillDownBody, $.jqplot.OHLCRenderer
 fillRect, $.jqplot.shapeRenderer
 fillStyle, $.jqplot.shapeRenderer
 fillToValue, Series
 fillToZero, Series
 fillUpBody, $.jqplot.OHLCRenderer
 followMouse, $.jqplot.Cursor
 fontFamily
 fontSize
 fontStretch
 fontWeight
 forceTickAt0, $.jqplot.LinearAxisRenderer
 forceTickAt100, $.jqplot.LinearAxisRenderer
 formatString
 formatter
 Functions
G
 get, $.jqplot.ThemeEngine
 getThemeNames, $.jqplot.ThemeEngine
 getThemes, $.jqplot.ThemeEngine
 GPL Version 2
 grid, jqPlot
 Grid
 gridLineColor, Grid
 gridLineWidth, Grid
 groups, $.jqplot.BarRenderer
H
 hideZeros, $.jqplot.PointLabels
 highlightAlpha, $.jqplot.BubbleRenderer
 highlightColor, $.jqplot.LineRenderer
 highlightColors
 highlightMouseDown
 highlightMouseOver
 hlc, $.jqplot.OHLCRenderer
 Hooks, $.jqplot
 HorizontalLine
 hubRadius, $.jqplot.MeterGaugeRenderer
+ +
true = fade in/out tooltip, flase = show/hide tooltip
this.fadeTooltip = true
true = fade in/out tooltip, flase = show/hide tooltip
this.fill = true
True to fill the bars.
this.fill = true
true or false, whether to fil the slices.
this.fill = true
true or false, whether to fill the areas.
True to fill area between bands [default: true].
this.fill = true
true or false, whether to fil the slices.
this.fill = false
whether to fill the shape.
this.fill = false
whether to fill the shape.
this.fill = false
true or false, whether to fill under lines or in bars.
this.fillAlpha
Alpha transparency to apply to the fill under the line.
this.fillAndStroke = false
If true will stroke the line (with color this.color) as well as fill under it.
this.fillAxis = 'y'
Either ‘x’ or ‘y’.
this.fillBetween = { series1: null, series2: null, color: null, baseSeries: 0, fill: true }
Fill between 2 line series in a plot.
css color spec for filled area.
this.fillColor
CSS color spec to use for fill under line.
this.fillDownBody = true
true to render a “down” day (close price lower than open price) with a filled candlestick body.
this.fillRect = false
true to draw shape as a filled rectangle.
this.fillStyle = '#999999'
css color spec for the fill style.
this.fillToValue = 0
fill a filled series to this value on the fill axis.
this.fillToZero = false
true will force bar and filled series to fill toward zero on the fill Axis.
this.fillUpBody = false
true to render an “up” day (close price greater than open price) with a filled candlestick body.
this.followMouse = false
Tooltip follows the mouse, it is not at a fixed location.
this.fontFamily
css spec for the font-family css attribute.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'
CSS spec for the font-family css attribute.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'
css spec for the font-family css attribute.
this.fontFamily
css font-family spec for the legend text.
this.fontFamily
css font-family spec for the text.
this.fontSize
css spec for the font-size css attribute.
this.fontSize = '11pt'
CSS spec for font size.
this.fontSize = '10pt'
CSS spec for font size.
this.fontSize
css spec for the font-size attribute.
this.fontSize
css font-size spec for the legend text.
this.fontSize
css font-size spec for the text.
this.fontStretch = 1.0
Multiplier to condense or expand font width.
this.fontStretch = 1.0
Multiplier to condense or expand font width.
this.fontWeight = 'normal'
this.fontWeight = 'normal'
CSS spec for fontWeight
this.forceTickAt0 = false
This will ensure that there is always a tick mark at 0.
this.forceTickAt100 = false
This will ensure that there is always a tick mark at 100.
this.formatString = ''
string passed to the formatter.
this.formatString = ''
string passed to the formatter.
this.formatString = null
alternative to tooltipFormatString will format the whole tooltip text, populating with x, y values as indicated by tooltipAxes option.
this.formatString = ''
string passed to the formatter.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
+ + + +
$.jqplot.ThemeEngine.prototype.get = function(name)
Get and return the named theme or the active theme if no name given.
$.jqplot.ThemeEngine.prototype.getThemeNames = function()
Return the list of theme names in this manager in alpha-numerical order.
$.jqplot.ThemeEngine.prototype.getThemes = function()
Return a list of themes in alpha-numerical order by name.
GNU GENERAL PUBLIC LICENSE Version 2, June 1991
this.grid = new Grid()
See Grid for grid specific options.
Object representing the grid on which the plot is drawn.
this.gridLineColor = '#cccccc'
color of the grid lines.
this.gridLineWidth = 1.0
width of the grid lines.
this.groups = 1
group bars into this many groups
+ + + +
this.hideZeros = false
true to not show a label for a value which is 0.
this.highlightAlpha = null
Alpha transparency to apply when highlighting bubble.
this.highlightColor = null
color to use when highlighting an area on a filled plot.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.highlightColors = []
an array of colors to use when highlighting a bar.
this.highlightColors = []
An array of colors to use when highlighting a slice.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.highlightColors = []
array of colors to use when highlighting an area.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a bubble.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a area.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over an area on a filled plot.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseOver = true
True to highlight bubbles when moused over.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseOver = true
True to highlight area when moused over.
this.highlightMouseOver = true
True to highlight area on a filled plot when moused over.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.hlc = false
true if is a hi-low-close chart (no open price).
A straight horizontal line.
this.hubRadius = null
Radius of the hub at the bottom center of gauge which the needle attaches to.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General4.html b/public/site_assets/test/js/dist/docs/index/General4.html new file mode 100644 index 00000000..c1841bc8 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General4.html @@ -0,0 +1,46 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
I
 index, Series
 init, jqPlot
 innerDiameter, $.jqplot.DonutRenderer
 insertBreaks, $.jqplot.BlockRenderer
 intersectionThreshold, $.jqplot.Cursor
 interval, $.jqplot.LineRenderer
 intervalColors, $.jqplot.MeterGaugeRenderer
 intervalInnerRadius, $.jqplot.MeterGaugeRenderer
 intervalOuterRadius, $.jqplot.MeterGaugeRenderer
 intervals, $.jqplot.MeterGaugeRenderer
 Introduction
 isarc
 isMinorTick
J
 jqPlot
 jqPlot Charts
 jqPlot CSS Customization
 jqPlot Options
 jqPlot Pugin Hooks, $.jqplot
 jqPlot Usage
 jqplot.enhancedLegendRenderer.js
 jqplot.pyramidAxisRenderer.js
 jqplot.pyramidRenderer.js
L
 label
 labelHeightAdjust, $.jqplot.MeterGaugeRenderer
 labelOptions, Axis
 labelPosition
 labelRenderer, Axis
 labels
 labelsFromSeries, $.jqplot.PointLabels
 legend, jqPlot
 Legend
 Line
 lineCap
 lineJoin
 linePattern
 lineWidth
 lineWidthAdjust, $.jqplot.Highlighter
 location
 looseZoom, $.jqplot.Cursor
M
 makeGridData
 marginBottom, Legend
 marginLeft, Legend
 marginRight, Legend
 marginTop, Legend
 mark
 markerOptions, Series
 markerRenderer
 markSize
 max
 methods
 Methods, $.jqplot.BlockRenderer
 min
 minorTicks
 MIT License
 moveBlock, $.jqplot.BlockRenderer
 moveSeriesToBack, jqPlot
 moveSeriesToFront, jqPlot
+ +
this.index
0 based index of this series in the plot series array.
this.init = function(target,
data,
options)
sets the plot target, checks data and applies user options to plot.
this.innerDiameter = null
Inner diameter of the donut, auto calculated by default.
this.insertBreaks = true
true to turn spaces in data block label into html breaks br /.
this.intersectionThreshold = 2
pixel distance from data point or marker to consider cursor lines intersecting with point.
interval: '3%' }
User specified interval above and below line for bands [default: ‘3%’’].
this.intervalColors = [ "#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"]
Array of colors to use for the intervals.
this.intervalInnerRadius = null
Radius of the inner circle of the interval ring.
this.intervalOuterRadius = null
Radius of the outer circle of the interval ring.
this.intervals = []
Array of ranges to be drawn around the gauge.
jqPlot requires jQuery (1.4+ required for certain features).
this.isarc = false
whether the shadow is an arc or not.
this.isarc = false
whether the shadow is an arc or not.
this.isMinorTick = false
if this is a minor tick.
this.isMinorTick = false
if this is a minor tick.
+ + + +
Plot object returned by call to $.jqplot.
Pure JavaScript plotting plugin for jQuery.
Much of the styling of jqPlot is done by css.
This document is out of date.
+ + + +
this.label = ''
The text or html for the label.
this.label = ''
label for the axis.
this.label = null
A gauge label like ‘kph’ or ‘Volts’
this.label = ''
Label for the trend line to use in the legend.
this.label = null
Label for the axis
this.label = ''
Line label to use in the legend.
this.labelHeightAdjust = 0
Number of Pixels to offset the label up (-) or down (+) from its default position.
this.labelOptions = {}
Options passed to the label renderer.
this.labelPosition = 'auto'
‘auto’, ‘start’, ‘middle’ or ‘end’.
this.labelPosition = 'inside'
Where to position the label, either ‘inside’ or ‘bottom’.
this.labelRenderer = $.jqplot.AxisLabelRenderer
A class of a rendering engine for creating an axis label.
this.labels = []
array of arrays of labels, one array for each series.
this.labels = []
Array of labels to use.
this.labelsFromSeries = false
true to use labels within data point arrays.
this.legend = new Legend()
see $.jqplot.TableLegendRenderer
Legend object.
A straight line.
Type of ending placed on the line [‘round’, ‘butt’, ‘square’]
this.lineCap = 'round'
how ends of the shadow line are rendered.
this.lineCap = 'round'
how ends of the shadow line are rendered.
this.lineCap = 'round'
Canvas lineCap style at ends of line.
this.lineJoin = 'miter'
How line segments of the shadow are joined.
this.lineJoin = 'miter'
How line segments of the shadow are joined.
this.lineJoin = 'round'
Canvas lineJoin style between segments of series.
this.linePattern = 'solid'
line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
this.linePattern = 'solid'
line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
Width of the line.
this.lineWidth = 2
width of line if areas are stroked and not filled.
this.lineWidth = 2
size of the line for non-filled markers.
this.lineWidth = 1.5
Width of the hi-low line and open/close ticks.
this.lineWidth = 1.5
width of the shadow line stroke.
this.lineWidth = 1.5
Width of the trend line.
this.lineWidth = 2.5
width of the line in pixels.
this.lineWidthAdjust = 2.5
Pixels to add to the lineWidth of the highlight.
this.location = 'n'
compass location where to position the label around the point.
this.location = 'ne'
Placement of the legend.
this.looseZoom = true
Will expand zoom range to provide more rounded tick values.
+ + + +
$.jqplot.BezierCurveRenderer.prototype.makeGridData = function(data,
plot)
converts any arbitrary data values to grid coordinates and returns them.
$.jqplot.MekkoRenderer.prototype.makeGridData = function(data,
plot)
converts any arbitrary data values to grid coordinates and returns them.
this.marginBottom = null
CSS margin for the legend DOM element.
this.marginLeft = null
CSS margin for the legend DOM element.
this.marginRight = null
CSS margin for the legend DOM element.
this.marginTop = null
CSS margin for the legend DOM element.
this.mark = 'outside'
tick mark on the axis.
this.mark = 'outside'
tick mark on the axis.
this.markerOptions = {}
renderer specific options to pass to the markerRenderer, see $.jqplot.MarkerRenderer.
this.markerRenderer = new $.jqplot.MarkerRenderer({shadow:false})
Renderer used to draw the marker of the highlighted point.
this.markerRenderer = {show:false}
Renderer to use to draw markers on the line.
this.markerRenderer = $.jqplot.MarkerRenderer
A class of a renderer which will draw marker (e.g.
this.markSize = 6
Length of the tick marks in pixels.
this.markSize = 4
Length of the tick marks in pixels.
this.max
Maximum value on the gauge.
this.max = null
maximum value of the axis (in data units, not pixels).
this.min
Minimum value on the gauge.
this.min = null
minimum value of the axis (in data units, not pixels).
this.minorTicks = 0
Number of ticks to add between “major” ticks.
this.minorTicks = 'auto'
Number of ticks to add between “major” ticks.
Copyright © 2009-2013 Chris Leonello
this.moveBlock = function (idx,
x,
y,
duration)
Moves an individual block.
this.moveSeriesToBack = function (idx)
This method requires jQuery 1.4+ Moves the specified series canvas behind all other series canvases.
this.moveSeriesToFront = function (idx)
This method requires jQuery 1.4+ Moves the specified series canvas in front of all other series canvases.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General5.html b/public/site_assets/test/js/dist/docs/index/General5.html new file mode 100644 index 00000000..443bb38f --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General5.html @@ -0,0 +1,50 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
N
 name, $.jqplot.CanvasOverlay
 needlePad, $.jqplot.MeterGaugeRenderer
 needleThickness, $.jqplot.MeterGaugeRenderer
 negativeColor, Series
 negativeSeriesColors, jqPlot
 neighborThreshold, Series
 newTheme, $.jqplot.ThemeEngine
 noDataIndicator, jqPlot
 numberColumns
 numberRows
 numberTicks, Axis
O
 objects, $.jqplot.CanvasOverlay
 offset, $.jqplot.shadowRenderer
 offsetBars
 openColor, $.jqplot.OHLCRenderer
 Options Tutorial
 Options Usage
P
 pad, Axis
 padding
 padMax, Axis
 padMin, Axis
 pegNeedle, $.jqplot.MeterGaugeRenderer
 placement, Legend
 position
 postDrawHooks, $.jqplot.$.jqplot
 postDrawSeriesHooks, $.jqplot.$.jqplot
 postDrawSeriesShadowHooks, $.jqplot.$.jqplot
 postInitHooks, $.jqplot.$.jqplot
 postParseOptionsHooks, $.jqplot.$.jqplot
 postParseSeriesOptionsHooks, $.jqplot.$.jqplot
 postSeriesInitHooks, $.jqplot.$.jqplot
 predraw, Legend
 preDrawHooks, $.jqplot.$.jqplot
 preDrawLegendHooks, $.jqplot.$.jqplot
 preDrawSeriesHooks, $.jqplot.$.jqplot
 preDrawSeriesShadowHooks, $.jqplot.$.jqplot
 prefix
 preInitHooks, $.jqplot.$.jqplot
 preParseOptionsHooks, $.jqplot.$.jqplot
 preParseSeriesOptionsHooks, $.jqplot.$.jqplot
 preSeriesInitHooks, $.jqplot.$.jqplot
 Properties
 pt2px
Q
 quickInit, jqPlot
R
 redraw, jqPlot
 reInitialize, jqPlot
 remove, $.jqplot.ThemeEngine
 rename, $.jqplot.ThemeEngine
 renderer
 rendererOptions
 replot, jqPlot
 resetAxesScale, jqPlot
 restoreOriginalSeriesOrder, jqPlot
 restorePreviousSeriesOrder, jqPlot
 ringColor, $.jqplot.MeterGaugeRenderer
 ringMargin, $.jqplot.DonutRenderer
 ringWidth, $.jqplot.MeterGaugeRenderer
 rowSpacing, Legend
+ +
Optional name for the overlay object.
this.needlePad = 6
Padding between needle and inner edge of the ring when the needle is at the min or max gauge value.
this.needleThickness = null
Maximum thickness the needle.
this.negativeColor
css color spec used for filled (area) plots that are filled to zero and the “useNegativeColors” option is true.
this.negativeSeriesColors = $.jqplot.config.defaultNegativeColors
colors to use for portions of the line below zero.
this.neighborThreshold = 4
how close or far (in pixels) the cursor must be from a point marker to detect the point.
$.jqplot.ThemeEngine.prototype.newTheme = function(name,
obj)
Create a new theme based on the default theme, adding it the themeEngine.
this.noDataIndicator = { show: false, indicator: 'Loading Data...', axes: { xaxis: { min: 0, max: 10, tickInterval: 2, show: true }, yaxis: { min: 0, max: 12, tickInterval: 3, show: true } } }
Options to set up a mock plot with a data loading indicator if no data is specified.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberTicks
Desired number of ticks.
+ + + +
this.objects = []
this.offset = 1
Pixel offset at the given shadow angle of each shadow stroke from the last stroke.
this.offsetBars = false
False will center bars on their y value.
this.openColor = null
color of the open price tick mark.
This document will help you understand how jqPlot’s options relate to the API documentation and the jqPlot object itself.
See Options Tutorial
+ + + +
this.pad = 1.2
Padding to extend the range above and below the data bounds.
this.padding = 20
padding between the donut and plot edges, legend, etc.
this.padding = {top: 20, right: 20, bottom: 20, left: 20}
padding between the funnel and plot edges, legend, etc.
this.padding = null
padding between the meterGauge and plot edges, auto calculated by default.
this.padding = 20
padding between the pie and plot edges, legend, etc.
this.padMax = null
Padding to extend the range above data bounds.
this.padMin = null
Padding to extend the range below data bounds.
this.pegNeedle = true
True will stop needle just below/above the min/max values if data is below/above min/max, as if the meter is “pegged”.
this.placement = "insideGrid"
“insideGrid” places legend inside the grid area of the plot.
this.position = null
Position of axis.
called after plot draw.
called after each series is drawn.
called after series shadows are drawn.
called after initialization.
called after user options are parsed.
called after series related options are parsed.
called after series is initialized.
Wether to draw the legend before the series or not.
called before plot draw.
called before the legend is drawn.
called before each series is drawn.
called before series shadows are drawn.
this.prefix = ''
String to prepend to the tick label.
this.prefix = ''
String to prepend to the tick label.
called before initialization.
called before user options are parsed.
called before series related options are parsed.
called before series is initialized.
Properties
Axes options are specified within an axes object at the top level of the plot options like so:
These properties are specified at the top of the options object like so:
Properties will be assigned from a series array at the top level of the options.
this.pt2px = null
Point to pixel scaling factor, used for computing height of bounding box around a label.
this.pt2px = null
Point to pixel scaling factor, used for computing height of bounding box around a label.
+ + + +
this.quickInit = function ()
Quick reinitialization plot for replotting.
+ + + +
this.redraw = function(clear)
Empties the plot target div and redraws the plot.
this.reInitialize = function (data,
opts)
reinitialize plot for replotting.
$.jqplot.ThemeEngine.prototype.remove = function(name)
Remove the given theme from the themeEngine.
$.jqplot.ThemeEngine.prototype.rename = function (oldName,
newName)
Rename a theme.
this.renderer = new $.jqplot.LineRenderer()
Renderer to use to draw the trend line.
this.renderer = $.jqplot.LinearAxisRenderer
A class of a rendering engine that handles tick generation, scaling input data to pixel grid units and drawing the axis element.
this.renderer = $.jqplot.CanvasGridRenderer
Instance of a renderer which will actually render the grid, see $.jqplot.CanvasGridRenderer.
this.renderer = $.jqplot.LineRenderer
A class of a renderer which will draw the series, see $.jqplot.LineRenderer.
this.renderer = $.jqplot.DivTitleRenderer
A class for creating a DOM element for the title, see $.jqplot.DivTitleRenderer.
this.rendererOptions = {marker:{show:false}}
Options to pass to the line renderer.
this.rendererOptions = {}
renderer specific options.
this.rendererOptions = {}
Options to pass on to the renderer, see $.jqplot.CanvasGridRenderer.
this.rendererOptions = {}
renderer specific options passed to the renderer.
this.rendererOptions = {}
Options to pass on to the renderer.
this.rendererOptions = {}
renderer specific options passed to the renderer.
this.replot = function(options)
Does a reinitialization of the plot followed by a redraw.
this.resetAxesScale = function(axes,
options)
Reset the specified axes min, max, numberTicks and tickInterval properties to null or reset these properties on all axes if no list of axes is provided.
this.restoreOriginalSeriesOrder = function ()
This method requires jQuery 1.4+ Restore the series canvas order to its original order when the plot was created.
this.restorePreviousSeriesOrder = function ()
This method requires jQuery 1.4+ Restore the series canvas order to its previous state.
this.ringColor = "#BBC6D0"
color of the outer ring, hub, and needle of the gauge.
this.ringMargin = null
pixel distance between rings, or multiple series in a donut plot.
this.ringWidth = null
width of the ring around the gauge.
this.rowSpacing = '0.5em'
css padding-top spec for the rows in the legend.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General6.html b/public/site_assets/test/js/dist/docs/index/General6.html new file mode 100644 index 00000000..de6ae15e --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General6.html @@ -0,0 +1,34 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
S
 scaleToHiddenSeries, Axis
 sectionMargin, $.jqplot.FunnelRenderer
 series, jqPlot
 Series
 seriesColors, jqPlot
 seriesDefaults, jqPlot
 seriesLabelIndex, $.jqplot.PointLabels
 seriesToggle
 seriesToggleReplot
 setGridData
 shadow
 shadowAlpha
 shadowAngle
 shadowColor, Grid
 shadowDepth
 shadowOffset
 shadowRenderer, $.jqplot.MarkerRenderer
 shadowWidth, Grid
 shapeRenderer, $.jqplot.MarkerRenderer
 show
 showBorders, $.jqplot.MekkoRenderer
 showCursorLegend, $.jqplot.Cursor
 showDataLabels
 showGridline
 showHorizontalLine, $.jqplot.Cursor
 showLabel
 showLabels
 showLine, Series
 showLines, $.jqplot.LineRenderer
 showMark
 showMarker
 showMinorTicks, Axis
 showSwatch, Legend
 showTickLabels, $.jqplot.MeterGaugeRenderer
 showTickMarks, Axis
 showTicks
 showTooltip
 showTooltipDataPosition, $.jqplot.Cursor
 showTooltipGridPosition, $.jqplot.Cursor
 showTooltipOutsideZoom, $.jqplot.Cursor
 showTooltipPrecision, $.jqplot.CanvasOverlay
 showTooltipUnitPosition, $.jqplot.Cursor
 showVerticalLine, $.jqplot.Cursor
 size
 sizeAdjust, $.jqplot.Highlighter
 sliceMargin
 smooth, $.jqplot.LineRenderer
 sortData, jqPlot
 sortMergedLabels, $.jqplot.CategoryAxisRenderer
 stackedValue, $.jqplot.PointLabels
 stackSeries, jqPlot
 start, Line
 startAngle
 stop, Line
 strokeRect, $.jqplot.shapeRenderer
 strokeStyle, $.jqplot.shapeRenderer
 style
 suffix, $.jqplot.AxisTickRenderer
 synchronizeHighlight
 syncTicks, Axis
+ +
this.scaleToHiddenSeries = false
True to include hidden series when computing axes bounds and scaling.
this.sectionMargin = 6
spacing between funnel sections in pixels.
this.series = []
Array of series object options.
An individual data series object.
this.seriesColors = $.jqplot.config.defaultColors
Ann array of CSS color specifications that will be applied, in order, to the series in the plot.
seriesDefaults: {}, series:[] }
default options that will be applied to all series.
this.seriesLabelIndex = null
array index for location of labels within data point arrays.
this.seriesToggle = 'normal'
false to not enable series on/off toggling on the legend.
this.seriesToggleReplot = false
True to replot the chart after toggling series on/off.
$.jqplot.BezierCurveRenderer.prototype.setGridData = function(plot)
converts the user data values to grid coordinates and stores them in the gridData array.
$.jqplot.MekkoRenderer.prototype.setGridData = function(plot)
converts the user data values to grid coordinates and stores them in the gridData array.
whether or not to draw a shadow on the line
this.shadow = true
whether or not to draw a shadow on the line
this.shadow = true
true or false, whether or not to show the shadow.
this.shadow = true
whether to show a shadow behind the grid.
this.shadowAlpha = 0.08
transparency of the shadow (0 = transparent, 1 = opaque)
Alpha channel transparency of shadow.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = '0.07'
Alpha channel transparency of shadow.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07
Alpha transparency of the shadow.
this.shadowAlpha = '0.07'
Alpha channel transparency of shadow.
this.shadowAlpha = '0.1'
Alpha channel transparency of shadow.
Shadow angle in degrees
this.shadowAngle = 45
Shadow angle in degrees
this.shadowAngle = 45
Angle of the shadow on the trend line.
this.shadowAngle = 45
shadow angle in degrees
this.shadowAngle = 45
Shadow angle in degrees
this.shadowColor = null
an optional css color spec for the shadow in ‘rgba(n, n, n, n)’ form
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowDepth = 4
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 3
number of strokes to make of the shadow.
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
Shadow offset from line in pixels
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 2
offset of the shadow from the area and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 1
Shadow offset from line in pixels
this.shadowOffset = 2
offset of the shadow from the gauge ring and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 1.0
pixel offset for each stroke of the shadow.
this.shadowOffset = 1.5
Offset of each shadow stroke from the border in pixels
this.shadowOffset = 1.25
Shadow offset from line in pixels
this.shadowRenderer = new $.jqplot.ShadowRenderer()
Renderer that will draws the shadows on the marker.
this.shadowWidth = 3
width of the stoke for the shadow
this.shapeRenderer = new $.jqplot.ShapeRenderer()
Renderer that will draw the marker.
this.show = true
whether or not to show the tick (mark and label).
this.show = true
whether or not to show the tick (mark and label).
this.show = true
whether or not to show the tick (mark and label).
this.show = true
whether or not to show the tick (mark and label).
true to show (draw), false to not draw.
this.show = $.jqplot.config.enablePlugins
whether to show the cursor or not.
this.show = $.jqplot.config.enablePlugins
true to show the highlight.
true to show the bands.
this.show = true
whether or not to show the marker.
this.show = $.jqplot.config.enablePlugins
show the labels or not.
this.show = $.jqplot.config.enablePlugins
Wether or not to show the trend line.
this.show = false
Wether to display the axis on the graph.
this.show = false
Wether to display the legend on the graph.
this.show = true
whether or not to draw the series.
this.show = true
whether or not to show the title
this.showBorders = true
True to draw borders lines between areas on the chart.
this.showCursorLegend = false
Replace the plot legend with an enhanced legend displaying intersection information.
this.showDataLabels = false
true to show data labels on slices.
this.showDataLabels = false
true to show data labels on slices.
this.showDataLabels = false
true to show data labels on slices.
this.showGridline = true
whether or not to draw the gridline on the grid at this tick.
this.showGridline = true
whether or not to draw the gridline on the grid at this tick.
this.showHorizontalLine = false
draw a horizontal line across the plot which follows the cursor.
this.showLabel = true
whether or not to show the label.
this.showLabel = true
whether or not to show the label.
this.showLabel = true
whether or not to show the label.
this.showLabel = true
true to show the axis label.
this.showLabel = true
true to show label for this series in the legend.
this.showLabels = true
True to show labels on bubbles (if any), false to not show.
this.showLabels = true
true to show the label text on the legend.
this.showLine = true
whether to actually draw the line or not.
True to show lines at top and bottom of bands [default: false].
this.showMark = true
whether or not to show the mark on the axis.
this.showMark = true
whether or not to show the mark on the axis.
this.showMarker = true
true to show the marker
this.showMarker = true
whether or not to show the markers at the data points.
this.showMinorTicks = true
Wether or not to show minor ticks.
this.showSwatches = true
true to show the color swatches on the legend.
this.showTickLabels = true
true to show tick labels next to ticks.
this.showTickMarks = true
Wether to show the tick marks (line crossing grid) or not.
this.showTicks = true
true to show ticks around gauge.
this.showTicks = true
Wether to show the ticks (both marks and labels) or not.
Show a tooltip with data point values.
this.showTooltip = true
show a cursor position tooltip.
this.showTooltip = true
Show a tooltip with data point values.
this.showTooltipDataPosition = false
Used with showVerticalLine to show intersecting data points in the tooltip.
this.showTooltipGridPosition = false
show the grid pixel coordinates of the mouse.
this.showTooltipOutsideZoom = false
True will keep updating the tooltip when zooming of the grid.
Controls how close to line cursor must be to show tooltip.
this.showTooltipUnitPosition = true
show the unit (data) coordinates of the mouse.
this.showVerticalLine = false
draw a vertical line across the plot which follows the cursor.
this.size = 4
Length of the tick beyond the grid in pixels.
this.size = 9.0
Size of the marker (diameter or circle, length of edge of square, etc.)
this.sizeAdjust = 5
Pixels to add to the overall size of the highlight.
this.sliceMargin = 0
angular spacing between donut slices in degrees.
this.sliceMargin = 0
angular spacing between pie slices in degrees.
this.renderer.smooth = false
True to draw a smoothed (interpolated) line through the data points with automatically computed number of smoothing points.
this.sortData = true
false to not sort the data passed in by the user.
this.sortMergedLabels = false
True to sort tick labels when labels are created by merging x axis values from multiple series.
this.stackedValue = false
true to display value as stacked in a stacked plot.
this.stackSeries = false
true or false, creates a stack or “mountain” plot.
[x, y] coordinates for the start of the line.
this.startAngle = 0
Angle to start drawing donut in degrees.
this.startAngle = 0
Angle to start drawing pie in degrees.
stop: [] }
[x, y] coordinates for the end of the line.
this.strokeRect = false
true to draw shape as a stroked rectangle.
this.strokeStyle = '#999999'
css color spec for the stoke style
this.style = 'crosshair'
CSS spec for cursor style
this.style = 'filledCircle'
One of diamond, circle, square, x, plus, dash, filledDiamond, filledCircle, filledSquare
this.suffix = ''
String to append to the tick label.
this.synchronizeHighlight = false
Index of another series to highlight when this series is highlighted.
this.syncTicks = null
true to try and synchronize tick spacing across multiple axes so that ticks and grid lines line up.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/General7.html b/public/site_assets/test/js/dist/docs/index/General7.html new file mode 100644 index 00000000..606365df --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/General7.html @@ -0,0 +1,58 @@ + + +Index + + + + + + + + + +
Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
T
 text, Title
 textAlign, Title
 textColor
 themes, $.jqplot.ThemeEngine
 thickness, $.jqplot.DonutRenderer
 tickColor, $.jqplot.MeterGaugeRenderer
 tickInset
 tickInterval, Axis
 tickLength, $.jqplot.OHLCRenderer
 tickMode, $.jqplot.MekkoAxisRenderer
 tickOptions, Axis
 tickPadding, $.jqplot.MeterGaugeRenderer
 tickRenderer
 ticks
 tickSpacing
 title, jqPlot
 Title
 tooltipAxes, $.jqplot.Highlighter
 tooltipAxisGroups, $.jqplot.Cursor
 tooltipFadeSpeed
 tooltipFormatString
 tooltipLocation
 tooltipOffset
 transposedData, $.jqplot.BarRenderer
 type, $.jqplot.Trendline
U
 upBodyColor, $.jqplot.OHLCRenderer
 Usage
 useAxesFormatters
 useNegativeColors, Series
 useSeriesColor, Axis
V
 varyBarColor, $.jqplot.BarRenderer
 varyBlockColors, $.jqplot.BlockRenderer
 varyBubbleColors, $.jqplot.BubbleRenderer
 Version
 VerticalLine
W
 waterfall, $.jqplot.BarRenderer
 wickColor, $.jqplot.OHLCRenderer
 widthRatio, $.jqplot.FunnelRenderer
X
 xaxis
 xmax
 xmin
 xoffset, Legend
 xpadding, $.jqplot.PointLabels
Y
 y, HorizontalLine
 yaxis
 yoffset, Legend
 ypadding, $.jqplot.PointLabels
 yvalues, $.jqplot.Highlighter
Z
 zoom, $.jqplot.Cursor
 zoomProxy, $.jqplot.Cursor.$.jqplot.Cursor
+ +
this.text = text
text of the title;
this.textAlign
css text-align spec for the text.
this.textColor
css spec for the color attribute.
this.textColor = '#666666'
css spec for the color attribute.
this.textColor = '#666666'
css spec for the color attribute.
this.textColor
css color spec for the legend text.
this.textColor
css color spec for the text.
this.themes = {}
hash of themes managed by the theme engine.
this.thickness = null
thickness of the donut, auto computed by default Overridden by if innerDiameter is specified.
this.tickColor = "#989898"
color of the tick marks around the gauge.
this.tickInset = 0
Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
this.tickInset = 0
Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
this.tickInterval
number of units between ticks.
this.tickLength = 'auto'
length of the line in pixels indicating open and close price.
this.tickMode
How to space the ticks on the axis.
this.tickOptions = {}
Options that will be passed to the tickRenderer, see $.jqplot.AxisTickRenderer options.
this.tickPadding = null
padding of the tick marks to the outer ring and the tick labels to marks.
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
this.tickRenderer = $.jqplot.AxisTickRenderer
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
this.ticks = []
Array of tick values.
this.ticks = []
1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis.
this.tickSpacing = 30
Degrees between ticks.
this.tickSpacing = 75
Approximate pixel spacing between ticks on graph.
this.title = new Title()
Title object.
Plot Title object.
this.tooltipAxes = 'both'
Which axes to display in tooltip, ‘x’, ‘y’ or ‘both’, ‘xy’ or ‘yx’ ‘both’ and ‘xy’ are equivalent, ‘yx’ reverses order of labels.
this.tooltipAxisGroups = []
Show position for the specified axes.
‘slow’, ‘def’, ‘fast’, or number of milliseconds.
this.tooltipFadeSpeed = "fast"
‘slow’, ‘def’, ‘fast’, or number of milliseconds.
tooltipFormatString: '%d, %d' }
Format string passed the x and y values of the cursor on the line.
this.tooltipFormatString = '%.4P, %.4P'
sprintf format string for the tooltip.
this.tooltipFormatString = '%.5P'
sprintf format string for the tooltip.
Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
this.tooltipLocation = 'se'
Where to position tooltip.
this.tooltipLocation = 'nw'
Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
Pixel offset of tooltip from the highlight.
this.tooltipOffset = 6
Pixel offset of tooltip from the grid boudaries or cursor center.
this.tooltipOffset = 2
Pixel offset of tooltip from the highlight.
this.transposedData = true
NOT IMPLEMENTED YET.
this.type = 'linear'
Either ‘exponential’, ‘exp’, or ‘linear’.
+ + + +
this.upBodyColor = null
Color of candlestick body of an “up” day.
See jqPlot Usage
this.useAxesFormatters = true
Use the x and y axes formatters to format the text in the tooltip.
this.useAxesFormatters = true
Use the x and y axes formatters to format the text in the tooltip.
this.useNegativeColors = true
true to color negative values differently in filled and bar charts.
this.useSeriesColor = false
Use the color of the first series associated with this axis for the tick marks and line bordering this axis.
+ + + +
this.varyBarColor = false
true to color each bar of a series separately rather than have every bar of a given series the same color.
this.varyBlockColors = false
true to vary the color of each block in this series according to the seriesColors array.
this.varyBubbleColors = true
True to vary the color of each bubble in this series according to the seriesColors array.
version: 1.0.8 revision: 1250
A straight vertical line.
+ + + +
this.waterfall = false
true to enable waterfall plot.
this.wickColor = null
color of the hi-lo line thorugh the candlestick body.
this.widthRatio = 0.2
The ratio of the width of the top of the funnel to the bottom.
+ + + +
X axis to use for positioning/scaling the line.
this.xaxis = 'xaxis'
which x axis to use with this series, either ‘xaxis’ or ‘x2axis’.
x value for the end of the line, null to scale to axis max.
x value for the end of the line, null to scale to axis max.
x value for the start of the line, null to scale to axis min.
x value for the start of the line, null to scale to axis min.
this.xoffset = 0
DEPRECATED.
this.xpadding = 6
horizontal padding in pixels between point and label
+ + + +
y value to position the line
Y axis to use for positioning/scaling the line.
this.yaxis = 'yaxis'
which y axis to use with this series, either ‘yaxis’ or ‘y2axis’.
this.yoffset = 0
DEPRECATED.
this.ypadding = 6
vertical padding in pixels between point and label
this.yvalues = 1
Number of y values to expect in the data point array.
+ + + +
this.zoom = false
Enable plot zooming.
$.jqplot.Cursor.zoomProxy = function(targetPlot,
controllerPlot)
links targetPlot to controllerPlot so that plot zooming of targetPlot will be controlled by zooming on the controllerPlot.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Hooks.html b/public/site_assets/test/js/dist/docs/index/Hooks.html new file mode 100644 index 00000000..704ea7e1 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Hooks.html @@ -0,0 +1,46 @@ + + +Hook Index + + + + + + + + + +
Hook Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
A
 addLegendRowHooks, $.jqplot.$.jqplot
E
 eventListenerHooks, $.jqplot.$.jqplot
J
 jqPlot Pugin Hooks, $.jqplot
P
 postDrawHooks, $.jqplot.$.jqplot
 postDrawSeriesHooks, $.jqplot.$.jqplot
 postDrawSeriesShadowHooks, $.jqplot.$.jqplot
 postInitHooks, $.jqplot.$.jqplot
 postParseOptionsHooks, $.jqplot.$.jqplot
 postParseSeriesOptionsHooks, $.jqplot.$.jqplot
 postSeriesInitHooks, $.jqplot.$.jqplot
 preDrawHooks, $.jqplot.$.jqplot
 preDrawLegendHooks, $.jqplot.$.jqplot
 preDrawSeriesHooks, $.jqplot.$.jqplot
 preDrawSeriesShadowHooks, $.jqplot.$.jqplot
 preInitHooks, $.jqplot.$.jqplot
 preParseOptionsHooks, $.jqplot.$.jqplot
 preParseSeriesOptionsHooks, $.jqplot.$.jqplot
 preSeriesInitHooks, $.jqplot.$.jqplot
+ +
called at the end of legend draw, so plugins can add rows to the legend table.
+ + + +
called at the end of plot drawing, binds listeners to the event canvas which lays on top of the grid area.
+ + + + + + + +
called after plot draw.
called after each series is drawn.
called after series shadows are drawn.
called after initialization.
called after user options are parsed.
called after series related options are parsed.
called after series is initialized.
called before plot draw.
called before the legend is drawn.
called before each series is drawn.
called before series shadows are drawn.
called before initialization.
called before user options are parsed.
called before series related options are parsed.
called before series is initialized.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Properties.html b/public/site_assets/test/js/dist/docs/index/Properties.html new file mode 100644 index 00000000..61a7286f --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Properties.html @@ -0,0 +1,42 @@ + + +Property Index + + + + + + + + + +
Property Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
A
 activeTheme, $.jqplot.ThemeEngine
 alignTicks, $.jqplot.LinearAxisRenderer
 alpha, $.jqplot.shadowRenderer
 angle
 animate, jqPlot
 animateReplot, jqPlot
 autoscale, Axis
 autoscaleBubbles, $.jqplot.BubbleRenderer
 autoscaleMultiplier, $.jqplot.BubbleRenderer
 autoscalePointsFactor, $.jqplot.BubbleRenderer
 axes, jqPlot
 axesDefaults, jqPlot
 axisDefaults, $.jqplot.LogAxisRenderer
B
 background
 bandData, $.jqplot.LineRenderer
 barDirection, $.jqplot.BarRenderer
 barLabelOptions, $.jqplot.MekkoAxisRenderer
 barLabelRenderer, $.jqplot.MekkoAxisRenderer
 barLabels, $.jqplot.MekkoAxisRenderer
 barMargin, $.jqplot.BarRenderer
 barPadding
 barWidth, $.jqplot.BarRenderer
 baselineColor
 baselineWidth
 bodyWidth, $.jqplot.OHLCRenderer
 border, Legend
 borderColor
 borderWidth
 breakOnNull, Series
 breakPoints, $.jqplot.LinearAxisRenderer
 breakTickLabel, $.jqplot.LinearAxisRenderer
 bringSeriesToFront, $.jqplot.Highlighter
 bubbleAlpha, $.jqplot.BubbleRenderer
 bubbleGradients, $.jqplot.BubbleRenderer
C
 candleStick, $.jqplot.OHLCRenderer
 clearRect, $.jqplot.shapeRenderer
 clickReset, $.jqplot.Cursor
 closeColor, $.jqplot.OHLCRenderer
 color
 constrainOutsideZoom, $.jqplot.Cursor
 constrainSmoothing, $.jqplot.LineRenderer
 constrainTo, $.jqplot.Dragable
 constrainZoomTo, $.jqplot.Cursor
 css, $.jqplot.BlockRenderer
 cursorLegendFormatString, $.jqplot.Cursor
+ +
this.activeTheme=null
Pointer to currently active theme
this.alignTicks = false
true to align tick marks across opposed axes such as from the y2axis to yaxis.
this.alpha = 0.07
alpha transparency of shadow stroke.
this.angle = 0
angle of text, measured clockwise from x axis.
this.angle = 0
angle of text, measured clockwise from x axis.
this.angle = 45
Angle of the shadow in degrees.
this.animate = false
True to animate the series on initial plot draw (renderer dependent).
this.animateReplot = false
True to animate series after a call to the replot() method.
this.autoscale = false
DEPRECATED the default scaling algorithm produces superior results.
this.autoscaleBubbles = true
True to scale the bubble radius based on plot size.
this.autoscaleMultiplier = 1.0
Multiplier the bubble size if autoscaleBubbles is true.
this.autoscalePointsFactor = -0.07
Factor which decreases bubble size based on how many bubbles on on the chart.
this.axes = {xaxis: new Axis('xaxis'), yaxis: new Axis('yaxis'), x2axis: new Axis('x2axis'), y2axis: new Axis('y2axis'), y3axis: new Axis('y3axis'), y4axis: new Axis('y4axis'), y5axis: new Axis('y5axis'), y6axis: new Axis('y6axis'), y7axis: new Axis('y7axis'), y8axis: new Axis('y8axis'), y9axis: new Axis('y9axis'), yMidAxis: new Axis('yMidAxis')}
up to 4 axes are supported, each with its own options, See Axis for axis specific options.
default options that will be applied to all axes.
Default properties which will be applied directly to the series.
+ + + +
this.background = "#efefef"
background color of the inside of the gauge.
this.background = '#fffdf6'
css spec for the background color.
this.background
css spec for the background of the legend box.
this.renderer.bandData = []
Data used to draw error bands or confidence intervals above/below a line.
this.barDirection = 'vertical'
‘vertical’ = up and down bars, ‘horizontal’ = side to side bars
this.barLabelOptions = {}
options object to pass to the bar label renderer.
this.barLabelRenderer = $.jqplot.AxisLabelRenderer
renderer to use to draw labels under each bar.
this.barLabels = this.barLabels || []
array of labels to put under each bar.
this.barMargin = 10
Number of pixels between groups of bars at adjacent axis values.
this.barPadding = 10
this.barPadding = 8
Number of pixels between adjacent bars at the same axis value.
this.barWidth = null
Width of the bar in pixels (auto by devaul).
this.baselineColor = null
CSS color spec for the baseline.
this.baselineColor = null
CSS color spec for the baseline.
this.baselineColor = null
CSS color spec for the baseline.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineWidth = null
width of the baseline in pixels.
this.baselineWidth = null
width of the baseline in pixels.
this.bodyWidth = 'auto'
width of the candlestick body in pixels.
this.border
css spec for the border around the legend box.
this.borderColor = null
color of the borders between areas on the chart
this.borderColor = null
color of the border adjacent to the axis.
this.borderColor = '#999999'
css spec for the color of the grid border.
this.borderWidth = null
width of line stroked at the border of the axis.
this.borderWidth = 2.0
width of the border in pixels.
this.breakOnNull = false
Wether line segments should be be broken at null value.
this.breakPoints = null
EXPERIMENTAL!! 
this.breakTickLabel = "&asymp
Label to use at the axis break if breakPoints are specified.
this.bringSeriesToFront = false
This option requires jQuery 1.4+ True to bring the series of the highlighted point to the front of other series.
this.bubbleAlpha = 1.0
Alpha transparency to apply to all bubbles in this series.
this.bubbleGradients = false
True to color the bubbles with gradient fills instead of flat colors.
+ + + +
this.candleStick = false
true to render chart as candleStick.
this.clearRect = false
true to cear a rectangle.
this.clickReset = false
Will reset plot zoom if single click on plot without drag.
this.closeColor = null
color of the close price tick mark.
color of the line
this.color
CSS color spec for the dragged point (and adjacent line segment or bar).
color of lines at top and bottom of bands [default: series color].
this.color = '#666666'
color of marker.
this.color = '#666666'
CSS color spec for the trend line.
this.color
css color spec for the series
this.constrainOutsideZoom = true
True to limit actual zoom area to edges of grid, even when zooming outside of plot area.
this.renderer.constrainSmoothing = true
True to use a more accurate smoothing algorithm that will not overshoot any data points.
this.constrainTo = 'none'
Constrain dragging motion to an axis or to none.
this.constrainZoomTo = 'none'
‘none’, ‘x’ or ‘y’
this.css = {padding:'2px', border:'1px solid #999', textAlign:'center'}
default css styles that will be applied to all data blocks.
this.cursorLegendFormatString = $.jqplot.Cursor.cursorLegendFormatString
Format string used in the cursor legend.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Properties2.html b/public/site_assets/test/js/dist/docs/index/Properties2.html new file mode 100644 index 00000000..1efa8561 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Properties2.html @@ -0,0 +1,42 @@ + + +Property Index + + + + + + + + + +
Property Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
D
 dashPattern
 data, jqPlot
 dataLabelCenterOn, $.jqplot.PieRenderer
 dataLabelFormatString
 dataLabelNudge
 dataLabelPositionFactor
 dataLabels
 dataLabelThreshold
 dataRenderer, jqPlot
 dataRendererOptions, jqPlot
 dblClickReset, $.jqplot.Cursor
 defaultAxisStart, jqPlot
 depth, $.jqplot.shadowRenderer
 diameter
 disableIEFading
 disableStack, Series
 downBodyColor, $.jqplot.OHLCRenderer
 drawBaseline
 drawBorder, Grid
 drawGridlines, Grid
 drawMajorGridlines, Axis
 drawMajorTickMarks, Axis
 drawMinorGridlines, Axis
 drawMinorTickMarks, Axis
E
 edgeTolerance, $.jqplot.PointLabels
 enableFontSupport
 escapeHtml
 escapeHTML
F
 fadeTooltip
 fill
 fillAlpha, Series
 fillAndStroke, Series
 fillAxis, Series
 fillBetween, jqPlot
 fillColor
 fillDownBody, $.jqplot.OHLCRenderer
 fillRect, $.jqplot.shapeRenderer
 fillStyle, $.jqplot.shapeRenderer
 fillToValue, Series
 fillToZero, Series
 fillUpBody, $.jqplot.OHLCRenderer
 followMouse, $.jqplot.Cursor
 fontFamily
 fontSize
 fontStretch
 fontWeight
 forceTickAt0, $.jqplot.LinearAxisRenderer
 forceTickAt100, $.jqplot.LinearAxisRenderer
 formatString
 formatter
+ +
dashPattern: [8,8] }
Array of line, space settings in pixels.
dashPattern: [8,8] }
Array of line, space settings in pixels.
this.data = []
user’s data.
this.dataLabelCenterOn = true
True to center the data label at its position.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelFormatString = null
Format string for data labels.
this.dataLabelNudge = 0
Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelNudge = 2
Number of pixels to slide the label away from (+) or toward (-) the center of the pie.
this.dataLabelPositionFactor = 0.4
A Multiplier (0-1) of the pie radius which controls position of label on slice.
this.dataLabelPositionFactor = 0.52
A Multiplier (0-1) of the pie radius which controls position of label on slice.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.dataLabels = 'percent'
Either ‘label’, ‘value’, ‘percent’ or an array of labels to place on the pie slices.
this.dataLabelThreshold = 3
this.dataLabelThreshold = 3
this.dataLabelThreshold = 3
Threshhold in percentage (0-100) of pie area, below which no label will be displayed.
this.dataRenderer
A callable which can be used to preprocess data passed into the plot.
this.dataRendererOptions
Options that will be passed to the dataRenderer.
this.dblClickReset = true
Will reset plot zoom if double click on plot without drag.
this.defaultAxisStart = 1
1-D data series are internally converted into 2-D [x,y] data point arrays by jqPlot.
this.depth = 3
how many times the shadow is stroked.
this.diameter = null
Outer diameter of the donut, auto computed by default
this.diameter = null
Outer diameter of the meterGauge, auto computed by default
this.diameter = null
Outer diameter of the pie, auto computed by default
this.disableIEFading = true
true to toggle series with a show/hide method only and not allow fading in/out.
this.disableStack = false
true to not stack this series with other series in the plot.
this.downBodyColor = null
Color of candlestick body on a “down” day.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBaseline = true
True to draw the axis baseline.
this.drawBorder = true
True to draw border around grid.
this.drawGridlines = true
whether to draw the gridlines on the plot.
this.drawMajorGridlines = true
True to draw gridlines for major axis ticks.
this.drawMajorTickMarks = true
True to draw tick marks for major axis ticks.
this.drawMinorGridlines = false
True to draw gridlines for minor ticks.
this.drawMinorTickMarks = true
True to draw tick marks for minor ticks.
+ + + +
this.edgeTolerance = -5
Number of pixels that the label must be away from an axis boundary in order to be drawn.
this.enableFontSupport = true
true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
this.enableFontSupport = true
true to turn on native canvas font support in Mozilla 3.5+ and Safari 4+.
this.escapeHtml = false
true to escape html in the box label.
this.escapeHtml = true
True to escape html in bubble label text.
this.escapeHtml = false
True to escape special characters with their html entity equivalents in legend text.
this.escapeHtml = false
True to escape special characters with their html entity equivalents in title text.
this.escapeHTML = false
true to escape HTML entities in the label.
this.escapeHTML = false
true to escape HTML entities in the label.
this.escapeHTML = true
true to escape html entities in the labels.
+ + + +
true = fade in/out tooltip, flase = show/hide tooltip
this.fadeTooltip = true
true = fade in/out tooltip, flase = show/hide tooltip
this.fill = true
True to fill the bars.
this.fill = true
true or false, whether to fil the slices.
this.fill = true
true or false, whether to fill the areas.
True to fill area between bands [default: true].
this.fill = true
true or false, whether to fil the slices.
this.fill = false
whether to fill the shape.
this.fill = false
whether to fill the shape.
this.fill = false
true or false, whether to fill under lines or in bars.
this.fillAlpha
Alpha transparency to apply to the fill under the line.
this.fillAndStroke = false
If true will stroke the line (with color this.color) as well as fill under it.
this.fillAxis = 'y'
Either ‘x’ or ‘y’.
this.fillBetween = { series1: null, series2: null, color: null, baseSeries: 0, fill: true }
Fill between 2 line series in a plot.
css color spec for filled area.
this.fillColor
CSS color spec to use for fill under line.
this.fillDownBody = true
true to render a “down” day (close price lower than open price) with a filled candlestick body.
this.fillRect = false
true to draw shape as a filled rectangle.
this.fillStyle = '#999999'
css color spec for the fill style.
this.fillToValue = 0
fill a filled series to this value on the fill axis.
this.fillToZero = false
true will force bar and filled series to fill toward zero on the fill Axis.
this.fillUpBody = false
true to render an “up” day (close price greater than open price) with a filled candlestick body.
this.followMouse = false
Tooltip follows the mouse, it is not at a fixed location.
this.fontFamily
css spec for the font-family css attribute.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'
CSS spec for the font-family css attribute.
this.fontFamily = '"Trebuchet MS", Arial, Helvetica, sans-serif'
css spec for the font-family css attribute.
this.fontFamily
css font-family spec for the legend text.
this.fontFamily
css font-family spec for the text.
this.fontSize
css spec for the font-size css attribute.
this.fontSize = '11pt'
CSS spec for font size.
this.fontSize = '10pt'
CSS spec for font size.
this.fontSize
css spec for the font-size attribute.
this.fontSize
css font-size spec for the legend text.
this.fontSize
css font-size spec for the text.
this.fontStretch = 1.0
Multiplier to condense or expand font width.
this.fontStretch = 1.0
Multiplier to condense or expand font width.
this.fontWeight = 'normal'
this.fontWeight = 'normal'
CSS spec for fontWeight
this.forceTickAt0 = false
This will ensure that there is always a tick mark at 0.
this.forceTickAt100 = false
This will ensure that there is always a tick mark at 100.
this.formatString = ''
string passed to the formatter.
this.formatString = ''
string passed to the formatter.
this.formatString = null
alternative to tooltipFormatString will format the whole tooltip text, populating with x, y values as indicated by tooltipAxes option.
this.formatString = ''
string passed to the formatter.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
this.formatter = $.jqplot.DefaultTickFormatter
A class of a formatter for the tick text.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Properties3.html b/public/site_assets/test/js/dist/docs/index/Properties3.html new file mode 100644 index 00000000..e650f9a9 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Properties3.html @@ -0,0 +1,46 @@ + + +Property Index + + + + + + + + + +
Property Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
G
 grid, jqPlot
 gridLineColor, Grid
 gridLineWidth, Grid
 groups, $.jqplot.BarRenderer
H
 hideZeros, $.jqplot.PointLabels
 highlightAlpha, $.jqplot.BubbleRenderer
 highlightColor, $.jqplot.LineRenderer
 highlightColors
 highlightMouseDown
 highlightMouseOver
 hlc, $.jqplot.OHLCRenderer
 hubRadius, $.jqplot.MeterGaugeRenderer
I
 index, Series
 innerDiameter, $.jqplot.DonutRenderer
 insertBreaks, $.jqplot.BlockRenderer
 intersectionThreshold, $.jqplot.Cursor
 interval, $.jqplot.LineRenderer
 intervalColors, $.jqplot.MeterGaugeRenderer
 intervalInnerRadius, $.jqplot.MeterGaugeRenderer
 intervalOuterRadius, $.jqplot.MeterGaugeRenderer
 intervals, $.jqplot.MeterGaugeRenderer
 isarc
 isMinorTick
L
 label
 labelHeightAdjust, $.jqplot.MeterGaugeRenderer
 labelOptions, Axis
 labelPosition
 labelRenderer, Axis
 labels
 labelsFromSeries, $.jqplot.PointLabels
 legend, jqPlot
 lineCap
 lineJoin
 linePattern
 lineWidth
 lineWidthAdjust, $.jqplot.Highlighter
 location
 looseZoom, $.jqplot.Cursor
+ +
this.grid = new Grid()
See Grid for grid specific options.
this.gridLineColor = '#cccccc'
color of the grid lines.
this.gridLineWidth = 1.0
width of the grid lines.
this.groups = 1
group bars into this many groups
+ + + +
this.hideZeros = false
true to not show a label for a value which is 0.
this.highlightAlpha = null
Alpha transparency to apply when highlighting bubble.
this.highlightColor = null
color to use when highlighting an area on a filled plot.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.highlightColors = []
an array of colors to use when highlighting a bar.
this.highlightColors = []
An array of colors to use when highlighting a slice.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.highlightColors = []
array of colors to use when highlighting an area.
this.highlightColors = []
an array of colors to use when highlighting a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a bubble.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a area.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over an area on a filled plot.
this.highlightMouseDown = false
True to highlight when a mouse button is pressed over a slice.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseOver = true
True to highlight bubbles when moused over.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.highlightMouseOver = true
True to highlight area when moused over.
this.highlightMouseOver = true
True to highlight area on a filled plot when moused over.
this.highlightMouseOver = true
True to highlight slice when moused over.
this.hlc = false
true if is a hi-low-close chart (no open price).
this.hubRadius = null
Radius of the hub at the bottom center of gauge which the needle attaches to.
+ + + +
this.index
0 based index of this series in the plot series array.
this.innerDiameter = null
Inner diameter of the donut, auto calculated by default.
this.insertBreaks = true
true to turn spaces in data block label into html breaks br /.
this.intersectionThreshold = 2
pixel distance from data point or marker to consider cursor lines intersecting with point.
interval: '3%' }
User specified interval above and below line for bands [default: ‘3%’’].
this.intervalColors = [ "#4bb2c5", "#EAA228", "#c5b47f", "#579575", "#839557", "#958c12", "#953579", "#4b5de4", "#d8b83f", "#ff5800", "#0085cc", "#c747a3", "#cddf54", "#FBD178", "#26B4E3", "#bd70c7"]
Array of colors to use for the intervals.
this.intervalInnerRadius = null
Radius of the inner circle of the interval ring.
this.intervalOuterRadius = null
Radius of the outer circle of the interval ring.
this.intervals = []
Array of ranges to be drawn around the gauge.
this.isarc = false
whether the shadow is an arc or not.
this.isarc = false
whether the shadow is an arc or not.
this.isMinorTick = false
if this is a minor tick.
this.isMinorTick = false
if this is a minor tick.
+ + + +
this.label = ''
The text or html for the label.
this.label = ''
label for the axis.
this.label = null
A gauge label like ‘kph’ or ‘Volts’
this.label = ''
Label for the trend line to use in the legend.
this.label = null
Label for the axis
this.label = ''
Line label to use in the legend.
this.labelHeightAdjust = 0
Number of Pixels to offset the label up (-) or down (+) from its default position.
this.labelOptions = {}
Options passed to the label renderer.
this.labelPosition = 'auto'
‘auto’, ‘start’, ‘middle’ or ‘end’.
this.labelPosition = 'inside'
Where to position the label, either ‘inside’ or ‘bottom’.
this.labelRenderer = $.jqplot.AxisLabelRenderer
A class of a rendering engine for creating an axis label.
this.labels = []
array of arrays of labels, one array for each series.
this.labels = []
Array of labels to use.
this.labelsFromSeries = false
true to use labels within data point arrays.
this.legend = new Legend()
see $.jqplot.TableLegendRenderer
Type of ending placed on the line [‘round’, ‘butt’, ‘square’]
this.lineCap = 'round'
how ends of the shadow line are rendered.
this.lineCap = 'round'
how ends of the shadow line are rendered.
this.lineCap = 'round'
Canvas lineCap style at ends of line.
this.lineJoin = 'miter'
How line segments of the shadow are joined.
this.lineJoin = 'miter'
How line segments of the shadow are joined.
this.lineJoin = 'round'
Canvas lineJoin style between segments of series.
this.linePattern = 'solid'
line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
this.linePattern = 'solid'
line pattern ‘dashed’, ‘dotted’, ‘solid’, some combination of ‘-’ and ‘.’
Width of the line.
this.lineWidth = 2
width of line if areas are stroked and not filled.
this.lineWidth = 2
size of the line for non-filled markers.
this.lineWidth = 1.5
Width of the hi-low line and open/close ticks.
this.lineWidth = 1.5
width of the shadow line stroke.
this.lineWidth = 1.5
Width of the trend line.
this.lineWidth = 2.5
width of the line in pixels.
this.lineWidthAdjust = 2.5
Pixels to add to the lineWidth of the highlight.
this.location = 'n'
compass location where to position the label around the point.
this.location = 'ne'
Placement of the legend.
this.looseZoom = true
Will expand zoom range to provide more rounded tick values.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Properties4.html b/public/site_assets/test/js/dist/docs/index/Properties4.html new file mode 100644 index 00000000..ce3c219b --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Properties4.html @@ -0,0 +1,50 @@ + + +Property Index + + + + + + + + + +
Property Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
M
 marginBottom, Legend
 marginLeft, Legend
 marginRight, Legend
 marginTop, Legend
 mark
 markerOptions, Series
 markerRenderer
 markSize
 max
 min
 minorTicks
N
 name, $.jqplot.CanvasOverlay
 needlePad, $.jqplot.MeterGaugeRenderer
 needleThickness, $.jqplot.MeterGaugeRenderer
 negativeColor, Series
 negativeSeriesColors, jqPlot
 neighborThreshold, Series
 noDataIndicator, jqPlot
 numberColumns
 numberRows
 numberTicks, Axis
O
 objects, $.jqplot.CanvasOverlay
 offset, $.jqplot.shadowRenderer
 offsetBars
 openColor, $.jqplot.OHLCRenderer
P
 pad, Axis
 padding
 padMax, Axis
 padMin, Axis
 pegNeedle, $.jqplot.MeterGaugeRenderer
 placement, Legend
 position
 predraw, Legend
 prefix
 pt2px
R
 renderer
 rendererOptions
 ringColor, $.jqplot.MeterGaugeRenderer
 ringMargin, $.jqplot.DonutRenderer
 ringWidth, $.jqplot.MeterGaugeRenderer
 rowSpacing, Legend
+ +
this.marginBottom = null
CSS margin for the legend DOM element.
this.marginLeft = null
CSS margin for the legend DOM element.
this.marginRight = null
CSS margin for the legend DOM element.
this.marginTop = null
CSS margin for the legend DOM element.
this.mark = 'outside'
tick mark on the axis.
this.mark = 'outside'
tick mark on the axis.
this.markerOptions = {}
renderer specific options to pass to the markerRenderer, see $.jqplot.MarkerRenderer.
this.markerRenderer = new $.jqplot.MarkerRenderer({shadow:false})
Renderer used to draw the marker of the highlighted point.
this.markerRenderer = {show:false}
Renderer to use to draw markers on the line.
this.markerRenderer = $.jqplot.MarkerRenderer
A class of a renderer which will draw marker (e.g.
this.markSize = 6
Length of the tick marks in pixels.
this.markSize = 4
Length of the tick marks in pixels.
this.max
Maximum value on the gauge.
this.max = null
maximum value of the axis (in data units, not pixels).
this.min
Minimum value on the gauge.
this.min = null
minimum value of the axis (in data units, not pixels).
this.minorTicks = 0
Number of ticks to add between “major” ticks.
this.minorTicks = 'auto'
Number of ticks to add between “major” ticks.
+ + + +
Optional name for the overlay object.
this.needlePad = 6
Padding between needle and inner edge of the ring when the needle is at the min or max gauge value.
this.needleThickness = null
Maximum thickness the needle.
this.negativeColor
css color spec used for filled (area) plots that are filled to zero and the “useNegativeColors” option is true.
this.negativeSeriesColors = $.jqplot.config.defaultNegativeColors
colors to use for portions of the line below zero.
this.neighborThreshold = 4
how close or far (in pixels) the cursor must be from a point marker to detect the point.
this.noDataIndicator = { show: false, indicator: 'Loading Data...', axes: { xaxis: { min: 0, max: 10, tickInterval: 2, show: true }, yaxis: { min: 0, max: 12, tickInterval: 3, show: true } } }
Options to set up a mock plot with a data loading indicator if no data is specified.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberColumns = null
Maximum number of columns in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberRows = null
Maximum number of rows in the legend.
this.numberTicks
Desired number of ticks.
+ + + +
this.objects = []
this.offset = 1
Pixel offset at the given shadow angle of each shadow stroke from the last stroke.
this.offsetBars = false
False will center bars on their y value.
this.openColor = null
color of the open price tick mark.
+ + + +
this.pad = 1.2
Padding to extend the range above and below the data bounds.
this.padding = 20
padding between the donut and plot edges, legend, etc.
this.padding = {top: 20, right: 20, bottom: 20, left: 20}
padding between the funnel and plot edges, legend, etc.
this.padding = null
padding between the meterGauge and plot edges, auto calculated by default.
this.padding = 20
padding between the pie and plot edges, legend, etc.
this.padMax = null
Padding to extend the range above data bounds.
this.padMin = null
Padding to extend the range below data bounds.
this.pegNeedle = true
True will stop needle just below/above the min/max values if data is below/above min/max, as if the meter is “pegged”.
this.placement = "insideGrid"
“insideGrid” places legend inside the grid area of the plot.
this.position = null
Position of axis.
Wether to draw the legend before the series or not.
this.prefix = ''
String to prepend to the tick label.
this.prefix = ''
String to prepend to the tick label.
this.pt2px = null
Point to pixel scaling factor, used for computing height of bounding box around a label.
this.pt2px = null
Point to pixel scaling factor, used for computing height of bounding box around a label.
+ + + +
this.renderer = new $.jqplot.LineRenderer()
Renderer to use to draw the trend line.
this.renderer = $.jqplot.LinearAxisRenderer
A class of a rendering engine that handles tick generation, scaling input data to pixel grid units and drawing the axis element.
this.renderer = $.jqplot.CanvasGridRenderer
Instance of a renderer which will actually render the grid, see $.jqplot.CanvasGridRenderer.
this.renderer = $.jqplot.LineRenderer
A class of a renderer which will draw the series, see $.jqplot.LineRenderer.
this.renderer = $.jqplot.DivTitleRenderer
A class for creating a DOM element for the title, see $.jqplot.DivTitleRenderer.
this.rendererOptions = {marker:{show:false}}
Options to pass to the line renderer.
this.rendererOptions = {}
renderer specific options.
this.rendererOptions = {}
Options to pass on to the renderer, see $.jqplot.CanvasGridRenderer.
this.rendererOptions = {}
renderer specific options passed to the renderer.
this.rendererOptions = {}
Options to pass on to the renderer.
this.rendererOptions = {}
renderer specific options passed to the renderer.
this.ringColor = "#BBC6D0"
color of the outer ring, hub, and needle of the gauge.
this.ringMargin = null
pixel distance between rings, or multiple series in a donut plot.
this.ringWidth = null
width of the ring around the gauge.
this.rowSpacing = '0.5em'
css padding-top spec for the rows in the legend.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Properties5.html b/public/site_assets/test/js/dist/docs/index/Properties5.html new file mode 100644 index 00000000..3c8de066 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Properties5.html @@ -0,0 +1,34 @@ + + +Property Index + + + + + + + + + +
Property Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
S
 scaleToHiddenSeries, Axis
 sectionMargin, $.jqplot.FunnelRenderer
 series, jqPlot
 seriesColors, jqPlot
 seriesDefaults, jqPlot
 seriesLabelIndex, $.jqplot.PointLabels
 seriesToggle
 seriesToggleReplot
 shadow
 shadowAlpha
 shadowAngle
 shadowColor, Grid
 shadowDepth
 shadowOffset
 shadowRenderer, $.jqplot.MarkerRenderer
 shadowWidth, Grid
 shapeRenderer, $.jqplot.MarkerRenderer
 show
 showBorders, $.jqplot.MekkoRenderer
 showCursorLegend, $.jqplot.Cursor
 showDataLabels
 showGridline
 showHorizontalLine, $.jqplot.Cursor
 showLabel
 showLabels
 showLine, Series
 showLines, $.jqplot.LineRenderer
 showMark
 showMarker
 showMinorTicks, Axis
 showSwatch, Legend
 showTickLabels, $.jqplot.MeterGaugeRenderer
 showTickMarks, Axis
 showTicks
 showTooltip
 showTooltipDataPosition, $.jqplot.Cursor
 showTooltipGridPosition, $.jqplot.Cursor
 showTooltipOutsideZoom, $.jqplot.Cursor
 showTooltipPrecision, $.jqplot.CanvasOverlay
 showTooltipUnitPosition, $.jqplot.Cursor
 showVerticalLine, $.jqplot.Cursor
 size
 sizeAdjust, $.jqplot.Highlighter
 sliceMargin
 smooth, $.jqplot.LineRenderer
 sortData, jqPlot
 sortMergedLabels, $.jqplot.CategoryAxisRenderer
 stackedValue, $.jqplot.PointLabels
 stackSeries, jqPlot
 start, Line
 startAngle
 stop, Line
 strokeRect, $.jqplot.shapeRenderer
 strokeStyle, $.jqplot.shapeRenderer
 style
 suffix, $.jqplot.AxisTickRenderer
 synchronizeHighlight
 syncTicks, Axis
+ +
this.scaleToHiddenSeries = false
True to include hidden series when computing axes bounds and scaling.
this.sectionMargin = 6
spacing between funnel sections in pixels.
this.series = []
Array of series object options.
this.seriesColors = $.jqplot.config.defaultColors
Ann array of CSS color specifications that will be applied, in order, to the series in the plot.
seriesDefaults: {}, series:[] }
default options that will be applied to all series.
this.seriesLabelIndex = null
array index for location of labels within data point arrays.
this.seriesToggle = 'normal'
false to not enable series on/off toggling on the legend.
this.seriesToggleReplot = false
True to replot the chart after toggling series on/off.
whether or not to draw a shadow on the line
this.shadow = true
whether or not to draw a shadow on the line
this.shadow = true
true or false, whether or not to show the shadow.
this.shadow = true
whether to show a shadow behind the grid.
this.shadowAlpha = 0.08
transparency of the shadow (0 = transparent, 1 = opaque)
Alpha channel transparency of shadow.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = '0.07'
Alpha channel transparency of shadow.
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07
transparency of the shadow (0 = transparent, 1 = opaque)
this.shadowAlpha = 0.07
Alpha transparency of the shadow.
this.shadowAlpha = '0.07'
Alpha channel transparency of shadow.
this.shadowAlpha = '0.1'
Alpha channel transparency of shadow.
Shadow angle in degrees
this.shadowAngle = 45
Shadow angle in degrees
this.shadowAngle = 45
Angle of the shadow on the trend line.
this.shadowAngle = 45
shadow angle in degrees
this.shadowAngle = 45
Shadow angle in degrees
this.shadowColor = null
an optional css color spec for the shadow in ‘rgba(n, n, n, n)’ form
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowDepth = 4
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 5
number of strokes to apply to the shadow, each stroke offset shadowOffset from the last.
this.shadowDepth = 3
number of strokes to make of the shadow.
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowDepth = 3
Number of times shadow is stroked, each stroke offset shadowOffset from the last.
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
Shadow offset from line in pixels
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 2
offset of the shadow from the area and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 1
Shadow offset from line in pixels
this.shadowOffset = 2
offset of the shadow from the gauge ring and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 2
offset of the shadow from the slice and offset of each succesive stroke of the shadow from the last.
this.shadowOffset = 1.0
pixel offset for each stroke of the shadow.
this.shadowOffset = 1.5
Offset of each shadow stroke from the border in pixels
this.shadowOffset = 1.25
Shadow offset from line in pixels
this.shadowRenderer = new $.jqplot.ShadowRenderer()
Renderer that will draws the shadows on the marker.
this.shadowWidth = 3
width of the stoke for the shadow
this.shapeRenderer = new $.jqplot.ShapeRenderer()
Renderer that will draw the marker.
this.show = true
whether or not to show the tick (mark and label).
this.show = true
whether or not to show the tick (mark and label).
this.show = true
whether or not to show the tick (mark and label).
this.show = true
whether or not to show the tick (mark and label).
true to show (draw), false to not draw.
this.show = $.jqplot.config.enablePlugins
whether to show the cursor or not.
this.show = $.jqplot.config.enablePlugins
true to show the highlight.
true to show the bands.
this.show = true
whether or not to show the marker.
this.show = $.jqplot.config.enablePlugins
show the labels or not.
this.show = $.jqplot.config.enablePlugins
Wether or not to show the trend line.
this.show = false
Wether to display the axis on the graph.
this.show = false
Wether to display the legend on the graph.
this.show = true
whether or not to draw the series.
this.show = true
whether or not to show the title
this.showBorders = true
True to draw borders lines between areas on the chart.
this.showCursorLegend = false
Replace the plot legend with an enhanced legend displaying intersection information.
this.showDataLabels = false
true to show data labels on slices.
this.showDataLabels = false
true to show data labels on slices.
this.showDataLabels = false
true to show data labels on slices.
this.showGridline = true
whether or not to draw the gridline on the grid at this tick.
this.showGridline = true
whether or not to draw the gridline on the grid at this tick.
this.showHorizontalLine = false
draw a horizontal line across the plot which follows the cursor.
this.showLabel = true
whether or not to show the label.
this.showLabel = true
whether or not to show the label.
this.showLabel = true
whether or not to show the label.
this.showLabel = true
true to show the axis label.
this.showLabel = true
true to show label for this series in the legend.
this.showLabels = true
True to show labels on bubbles (if any), false to not show.
this.showLabels = true
true to show the label text on the legend.
this.showLine = true
whether to actually draw the line or not.
True to show lines at top and bottom of bands [default: false].
this.showMark = true
whether or not to show the mark on the axis.
this.showMark = true
whether or not to show the mark on the axis.
this.showMarker = true
true to show the marker
this.showMarker = true
whether or not to show the markers at the data points.
this.showMinorTicks = true
Wether or not to show minor ticks.
this.showSwatches = true
true to show the color swatches on the legend.
this.showTickLabels = true
true to show tick labels next to ticks.
this.showTickMarks = true
Wether to show the tick marks (line crossing grid) or not.
this.showTicks = true
true to show ticks around gauge.
this.showTicks = true
Wether to show the ticks (both marks and labels) or not.
Show a tooltip with data point values.
this.showTooltip = true
show a cursor position tooltip.
this.showTooltip = true
Show a tooltip with data point values.
this.showTooltipDataPosition = false
Used with showVerticalLine to show intersecting data points in the tooltip.
this.showTooltipGridPosition = false
show the grid pixel coordinates of the mouse.
this.showTooltipOutsideZoom = false
True will keep updating the tooltip when zooming of the grid.
Controls how close to line cursor must be to show tooltip.
this.showTooltipUnitPosition = true
show the unit (data) coordinates of the mouse.
this.showVerticalLine = false
draw a vertical line across the plot which follows the cursor.
this.size = 4
Length of the tick beyond the grid in pixels.
this.size = 9.0
Size of the marker (diameter or circle, length of edge of square, etc.)
this.sizeAdjust = 5
Pixels to add to the overall size of the highlight.
this.sliceMargin = 0
angular spacing between donut slices in degrees.
this.sliceMargin = 0
angular spacing between pie slices in degrees.
this.renderer.smooth = false
True to draw a smoothed (interpolated) line through the data points with automatically computed number of smoothing points.
this.sortData = true
false to not sort the data passed in by the user.
this.sortMergedLabels = false
True to sort tick labels when labels are created by merging x axis values from multiple series.
this.stackedValue = false
true to display value as stacked in a stacked plot.
this.stackSeries = false
true or false, creates a stack or “mountain” plot.
[x, y] coordinates for the start of the line.
this.startAngle = 0
Angle to start drawing donut in degrees.
this.startAngle = 0
Angle to start drawing pie in degrees.
stop: [] }
[x, y] coordinates for the end of the line.
this.strokeRect = false
true to draw shape as a stroked rectangle.
this.strokeStyle = '#999999'
css color spec for the stoke style
this.style = 'crosshair'
CSS spec for cursor style
this.style = 'filledCircle'
One of diamond, circle, square, x, plus, dash, filledDiamond, filledCircle, filledSquare
this.suffix = ''
String to append to the tick label.
this.synchronizeHighlight = false
Index of another series to highlight when this series is highlighted.
this.syncTicks = null
true to try and synchronize tick spacing across multiple axes so that ticks and grid lines line up.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/index/Properties6.html b/public/site_assets/test/js/dist/docs/index/Properties6.html new file mode 100644 index 00000000..b32d5475 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/index/Properties6.html @@ -0,0 +1,58 @@ + + +Property Index + + + + + + + + + +
Property Index
$#! · 0-9 · A · B · C · D · E · F · G · H · I · J · K · L · M · N · O · P · Q · R · S · T · U · V · W · X · Y · Z
T
 text, Title
 textAlign, Title
 textColor
 themes, $.jqplot.ThemeEngine
 thickness, $.jqplot.DonutRenderer
 tickColor, $.jqplot.MeterGaugeRenderer
 tickInset
 tickInterval, Axis
 tickLength, $.jqplot.OHLCRenderer
 tickMode, $.jqplot.MekkoAxisRenderer
 tickOptions, Axis
 tickPadding, $.jqplot.MeterGaugeRenderer
 tickRenderer
 ticks
 tickSpacing
 title, jqPlot
 tooltipAxes, $.jqplot.Highlighter
 tooltipAxisGroups, $.jqplot.Cursor
 tooltipFadeSpeed
 tooltipFormatString
 tooltipLocation
 tooltipOffset
 transposedData, $.jqplot.BarRenderer
 type, $.jqplot.Trendline
U
 upBodyColor, $.jqplot.OHLCRenderer
 useAxesFormatters
 useNegativeColors, Series
 useSeriesColor, Axis
V
 varyBarColor, $.jqplot.BarRenderer
 varyBlockColors, $.jqplot.BlockRenderer
 varyBubbleColors, $.jqplot.BubbleRenderer
W
 waterfall, $.jqplot.BarRenderer
 wickColor, $.jqplot.OHLCRenderer
 widthRatio, $.jqplot.FunnelRenderer
X
 xaxis
 xmax
 xmin
 xoffset, Legend
 xpadding, $.jqplot.PointLabels
Y
 y, HorizontalLine
 yaxis
 yoffset, Legend
 ypadding, $.jqplot.PointLabels
 yvalues, $.jqplot.Highlighter
Z
 zoom, $.jqplot.Cursor
+ +
this.text = text
text of the title;
this.textAlign
css text-align spec for the text.
this.textColor
css spec for the color attribute.
this.textColor = '#666666'
css spec for the color attribute.
this.textColor = '#666666'
css spec for the color attribute.
this.textColor
css color spec for the legend text.
this.textColor
css color spec for the text.
this.themes = {}
hash of themes managed by the theme engine.
this.thickness = null
thickness of the donut, auto computed by default Overridden by if innerDiameter is specified.
this.tickColor = "#989898"
color of the tick marks around the gauge.
this.tickInset = 0
Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
this.tickInset = 0
Controls the amount to inset the first and last ticks from the edges of the grid, in multiples of the tick interval.
this.tickInterval
number of units between ticks.
this.tickLength = 'auto'
length of the line in pixels indicating open and close price.
this.tickMode
How to space the ticks on the axis.
this.tickOptions = {}
Options that will be passed to the tickRenderer, see $.jqplot.AxisTickRenderer options.
this.tickPadding = null
padding of the tick marks to the outer ring and the tick labels to marks.
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
this.tickRenderer = $.jqplot.AxisTickRenderer
A class of a rendering engine for creating the ticks labels displayed on the plot, See $.jqplot.AxisTickRenderer.
this.ticks = []
Array of tick values.
this.ticks = []
1D [val, val, ...] or 2D [[val, label], [val, label], ...] array of ticks for the axis.
this.tickSpacing = 30
Degrees between ticks.
this.tickSpacing = 75
Approximate pixel spacing between ticks on graph.
this.title = new Title()
Title object.
this.tooltipAxes = 'both'
Which axes to display in tooltip, ‘x’, ‘y’ or ‘both’, ‘xy’ or ‘yx’ ‘both’ and ‘xy’ are equivalent, ‘yx’ reverses order of labels.
this.tooltipAxisGroups = []
Show position for the specified axes.
‘slow’, ‘def’, ‘fast’, or number of milliseconds.
this.tooltipFadeSpeed = "fast"
‘slow’, ‘def’, ‘fast’, or number of milliseconds.
tooltipFormatString: '%d, %d' }
Format string passed the x and y values of the cursor on the line.
this.tooltipFormatString = '%.4P, %.4P'
sprintf format string for the tooltip.
this.tooltipFormatString = '%.5P'
sprintf format string for the tooltip.
Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
this.tooltipLocation = 'se'
Where to position tooltip.
this.tooltipLocation = 'nw'
Where to position tooltip, ‘n’, ‘ne’, ‘e’, ‘se’, ‘s’, ‘sw’, ‘w’, ‘nw’
Pixel offset of tooltip from the highlight.
this.tooltipOffset = 6
Pixel offset of tooltip from the grid boudaries or cursor center.
this.tooltipOffset = 2
Pixel offset of tooltip from the highlight.
this.transposedData = true
NOT IMPLEMENTED YET.
this.type = 'linear'
Either ‘exponential’, ‘exp’, or ‘linear’.
+ + + +
this.upBodyColor = null
Color of candlestick body of an “up” day.
this.useAxesFormatters = true
Use the x and y axes formatters to format the text in the tooltip.
this.useAxesFormatters = true
Use the x and y axes formatters to format the text in the tooltip.
this.useNegativeColors = true
true to color negative values differently in filled and bar charts.
this.useSeriesColor = false
Use the color of the first series associated with this axis for the tick marks and line bordering this axis.
+ + + +
this.varyBarColor = false
true to color each bar of a series separately rather than have every bar of a given series the same color.
this.varyBlockColors = false
true to vary the color of each block in this series according to the seriesColors array.
this.varyBubbleColors = true
True to vary the color of each bubble in this series according to the seriesColors array.
+ + + +
this.waterfall = false
true to enable waterfall plot.
this.wickColor = null
color of the hi-lo line thorugh the candlestick body.
this.widthRatio = 0.2
The ratio of the width of the top of the funnel to the bottom.
+ + + +
X axis to use for positioning/scaling the line.
this.xaxis = 'xaxis'
which x axis to use with this series, either ‘xaxis’ or ‘x2axis’.
x value for the end of the line, null to scale to axis max.
x value for the end of the line, null to scale to axis max.
x value for the start of the line, null to scale to axis min.
x value for the start of the line, null to scale to axis min.
this.xoffset = 0
DEPRECATED.
this.xpadding = 6
horizontal padding in pixels between point and label
+ + + +
y value to position the line
Y axis to use for positioning/scaling the line.
this.yaxis = 'yaxis'
which y axis to use with this series, either ‘yaxis’ or ‘y2axis’.
this.yoffset = 0
DEPRECATED.
this.ypadding = 6
vertical padding in pixels between point and label
this.yvalues = 1
Number of y values to expect in the data point array.
+ + + +
this.zoom = false
Enable plot zooming.
+ +
+ + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/javascript/main.js b/public/site_assets/test/js/dist/docs/javascript/main.js new file mode 100644 index 00000000..efcdca96 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/javascript/main.js @@ -0,0 +1,836 @@ +// This file is part of Natural Docs, which is Copyright (C) 2003-2008 Greg Valure +// Natural Docs is licensed under the GPL + + +// +// Browser Styles +// ____________________________________________________________________________ + +var agt=navigator.userAgent.toLowerCase(); +var browserType; +var browserVer; + +if (agt.indexOf("opera") != -1) + { + browserType = "Opera"; + + if (agt.indexOf("opera 7") != -1 || agt.indexOf("opera/7") != -1) + { browserVer = "Opera7"; } + else if (agt.indexOf("opera 8") != -1 || agt.indexOf("opera/8") != -1) + { browserVer = "Opera8"; } + else if (agt.indexOf("opera 9") != -1 || agt.indexOf("opera/9") != -1) + { browserVer = "Opera9"; } + } + +else if (agt.indexOf("applewebkit") != -1) + { + browserType = "Safari"; + + if (agt.indexOf("version/3") != -1) + { browserVer = "Safari3"; } + else if (agt.indexOf("safari/4") != -1) + { browserVer = "Safari2"; } + } + +else if (agt.indexOf("khtml") != -1) + { + browserType = "Konqueror"; + } + +else if (agt.indexOf("msie") != -1) + { + browserType = "IE"; + + if (agt.indexOf("msie 6") != -1) + { browserVer = "IE6"; } + else if (agt.indexOf("msie 7") != -1) + { browserVer = "IE7"; } + } + +else if (agt.indexOf("gecko") != -1) + { + browserType = "Firefox"; + + if (agt.indexOf("rv:1.7") != -1) + { browserVer = "Firefox1"; } + else if (agt.indexOf("rv:1.8)") != -1 || agt.indexOf("rv:1.8.0") != -1) + { browserVer = "Firefox15"; } + else if (agt.indexOf("rv:1.8.1") != -1) + { browserVer = "Firefox2"; } + } + + +// +// Support Functions +// ____________________________________________________________________________ + + +function GetXPosition(item) + { + var position = 0; + + if (item.offsetWidth != null) + { + while (item != document.body && item != null) + { + position += item.offsetLeft; + item = item.offsetParent; + }; + }; + + return position; + }; + + +function GetYPosition(item) + { + var position = 0; + + if (item.offsetWidth != null) + { + while (item != document.body && item != null) + { + position += item.offsetTop; + item = item.offsetParent; + }; + }; + + return position; + }; + + +function MoveToPosition(item, x, y) + { + // Opera 5 chokes on the px extension, so it can use the Microsoft one instead. + + if (item.style.left != null) + { + item.style.left = x + "px"; + item.style.top = y + "px"; + } + else if (item.style.pixelLeft != null) + { + item.style.pixelLeft = x; + item.style.pixelTop = y; + }; + }; + + +// +// Menu +// ____________________________________________________________________________ + + +function ToggleMenu(id) + { + if (!window.document.getElementById) + { return; }; + + var display = window.document.getElementById(id).style.display; + + if (display == "none") + { display = "block"; } + else + { display = "none"; } + + window.document.getElementById(id).style.display = display; + } + +function HideAllBut(ids, max) + { + if (document.getElementById) + { + ids.sort( function(a,b) { return a - b; } ); + var number = 1; + + while (number < max) + { + if (ids.length > 0 && number == ids[0]) + { ids.shift(); } + else + { + document.getElementById("MGroupContent" + number).style.display = "none"; + }; + + number++; + }; + }; + } + + +// +// Tooltips +// ____________________________________________________________________________ + + +var tooltipTimer = 0; + +function ShowTip(event, tooltipID, linkID) + { + if (tooltipTimer) + { clearTimeout(tooltipTimer); }; + + var docX = event.clientX + window.pageXOffset; + var docY = event.clientY + window.pageYOffset; + + var showCommand = "ReallyShowTip('" + tooltipID + "', '" + linkID + "', " + docX + ", " + docY + ")"; + + tooltipTimer = setTimeout(showCommand, 1000); + } + +function ReallyShowTip(tooltipID, linkID, docX, docY) + { + tooltipTimer = 0; + + var tooltip; + var link; + + if (document.getElementById) + { + tooltip = document.getElementById(tooltipID); + link = document.getElementById(linkID); + } +/* else if (document.all) + { + tooltip = eval("document.all['" + tooltipID + "']"); + link = eval("document.all['" + linkID + "']"); + } +*/ + if (tooltip) + { + var left = GetXPosition(link); + var top = GetYPosition(link); + top += link.offsetHeight; + + + // The fallback method is to use the mouse X and Y relative to the document. We use a separate if and test if its a number + // in case some browser snuck through the above if statement but didn't support everything. + + if (!isFinite(top) || top == 0) + { + left = docX; + top = docY; + } + + // Some spacing to get it out from under the cursor. + + top += 10; + + // Make sure the tooltip doesnt get smushed by being too close to the edge, or in some browsers, go off the edge of the + // page. We do it here because Konqueror does get offsetWidth right even if it doesnt get the positioning right. + + if (tooltip.offsetWidth != null) + { + var width = tooltip.offsetWidth; + var docWidth = document.body.clientWidth; + + if (left + width > docWidth) + { left = docWidth - width - 1; } + + // If there's a horizontal scroll bar we could go past zero because it's using the page width, not the window width. + if (left < 0) + { left = 0; }; + } + + MoveToPosition(tooltip, left, top); + tooltip.style.visibility = "visible"; + } + } + +function HideTip(tooltipID) + { + if (tooltipTimer) + { + clearTimeout(tooltipTimer); + tooltipTimer = 0; + } + + var tooltip; + + if (document.getElementById) + { tooltip = document.getElementById(tooltipID); } + else if (document.all) + { tooltip = eval("document.all['" + tooltipID + "']"); } + + if (tooltip) + { tooltip.style.visibility = "hidden"; } + } + + +// +// Blockquote fix for IE +// ____________________________________________________________________________ + + +function NDOnLoad() + { + if (browserVer == "IE6") + { + var scrollboxes = document.getElementsByTagName('blockquote'); + + if (scrollboxes.item(0)) + { + NDDoResize(); + window.onresize=NDOnResize; + }; + }; + }; + + +var resizeTimer = 0; + +function NDOnResize() + { + if (resizeTimer != 0) + { clearTimeout(resizeTimer); }; + + resizeTimer = setTimeout(NDDoResize, 250); + }; + + +function NDDoResize() + { + var scrollboxes = document.getElementsByTagName('blockquote'); + + var i; + var item; + + i = 0; + while (item = scrollboxes.item(i)) + { + item.style.width = 100; + i++; + }; + + i = 0; + while (item = scrollboxes.item(i)) + { + item.style.width = item.parentNode.offsetWidth; + i++; + }; + + clearTimeout(resizeTimer); + resizeTimer = 0; + } + + + +/* ________________________________________________________________________________________________________ + + Class: SearchPanel + ________________________________________________________________________________________________________ + + A class handling everything associated with the search panel. + + Parameters: + + name - The name of the global variable that will be storing this instance. Is needed to be able to set timeouts. + mode - The mode the search is going to work in. Pass CommandLineOption()>, so the + value will be something like "HTML" or "FramedHTML". + + ________________________________________________________________________________________________________ +*/ + + +function SearchPanel(name, mode, resultsPath) + { + if (!name || !mode || !resultsPath) + { alert("Incorrect parameters to SearchPanel."); }; + + + // Group: Variables + // ________________________________________________________________________ + + /* + var: name + The name of the global variable that will be storing this instance of the class. + */ + this.name = name; + + /* + var: mode + The mode the search is going to work in, such as "HTML" or "FramedHTML". + */ + this.mode = mode; + + /* + var: resultsPath + The relative path from the current HTML page to the results page directory. + */ + this.resultsPath = resultsPath; + + /* + var: keyTimeout + The timeout used between a keystroke and when a search is performed. + */ + this.keyTimeout = 0; + + /* + var: keyTimeoutLength + The length of in thousandths of a second. + */ + this.keyTimeoutLength = 500; + + /* + var: lastSearchValue + The last search string executed, or an empty string if none. + */ + this.lastSearchValue = ""; + + /* + var: lastResultsPage + The last results page. The value is only relevant if is set. + */ + this.lastResultsPage = ""; + + /* + var: deactivateTimeout + + The timeout used between when a control is deactivated and when the entire panel is deactivated. Is necessary + because a control may be deactivated in favor of another control in the same panel, in which case it should stay + active. + */ + this.deactivateTimout = 0; + + /* + var: deactivateTimeoutLength + The length of in thousandths of a second. + */ + this.deactivateTimeoutLength = 200; + + + + + // Group: DOM Elements + // ________________________________________________________________________ + + + // Function: DOMSearchField + this.DOMSearchField = function() + { return document.getElementById("MSearchField"); }; + + // Function: DOMSearchType + this.DOMSearchType = function() + { return document.getElementById("MSearchType"); }; + + // Function: DOMPopupSearchResults + this.DOMPopupSearchResults = function() + { return document.getElementById("MSearchResults"); }; + + // Function: DOMPopupSearchResultsWindow + this.DOMPopupSearchResultsWindow = function() + { return document.getElementById("MSearchResultsWindow"); }; + + // Function: DOMSearchPanel + this.DOMSearchPanel = function() + { return document.getElementById("MSearchPanel"); }; + + + + + // Group: Event Handlers + // ________________________________________________________________________ + + + /* + Function: OnSearchFieldFocus + Called when focus is added or removed from the search field. + */ + this.OnSearchFieldFocus = function(isActive) + { + this.Activate(isActive); + }; + + + /* + Function: OnSearchFieldChange + Called when the content of the search field is changed. + */ + this.OnSearchFieldChange = function() + { + if (this.keyTimeout) + { + clearTimeout(this.keyTimeout); + this.keyTimeout = 0; + }; + + var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); + + if (searchValue != this.lastSearchValue) + { + if (searchValue != "") + { + this.keyTimeout = setTimeout(this.name + ".Search()", this.keyTimeoutLength); + } + else + { + if (this.mode == "HTML") + { this.DOMPopupSearchResultsWindow().style.display = "none"; }; + this.lastSearchValue = ""; + }; + }; + }; + + + /* + Function: OnSearchTypeFocus + Called when focus is added or removed from the search type. + */ + this.OnSearchTypeFocus = function(isActive) + { + this.Activate(isActive); + }; + + + /* + Function: OnSearchTypeChange + Called when the search type is changed. + */ + this.OnSearchTypeChange = function() + { + var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); + + if (searchValue != "") + { + this.Search(); + }; + }; + + + + // Group: Action Functions + // ________________________________________________________________________ + + + /* + Function: CloseResultsWindow + Closes the results window. + */ + this.CloseResultsWindow = function() + { + this.DOMPopupSearchResultsWindow().style.display = "none"; + this.Activate(false, true); + }; + + + /* + Function: Search + Performs a search. + */ + this.Search = function() + { + this.keyTimeout = 0; + + var searchValue = this.DOMSearchField().value.replace(/^ +/, ""); + var searchTopic = this.DOMSearchType().value; + + var pageExtension = searchValue.substr(0,1); + + if (pageExtension.match(/^[a-z]/i)) + { pageExtension = pageExtension.toUpperCase(); } + else if (pageExtension.match(/^[0-9]/)) + { pageExtension = 'Numbers'; } + else + { pageExtension = "Symbols"; }; + + var resultsPage; + var resultsPageWithSearch; + var hasResultsPage; + + // indexSectionsWithContent is defined in searchdata.js + if (indexSectionsWithContent[searchTopic][pageExtension] == true) + { + resultsPage = this.resultsPath + '/' + searchTopic + pageExtension + '.html'; + resultsPageWithSearch = resultsPage+'?'+escape(searchValue); + hasResultsPage = true; + } + else + { + resultsPage = this.resultsPath + '/NoResults.html'; + resultsPageWithSearch = resultsPage; + hasResultsPage = false; + }; + + var resultsFrame; + if (this.mode == "HTML") + { resultsFrame = window.frames.MSearchResults; } + else if (this.mode == "FramedHTML") + { resultsFrame = window.top.frames['Content']; }; + + + if (resultsPage != this.lastResultsPage || + + // Bug in IE. If everything becomes hidden in a run, none of them will be able to be reshown in the next for some + // reason. It counts the right number of results, and you can even read the display as "block" after setting it, but it + // just doesn't work in IE 6 or IE 7. So if we're on the right page but the previous search had no results, reload the + // page anyway to get around the bug. + (browserType == "IE" && hasResultsPage && + (!resultsFrame.searchResults || resultsFrame.searchResults.lastMatchCount == 0)) ) + + { + resultsFrame.location.href = resultsPageWithSearch; + } + + // So if the results page is right and there's no IE bug, reperform the search on the existing page. We have to check if there + // are results because NoResults.html doesn't have any JavaScript, and it would be useless to do anything on that page even + // if it did. + else if (hasResultsPage) + { + // We need to check if this exists in case the frame is present but didn't finish loading. + if (resultsFrame.searchResults) + { resultsFrame.searchResults.Search(searchValue); } + + // Otherwise just reload instead of waiting. + else + { resultsFrame.location.href = resultsPageWithSearch; }; + }; + + + var domPopupSearchResultsWindow = this.DOMPopupSearchResultsWindow(); + + if (this.mode == "HTML" && domPopupSearchResultsWindow.style.display != "block") + { + var domSearchType = this.DOMSearchType(); + + var left = GetXPosition(domSearchType); + var top = GetYPosition(domSearchType) + domSearchType.offsetHeight; + + MoveToPosition(domPopupSearchResultsWindow, left, top); + domPopupSearchResultsWindow.style.display = 'block'; + }; + + + this.lastSearchValue = searchValue; + this.lastResultsPage = resultsPage; + }; + + + + // Group: Activation Functions + // Functions that handle whether the entire panel is active or not. + // ________________________________________________________________________ + + + /* + Function: Activate + + Activates or deactivates the search panel, resetting things to their default values if necessary. You can call this on every + control's OnBlur() and it will handle not deactivating the entire panel when focus is just switching between them transparently. + + Parameters: + + isActive - Whether you're activating or deactivating the panel. + ignoreDeactivateDelay - Set if you're positive the action will deactivate the panel and thus want to skip the delay. + */ + this.Activate = function(isActive, ignoreDeactivateDelay) + { + // We want to ignore isActive being false while the results window is open. + if (isActive || (this.mode == "HTML" && this.DOMPopupSearchResultsWindow().style.display == "block")) + { + if (this.inactivateTimeout) + { + clearTimeout(this.inactivateTimeout); + this.inactivateTimeout = 0; + }; + + this.DOMSearchPanel().className = 'MSearchPanelActive'; + + var searchField = this.DOMSearchField(); + + if (searchField.value == 'Search') + { searchField.value = ""; } + } + else if (!ignoreDeactivateDelay) + { + this.inactivateTimeout = setTimeout(this.name + ".InactivateAfterTimeout()", this.inactivateTimeoutLength); + } + else + { + this.InactivateAfterTimeout(); + }; + }; + + + /* + Function: InactivateAfterTimeout + + Called by , which is set by . Inactivation occurs on a timeout because a control may + receive OnBlur() when focus is really transferring to another control in the search panel. In this case we don't want to + actually deactivate the panel because not only would that cause a visible flicker but it could also reset the search value. + So by doing it on a timeout instead, there's a short period where the second control's OnFocus() can cancel the deactivation. + */ + this.InactivateAfterTimeout = function() + { + this.inactivateTimeout = 0; + + this.DOMSearchPanel().className = 'MSearchPanelInactive'; + this.DOMSearchField().value = "Search"; + + this.lastSearchValue = ""; + this.lastResultsPage = ""; + }; + }; + + + + +/* ________________________________________________________________________________________________________ + + Class: SearchResults + _________________________________________________________________________________________________________ + + The class that handles everything on the search results page. + _________________________________________________________________________________________________________ +*/ + + +function SearchResults(name, mode) + { + /* + var: mode + The mode the search is going to work in, such as "HTML" or "FramedHTML". + */ + this.mode = mode; + + /* + var: lastMatchCount + The number of matches from the last run of . + */ + this.lastMatchCount = 0; + + + /* + Function: Toggle + Toggles the visibility of the passed element ID. + */ + this.Toggle = function(id) + { + if (this.mode == "FramedHTML") + { return; }; + + var parentElement = document.getElementById(id); + + var element = parentElement.firstChild; + + while (element && element != parentElement) + { + if (element.nodeName == 'DIV' && element.className == 'ISubIndex') + { + if (element.style.display == 'block') + { element.style.display = "none"; } + else + { element.style.display = 'block'; } + }; + + if (element.nodeName == 'DIV' && element.hasChildNodes()) + { element = element.firstChild; } + else if (element.nextSibling) + { element = element.nextSibling; } + else + { + do + { + element = element.parentNode; + } + while (element && element != parentElement && !element.nextSibling); + + if (element && element != parentElement) + { element = element.nextSibling; }; + }; + }; + }; + + + /* + Function: Search + + Searches for the passed string. If there is no parameter, it takes it from the URL query. + + Always returns true, since other documents may try to call it and that may or may not be possible. + */ + this.Search = function(search) + { + if (!search) + { + search = window.location.search; + search = search.substring(1); // Remove the leading ? + search = unescape(search); + }; + + search = search.replace(/^ +/, ""); + search = search.replace(/ +$/, ""); + search = search.toLowerCase(); + + if (search.match(/[^a-z0-9]/)) // Just a little speedup so it doesn't have to go through the below unnecessarily. + { + search = search.replace(/\_/g, "_und"); + search = search.replace(/\ +/gi, "_spc"); + search = search.replace(/\~/g, "_til"); + search = search.replace(/\!/g, "_exc"); + search = search.replace(/\@/g, "_att"); + search = search.replace(/\#/g, "_num"); + search = search.replace(/\$/g, "_dol"); + search = search.replace(/\%/g, "_pct"); + search = search.replace(/\^/g, "_car"); + search = search.replace(/\&/g, "_amp"); + search = search.replace(/\*/g, "_ast"); + search = search.replace(/\(/g, "_lpa"); + search = search.replace(/\)/g, "_rpa"); + search = search.replace(/\-/g, "_min"); + search = search.replace(/\+/g, "_plu"); + search = search.replace(/\=/g, "_equ"); + search = search.replace(/\{/g, "_lbc"); + search = search.replace(/\}/g, "_rbc"); + search = search.replace(/\[/g, "_lbk"); + search = search.replace(/\]/g, "_rbk"); + search = search.replace(/\:/g, "_col"); + search = search.replace(/\;/g, "_sco"); + search = search.replace(/\"/g, "_quo"); + search = search.replace(/\'/g, "_apo"); + search = search.replace(/\/g, "_ran"); + search = search.replace(/\,/g, "_com"); + search = search.replace(/\./g, "_per"); + search = search.replace(/\?/g, "_que"); + search = search.replace(/\//g, "_sla"); + search = search.replace(/[^a-z0-9\_]i/gi, "_zzz"); + }; + + var resultRows = document.getElementsByTagName("div"); + var matches = 0; + + var i = 0; + while (i < resultRows.length) + { + var row = resultRows.item(i); + + if (row.className == "SRResult") + { + var rowMatchName = row.id.toLowerCase(); + rowMatchName = rowMatchName.replace(/^sr\d*_/, ''); + + if (search.length <= rowMatchName.length && rowMatchName.substr(0, search.length) == search) + { + row.style.display = "block"; + matches++; + } + else + { row.style.display = "none"; }; + }; + + i++; + }; + + document.getElementById("Searching").style.display="none"; + + if (matches == 0) + { document.getElementById("NoMatches").style.display="block"; } + else + { document.getElementById("NoMatches").style.display="none"; } + + this.lastMatchCount = matches; + + return true; + }; + }; + diff --git a/public/site_assets/test/js/dist/docs/javascript/searchdata.js b/public/site_assets/test/js/dist/docs/javascript/searchdata.js new file mode 100644 index 00000000..c23b4e3b --- /dev/null +++ b/public/site_assets/test/js/dist/docs/javascript/searchdata.js @@ -0,0 +1,182 @@ +var indexSectionsWithContent = { + "General": { + "Symbols": true, + "Numbers": false, + "A": true, + "B": true, + "C": true, + "D": true, + "E": true, + "F": true, + "G": true, + "H": true, + "I": true, + "J": true, + "K": false, + "L": true, + "M": true, + "N": true, + "O": true, + "P": true, + "Q": true, + "R": true, + "S": true, + "T": true, + "U": true, + "V": true, + "W": true, + "X": true, + "Y": true, + "Z": true + }, + "Functions": { + "Symbols": false, + "Numbers": false, + "A": false, + "B": false, + "C": true, + "D": true, + "E": false, + "F": false, + "G": true, + "H": false, + "I": true, + "J": false, + "K": false, + "L": false, + "M": true, + "N": true, + "O": false, + "P": false, + "Q": true, + "R": true, + "S": true, + "T": false, + "U": false, + "V": false, + "W": false, + "X": false, + "Y": false, + "Z": true + }, + "Files": { + "Symbols": false, + "Numbers": false, + "A": false, + "B": false, + "C": false, + "D": false, + "E": false, + "F": false, + "G": false, + "H": false, + "I": false, + "J": true, + "K": false, + "L": false, + "M": false, + "N": false, + "O": false, + "P": false, + "Q": false, + "R": false, + "S": false, + "T": false, + "U": false, + "V": false, + "W": false, + "X": false, + "Y": false, + "Z": false + }, + "Classes": { + "Symbols": true, + "Numbers": false, + "A": true, + "B": false, + "C": false, + "D": true, + "E": false, + "F": false, + "G": true, + "H": true, + "I": false, + "J": true, + "K": false, + "L": true, + "M": false, + "N": false, + "O": false, + "P": false, + "Q": false, + "R": false, + "S": true, + "T": true, + "U": false, + "V": true, + "W": false, + "X": false, + "Y": false, + "Z": false + }, + "Hooks": { + "Symbols": false, + "Numbers": false, + "A": true, + "B": false, + "C": false, + "D": false, + "E": true, + "F": false, + "G": false, + "H": false, + "I": false, + "J": true, + "K": false, + "L": false, + "M": false, + "N": false, + "O": false, + "P": true, + "Q": false, + "R": false, + "S": false, + "T": false, + "U": false, + "V": false, + "W": false, + "X": false, + "Y": false, + "Z": false + }, + "Properties": { + "Symbols": false, + "Numbers": false, + "A": true, + "B": true, + "C": true, + "D": true, + "E": true, + "F": true, + "G": true, + "H": true, + "I": true, + "J": false, + "K": false, + "L": true, + "M": true, + "N": true, + "O": true, + "P": true, + "Q": false, + "R": true, + "S": true, + "T": true, + "U": true, + "V": true, + "W": true, + "X": true, + "Y": true, + "Z": true + } + } \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesA.html b/public/site_assets/test/js/dist/docs/search/ClassesA.html new file mode 100644 index 00000000..f157bd74 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesA.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesD.html b/public/site_assets/test/js/dist/docs/search/ClassesD.html new file mode 100644 index 00000000..a18ebd09 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesD.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesG.html b/public/site_assets/test/js/dist/docs/search/ClassesG.html new file mode 100644 index 00000000..eb101973 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesG.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesH.html b/public/site_assets/test/js/dist/docs/search/ClassesH.html new file mode 100644 index 00000000..13851fa6 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesH.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesJ.html b/public/site_assets/test/js/dist/docs/search/ClassesJ.html new file mode 100644 index 00000000..c698abb5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesJ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesL.html b/public/site_assets/test/js/dist/docs/search/ClassesL.html new file mode 100644 index 00000000..4f606db5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesL.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesS.html b/public/site_assets/test/js/dist/docs/search/ClassesS.html new file mode 100644 index 00000000..8ea4c67b --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesS.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesSymbols.html b/public/site_assets/test/js/dist/docs/search/ClassesSymbols.html new file mode 100644 index 00000000..578cf955 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesSymbols.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesT.html b/public/site_assets/test/js/dist/docs/search/ClassesT.html new file mode 100644 index 00000000..dbf2945d --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesT.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/ClassesV.html b/public/site_assets/test/js/dist/docs/search/ClassesV.html new file mode 100644 index 00000000..f691115c --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/ClassesV.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FilesJ.html b/public/site_assets/test/js/dist/docs/search/FilesJ.html new file mode 100644 index 00000000..e6c88cc9 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FilesJ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsC.html b/public/site_assets/test/js/dist/docs/search/FunctionsC.html new file mode 100644 index 00000000..d0b4661b --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsC.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
copy, $.jqplot.ThemeEngine
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsD.html b/public/site_assets/test/js/dist/docs/search/FunctionsD.html new file mode 100644 index 00000000..db77c9ef --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsD.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
destroy, jqPlot
drawSeries, jqPlot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsG.html b/public/site_assets/test/js/dist/docs/search/FunctionsG.html new file mode 100644 index 00000000..05d61765 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsG.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
get, $.jqplot.ThemeEngine
getThemeNames, $.jqplot.ThemeEngine
getThemes, $.jqplot.ThemeEngine
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsI.html b/public/site_assets/test/js/dist/docs/search/FunctionsI.html new file mode 100644 index 00000000..e296665a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsI.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
init, jqPlot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsM.html b/public/site_assets/test/js/dist/docs/search/FunctionsM.html new file mode 100644 index 00000000..24220105 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsM.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
moveBlock, $.jqplot.BlockRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsN.html b/public/site_assets/test/js/dist/docs/search/FunctionsN.html new file mode 100644 index 00000000..b1ee34fd --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsN.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
newTheme, $.jqplot.ThemeEngine
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsQ.html b/public/site_assets/test/js/dist/docs/search/FunctionsQ.html new file mode 100644 index 00000000..508e62c5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsQ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
quickInit, jqPlot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsR.html b/public/site_assets/test/js/dist/docs/search/FunctionsR.html new file mode 100644 index 00000000..df20f912 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsR.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
redraw, jqPlot
reInitialize, jqPlot
remove, $.jqplot.ThemeEngine
rename, $.jqplot.ThemeEngine
replot, jqPlot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsS.html b/public/site_assets/test/js/dist/docs/search/FunctionsS.html new file mode 100644 index 00000000..90a5d9ff --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsS.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/FunctionsZ.html b/public/site_assets/test/js/dist/docs/search/FunctionsZ.html new file mode 100644 index 00000000..18c499ab --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/FunctionsZ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
zoomProxy, $.jqplot.Cursor.$.jqplot.Cursor
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralA.html b/public/site_assets/test/js/dist/docs/search/GeneralA.html new file mode 100644 index 00000000..6ed99231 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralA.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
activeTheme, $.jqplot.ThemeEngine
addLegendRowHooks, $.jqplot.$.jqplot
alignTicks, $.jqplot.LinearAxisRenderer
alpha, $.jqplot.shadowRenderer
animate, jqPlot
autoscale, Axis
autoscaleBubbles, $.jqplot.BubbleRenderer
autoscaleMultiplier, $.jqplot.BubbleRenderer
autoscalePointsFactor, $.jqplot.BubbleRenderer
axes, jqPlot
axesDefaults, jqPlot
axisDefaults, $.jqplot.LogAxisRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralB.html b/public/site_assets/test/js/dist/docs/search/GeneralB.html new file mode 100644 index 00000000..d0ddb9b6 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralB.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
bandData, $.jqplot.LineRenderer
bands, $.jqplot.LineRenderer
barDirection, $.jqplot.BarRenderer
barLabelOptions, $.jqplot.MekkoAxisRenderer
barLabelRenderer, $.jqplot.MekkoAxisRenderer
barLabels, $.jqplot.MekkoAxisRenderer
barMargin, $.jqplot.BarRenderer
barWidth, $.jqplot.BarRenderer
bodyWidth, $.jqplot.OHLCRenderer
border, Legend
breakOnNull, Series
breakPoints, $.jqplot.LinearAxisRenderer
breakTickLabel, $.jqplot.LinearAxisRenderer
bringSeriesToFront, $.jqplot.Highlighter
bubbleAlpha, $.jqplot.BubbleRenderer
bubbleGradients, $.jqplot.BubbleRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralC.html b/public/site_assets/test/js/dist/docs/search/GeneralC.html new file mode 100644 index 00000000..2dc39965 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralC.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
candleStick, $.jqplot.OHLCRenderer
clearRect, $.jqplot.shapeRenderer
clickReset, $.jqplot.Cursor
closeColor, $.jqplot.OHLCRenderer
constrainOutsideZoom, $.jqplot.Cursor
constrainSmoothing, $.jqplot.LineRenderer
constrainTo, $.jqplot.Dragable
constrainZoomTo, $.jqplot.Cursor
copy, $.jqplot.ThemeEngine
css, $.jqplot.BlockRenderer
cursorLegendFormatString, $.jqplot.Cursor
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralD.html b/public/site_assets/test/js/dist/docs/search/GeneralD.html new file mode 100644 index 00000000..31dda824 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralD.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralE.html b/public/site_assets/test/js/dist/docs/search/GeneralE.html new file mode 100644 index 00000000..e290fe99 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralE.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
edgeTolerance, $.jqplot.PointLabels
eventListenerHooks, $.jqplot.$.jqplot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralF.html b/public/site_assets/test/js/dist/docs/search/GeneralF.html new file mode 100644 index 00000000..42d15604 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralF.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralG.html b/public/site_assets/test/js/dist/docs/search/GeneralG.html new file mode 100644 index 00000000..468fe211 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralG.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
get, $.jqplot.ThemeEngine
getThemeNames, $.jqplot.ThemeEngine
getThemes, $.jqplot.ThemeEngine
grid, jqPlot
groups, $.jqplot.BarRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralH.html b/public/site_assets/test/js/dist/docs/search/GeneralH.html new file mode 100644 index 00000000..e4e2c112 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralH.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
hideZeros, $.jqplot.PointLabels
highlightAlpha, $.jqplot.BubbleRenderer
highlightColor, $.jqplot.LineRenderer
hlc, $.jqplot.OHLCRenderer
Hooks, $.jqplot
hubRadius, $.jqplot.MeterGaugeRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralI.html b/public/site_assets/test/js/dist/docs/search/GeneralI.html new file mode 100644 index 00000000..890ed13e --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralI.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
index, Series
init, jqPlot
innerDiameter, $.jqplot.DonutRenderer
insertBreaks, $.jqplot.BlockRenderer
intersectionThreshold, $.jqplot.Cursor
interval, $.jqplot.LineRenderer
intervalColors, $.jqplot.MeterGaugeRenderer
intervalInnerRadius, $.jqplot.MeterGaugeRenderer
intervalOuterRadius, $.jqplot.MeterGaugeRenderer
intervals, $.jqplot.MeterGaugeRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralJ.html b/public/site_assets/test/js/dist/docs/search/GeneralJ.html new file mode 100644 index 00000000..bb0dc421 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralJ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralL.html b/public/site_assets/test/js/dist/docs/search/GeneralL.html new file mode 100644 index 00000000..efd7bd50 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralL.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralM.html b/public/site_assets/test/js/dist/docs/search/GeneralM.html new file mode 100644 index 00000000..9ace14d5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralM.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralN.html b/public/site_assets/test/js/dist/docs/search/GeneralN.html new file mode 100644 index 00000000..d35269fd --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralN.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
name, $.jqplot.CanvasOverlay
needlePad, $.jqplot.MeterGaugeRenderer
needleThickness, $.jqplot.MeterGaugeRenderer
newTheme, $.jqplot.ThemeEngine
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralO.html b/public/site_assets/test/js/dist/docs/search/GeneralO.html new file mode 100644 index 00000000..80693c57 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralO.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
objects, $.jqplot.CanvasOverlay
offset, $.jqplot.shadowRenderer
openColor, $.jqplot.OHLCRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralP.html b/public/site_assets/test/js/dist/docs/search/GeneralP.html new file mode 100644 index 00000000..6d0ffb40 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralP.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
pad, Axis
padMax, Axis
padMin, Axis
pegNeedle, $.jqplot.MeterGaugeRenderer
placement, Legend
postDrawHooks, $.jqplot.$.jqplot
postDrawSeriesHooks, $.jqplot.$.jqplot
postDrawSeriesShadowHooks, $.jqplot.$.jqplot
postInitHooks, $.jqplot.$.jqplot
postParseOptionsHooks, $.jqplot.$.jqplot
postParseSeriesOptionsHooks, $.jqplot.$.jqplot
postSeriesInitHooks, $.jqplot.$.jqplot
predraw, Legend
preDrawHooks, $.jqplot.$.jqplot
preDrawLegendHooks, $.jqplot.$.jqplot
preDrawSeriesHooks, $.jqplot.$.jqplot
preDrawSeriesShadowHooks, $.jqplot.$.jqplot
preInitHooks, $.jqplot.$.jqplot
preParseOptionsHooks, $.jqplot.$.jqplot
preParseSeriesOptionsHooks, $.jqplot.$.jqplot
preSeriesInitHooks, $.jqplot.$.jqplot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralQ.html b/public/site_assets/test/js/dist/docs/search/GeneralQ.html new file mode 100644 index 00000000..508e62c5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralQ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
quickInit, jqPlot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralR.html b/public/site_assets/test/js/dist/docs/search/GeneralR.html new file mode 100644 index 00000000..e26ed447 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralR.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
redraw, jqPlot
reInitialize, jqPlot
remove, $.jqplot.ThemeEngine
rename, $.jqplot.ThemeEngine
replot, jqPlot
ringColor, $.jqplot.MeterGaugeRenderer
ringMargin, $.jqplot.DonutRenderer
ringWidth, $.jqplot.MeterGaugeRenderer
rowSpacing, Legend
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralS.html b/public/site_assets/test/js/dist/docs/search/GeneralS.html new file mode 100644 index 00000000..cd62682c --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralS.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
sectionMargin, $.jqplot.FunnelRenderer
series, jqPlot
seriesColors, jqPlot
seriesLabelIndex, $.jqplot.PointLabels
shadowRenderer, $.jqplot.MarkerRenderer
shapeRenderer, $.jqplot.MarkerRenderer
showBorders, $.jqplot.MekkoRenderer
showCursorLegend, $.jqplot.Cursor
showHorizontalLine, $.jqplot.Cursor
showLine, Series
showLines, $.jqplot.LineRenderer
showSwatch, Legend
showTickLabels, $.jqplot.MeterGaugeRenderer
showTooltipDataPosition, $.jqplot.Cursor
showTooltipGridPosition, $.jqplot.Cursor
showTooltipOutsideZoom, $.jqplot.Cursor
showTooltipPrecision, $.jqplot.CanvasOverlay
showTooltipUnitPosition, $.jqplot.Cursor
showVerticalLine, $.jqplot.Cursor
sizeAdjust, $.jqplot.Highlighter
smooth, $.jqplot.LineRenderer
sortData, jqPlot
sortMergedLabels, $.jqplot.CategoryAxisRenderer
stackedValue, $.jqplot.PointLabels
stackSeries, jqPlot
start, Line
stop, Line
strokeRect, $.jqplot.shapeRenderer
strokeStyle, $.jqplot.shapeRenderer
suffix, $.jqplot.AxisTickRenderer
syncTicks, Axis
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralSymbols.html b/public/site_assets/test/js/dist/docs/search/GeneralSymbols.html new file mode 100644 index 00000000..578cf955 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralSymbols.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralT.html b/public/site_assets/test/js/dist/docs/search/GeneralT.html new file mode 100644 index 00000000..a3554727 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralT.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
text, Title
textAlign, Title
themes, $.jqplot.ThemeEngine
thickness, $.jqplot.DonutRenderer
tickColor, $.jqplot.MeterGaugeRenderer
tickLength, $.jqplot.OHLCRenderer
tickMode, $.jqplot.MekkoAxisRenderer
tickPadding, $.jqplot.MeterGaugeRenderer
title, jqPlot
tooltipAxes, $.jqplot.Highlighter
tooltipAxisGroups, $.jqplot.Cursor
transposedData, $.jqplot.BarRenderer
type, $.jqplot.Trendline
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralU.html b/public/site_assets/test/js/dist/docs/search/GeneralU.html new file mode 100644 index 00000000..a4e505f9 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralU.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
upBodyColor, $.jqplot.OHLCRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralV.html b/public/site_assets/test/js/dist/docs/search/GeneralV.html new file mode 100644 index 00000000..d825fc75 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralV.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
varyBarColor, $.jqplot.BarRenderer
varyBlockColors, $.jqplot.BlockRenderer
varyBubbleColors, $.jqplot.BubbleRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralW.html b/public/site_assets/test/js/dist/docs/search/GeneralW.html new file mode 100644 index 00000000..a28000a8 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralW.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
waterfall, $.jqplot.BarRenderer
wickColor, $.jqplot.OHLCRenderer
widthRatio, $.jqplot.FunnelRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralX.html b/public/site_assets/test/js/dist/docs/search/GeneralX.html new file mode 100644 index 00000000..e024dac5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralX.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
xoffset, Legend
xpadding, $.jqplot.PointLabels
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralY.html b/public/site_assets/test/js/dist/docs/search/GeneralY.html new file mode 100644 index 00000000..333691d1 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralY.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
y, HorizontalLine
yoffset, Legend
ypadding, $.jqplot.PointLabels
yvalues, $.jqplot.Highlighter
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/GeneralZ.html b/public/site_assets/test/js/dist/docs/search/GeneralZ.html new file mode 100644 index 00000000..d349454a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/GeneralZ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
zoom, $.jqplot.Cursor
zoomProxy, $.jqplot.Cursor.$.jqplot.Cursor
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/HooksA.html b/public/site_assets/test/js/dist/docs/search/HooksA.html new file mode 100644 index 00000000..1489a840 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/HooksA.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
addLegendRowHooks, $.jqplot.$.jqplot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/HooksE.html b/public/site_assets/test/js/dist/docs/search/HooksE.html new file mode 100644 index 00000000..0e354cf4 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/HooksE.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
eventListenerHooks, $.jqplot.$.jqplot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/HooksJ.html b/public/site_assets/test/js/dist/docs/search/HooksJ.html new file mode 100644 index 00000000..8f4461e5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/HooksJ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/HooksP.html b/public/site_assets/test/js/dist/docs/search/HooksP.html new file mode 100644 index 00000000..59f640ae --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/HooksP.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
postDrawHooks, $.jqplot.$.jqplot
postDrawSeriesHooks, $.jqplot.$.jqplot
postDrawSeriesShadowHooks, $.jqplot.$.jqplot
postInitHooks, $.jqplot.$.jqplot
postParseOptionsHooks, $.jqplot.$.jqplot
postParseSeriesOptionsHooks, $.jqplot.$.jqplot
postSeriesInitHooks, $.jqplot.$.jqplot
preDrawHooks, $.jqplot.$.jqplot
preDrawLegendHooks, $.jqplot.$.jqplot
preDrawSeriesHooks, $.jqplot.$.jqplot
preDrawSeriesShadowHooks, $.jqplot.$.jqplot
preInitHooks, $.jqplot.$.jqplot
preParseOptionsHooks, $.jqplot.$.jqplot
preParseSeriesOptionsHooks, $.jqplot.$.jqplot
preSeriesInitHooks, $.jqplot.$.jqplot
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/NoResults.html b/public/site_assets/test/js/dist/docs/search/NoResults.html new file mode 100644 index 00000000..1e149c11 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/NoResults.html @@ -0,0 +1,15 @@ + + + + + + + + + + + + +
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesA.html b/public/site_assets/test/js/dist/docs/search/PropertiesA.html new file mode 100644 index 00000000..bdea7f32 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesA.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
activeTheme, $.jqplot.ThemeEngine
alignTicks, $.jqplot.LinearAxisRenderer
alpha, $.jqplot.shadowRenderer
animate, jqPlot
autoscale, Axis
autoscaleBubbles, $.jqplot.BubbleRenderer
autoscaleMultiplier, $.jqplot.BubbleRenderer
autoscalePointsFactor, $.jqplot.BubbleRenderer
axes, jqPlot
axesDefaults, jqPlot
axisDefaults, $.jqplot.LogAxisRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesB.html b/public/site_assets/test/js/dist/docs/search/PropertiesB.html new file mode 100644 index 00000000..3f32a1c1 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesB.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
bandData, $.jqplot.LineRenderer
barDirection, $.jqplot.BarRenderer
barLabelOptions, $.jqplot.MekkoAxisRenderer
barLabelRenderer, $.jqplot.MekkoAxisRenderer
barLabels, $.jqplot.MekkoAxisRenderer
barMargin, $.jqplot.BarRenderer
barWidth, $.jqplot.BarRenderer
bodyWidth, $.jqplot.OHLCRenderer
border, Legend
breakOnNull, Series
breakPoints, $.jqplot.LinearAxisRenderer
breakTickLabel, $.jqplot.LinearAxisRenderer
bringSeriesToFront, $.jqplot.Highlighter
bubbleAlpha, $.jqplot.BubbleRenderer
bubbleGradients, $.jqplot.BubbleRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesC.html b/public/site_assets/test/js/dist/docs/search/PropertiesC.html new file mode 100644 index 00000000..54dfe94a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesC.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
candleStick, $.jqplot.OHLCRenderer
clearRect, $.jqplot.shapeRenderer
clickReset, $.jqplot.Cursor
closeColor, $.jqplot.OHLCRenderer
constrainOutsideZoom, $.jqplot.Cursor
constrainSmoothing, $.jqplot.LineRenderer
constrainTo, $.jqplot.Dragable
constrainZoomTo, $.jqplot.Cursor
css, $.jqplot.BlockRenderer
cursorLegendFormatString, $.jqplot.Cursor
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesD.html b/public/site_assets/test/js/dist/docs/search/PropertiesD.html new file mode 100644 index 00000000..4a1e95e4 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesD.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesE.html b/public/site_assets/test/js/dist/docs/search/PropertiesE.html new file mode 100644 index 00000000..b85b5ed9 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesE.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
edgeTolerance, $.jqplot.PointLabels
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesF.html b/public/site_assets/test/js/dist/docs/search/PropertiesF.html new file mode 100644 index 00000000..8ce28e86 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesF.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesG.html b/public/site_assets/test/js/dist/docs/search/PropertiesG.html new file mode 100644 index 00000000..fc00c892 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesG.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
grid, jqPlot
groups, $.jqplot.BarRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesH.html b/public/site_assets/test/js/dist/docs/search/PropertiesH.html new file mode 100644 index 00000000..906f4362 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesH.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
hideZeros, $.jqplot.PointLabels
highlightAlpha, $.jqplot.BubbleRenderer
highlightColor, $.jqplot.LineRenderer
hlc, $.jqplot.OHLCRenderer
hubRadius, $.jqplot.MeterGaugeRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesI.html b/public/site_assets/test/js/dist/docs/search/PropertiesI.html new file mode 100644 index 00000000..2bf165af --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesI.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
index, Series
innerDiameter, $.jqplot.DonutRenderer
insertBreaks, $.jqplot.BlockRenderer
intersectionThreshold, $.jqplot.Cursor
interval, $.jqplot.LineRenderer
intervalColors, $.jqplot.MeterGaugeRenderer
intervalInnerRadius, $.jqplot.MeterGaugeRenderer
intervalOuterRadius, $.jqplot.MeterGaugeRenderer
intervals, $.jqplot.MeterGaugeRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesL.html b/public/site_assets/test/js/dist/docs/search/PropertiesL.html new file mode 100644 index 00000000..499e8e30 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesL.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + + \ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesM.html b/public/site_assets/test/js/dist/docs/search/PropertiesM.html new file mode 100644 index 00000000..d259a31a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesM.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
marginBottom, Legend
marginLeft, Legend
marginRight, Legend
marginTop, Legend
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesN.html b/public/site_assets/test/js/dist/docs/search/PropertiesN.html new file mode 100644 index 00000000..05ed6992 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesN.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
name, $.jqplot.CanvasOverlay
needlePad, $.jqplot.MeterGaugeRenderer
needleThickness, $.jqplot.MeterGaugeRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesO.html b/public/site_assets/test/js/dist/docs/search/PropertiesO.html new file mode 100644 index 00000000..e6efdb8a --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesO.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
objects, $.jqplot.CanvasOverlay
offset, $.jqplot.shadowRenderer
openColor, $.jqplot.OHLCRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesP.html b/public/site_assets/test/js/dist/docs/search/PropertiesP.html new file mode 100644 index 00000000..b8a10b15 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesP.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
pad, Axis
padMax, Axis
padMin, Axis
pegNeedle, $.jqplot.MeterGaugeRenderer
placement, Legend
predraw, Legend
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesR.html b/public/site_assets/test/js/dist/docs/search/PropertiesR.html new file mode 100644 index 00000000..968c094b --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesR.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
ringColor, $.jqplot.MeterGaugeRenderer
ringMargin, $.jqplot.DonutRenderer
ringWidth, $.jqplot.MeterGaugeRenderer
rowSpacing, Legend
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesS.html b/public/site_assets/test/js/dist/docs/search/PropertiesS.html new file mode 100644 index 00000000..48f664f2 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesS.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
sectionMargin, $.jqplot.FunnelRenderer
series, jqPlot
seriesColors, jqPlot
seriesLabelIndex, $.jqplot.PointLabels
shadowRenderer, $.jqplot.MarkerRenderer
shapeRenderer, $.jqplot.MarkerRenderer
showBorders, $.jqplot.MekkoRenderer
showCursorLegend, $.jqplot.Cursor
showHorizontalLine, $.jqplot.Cursor
showLine, Series
showLines, $.jqplot.LineRenderer
showSwatch, Legend
showTickLabels, $.jqplot.MeterGaugeRenderer
showTooltipDataPosition, $.jqplot.Cursor
showTooltipGridPosition, $.jqplot.Cursor
showTooltipOutsideZoom, $.jqplot.Cursor
showTooltipPrecision, $.jqplot.CanvasOverlay
showTooltipUnitPosition, $.jqplot.Cursor
showVerticalLine, $.jqplot.Cursor
sizeAdjust, $.jqplot.Highlighter
smooth, $.jqplot.LineRenderer
sortData, jqPlot
sortMergedLabels, $.jqplot.CategoryAxisRenderer
stackedValue, $.jqplot.PointLabels
stackSeries, jqPlot
start, Line
stop, Line
strokeRect, $.jqplot.shapeRenderer
strokeStyle, $.jqplot.shapeRenderer
suffix, $.jqplot.AxisTickRenderer
syncTicks, Axis
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesT.html b/public/site_assets/test/js/dist/docs/search/PropertiesT.html new file mode 100644 index 00000000..c75aa4b5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesT.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
text, Title
textAlign, Title
themes, $.jqplot.ThemeEngine
thickness, $.jqplot.DonutRenderer
tickColor, $.jqplot.MeterGaugeRenderer
tickLength, $.jqplot.OHLCRenderer
tickMode, $.jqplot.MekkoAxisRenderer
tickPadding, $.jqplot.MeterGaugeRenderer
title, jqPlot
tooltipAxes, $.jqplot.Highlighter
tooltipAxisGroups, $.jqplot.Cursor
transposedData, $.jqplot.BarRenderer
type, $.jqplot.Trendline
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesU.html b/public/site_assets/test/js/dist/docs/search/PropertiesU.html new file mode 100644 index 00000000..76b96208 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesU.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
upBodyColor, $.jqplot.OHLCRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesV.html b/public/site_assets/test/js/dist/docs/search/PropertiesV.html new file mode 100644 index 00000000..0d957d3e --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesV.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
varyBarColor, $.jqplot.BarRenderer
varyBlockColors, $.jqplot.BlockRenderer
varyBubbleColors, $.jqplot.BubbleRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesW.html b/public/site_assets/test/js/dist/docs/search/PropertiesW.html new file mode 100644 index 00000000..a28000a8 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesW.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
waterfall, $.jqplot.BarRenderer
wickColor, $.jqplot.OHLCRenderer
widthRatio, $.jqplot.FunnelRenderer
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesX.html b/public/site_assets/test/js/dist/docs/search/PropertiesX.html new file mode 100644 index 00000000..e024dac5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesX.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
xoffset, Legend
xpadding, $.jqplot.PointLabels
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesY.html b/public/site_assets/test/js/dist/docs/search/PropertiesY.html new file mode 100644 index 00000000..333691d1 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesY.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
y, HorizontalLine
yoffset, Legend
ypadding, $.jqplot.PointLabels
yvalues, $.jqplot.Highlighter
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/search/PropertiesZ.html b/public/site_assets/test/js/dist/docs/search/PropertiesZ.html new file mode 100644 index 00000000..cb69edf5 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/search/PropertiesZ.html @@ -0,0 +1,20 @@ + + + + + + + + + + + + +
Loading...
zoom, $.jqplot.Cursor
Searching...
No Matches
\ No newline at end of file diff --git a/public/site_assets/test/js/dist/docs/styles/1.css b/public/site_assets/test/js/dist/docs/styles/1.css new file mode 100644 index 00000000..17e9cbc3 --- /dev/null +++ b/public/site_assets/test/js/dist/docs/styles/1.css @@ -0,0 +1,767 @@ +/* + IMPORTANT: If you're editing this file in the output directory of one of + your projects, your changes will be overwritten the next time you run + Natural Docs. Instead, copy this file to your project directory, make your + changes, and you can use it with -s. Even better would be to make a CSS + file in your project directory with only your changes, which you can then + use with -s [original style] [your changes]. + + On the other hand, if you're editing this file in the Natural Docs styles + directory, the changes will automatically be applied to all your projects + that use this style the next time Natural Docs is run on them. + + This file is part of Natural Docs, which is Copyright (C) 2003-2008 Greg Valure + Natural Docs is licensed under the GPL +*/ + +body { + font: 10pt Verdana, Arial, sans-serif; + color: #000000; + margin: 0; padding: 0; + } + +.ContentPage, +.IndexPage, +.FramedMenuPage { + background-color: #E8E8E8; + } +.FramedContentPage, +.FramedIndexPage, +.FramedSearchResultsPage, +.PopupSearchResultsPage { + background-color: #FFFFFF; + } + + +a:link, +a:visited { color: #900000; text-decoration: none } +a:hover { color: #900000; text-decoration: underline } +a:active { color: #FF0000; text-decoration: underline } + +td { + vertical-align: top } + +img { border: 0; } + + +/* + Comment out this line to use web-style paragraphs (blank line between + paragraphs, no indent) instead of print-style paragraphs (no blank line, + indented.) +*/ +p { + text-indent: 5ex; margin: 0 } + + +/* Opera doesn't break with just wbr, but will if you add this. */ +.Opera wbr:after { + content: "\00200B"; + } + + +/* Blockquotes are used as containers for things that may need to scroll. */ +blockquote { + padding: 0; + margin: 0; + overflow: auto; + } + + +.Firefox1 blockquote { + padding-bottom: .5em; + } + +/* Turn off scrolling when printing. */ +@media print { + blockquote { + overflow: visible; + } + .IE blockquote { + width: auto; + } + } + + + +#Menu { + font-size: 9pt; + padding: 10px 0 0 0; + } +.ContentPage #Menu, +.IndexPage #Menu { + position: absolute; + top: 0; + left: 0; + width: 31ex; + overflow: hidden; + } +.ContentPage .Firefox #Menu, +.IndexPage .Firefox #Menu { + width: 27ex; + } + + + .MTitle { + font-size: 16pt; font-weight: bold; font-variant: small-caps; + text-align: center; + padding: 5px 10px 15px 10px; + border-bottom: 1px dotted #000000; + margin-bottom: 15px } + + .MSubTitle { + font-size: 9pt; font-weight: normal; font-variant: normal; + margin-top: 1ex; margin-bottom: 5px } + + + .MEntry a:link, + .MEntry a:hover, + .MEntry a:visited { color: #606060; margin-right: 0 } + .MEntry a:active { color: #A00000; margin-right: 0 } + + + .MGroup { + font-variant: small-caps; font-weight: bold; + margin: 1em 0 1em 10px; + } + + .MGroupContent { + font-variant: normal; font-weight: normal } + + .MGroup a:link, + .MGroup a:hover, + .MGroup a:visited { color: #545454; margin-right: 10px } + .MGroup a:active { color: #A00000; margin-right: 10px } + + + .MFile, + .MText, + .MLink, + .MIndex { + padding: 1px 17px 2px 10px; + margin: .25em 0 .25em 0; + } + + .MText { + font-size: 8pt; font-style: italic } + + .MLink { + font-style: italic } + + #MSelected { + color: #000000; background-color: #FFFFFF; + /* Replace padding with border. */ + padding: 0 10px 0 10px; + border-width: 1px 2px 2px 0; border-style: solid; border-color: #000000; + margin-right: 5px; + } + + /* Close off the left side when its in a group. */ + .MGroup #MSelected { + padding-left: 9px; border-left-width: 1px } + + /* A treat for Mozilla users. Blatantly non-standard. Will be replaced with CSS 3 attributes when finalized/supported. */ + .Firefox #MSelected { + -moz-border-radius-topright: 10px; + -moz-border-radius-bottomright: 10px } + .Firefox .MGroup #MSelected { + -moz-border-radius-topleft: 10px; + -moz-border-radius-bottomleft: 10px } + + + #MSearchPanel { + padding: 0px 6px; + margin: .25em 0; + } + + + #MSearchField { + font: italic 9pt Verdana, sans-serif; + color: #606060; + background-color: #E8E8E8; + border: none; + padding: 2px 4px; + width: 100%; + } + /* Only Opera gets it right. */ + .Firefox #MSearchField, + .IE #MSearchField, + .Safari #MSearchField { + width: 94%; + } + .Opera9 #MSearchField, + .Konqueror #MSearchField { + width: 97%; + } + .FramedMenuPage .Firefox #MSearchField, + .FramedMenuPage .Safari #MSearchField, + .FramedMenuPage .Konqueror #MSearchField { + width: 98%; + } + + /* Firefox doesn't do this right in frames without #MSearchPanel added on. + It's presence doesn't hurt anything other browsers. */ + #MSearchPanel.MSearchPanelInactive:hover #MSearchField { + background-color: #FFFFFF; + border: 1px solid #C0C0C0; + padding: 1px 3px; + } + .MSearchPanelActive #MSearchField { + background-color: #FFFFFF; + border: 1px solid #C0C0C0; + font-style: normal; + padding: 1px 3px; + } + + #MSearchType { + visibility: hidden; + font: 8pt Verdana, sans-serif; + width: 98%; + padding: 0; + border: 1px solid #C0C0C0; + } + .MSearchPanelActive #MSearchType, + /* As mentioned above, Firefox doesn't do this right in frames without #MSearchPanel added on. */ + #MSearchPanel.MSearchPanelInactive:hover #MSearchType, + #MSearchType:focus { + visibility: visible; + color: #606060; + } + #MSearchType option#MSearchEverything { + font-weight: bold; + } + + .Opera8 .MSearchPanelInactive:hover, + .Opera8 .MSearchPanelActive { + margin-left: -1px; + } + + + iframe#MSearchResults { + width: 60ex; + height: 15em; + } + #MSearchResultsWindow { + display: none; + position: absolute; + left: 0; top: 0; + border: 1px solid #000000; + background-color: #E8E8E8; + } + #MSearchResultsWindowClose { + font-weight: bold; + font-size: 8pt; + display: block; + padding: 2px 5px; + } + #MSearchResultsWindowClose:link, + #MSearchResultsWindowClose:visited { + color: #000000; + text-decoration: none; + } + #MSearchResultsWindowClose:active, + #MSearchResultsWindowClose:hover { + color: #800000; + text-decoration: none; + background-color: #F4F4F4; + } + + + + +#Content { + padding-bottom: 15px; + } + +.ContentPage #Content { + border-width: 0 0 1px 1px; + border-style: solid; + border-color: #000000; + background-color: #FFFFFF; + font-size: 9pt; /* To make 31ex match the menu's 31ex. */ + margin-left: 31ex; + } +.ContentPage .Firefox #Content { + margin-left: 27ex; + } + + + + .CTopic { + font-size: 10pt; + margin-bottom: 3em; + } + + + .CTitle { + font-size: 12pt; font-weight: bold; + border-width: 0 0 1px 0; border-style: solid; border-color: #A0A0A0; + margin: 0 15px .5em 15px } + + .CGroup .CTitle { + font-size: 16pt; font-variant: small-caps; + padding-left: 15px; padding-right: 15px; + border-width: 0 0 2px 0; border-color: #000000; + margin-left: 0; margin-right: 0 } + + .CClass .CTitle, + .CInterface .CTitle, + .CDatabase .CTitle, + .CDatabaseTable .CTitle, + .CSection .CTitle { + font-size: 18pt; + color: #FFFFFF; background-color: #A0A0A0; + padding: 10px 15px 10px 15px; + border-width: 2px 0; border-color: #000000; + margin-left: 0; margin-right: 0 } + + #MainTopic .CTitle { + font-size: 20pt; + color: #FFFFFF; background-color: #7070C0; + padding: 10px 15px 10px 15px; + border-width: 0 0 3px 0; border-color: #000000; + margin-left: 0; margin-right: 0 } + + .CBody { + margin-left: 15px; margin-right: 15px } + + + .CToolTip { + position: absolute; visibility: hidden; + left: 0; top: 0; + background-color: #FFFFE0; + padding: 5px; + border-width: 1px 2px 2px 1px; border-style: solid; border-color: #000000; + font-size: 8pt; + } + + .Opera .CToolTip { + max-width: 98%; + } + + /* Scrollbars would be useless. */ + .CToolTip blockquote { + overflow: hidden; + } + .IE6 .CToolTip blockquote { + overflow: visible; + } + + .CHeading { + font-weight: bold; font-size: 10pt; + margin: 1.5em 0 .5em 0; + } + + .CBody pre { + font: 10pt "Courier New", Courier, monospace; + margin: 1em 0; + } + + .CBody ul { + /* I don't know why CBody's margin doesn't apply, but it's consistent across browsers so whatever. + Reapply it here as padding. */ + padding-left: 15px; padding-right: 15px; + margin: .5em 5ex .5em 5ex; + } + + .CDescriptionList { + margin: .5em 5ex 0 5ex } + + .CDLEntry { + font: 10pt "Courier New", Courier, monospace; color: #808080; + padding-bottom: .25em; + white-space: nowrap } + + .CDLDescription { + font-size: 10pt; /* For browsers that don't inherit correctly, like Opera 5. */ + padding-bottom: .5em; padding-left: 5ex } + + + .CTopic img { + text-align: center; + display: block; + margin: 1em auto; + } + .CImageCaption { + font-variant: small-caps; + font-size: 8pt; + color: #808080; + text-align: center; + position: relative; + top: 1em; + } + + .CImageLink { + color: #808080; + font-style: italic; + } + a.CImageLink:link, + a.CImageLink:visited, + a.CImageLink:hover { color: #808080 } + + + + + +.Prototype { + font: 10pt "Courier New", Courier, monospace; + padding: 5px 3ex; + border-width: 1px; border-style: solid; + margin: 0 5ex 1.5em 5ex; + } + + .Prototype td { + font-size: 10pt; + } + + .PDefaultValue, + .PDefaultValuePrefix, + .PTypePrefix { + color: #8F8F8F; + } + .PTypePrefix { + text-align: right; + } + .PAfterParameters { + vertical-align: bottom; + } + + .IE .Prototype table { + padding: 0; + } + + .CFunction .Prototype { + background-color: #F4F4F4; border-color: #D0D0D0 } + .CProperty .Prototype { + background-color: #F4F4FF; border-color: #C0C0E8 } + .CVariable .Prototype { + background-color: #FFFFF0; border-color: #E0E0A0 } + + .CClass .Prototype { + border-width: 1px 2px 2px 1px; border-style: solid; border-color: #A0A0A0; + background-color: #F4F4F4; + } + .CInterface .Prototype { + border-width: 1px 2px 2px 1px; border-style: solid; border-color: #A0A0D0; + background-color: #F4F4FF; + } + + .CDatabaseIndex .Prototype, + .CConstant .Prototype { + background-color: #D0D0D0; border-color: #000000 } + .CType .Prototype, + .CEnumeration .Prototype { + background-color: #FAF0F0; border-color: #E0B0B0; + } + .CDatabaseTrigger .Prototype, + .CEvent .Prototype, + .CDelegate .Prototype { + background-color: #F0FCF0; border-color: #B8E4B8 } + + .CToolTip .Prototype { + margin: 0 0 .5em 0; + white-space: nowrap; + } + + + + + +.Summary { + margin: 1.5em 5ex 0 5ex } + + .STitle { + font-size: 12pt; font-weight: bold; + margin-bottom: .5em } + + + .SBorder { + background-color: #FFFFF0; + padding: 15px; + border: 1px solid #C0C060 } + + /* In a frame IE 6 will make them too long unless you set the width to 100%. Without frames it will be correct without a width + or slightly too long (but not enough to scroll) with a width. This arbitrary weirdness simply astounds me. IE 7 has the same + problem with frames, haven't tested it without. */ + .FramedContentPage .IE .SBorder { + width: 100% } + + /* A treat for Mozilla users. Blatantly non-standard. Will be replaced with CSS 3 attributes when finalized/supported. */ + .Firefox .SBorder { + -moz-border-radius: 20px } + + + .STable { + font-size: 9pt; width: 100% } + + .SEntry { + width: 30% } + .SDescription { + width: 70% } + + + .SMarked { + background-color: #F8F8D8 } + + .SDescription { padding-left: 2ex } + .SIndent1 .SEntry { padding-left: 1.5ex } .SIndent1 .SDescription { padding-left: 3.5ex } + .SIndent2 .SEntry { padding-left: 3.0ex } .SIndent2 .SDescription { padding-left: 5.0ex } + .SIndent3 .SEntry { padding-left: 4.5ex } .SIndent3 .SDescription { padding-left: 6.5ex } + .SIndent4 .SEntry { padding-left: 6.0ex } .SIndent4 .SDescription { padding-left: 8.0ex } + .SIndent5 .SEntry { padding-left: 7.5ex } .SIndent5 .SDescription { padding-left: 9.5ex } + + .SDescription a { color: #800000} + .SDescription a:active { color: #A00000 } + + .SGroup td { + padding-top: .5em; padding-bottom: .25em } + + .SGroup .SEntry { + font-weight: bold; font-variant: small-caps } + + .SGroup .SEntry a { color: #800000 } + .SGroup .SEntry a:active { color: #F00000 } + + + .SMain td, + .SClass td, + .SDatabase td, + .SDatabaseTable td, + .SSection td { + font-size: 10pt; + padding-bottom: .25em } + + .SClass td, + .SDatabase td, + .SDatabaseTable td, + .SSection td { + padding-top: 1em } + + .SMain .SEntry, + .SClass .SEntry, + .SDatabase .SEntry, + .SDatabaseTable .SEntry, + .SSection .SEntry { + font-weight: bold; + } + + .SMain .SEntry a, + .SClass .SEntry a, + .SDatabase .SEntry a, + .SDatabaseTable .SEntry a, + .SSection .SEntry a { color: #000000 } + + .SMain .SEntry a:active, + .SClass .SEntry a:active, + .SDatabase .SEntry a:active, + .SDatabaseTable .SEntry a:active, + .SSection .SEntry a:active { color: #A00000 } + + + + + +.ClassHierarchy { + margin: 0 15px 1em 15px } + + .CHEntry { + border-width: 1px 2px 2px 1px; border-style: solid; border-color: #A0A0A0; + margin-bottom: 3px; + padding: 2px 2ex; + font-size: 10pt; + background-color: #F4F4F4; color: #606060; + } + + .Firefox .CHEntry { + -moz-border-radius: 4px; + } + + .CHCurrent .CHEntry { + font-weight: bold; + border-color: #000000; + color: #000000; + } + + .CHChildNote .CHEntry { + font-style: italic; + font-size: 8pt; + } + + .CHIndent { + margin-left: 3ex; + } + + .CHEntry a:link, + .CHEntry a:visited, + .CHEntry a:hover { + color: #606060; + } + .CHEntry a:active { + color: #800000; + } + + + + + +#Index { + background-color: #FFFFFF; + } + +/* As opposed to .PopupSearchResultsPage #Index */ +.IndexPage #Index, +.FramedIndexPage #Index, +.FramedSearchResultsPage #Index { + padding: 15px; + } + +.IndexPage #Index { + border-width: 0 0 1px 1px; + border-style: solid; + border-color: #000000; + font-size: 9pt; /* To make 27ex match the menu's 27ex. */ + margin-left: 27ex; + } + + + .IPageTitle { + font-size: 20pt; font-weight: bold; + color: #FFFFFF; background-color: #7070C0; + padding: 10px 15px 10px 15px; + border-width: 0 0 3px 0; border-color: #000000; border-style: solid; + margin: -15px -15px 0 -15px } + + .FramedSearchResultsPage .IPageTitle { + margin-bottom: 15px; + } + + .INavigationBar { + font-size: 10pt; + text-align: center; + background-color: #FFFFF0; + padding: 5px; + border-bottom: solid 1px black; + margin: 0 -15px 15px -15px; + } + + .INavigationBar a { + font-weight: bold } + + .IHeading { + font-size: 16pt; font-weight: bold; + padding: 2.5em 0 .5em 0; + text-align: center; + width: 3.5ex; + } + #IFirstHeading { + padding-top: 0; + } + + .IEntry { + font-size: 10pt; + padding-left: 1ex; + } + .PopupSearchResultsPage .IEntry { + font-size: 8pt; + padding: 1px 5px; + } + .PopupSearchResultsPage .Opera9 .IEntry, + .FramedSearchResultsPage .Opera9 .IEntry { + text-align: left; + } + .FramedSearchResultsPage .IEntry { + padding: 0; + } + + .ISubIndex { + padding-left: 3ex; padding-bottom: .5em } + .PopupSearchResultsPage .ISubIndex { + display: none; + } + + /* While it may cause some entries to look like links when they aren't, I found it's much easier to read the + index if everything's the same color. */ + .ISymbol { + font-weight: bold; color: #900000 } + + .IndexPage .ISymbolPrefix, + .FramedIndexPage .ISymbolPrefix { + font-size: 10pt; + text-align: right; + color: #C47C7C; + background-color: #F8F8F8; + border-right: 3px solid #E0E0E0; + border-left: 1px solid #E0E0E0; + padding: 0 1px 0 2px; + } + .PopupSearchResultsPage .ISymbolPrefix, + .FramedSearchResultsPage .ISymbolPrefix { + color: #900000; + } + .PopupSearchResultsPage .ISymbolPrefix { + font-size: 8pt; + } + + .IndexPage #IFirstSymbolPrefix, + .FramedIndexPage #IFirstSymbolPrefix { + border-top: 1px solid #E0E0E0; + } + .IndexPage #ILastSymbolPrefix, + .FramedIndexPage #ILastSymbolPrefix { + border-bottom: 1px solid #E0E0E0; + } + .IndexPage #IOnlySymbolPrefix, + .FramedIndexPage #IOnlySymbolPrefix { + border-top: 1px solid #E0E0E0; + border-bottom: 1px solid #E0E0E0; + } + + a.IParent, + a.IFile { + display: block; + } + + .PopupSearchResultsPage .SRStatus { + padding: 2px 5px; + font-size: 8pt; + font-style: italic; + } + .FramedSearchResultsPage .SRStatus { + font-size: 10pt; + font-style: italic; + } + + .SRResult { + display: none; + } + + + +#Footer { + font-size: 8pt; + color: #989898; + text-align: right; + } + +#Footer p { + text-indent: 0; + margin-bottom: .5em; + } + +.ContentPage #Footer, +.IndexPage #Footer { + text-align: right; + margin: 2px; + } + +.FramedMenuPage #Footer { + text-align: center; + margin: 5em 10px 10px 10px; + padding-top: 1em; + border-top: 1px solid #C8C8C8; + } + + #Footer a:link, + #Footer a:hover, + #Footer a:visited { color: #989898 } + #Footer a:active { color: #A00000 } + diff --git a/public/site_assets/test/js/dist/docs/styles/2.css b/public/site_assets/test/js/dist/docs/styles/2.css new file mode 100644 index 00000000..12117d4e --- /dev/null +++ b/public/site_assets/test/js/dist/docs/styles/2.css @@ -0,0 +1,174 @@ +html, body { + height: 100%; +} + +/* +div.Firefox { + height: 100%; +} +*/ + +.MTitle { + font-variant: normal; +} + +.MLink { + font-style: normal; +} + +.CBody { +margin-left: 30px; +margin-right: 30px; +} + +p { + text-indent: 0; + margin-bottom: 1em; + } + +.CBody p { +/* + padding-top: 4px; + padding-bottom: 4px; +*/ +} + +#Menu { + margin-top: 94px; + border: 0px; +} + +body.ContentPage { + background-image: url('../../images/background.jpg'); + background-color: #818181; + background-position: left top; + background-repeat: repeat-x; +} + +.MGroup a:link, +.MGroup a:hover, +.MGroup a:visited { color: #bfbfbf; margin-right: 10px } +.MGroup a:active { color: #f58f07; margin-right: 10px } + + +.MEntry a:link, +.MEntry a:hover, +.MEntry a:visited { color: #bfbfbf; margin-right: 0 } +.MEntry a:active { color: #f58f07; margin-right: 0 } + +#Footer { + color: #bfbfbf; +} + +#Footer a:link, #Footer a:hover, #Footer a:visited { + color: #5c93f0; +} + +#MainTopic div.CTitle.logo { + color: #292929; + font-size: 0px; + font-style: normal; + font-weight: normal; + border-width: 0px; + padding: 0px; + margin: 0px; + background-position: left top; + background-repeat: no-repeat; + background-image: url('../../images/logo.jpg'); + background-color: #292929; + height: 94px; + position: relative; + +} + +#MainTopic h1.CTitle a { + display: none; +} + + +#MainTopic div.CBody p:first-child { + margin-top: 24px; +} + +.ContentPage #Content { + border: 0px; +/* height: 100%; */ +} + +#IPageLogo { + width: 780px; + color: #292929; + font-style: normal; + font-weight: normal; + border-width: 0px; + padding: 0px; + margin: 0px; + background-position: left top; + background-repeat: no-repeat; + background-image: url('../../images/logo.jpg'); + background-color: #292929; + height: 94px; + position: relative; + left: 27ex; +} + +#Menu, #IPageLogo { + font-size: 9pt; +} + +body.IndexPage { + background-image: url('../../images/background.jpg'); +} + +/*#IPageLogo:hover { + cursor: pointer; +}*/ + +.IPageTitle { + background-color:#FFFFF0; + color: #333333; + border: 0px; +} + + + +div.nav { + position:relative; + top: 70px; + text-align: right; +} + +a.nav span { + font-size: 11px; + position: relative; + bottom: 2px; +} + +a.nav:visited { + text-decoration: none; + border: 0px; + color: #aaaaaa; +} + +a.nav, a.nav:link { + border: 0px; + text-decoration: none; + font-family: Tahoma, "Helvetica Neue", "Trebuchet MS", Verdana, Arial, sans-serif; + font-size: 16px; + color: #aaaaaa; + margin-right: 11px; +} + +a.nav:hover { + text-decoration: none; + border: 0px; + color: #E0771C; +} + +a.nav:active { + text-decoration: none; + border: 0px; + color: #E0771C; +} + + diff --git a/public/site_assets/test/js/dist/docs/styles/main.css b/public/site_assets/test/js/dist/docs/styles/main.css new file mode 100644 index 00000000..c24541cf --- /dev/null +++ b/public/site_assets/test/js/dist/docs/styles/main.css @@ -0,0 +1,2 @@ +@import URL("1.css"); +@import URL("2.css"); diff --git a/public/site_assets/test/js/dist/examples/KCPsample4.csv b/public/site_assets/test/js/dist/examples/KCPsample4.csv new file mode 100644 index 00000000..453517b0 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/KCPsample4.csv @@ -0,0 +1,25 @@ +Product or service,v01,v02,v03,v04,v05,v06,v07,v08,v09,v10,v11,v12,v13,v14,v15,v16,v17,v18,v19,v20 +Rice,15.8442,13.0993,11.2898,10.7892,10.252,9.0165,8.5287,7.7442,6.9867,6.5213,5.9473,5.4766,4.9214,4.6398,3.8935,3.5228,3.0128,2.4847,2.0357,1.0672 +Bread and other cereals,1.7703,2.2535,2.2753,2.7927,2.2509,2.4341,2.5518,2.5547,2.4204,2.4186,2.4261,2.2927,2.4386,2.2295,2.2203,1.915,1.8791,1.7941,1.6567,0.9296 +Meat,8.3728,8.1221,8.3989,7.9758,8.8246,8.2377,8.432,7.8466,7.5343,7.1171,6.9801,6.9349,5.8307,5.7089,4.927,4.2237,3.6872,3.1429,2.581,1.3766 +Fish and seafood,9.1249,8.7326,7.6122,7.8577,7.1625,6.8527,6.5158,6.1715,6.1298,5.8702,5.3456,4.9906,4.4424,4.3022,3.5298,3.405,2.9977,2.4159,2.0832,1.1499 +Fruits and vegetables,8.0508,7.7875,7.6534,7.4448,7.3702,7.4188,7.3882,7.1647,6.9617,6.6576,6.6077,6.4823,5.9117,5.8149,5.505,5.5355,5.0907,4.569,4.3049,2.6325 +Other food products,10.4408,9.8278,9.9293,9.5176,9.6658,9.2359,9.2842,8.6497,8.7656,8.2962,8.155,7.7294,7.3674,6.9888,6.2995,5.7314,5.2703,4.6947,3.9614,2.2509 +Catering services,4.1883,4.7514,5.3198,5.8819,5.1732,5.5764,6.1713,6.7915,6.8511,7.2681,7.1461,8.109,9.2649,9.5322,11.2138,12.8299,12.9621,13.8936,13.7828,10.0525 +Non-alcoholic beverages,0.6641,0.8454,0.9018,1.0461,1.0113,1.235,1.279,1.3049,1.5024,1.4471,1.5358,1.5796,1.6471,1.6443,1.6562,1.6763,1.6097,1.5039,1.3752,0.864 +Alcoholic beverages,0.5221,0.6997,0.8513,0.8849,0.9168,0.9099,0.8339,0.9921,1.1169,1.1764,1.1936,1.1415,1.1181,1.2889,1.1378,1.023,1.1283,1.0417,0.9839,0.587 +Tobacco and narcotics,1.0969,1.188,1.0713,1.2803,1.1787,1.148,1.3229,1.1726,1.3764,1.3887,1.4011,1.3034,1.4368,1.5017,1.4899,1.4123,1.3168,1.1407,0.8458,0.38 +Clothing and footwear,2.275,2.5511,3.1025,2.9834,3.2857,3.7625,3.1928,3.7071,4.0364,3.629,3.9258,3.2208,3.7113,3.3166,3.4775,3.429,3.6121,3.4569,3.8416,4.1323 +Rentals (actual or imputed) and maintenance and repair of the dwelling,16.0654,15.719,16.3773,16.0175,15.8853,16.132,16.1309,16.3491,15.8512,16.4743,16.2862,15.7327,16.2793,16.6329,17.4903,17.4425,17.3413,18.3527,18.5029,15.2763 +Water supply and miscellaneous services related to the dwelling,1.1145,1.176,1.1183,1.0411,1.0058,1.0796,1.0321,1.0714,1.1117,1.0278,1.136,1.1397,1.1556,1.2206,1.2871,1.2361,1.2111,1.2312,1.1545,0.7881 +Electricity gas and other fuels,4.5928,4.7558,4.8855,4.4684,4.6677,4.6038,4.7789,4.6098,4.4171,4.5078,4.4137,4.4645,4.2693,4.2836,4.1709,4.159,3.8423,3.9957,3.6816,2.5785 +Furnishing household equipment and routine household maintenance,2.1027,2.1576,2.0721,2.0623,2.3498,2.2573,2.2866,2.3766,2.2488,2.3665,2.3445,2.2474,2.3345,2.2479,2.158,2.355,2.0744,2.2269,3.0474,3.8925 +Health,1.2709,1.6007,1.3996,1.612,1.4649,1.5875,1.7056,1.7315,1.7378,2.0401,2.3265,2.1096,2.0513,2.1548,2.0634,2.2206,1.8427,2.4817,2.3066,2.1685 +Transport,4.6414,5.6167,5.9571,6.5372,7.0242,7.6332,7.9823,8.3906,9.112,9.6872,10.2014,11.0074,11.375,11.6753,12.0489,12.0692,13.2962,13.2183,14.6559,32.0912 +Communication,0.2334,0.3642,0.5267,0.5911,0.8888,1.1633,1.0997,1.76,1.9811,2.1708,2.931,3.2634,3.6254,4.107,4.6944,5.0941,5.9984,6.2419,6.6059,5.8353 +Recreation and culture,2.2553,2.8903,2.9564,3.2839,3.4822,3.255,3.1666,3.4245,3.4066,3.8536,3.6333,4.0331,4.4847,4.3552,4.2768,4.1439,4.7196,4.6585,4.4286,3.921 +Education,0.3437,0.3282,0.4805,0.3881,0.4796,0.9766,0.6589,0.6443,1.0423,0.7941,1.064,1.5504,1.3977,1.5226,1.8344,1.9186,2.3022,2.8188,2.8424,2.7792 +Personal care,3.4466,3.5641,3.5711,3.4219,3.2835,3.3569,3.3416,3.4544,3.3675,3.2806,3.118,3.1881,3.2252,3.0588,3.0051,2.9868,3.0361,2.8972,2.9611,2.2867 +Other miscellaneous goods and services,1.5831,1.9691,2.2498,2.122,2.3766,2.1273,2.3165,2.0884,2.0421,2.0067,1.8809,2.0027,1.7115,1.7734,1.6204,1.6702,1.769,1.7391,2.3607,2.9604 +Food and non-alcoholic beverages,58.4561,55.4196,53.3806,53.3059,51.7105,50.007,50.1509,48.2276,47.1521,45.5962,44.1436,43.5952,41.8242,40.8606,39.2451,38.8396,36.5095,34.4988,31.7809,20.3231 +Non food,41.5439,44.5804,46.6194,46.6941,48.2895,49.993,49.8491,51.7724,52.8479,54.4038,55.8564,56.4048,58.1758,59.1394,60.7549,61.1604,63.4905,65.5012,68.2191,79.6769 diff --git a/public/site_assets/test/js/dist/examples/ages.json b/public/site_assets/test/js/dist/examples/ages.json new file mode 100644 index 00000000..86916187 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/ages.json @@ -0,0 +1,5 @@ +[[1043353182,539695335,503657847,28.24,27.51,29.01,51.78], +[0.0085318435343400800,0.0088774027062416400,0.0094714560875224100,0.0101640893891056000,0.0108249758696292000,0.0113773174183149000,0.0117954271696904000,0.0120868766491156000,0.0122726357410028000,0.0123620512208843000,0.0124092312631522000,0.0123929933989534000,0.0123170841477326000,0.0121788940682660000,0.0119848553256476000,0.0117367932349178000,0.0114334768233470000,0.0110840887113746000,0.0107005336950161000,0.0102889073661635000,0.0098746874267631800,0.0094727992165526500,0.0091066817836288100,0.0087853078056091400,0.0085176451289595700,0.0082955898249666400,0.0081021034227657000,0.0079410857437656400,0.0078129432771183200,0.0077041517746791700,0.0076076629996558600,0.0075063773837400400,0.0074212932416191700,0.0073577960797626100,0.0073199937766648000,0.0072872222696609900,0.0072249036551971000,0.0071436496521446000,0.0070535868312601700,0.0069442503777637000,0.0068032069975035000,0.0066093294501292200,0.0063936409488174700,0.0061768176372133200,0.0059737878831400300,0.0057724507581444500,0.0055456647375558400,0.0053139201135624000,0.0050952395722700100,0.0048873227886988200,0.0046839194356973000,0.0044709211871979300,0.0042683374557587400,0.0040886232834079100,0.0039394433696905200,0.0038097165950705600,0.0036797119436340500,0.0035595490798891500,0.0034559622921317600,0.0033586853733251200,0.0032515219944251700,0.0031141174480235800,0.0029601056879342400,0.0027997057390388600,0.0026388958299152400,0.0024706340765107900,0.0022829305753990900,0.0020900571013307600,0.0019037152224417700,0.0017251049256371200,0.0015499961243315000,0.0013709889555399900,0.0011982773790103000,0.0010401790931594200,0.0009015220565900700,0.0007812832602556460,0.0006749752626942340,0.0005833580512023270,0.0005061657847658260,0.0004399544894590220,0.0003808034210932470,0.0003273788998735520,0.0002794993115460400,0.0002369793671257210,0.0001995479850687680,0.0001668101805315270,0.0001383186716039340,0.0001138075253115040,0.0000929924552954457,0.0000755223736670678,0.0000610047525059652,0.0000490638302928227,0.0000396489252832302,0.0000330891826825378,0.0000281195284929135,0.0001070412478036410], +[0.0071192629623232800,0.0072839317935624000,0.0075693293189514500,0.0079091875498352200,0.0082360857829773300,0.0084979038169712600,0.0086893986451354100,0.0088353986277422900,0.0089633895658643000,0.0090878796761182500,0.0092337667384807200,0.0093792123312149900,0.0095192745279032600,0.0096463104169553400,0.0097588790000607600,0.0098544841215461300,0.0099282199747865200,0.0099763812248601700,0.0099957597226035700,0.0099801585489242500,0.0099375446097938400,0.0098709094654945100,0.0097926096630396900,0.0097014318757340600,0.0095968423362564000,0.0094699215837397400,0.0093120985109391200,0.0091337644254482100,0.0089445678055607600,0.0087423328014590000,0.0085321350430430500,0.0083104164267343500,0.0081040369311665900,0.0079207770770160300,0.0077675098774536000,0.0076284130950824500,0.0074765938644635800,0.0073237591351693500,0.0071772210497332700,0.0070244435483804400,0.0068550745015274400,0.0066526057090785200,0.0064404461001358000,0.0062305720357510500,0.0060342707683446500,0.0058408705961082800,0.0056264339860478000,0.0054065565344313600,0.0051920462742280000,0.0049765895152515200,0.0047558832991186200,0.0045207003388048400,0.0042899070487080500,0.0040745089551306800,0.0038817655555785800,0.0037053224400247200,0.0035332134254902200,0.0033727187145046400,0.0032284905944481100,0.0030937679725170100,0.0029582187048090100,0.0028081834596732200,0.0026513461722362800,0.0024926069125082600,0.0023353006048059200,0.0021744630786167700,0.0020021420693961100,0.0018298895084829500,0.0016671380010344600,0.0015153637133401800,0.0013712248188900700,0.0012284616818527500,0.0010934572254154500,0.0009707133813897040,0.0008622603131043950,0.0007661899219731710,0.0006786114871838230,0.0006005435486257860,0.0005322956370150040,0.0004715229254612440,0.0004158721219136000,0.0003645948643149670,0.0003176904909297340,0.0002751152300590630,0.0002367021156783720,0.0002021700726755280,0.0001712214234345020,0.0001437557719387760,0.0001197138111336940,0.0000989925882290494,0.0000814263200020563,0.0000667991474109870,0.0000549164545704749,0.0000455518367647343,0.0000384480445034309,0.0001437755914949950], +[1.284165231,1.3059697282,1.3408259576,1.3770498469,1.4083776842,1.4346340126,1.4545779876,1.4658887137,1.4671638972,1.457608962,1.4400548643,1.4158684686,1.3864911961,1.3528812542,1.3159697978,1.27622903,1.2340137083,1.1905291022,1.1471037258,1.1047013276,1.0647737249,1.0283340659,0.9964942039,0.9703629438,0.9510519527,0.9386721807,0.932316307,0.9316292996,0.9359838821,0.9443012277,0.9554470086,0.9678781103,0.9812761433,0.9953894103,1.0098153246,1.0236249732,1.035479081,1.0451994053,1.0530930686,1.0593183708,1.0634438538,1.0645809137,1.0637641578,1.0623066923,1.0608111193,1.0589993944,1.0561690641,1.0531914677,1.0515722425,1.052330754,1.0553372965,1.0597522653,1.0661637808,1.0752634417,1.0874733411,1.1017415355,1.1159815378,1.1309096828,1.1470504754,1.1633078085,1.1777943775,1.1882903501,1.1963378464,1.2035708256,1.2108560457,1.2175013424,1.2218302494,1.2239011525,1.223611334,1.2198647763,1.2112533925,1.1958739376,1.1742717733,1.1482333683,1.1203430352,1.0926602484,1.0658097999,1.040887396,1.0189501507,0.9998112064,0.9811922123,0.9621730704,0.9427349027,0.9230154312,0.903354613,0.8841353287,0.8656369091,0.8483181293,0.8323701879,0.8174967062,0.8028084248,0.7870522949,0.7736454722,0.7783827557,0.7836945697,0.7977724963], +[0,1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,36,37,38,39,40,41,42,43,44,45,46,47,48,49,50,51,52,53,54,55,56,57,58,59,60,61,62,63,64,65,66,67,68,69,70,71,72,73,74,75,76,77,78,79,80,81,82,83,84,85,86,87,88,89,90,91,92,93,94,"95+", ""]] \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/ajax-loader.gif b/public/site_assets/test/js/dist/examples/ajax-loader.gif new file mode 100644 index 00000000..3288d103 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/ajax-loader.gif differ diff --git a/public/site_assets/test/js/dist/examples/area.html b/public/site_assets/test/js/dist/examples/area.html new file mode 100644 index 00000000..7918fd03 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/area.html @@ -0,0 +1,289 @@ + + + + + + Filled (Area) Charts + + + + + + + + + + + + + +
+
+
+ + + + + + +

Area charts support highlighting and mouse events by default. The options and handlers and callbacks are essentially the same as with bar, pie, donut and funnel charts. One notable exception for area charts is that no data point index will be provided to the callback and the entire data set for the highlighted area will be returned. This is because the area is not associated with one particular data point, but with the entire data set of the series.

+ +
Moused Over: Nothing
+ +
+ +

For the chart below, mouseover has been disabled and click handling is enabled by setting "highlightMouseDown: true". For "fillToZero" area charts that have both negative and positive values as shown below, clicking in either the positive of negative regions will generate the same result.

+ +
You Clicked: Nothing yet
+ +
+ +
+ +
I'm a tooltip.
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/axisLabelTests.html b/public/site_assets/test/js/dist/examples/axisLabelTests.html new file mode 100644 index 00000000..57244d34 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/axisLabelTests.html @@ -0,0 +1,217 @@ + + + + + + Axis Labels + + + + + + + + + + + + + +
+
+
+ + + + +

jqPlot support axis labels through the "label" option of each axis. The default label renderer creates labels in div tags, which allows full css control over every label. Labels are assigned css classes like "jqplot-axis_name-label" where "axis_name" will be xaxis, yaxis, etc.

+ +
+ +

+
+
+

By including the "jqplot.canvasTextRenderer.min.js" and "jqplot.canvasAxisLabelRenderer.min.js" plugins, you can render label text directly onto canvas elements. This allows text to be rotated and yaxes will have their labels rotated 90 degrees by default. By default the labels will be rendered using the Hershey font metrics and not stroked as text. Most recent browsers (include IE 9) support native text rendering in canvas elements.

+ +
+ +

+
+      
+

If a visitors is using a browser suppporting native canvas fonts, the plot belowsupported browser, they will see the labels in the plot below rendered as 12 pt Georgia (or their system serif font if Georgia is unavailable). If they are on an unsupported browser, they will see the default Hershey font.

+ +
+ +

+
+
+  
+
+  
+
+  
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+  
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/axisLabelsRotatedText.html b/public/site_assets/test/js/dist/examples/axisLabelsRotatedText.html new file mode 100644 index 00000000..c3e7ebec --- /dev/null +++ b/public/site_assets/test/js/dist/examples/axisLabelsRotatedText.html @@ -0,0 +1,289 @@ + + + + + + Axis Labels and Rotated Text + + + + + + + + + + + + + +
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/axisScalingForceTickAt.html b/public/site_assets/test/js/dist/examples/axisScalingForceTickAt.html new file mode 100644 index 00000000..bc40d700 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/axisScalingForceTickAt.html @@ -0,0 +1,300 @@ + + + + + + Force Plot to Have Tick at 0 or 100 + + + + + + + + + + + + + +
+
+
+ + + + + + + + + + + + + + + + + + + +
+

+
+

+
+

+
+

+
+

+
+ +
+ + +
+
+ + +
+ +

+
+
+
+
+
+
+    
+    
+    
+    
+
+
+  
+  
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/bandedLine.html b/public/site_assets/test/js/dist/examples/bandedLine.html new file mode 100644 index 00000000..ac6b2c9d --- /dev/null +++ b/public/site_assets/test/js/dist/examples/bandedLine.html @@ -0,0 +1,370 @@ + + + + + + Error Bands and Confidence Intervals + + + + + + + + + + + + + +
+
+
+ + + +

Bands (like confidence intervals or error bands) can be added to line charts through the "bands" option of the line renderer. The band data can be automatically computed or manually assigned. If assigned manually, the simpliest approach is to set the "rendererOptions: { bandData: [] }" array on the series. Note that band data is taken into account when axes scale themselves so bands will not get clipped.

+ + +

Band data can be supplied as arrays of [x,y] values. One array for the upper band line and one for the lower band line.

+ +
+

+
+
+

The number of points in the band data arrays does not have to correspond to the number of points in the data series. Also, band data will be drawn as smoothed lines if the data series is smoothed.

+ +
+

+
+

In this example, band data is supplied as an array of arrays of y values for the low and hi bands. X values for the bands are taken from the x values of the series. The band data is of the form: [ [y low 1, y hi 1], [y low 2, y hi 2], ... ] and there must be a corresponding array of low/hi y values for each x value in the data series.

+ +
+

+
+

The band data can also be supplied as an array of [low y values], [hi y values]. In this case there must also be an equal number of low y values and hi y values as there are data points in the series. X values for the low and hi bands will be taken from the series data. Additionally, the order of low/hi values does not matter as long as they are consistent. jqPlot will figure out which is the low values and which are the high values.

+ +
+

+
+

Band data does not have to be provided. By default, jqPlot will compute +/- 3% band intervals if the "rendererOptions: { bands: { show: true } }" option is set. The band intervals can be customized as well through the "rendererOptions: { bands: { interval: [number|string|arry] } }" option. Valid intervals are:

+ +
    +
  • '1.7' - will add bands at y +/- 1.7 above and below the line.
  • +
  • '10%' - will compute +/- 10% interval bands.
  • +
  • [3, '-10%'] - will add bands at y + 3 and y - 10% above and below the line.
  • +
+ +

Examples of such interval specifications are shown below:

+ +
+

+ 
+

+
+ 
+

+    
+

You can also customize the fill color of the bands and turn on/off band lines. By default, bands respond to the mouse over event, but they can be set to respond to mouse down as well.

+
+

+
+

Note, the plots on this page all extend the following pre-defined theme:

+ +

+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+    
+    
+    
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/bar-charts.html b/public/site_assets/test/js/dist/examples/bar-charts.html new file mode 100644 index 00000000..6c17fbed --- /dev/null +++ b/public/site_assets/test/js/dist/examples/bar-charts.html @@ -0,0 +1,279 @@ + + + + + + Vertical and Horizontal Bar Charts + + + + + + + + + + + + + +
+
+
+ + + + + + + +
+ +

+
+    
+ +

+
+    

Click on a bar in the plot below to update the text box.

+

You Clicked: + Nothing yet. +

+
+ +

+
+  
+  
+
+
+
+    
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+    
+    
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/barLineAnimated.html b/public/site_assets/test/js/dist/examples/barLineAnimated.html new file mode 100644 index 00000000..0dec339a --- /dev/null +++ b/public/site_assets/test/js/dist/examples/barLineAnimated.html @@ -0,0 +1,225 @@ + + + + + + Animated Charts + + + + + + + + + + + + + +
+
+
+ + + + +
+ +

This plot animates the bars bottom to top and the line series left to right upon initial page load. Since the animateReplot: true option is set, the bars and line will also animate upon calls to plot1.replot( { resetAxes: true } ).

+ +

+
+
+ 
+
+
+
+
+
+    
+    
+    
+    
+
+
+  
+  
+   
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/barTest.html b/public/site_assets/test/js/dist/examples/barTest.html new file mode 100644 index 00000000..8296c6a5 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/barTest.html @@ -0,0 +1,358 @@ + + + + + + Bar Charts + + + + + + + + + + + + + +
+
+
+ + + + +

Below is a default bar plot. Bars will highlight on mouseover. Events are triggered when you mouseover a bar and also when you click on a bar. Here We capture the 'jqplotDataClick' event and display the clicked series index, point index and data values. When series data is assigned as a 1-dimensional array as in this example, jqPlot automatically converts it into a 2-dimensional array for plotting. So a series defined as [2, 6, 7, 10] will become [[1,2], [2,6], [3,7], [4,10]].

+ +

You Clicked: Nothing yet
+ +
+

+
+    

The plot target also fires a 'jqplotDataMouseOver' when the cursor is moused over a bar even if highlighting is turned off. This event will fire continuously as the user mouses over the bar. 'jqplotDataHighlight' fires only once when the user first passes over the bar. Additionally, a 'jqplotDataUnhighlight' event is fired when the user moves out of a bar (if highlighting is enabled).

+ +

Moused Over: Nothing
+ +
+

+    
+    
Moused Over: Nothing
+
Clicked: Nothing
+ +
+

+    
+    

The next example has the plot's 'captureRightClick' option set to true. This causes the plot to fire a 'jqplotRightClick' event the the user clicks the right mouse button over a bar. Here, the 'highlightMouseDown' option is also set to true. This will highlight a slice on mouse down instead of on move over. Highlighting will occur for either left or right click.

+ +
You Right Clicked: Nothing yet
+ +
+

+    
+    
+

+    
+    
+

+        
+

A pie chart is added to test for incompatibilities.

+
+

+
+

The next example shows the placement of point labels on negative bars. They should be placed on the opposite position. That is, if it is placed 'north' to the positive bars, then it should be placed 'south' to the negative bars.

+
+

+
+  
+    
+  
+    
+  
+    
+  
+    
+  
+    
+  
+
+   
+
+     
+
+
+
+
+
+    
+    
+    
+    
+
+
+  
+  
+  
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/bezierCurve.html b/public/site_assets/test/js/dist/examples/bezierCurve.html new file mode 100644 index 00000000..0ac8f0dc --- /dev/null +++ b/public/site_assets/test/js/dist/examples/bezierCurve.html @@ -0,0 +1,185 @@ + + + + + + Bezier Curve Plots + + + + + + + + + + + + + +
+
+
+ + + + +

The Bezier curve renderer can distinguish between two different input data formats. This first example has the data passed in as 2 data points, the second one defining the Bezier curve to the end point. With this format, non-default axes renderers will require specifying the minimum and maximum on the axes.

+
+    [[xstart, ystart], [cp1x, cp1y, cp2x, cp2y, xend, yend]];
+
+
+

This second example has the data broken out into 4 points, which will be assembled to define the Bezier Curve. With this format, any axes renderer can be used without explicitly specifying the minimum and maximum.

+
+    [[xstart, ystart], [cp1x, cp1y], [cp2x, cp2y], [xend, yend]];
+
+
+

Here is an example using a date axis renderer with Bezier curves. The data looks like:

+
+    [['01/01/2010', 6], ['02/01/2010', 9], ['03/01/2010', 8], ['04/01/2010', 3]]
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/blockPlot.html b/public/site_assets/test/js/dist/examples/blockPlot.html new file mode 100644 index 00000000..94f4ebb3 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/blockPlot.html @@ -0,0 +1,259 @@ + + + + + + Block Plots + + + + + + + + + + + + + +
+
+
+ + + + +

Below is an example block plot. This plot also uses the Enhanced Legend Renderer plugin. Clicking on an item in the legend will toggle display of the appropriate series.

+ +
+ +

Blocks can be moved by selecting the series, the point, and an optional duration parameter. If specified, duration will animate the movement. Duration is either a number in milliseconds, or the keywords 'fast' or 'slow'. Higher numbers will cause a slower animation.

+ Series: + Point: + Duration: + X: + Y: + +

+    
+    
+    

This second chart is like the first except the "varyBlockColors" renderer option is set to true. This will vary the color of each block in a series separately. This allows displaying a third dimension to the data such as grouping beverage products by producer and by category such as "cola", "tea", "energy drink", etc.

+ +

Also, the legend has its "showSwatches" option set to false, since the blocks of each series will be of varying color and won't correspond to one swatch color. This still enables the user to show and hide the series by clicking on a label in the legend.

+ +
+ + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/bubble-plots.html b/public/site_assets/test/js/dist/examples/bubble-plots.html new file mode 100644 index 00000000..c52d5be6 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/bubble-plots.html @@ -0,0 +1,273 @@ + + + + + + Bubble Plots + + + + + + + + + + + + + +
+
+
+ + + + + + +

Bubble charts represent 3 dimensional data. First, a basic bubble chart with the "bubbleGradients: true" option to specify gradient fills. Radial gradients are not supported in IE version before IE 9 and will be automatically disabled.

+ +
+ +

+
+
+

Data is passed in to a bubble chart as a series of [x, y, radius, <label or object>]. The optional fourth element of the data point can either be either a label string or an object having 'label' and/or 'color' properties to assign to the bubble.

+ +

By default, all bubbles are scaled according to the size of the plot area. The radius value in the data point will be adjusted to fit the bubbles in the chart. If the "autoscaleBubbles" option is set to false, the radius value in the data will be taken as a literal pixel value for the radius of the points.

+ +

Next are some basic customizations of bubble appearance with the "bubbleAlpha" and "highlightAlpha" options.

+ +
+ +

+
+
+

In the following example, display of a custom toolip and highlighting of a custom table legend is performed by binding to the "jqplotDataHighlight" and "jqplotDataUnhighlight" events. The custom legend table here is dynamically created with a few lines of jQuery (O.K., it could be done in one line) based on the data array of the plot.

+ + + + + + +
CompanyR Value
+ +

+
+
+
+  
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/bubbleChart.html b/public/site_assets/test/js/dist/examples/bubbleChart.html new file mode 100644 index 00000000..16752574 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/bubbleChart.html @@ -0,0 +1,324 @@ + + + + + + Bubble Charts + + + + + + + + + + + + + +
+
+
+ + + + + + + +

Bubble charts represent 3 dimensional data. Data is passed in to a bubble chart as a series of [x, y, radius, <label or object>]. The optional fourth element of the data point can either be either a label string or an object having 'label' and/or 'color' properties to assign to the bubble.

+ +

By default, all bubbles are scaled according to the size of the plot area. The radius value in the data point will be adjusted to fit the bubbles in the chart. If the "autoscaleBubbles" option is set to false, the radius value in the data will be taken as a literal pixel value for the radius of the points.

+ +

The below chart show basic customization of bubble appearance with the "bubbleAlpha" and "highlightAlpha" options.

+ +
+

+
+
+
+
+    
+    
+
CompanyR Value
+

+
+

Below is a basic bubble chart showing usage of the optional label and color properties passed in with the data.

+ +
+

+
+

The next chart uses the "bubbleGradients: true" option to specify gradient fills on the bubbles. Radial gradients are not supported in IE* and will be automatically disabled.

+ +
+ +

*Radial gradients are not supported in IE 7 and IE 8 because they are not supported in the excanvas emulation layer used by jqPlot to render charts in IE 7 and IE 8. jqPlot renders charts using the HTML canvas element which is supported by nearly every browser including IE 9. Excanvas translates the canvas rendering to VML rendering for IE 7 and 8, but unfortunately does not properly handle radial gradients.

+ +

+
+

The following bubble chart shows the "autoscalePointsFactor" and "autoscaleMultiplier" options which can be used to control bubble scaling. The "autoscalePointsFactor" options controls bubble scaling with the number of points on the plot. A negative value will decrease bubble size and number of bubbles increases. The "autoscaleMultiplier" will makes all bubbles larger or smaller for values greater or less than 1.0.

+ +

This chart also demonstrates some of the highlighting options. Bubble highlighting is controlled with the "highlightMouseOver" and "highlightMouseDown" boolean options. Here the "highlightMouseDown: true" option is set which causes the plot to highlight on mousedown (click). This automatically sets the "highlightMouseOver" option to false.

+ +

Events are also trigger with plot interaction. Specifically, "jqplotDataHighlight", "jqplotDataUnhighlight", "jqplotDataClick" and "jqplotDataRightClick" events are triggered. Handlers are passed an event object, the series index, the point index, and the bubble data.

+ +
+

+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/candlestick-charts.html b/public/site_assets/test/js/dist/examples/candlestick-charts.html new file mode 100644 index 00000000..a097f4e2 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/candlestick-charts.html @@ -0,0 +1,269 @@ + + + + + + Open Hi Low Close and Candlestick Charts + + + + + + + + + + + + + +
+
+
+ + + + +

OHLC, HLC and Candlestick charts are all created using the $.jqplot.OHLCRenderer plugin. The plots on this page make use of the highlighter plugin which shows a customized tooltip as the mouse moves over a data point.

+
+ +

+
+
+ +

+
+

The previous plots use the following data set. jqPlot will parse most human readable date formats. It is always safest, however, to pass a date in as a JavaScript timestamp rather than have jqPlot parse an arbitrary date string.

+ +

+
+
+
+
+
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+    
+    
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/candlestick.html b/public/site_assets/test/js/dist/examples/candlestick.html new file mode 100644 index 00000000..96712193 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/candlestick.html @@ -0,0 +1,380 @@ + + + + + + Candlestick and Open Hi Low Close Charts + + + + + + + + + + + + + +
+
+
+ + + + +
+

+
+

+
+

+
+

+
+

+

The examples on this page use the folowing code:

+

+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+    
+    
+    
+    
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/canvas-overlay.html b/public/site_assets/test/js/dist/examples/canvas-overlay.html new file mode 100644 index 00000000..e644af50 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/canvas-overlay.html @@ -0,0 +1,291 @@ + + + + + + Draw Lines on Plots - Canvas Overlay + + + + + + + + + + + + + +
+
+
+ + + + + +
+ + + +

+
+    
+

+
+  
+  
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+  
+  
+  
+  
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/bar-alpha.png b/public/site_assets/test/js/dist/examples/colorpicker/images/bar-alpha.png new file mode 100644 index 00000000..2950daeb Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/bar-alpha.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/bar-opacity.png b/public/site_assets/test/js/dist/examples/colorpicker/images/bar-opacity.png new file mode 100644 index 00000000..e42ad081 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/bar-opacity.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/bar-pointer.png b/public/site_assets/test/js/dist/examples/colorpicker/images/bar-pointer.png new file mode 100644 index 00000000..6e980cfa Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/bar-pointer.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/bar.png b/public/site_assets/test/js/dist/examples/colorpicker/images/bar.png new file mode 100644 index 00000000..80eb2bbe Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/bar.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/map-opacity.png b/public/site_assets/test/js/dist/examples/colorpicker/images/map-opacity.png new file mode 100644 index 00000000..6756cee6 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/map-opacity.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/map-pointer.png b/public/site_assets/test/js/dist/examples/colorpicker/images/map-pointer.png new file mode 100644 index 00000000..64992968 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/map-pointer.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/map.png b/public/site_assets/test/js/dist/examples/colorpicker/images/map.png new file mode 100644 index 00000000..853d38c6 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/map.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/preview-opacity.png b/public/site_assets/test/js/dist/examples/colorpicker/images/preview-opacity.png new file mode 100644 index 00000000..0dd9a2f8 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/preview-opacity.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/images/ui-colorpicker.png b/public/site_assets/test/js/dist/examples/colorpicker/images/ui-colorpicker.png new file mode 100644 index 00000000..e244c689 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/colorpicker/images/ui-colorpicker.png differ diff --git a/public/site_assets/test/js/dist/examples/colorpicker/index.html b/public/site_assets/test/js/dist/examples/colorpicker/index.html new file mode 100644 index 00000000..70920cdd --- /dev/null +++ b/public/site_assets/test/js/dist/examples/colorpicker/index.html @@ -0,0 +1,229 @@ + + + + jQuery Colorpicker + + + + + + + + + + + + +

jQuery ColorPicker

+ +
+ + +
+

Basic <input> example, without any options

+ +
+ +
+

Basic element (<span>> example, without any options

+ +
+ +
+

Fully-featured example

+ +
+ +
+

Localized to Dutch (nl)

+ +
+ +
+

Limit to websafe colors

+ +
+ +
+

Alternative field class

+ + +
Background-color on outside, text color here
+
+
+ +
+

Events

+ +
+
+ +
+

Output formatting HSLA

+ + +
+ +
+

Output format list

+ You can specify a list of output formats, the first perfect match for the color is output. + + +
+ +
+

Dialog with Colorpicker popup (demonstrates z-index)

+ +
+ Basic <input> example, without any options: +
+ Basic element example, without any options: +
+
+ +
+

Modal (and showCancelButton, closeOnEscape, showCloseButton)

+ +
+ +
+

Input formatting

+ Demonstrates the ability to parse common color formats as input. + +
+ +
+

Popup from any element (<em>)

+ Just click on this Emphasized word to show the colorpicker. +
+
+ + + + diff --git a/public/site_assets/test/js/dist/examples/colorpicker/jquery.colorpicker.css b/public/site_assets/test/js/dist/examples/colorpicker/jquery.colorpicker.css new file mode 100644 index 00000000..8487cdce --- /dev/null +++ b/public/site_assets/test/js/dist/examples/colorpicker/jquery.colorpicker.css @@ -0,0 +1,199 @@ +.ui-colorpicker, +.ui-dialog.ui-colorpicker { + width: auto; + white-space: nowrap; + + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.ui-colorpicker-inline { + position: static; +} + +.ui-colorpicker-buttonset { + float: left; + margin-left: .4em; +} + +.ui-colorpicker-buttonset .ui-button { + margin: .5em 0 .5em 0; + cursor: pointer; +} + +.ui-colorpicker-buttonpane { + background-image: none; + margin: .7em 0 0 0; + padding: 0 .2em; + border-left: 0; + border-right: 0; + border-bottom: 0; +} + +.ui-colorpicker-buttonpane button { + float: right; + margin: .5em .2em .4em; + cursor: pointer; + padding: .2em .6em .3em .6em; + width: auto; + overflow: visible; +} + +.ui-colorpicker-buttonpane button.ui-colorpicker-current { + float: left; +} + +.ui-colorpicker table { + font-size: 100%; /* Reset browser table font-size */ + margin: 0; +} + +.ui-colorpicker table td { + vertical-align: top; +} + +.ui-colorpicker-padding-left { + padding-left: 10px; +} +.ui-colorpicker-padding-top { + padding-top: 10px; +} + +.ui-colorpicker-border { + border: 1px inset; + display: inline-block; +} + +/* Bar & map */ +.ui-colorpicker-map > *, +.ui-colorpicker-bar > * { + position: absolute; + cursor: crosshair; +} + +.ui-colorpicker-map-pointer, +.ui-colorpicker-bar-pointer { + position: absolute; +} +/* Map */ +.ui-colorpicker-map, +.ui-colorpicker-map > * { + display: block; + width: 256px; + height: 256px; + overflow: hidden; +} + +.ui-colorpicker-map-layer-1, +.ui-colorpicker-map-layer-2 { + background: url(images/map.png) no-repeat; +} + +.ui-colorpicker-map-layer-alpha { + background: url(images/map-opacity.png); +} + +.ui-colorpicker-map-pointer { + display: inline-block; + width: 15px; + height: 15px; + background: url(images/map-pointer.png) no-repeat; +} + +/* Bar */ +.ui-colorpicker-bar, +.ui-colorpicker-bar > * { + display: block; + width: 20px; + height: 256px; + overflow: hidden; + background-repeat: repeat-x; +} + +.ui-colorpicker-bar-layer-1, +.ui-colorpicker-bar-layer-2, +.ui-colorpicker-bar-layer-3, +.ui-colorpicker-bar-layer-4 { + background: url(images/bar.png) repeat-x; +} + +.ui-colorpicker-bar-layer-alpha { + background: url(images/bar-opacity.png); +} + +.ui-colorpicker-bar-layer-alphabar { + background: url(images/bar-alpha.png); +} + +.ui-colorpicker-bar-pointer { + display: inline-block; + width: 20px; + height: 7px; + background: url(images/bar-pointer.png) no-repeat; +} + +/* Preview */ +.ui-colorpicker-preview { + text-align: center; +} + +.ui-colorpicker-preview-initial { + cursor: pointer; +} + +.ui-colorpicker-preview-initial, +.ui-colorpicker-preview-current { + width: 50px; + height: 20px; + display: inline-block; +} + +.ui-colorpicker-preview-initial-alpha, +.ui-colorpicker-preview-current-alpha { + width: 50px; + height: 20px; + display: inline-block; + background: url(images/preview-opacity.png) repeat; +} + +/* Inputs */ +.ui-colorpicker-rgb label, +.ui-colorpicker-hsv label, +.ui-colorpicker-hsl label, +.ui-colorpicker-lab label, +.ui-colorpicker-cmyk label, +.ui-colorpicker-alpha label { + width: 1.5em; + display: inline-block; +} + +.ui-colorpicker-number { + margin: .1em; + width: 4em; +} + +/* Hex */ +.ui-colorpicker-hex { + text-align: center; +} + +/* Swatches */ +.ui-colorpicker-swatches { + width: 84px; + height: 256px; + overflow: auto; + background-color: #f8f8f8; +} + +.ui-colorpicker-swatch { + cursor: pointer; + float: left; + width: 11px; + height: 11px; + border-right: 1px solid black; + border-bottom: 1px solid black; +} \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/colorpicker/jquery.colorpicker.js b/public/site_assets/test/js/dist/examples/colorpicker/jquery.colorpicker.js new file mode 100644 index 00000000..4aaee1cc --- /dev/null +++ b/public/site_assets/test/js/dist/examples/colorpicker/jquery.colorpicker.js @@ -0,0 +1,2565 @@ +/*jslint devel: true, bitwise: true, regexp: true, browser: true, confusion: true, unparam: true, eqeq: true, white: true, nomen: true, plusplus: true, maxerr: 50, indent: 4 */ +/*globals jQuery,Color */ + +/* + * ColorPicker + * + * Copyright (c) 2011-2012 Martijn W. van der Lee + * Licensed under the MIT. + * + * Full-featured colorpicker for jQueryUI with full theming support. + * Most images from jPicker by Christopher T. Tillman. + * Sourcecode created from scratch by Martijn W. van der Lee. + */ + +(function ($) { + "use strict"; + + $.colorpicker = new function() { + this.regional = []; + this.regional[''] = { + ok: 'OK', + cancel: 'Cancel', + none: 'None', + button: 'Color', + title: 'Pick a color', + transparent: 'Transparent', + hsvH: 'H', + hsvS: 'S', + hsvV: 'V', + rgbR: 'R', + rgbG: 'G', + rgbB: 'B', + labL: 'L', + labA: 'a', + labB: 'b', + hslH: 'H', + hslS: 'S', + hslL: 'L', + cmykC: 'C', + cmykM: 'M', + cmykY: 'Y', + cmykK: 'K', + alphaA: 'A' + }; + }; + + var _colorpicker_index = 0, + + _container_popup = '', + + _container_inline = '
', + + _parts_lists = { + 'full': ['header', 'map', 'bar', 'hex', 'hsv', 'rgb', 'alpha', 'lab', 'cmyk', 'preview', 'swatches', 'footer'], + 'popup': ['map', 'bar', 'hex', 'hsv', 'rgb', 'alpha', 'preview', 'footer'], + 'draggable': ['header', 'map', 'bar', 'hex', 'hsv', 'rgb', 'alpha', 'preview', 'footer'], + 'inline': ['map', 'bar', 'hex', 'hsv', 'rgb', 'alpha', 'preview'] + }, + + _intToHex = function (dec) { + var result = Math.round(dec).toString(16); + if (result.length === 1) { + result = ('0' + result); + } + return result.toLowerCase(); + }, + + _formats = { + '#HEX': function(color) { + return _formatColor('#rxgxbx', color); + } + , '#HEX3': function(color) { + var hex3 = _formats.HEX3(color); + return hex3 === false? false : '#'+hex3; + } + , 'HEX': function(color) { + return _formatColor('rxgxbx', color); + } + , 'HEX3': function(color) { + var rgb = color.getRGB(), + r = Math.round(rgb.r * 255), + g = Math.round(rgb.g * 255), + b = Math.round(rgb.b * 255); + + if (((r >>> 4) == (r &= 0xf)) + && ((g >>> 4) == (g &= 0xf)) + && ((b >>> 4) == (b &= 0xf))) { + return r.toString(16)+g.toString(16)+b.toString(16); + } + return false; + } + , 'RGB': function(color) { + return color.getAlpha() >= 1 + ? _formatColor('rgb(rd,gd,bd)', color) + : false; + } + , 'RGBA': function(color) { + return _formatColor('rgba(rd,gd,bd,af)', color); + } + , 'RGB%': function(color) { + return color.getAlpha() >= 1 + ? _formatColor('rgb(rp%,gp%,bp%)', color) + : false; + } + , 'RGBA%': function(color) { + return _formatColor('rgba(rp%,gp%,bp%,af)', color); + } + , 'HSL': function(color) { + return color.getAlpha() >= 1 + ? _formatColor('hsl(hd,sd,vd)', color) + : false; + } + , 'HSLA': function(color) { + return _formatColor('hsla(hd,sd,vd,af)', color); + } + , 'HSL%': function(color) { + return color.getAlpha() >= 1 + ? _formatColor('hsl(hp%,sp%,vp%)', color) + : false; + } + , 'HSLA%': function(color) { + return _formatColor('hsla(hp%,sp%,vp%,af)', color); + } + , 'NAME': function(color) { + return _closestName(color); + } + , 'EXACT': function(color) { //@todo experimental. Implement a good fallback list + return _exactName(color); + } + }, + + _formatColor = function (formats, color) { + var that = this, + text = null, + types = { 'x': function(v) {return _intToHex(v * 255);} + , 'd': function(v) {return Math.round(v * 255);} + , 'f': function(v) {return v;} + , 'p': function(v) {return v * 100;} + }, + channels = color.getChannels(); + + if (!$.isArray(formats)) { + formats = [formats]; + } + + $.each(formats, function(index, format) { + if (_formats[format]) { + text = _formats[format](color); + return (text === false); + } else { + text = format.replace(/\\?[argbhsvcmykLAB][xdfp]/g, function(m) { + if (m.match(/^\\/)) { + return m.slice(1); + } + return types[m.charAt(1)](channels[m.charAt(0)]); + }); + return false; + } + }); + + return text; + }, + + _colors = { + 'black': {r: 0, g: 0, b: 0}, + 'dimgray': {r: 0.4117647058823529, g: 0.4117647058823529, b: 0.4117647058823529}, + 'gray': {r: 0.5019607843137255, g: 0.5019607843137255, b: 0.5019607843137255}, + 'darkgray': {r: 0.6627450980392157, g: 0.6627450980392157, b: 0.6627450980392157}, + 'silver': {r: 0.7529411764705882, g: 0.7529411764705882, b: 0.7529411764705882}, + 'lightgrey': {r: 0.8274509803921568, g: 0.8274509803921568, b: 0.8274509803921568}, + 'gainsboro': {r: 0.8627450980392157, g: 0.8627450980392157, b: 0.8627450980392157}, + 'whitesmoke': {r: 0.9607843137254902, g: 0.9607843137254902, b: 0.9607843137254902}, + 'white': {r: 1, g: 1, b: 1}, + 'rosybrown': {r: 0.7372549019607844, g: 0.5607843137254902, b: 0.5607843137254902}, + 'indianred': {r: 0.803921568627451, g: 0.3607843137254902, b: 0.3607843137254902}, + 'brown': {r: 0.6470588235294118, g: 0.16470588235294117, b: 0.16470588235294117}, + 'firebrick': {r: 0.6980392156862745, g: 0.13333333333333333, b: 0.13333333333333333}, + 'lightcoral': {r: 0.9411764705882353, g: 0.5019607843137255, b: 0.5019607843137255}, + 'maroon': {r: 0.5019607843137255, g: 0, b: 0}, + 'darkred': {r: 0.5450980392156862, g: 0, b: 0}, + 'red': {r: 1, g: 0, b: 0}, + 'snow': {r: 1, g: 0.9803921568627451, b: 0.9803921568627451}, + 'salmon': {r: 0.9803921568627451, g: 0.5019607843137255, b: 0.4470588235294118}, + 'mistyrose': {r: 1, g: 0.8941176470588236, b: 0.8823529411764706}, + 'tomato': {r: 1, g: 0.38823529411764707, b: 0.2784313725490196}, + 'darksalmon': {r: 0.9137254901960784, g: 0.5882352941176471, b: 0.47843137254901963}, + 'orangered': {r: 1, g: 0.27058823529411763, b: 0}, + 'coral': {r: 1, g: 0.4980392156862745, b: 0.3137254901960784}, + 'lightsalmon': {r: 1, g: 0.6274509803921569, b: 0.47843137254901963}, + 'sienna': {r: 0.6274509803921569, g: 0.3215686274509804, b: 0.17647058823529413}, + 'seashell': {r: 1, g: 0.9607843137254902, b: 0.9333333333333333}, + 'chocolate': {r: 0.8235294117647058, g: 0.4117647058823529, b: 0.11764705882352941}, + 'saddlebrown': {r: 0.5450980392156862, g: 0.27058823529411763, b: 0.07450980392156863}, + 'sandybrown': {r: 0.9568627450980393, g: 0.6431372549019608, b: 0.3764705882352941}, + 'peachpuff': {r: 1, g: 0.8549019607843137, b: 0.7254901960784313}, + 'peru': {r: 0.803921568627451, g: 0.5215686274509804, b: 0.24705882352941178}, + 'linen': {r: 0.9803921568627451, g: 0.9411764705882353, b: 0.9019607843137255}, + 'darkorange': {r: 1, g: 0.5490196078431373, b: 0}, + 'bisque': {r: 1, g: 0.8941176470588236, b: 0.7686274509803922}, + 'burlywood': {r: 0.8705882352941177, g: 0.7215686274509804, b: 0.5294117647058824}, + 'tan': {r: 0.8235294117647058, g: 0.7058823529411765, b: 0.5490196078431373}, + 'antiquewhite': {r: 0.9803921568627451, g: 0.9215686274509803, b: 0.8431372549019608}, + 'navajowhite': {r: 1, g: 0.8705882352941177, b: 0.6784313725490196}, + 'blanchedalmond': {r: 1, g: 0.9215686274509803, b: 0.803921568627451}, + 'papayawhip': {r: 1, g: 0.9372549019607843, b: 0.8352941176470589}, + 'orange': {r: 1, g: 0.6470588235294118, b: 0}, + 'moccasin': {r: 1, g: 0.8941176470588236, b: 0.7098039215686275}, + 'wheat': {r: 0.9607843137254902, g: 0.8705882352941177, b: 0.7019607843137254}, + 'oldlace': {r: 0.9921568627450981, g: 0.9607843137254902, b: 0.9019607843137255}, + 'floralwhite': {r: 1, g: 0.9803921568627451, b: 0.9411764705882353}, + 'goldenrod': {r: 0.8549019607843137, g: 0.6470588235294118, b: 0.12549019607843137}, + 'darkgoldenrod': {r: 0.7215686274509804, g: 0.5254901960784314, b: 0.043137254901960784}, + 'cornsilk': {r: 1, g: 0.9725490196078431, b: 0.8627450980392157}, + 'gold': {r: 1, g: 0.8431372549019608, b: 0}, + 'palegoldenrod': {r: 0.9333333333333333, g: 0.9098039215686274, b: 0.6666666666666666}, + 'khaki': {r: 0.9411764705882353, g: 0.9019607843137255, b: 0.5490196078431373}, + 'lemonchiffon': {r: 1, g: 0.9803921568627451, b: 0.803921568627451}, + 'darkkhaki': {r: 0.7411764705882353, g: 0.7176470588235294, b: 0.4196078431372549}, + 'beige': {r: 0.9607843137254902, g: 0.9607843137254902, b: 0.8627450980392157}, + 'lightgoldenrodyellow': {r: 0.9803921568627451, g: 0.9803921568627451, b: 0.8235294117647058}, + 'olive': {r: 0.5019607843137255, g: 0.5019607843137255, b: 0}, + 'yellow': {r: 1, g: 1, b: 0}, + 'lightyellow': {r: 1, g: 1, b: 0.8784313725490196}, + 'ivory': {r: 1, g: 1, b: 0.9411764705882353}, + 'olivedrab': {r: 0.4196078431372549, g: 0.5568627450980392, b: 0.13725490196078433}, + 'yellowgreen': {r: 0.6039215686274509, g: 0.803921568627451, b: 0.19607843137254902}, + 'darkolivegreen': {r: 0.3333333333333333, g: 0.4196078431372549, b: 0.1843137254901961}, + 'greenyellow': {r: 0.6784313725490196, g: 1, b: 0.1843137254901961}, + 'lawngreen': {r: 0.48627450980392156, g: 0.9882352941176471, b: 0}, + 'chartreuse': {r: 0.4980392156862745, g: 1, b: 0}, + 'darkseagreen': {r: 0.5607843137254902, g: 0.7372549019607844, b: 0.5607843137254902}, + 'forestgreen': {r: 0.13333333333333333, g: 0.5450980392156862, b: 0.13333333333333333}, + 'limegreen': {r: 0.19607843137254902, g: 0.803921568627451, b: 0.19607843137254902}, + 'lightgreen': {r: 0.5647058823529412, g: 0.9333333333333333, b: 0.5647058823529412}, + 'palegreen': {r: 0.596078431372549, g: 0.984313725490196, b: 0.596078431372549}, + 'darkgreen': {r: 0, g: 0.39215686274509803, b: 0}, + 'green': {r: 0, g: 0.5019607843137255, b: 0}, + 'lime': {r: 0, g: 1, b: 0}, + 'honeydew': {r: 0.9411764705882353, g: 1, b: 0.9411764705882353}, + 'mediumseagreen': {r: 0.23529411764705882, g: 0.7019607843137254, b: 0.44313725490196076}, + 'seagreen': {r: 0.1803921568627451, g: 0.5450980392156862, b: 0.3411764705882353}, + 'springgreen': {r: 0, g: 1, b: 0.4980392156862745}, + 'mintcream': {r: 0.9607843137254902, g: 1, b: 0.9803921568627451}, + 'mediumspringgreen': {r: 0, g: 0.9803921568627451, b: 0.6039215686274509}, + 'mediumaquamarine': {r: 0.4, g: 0.803921568627451, b: 0.6666666666666666}, + 'aquamarine': {r: 0.4980392156862745, g: 1, b: 0.8313725490196079}, + 'turquoise': {r: 0.25098039215686274, g: 0.8784313725490196, b: 0.8156862745098039}, + 'lightseagreen': {r: 0.12549019607843137, g: 0.6980392156862745, b: 0.6666666666666666}, + 'mediumturquoise': {r: 0.2823529411764706, g: 0.8196078431372549, b: 0.8}, + 'darkslategray': {r: 0.1843137254901961, g: 0.30980392156862746, b: 0.30980392156862746}, + 'paleturquoise': {r: 0.6862745098039216, g: 0.9333333333333333, b: 0.9333333333333333}, + 'teal': {r: 0, g: 0.5019607843137255, b: 0.5019607843137255}, + 'darkcyan': {r: 0, g: 0.5450980392156862, b: 0.5450980392156862}, + 'darkturquoise': {r: 0, g: 0.807843137254902, b: 0.8196078431372549}, + 'aqua': {r: 0, g: 1, b: 1}, + 'cyan': {r: 0, g: 1, b: 1}, + 'lightcyan': {r: 0.8784313725490196, g: 1, b: 1}, + 'azure': {r: 0.9411764705882353, g: 1, b: 1}, + 'cadetblue': {r: 0.37254901960784315, g: 0.6196078431372549, b: 0.6274509803921569}, + 'powderblue': {r: 0.6901960784313725, g: 0.8784313725490196, b: 0.9019607843137255}, + 'lightblue': {r: 0.6784313725490196, g: 0.8470588235294118, b: 0.9019607843137255}, + 'deepskyblue': {r: 0, g: 0.7490196078431373, b: 1}, + 'skyblue': {r: 0.5294117647058824, g: 0.807843137254902, b: 0.9215686274509803}, + 'lightskyblue': {r: 0.5294117647058824, g: 0.807843137254902, b: 0.9803921568627451}, + 'steelblue': {r: 0.27450980392156865, g: 0.5098039215686274, b: 0.7058823529411765}, + 'aliceblue': {r: 0.9411764705882353, g: 0.9725490196078431, b: 1}, + 'dodgerblue': {r: 0.11764705882352941, g: 0.5647058823529412, b: 1}, + 'slategray': {r: 0.4392156862745098, g: 0.5019607843137255, b: 0.5647058823529412}, + 'lightslategray': {r: 0.4666666666666667, g: 0.5333333333333333, b: 0.6}, + 'lightsteelblue': {r: 0.6901960784313725, g: 0.7686274509803922, b: 0.8705882352941177}, + 'cornflowerblue': {r: 0.39215686274509803, g: 0.5843137254901961, b: 0.9294117647058824}, + 'royalblue': {r: 0.2549019607843137, g: 0.4117647058823529, b: 0.8823529411764706}, + 'midnightblue': {r: 0.09803921568627451, g: 0.09803921568627451, b: 0.4392156862745098}, + 'lavender': {r: 0.9019607843137255, g: 0.9019607843137255, b: 0.9803921568627451}, + 'navy': {r: 0, g: 0, b: 0.5019607843137255}, + 'darkblue': {r: 0, g: 0, b: 0.5450980392156862}, + 'mediumblue': {r: 0, g: 0, b: 0.803921568627451}, + 'blue': {r: 0, g: 0, b: 1}, + 'ghostwhite': {r: 0.9725490196078431, g: 0.9725490196078431, b: 1}, + 'darkslateblue': {r: 0.2823529411764706, g: 0.23921568627450981, b: 0.5450980392156862}, + 'slateblue': {r: 0.41568627450980394, g: 0.35294117647058826, b: 0.803921568627451}, + 'mediumslateblue': {r: 0.4823529411764706, g: 0.40784313725490196, b: 0.9333333333333333}, + 'mediumpurple': {r: 0.5764705882352941, g: 0.4392156862745098, b: 0.8588235294117647}, + 'blueviolet': {r: 0.5411764705882353, g: 0.16862745098039217, b: 0.8862745098039215}, + 'indigo': {r: 0.29411764705882354, g: 0, b: 0.5098039215686274}, + 'darkorchid': {r: 0.6, g: 0.19607843137254902, b: 0.8}, + 'darkviolet': {r: 0.5803921568627451, g: 0, b: 0.8274509803921568}, + 'mediumorchid': {r: 0.7294117647058823, g: 0.3333333333333333, b: 0.8274509803921568}, + 'thistle': {r: 0.8470588235294118, g: 0.7490196078431373, b: 0.8470588235294118}, + 'plum': {r: 0.8666666666666667, g: 0.6274509803921569, b: 0.8666666666666667}, + 'violet': {r: 0.9333333333333333, g: 0.5098039215686274, b: 0.9333333333333333}, + 'purple': {r: 0.5019607843137255, g: 0, b: 0.5019607843137255}, + 'darkmagenta': {r: 0.5450980392156862, g: 0, b: 0.5450980392156862}, + 'magenta': {r: 1, g: 0, b: 1}, + 'fuchsia': {r: 1, g: 0, b: 1}, + 'orchid': {r: 0.8549019607843137, g: 0.4392156862745098, b: 0.8392156862745098}, + 'mediumvioletred': {r: 0.7803921568627451, g: 0.08235294117647059, b: 0.5215686274509804}, + 'deeppink': {r: 1, g: 0.0784313725490196, b: 0.5764705882352941}, + 'hotpink': {r: 1, g: 0.4117647058823529, b: 0.7058823529411765}, + 'palevioletred': {r: 0.8588235294117647, g: 0.4392156862745098, b: 0.5764705882352941}, + 'lavenderblush': {r: 1, g: 0.9411764705882353, b: 0.9607843137254902}, + 'crimson': {r: 0.8627450980392157, g: 0.0784313725490196, b: 0.23529411764705882}, + 'pink': {r: 1, g: 0.7529411764705882, b: 0.796078431372549}, + 'lightpink': {r: 1, g: 0.7137254901960784, b: 0.7568627450980392} + }, + + _exactName = function(color) { + var name = false; + + $.each(_colors, function(n, color_b) { + if (color.equals(new Color(color_b.r, color_b.g, color_b.b))) { + name = n; + return false; + } + }); + + return name; + }, + + _closestName = function(color) { + var rgb = color.getRGB(), + distance = null, + name = false, + d; + + $.each(_colors, function(n, color_b) { + d = color.distance(new Color(color_b.r, color_b.g, color_b.b)); + if (d < distance || distance === null) { + name = n; + if (d == 0) { + return false; // can't get much closer than 0 + } + distance = d; + } + }); + + return name; + }, + + _parseHex = function(color) { + var c, + m; + + // {#}rrggbb + m = /^#?([a-fA-F0-9]{1,6})$/.exec(color); + if (m) { + c = parseInt(m[1], 16); + return new Color( + ((c >> 16) & 0xFF) / 255, + ((c >> 8) & 0xFF) / 255, + (c & 0xFF) / 255 + ); + } + + return false; + }, + + _parseColor = function(color) { + var name = $.trim(color).toLowerCase(), + m; + + if (color == '') { + return new Color(); + } + + if (_colors[name]) { + return new Color(_colors[name].r, _colors[name].g, _colors[name].b); + } + + // rgba(r,g,b,a) + m = /^rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)$/.exec(color); + if (m) { + return new Color( + m[1] / 255, + m[2] / 255, + m[3] / 255, + parseFloat(m[4]) + ); + } + + // hsla(r,g,b,a) + m = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)$/.exec(color); + if (m) { + return (new Color()).setHSL( + m[1] / 255, + m[2] / 255, + m[3] / 255).setAlpha(parseFloat(m[4])); + } + + // rgba(r%,g%,b%,a%) + m = /^rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)$/.exec(color); + if (m) { + return new Color( + m[1] / 100, + m[2] / 100, + m[3] / 100, + m[4] / 100 + ); + } + + // hsla(r%,g%,b%,a%) + m = /^hsla?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)$/.exec(color); + if (m) { + return (new Color()).setHSL( + m[1] / 100, + m[2] / 100, + m[3] / 100).setAlpha(m[4] / 100); + } + + // #rrggbb + m = /^#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})$/.exec(color); + if (m) { + return new Color( + parseInt(m[1], 16) / 255, + parseInt(m[2], 16) / 255, + parseInt(m[3], 16) / 255 + ); + } + + // #rgb + m = /^#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])$/.exec(color); + if (m) { + return new Color( + parseInt(m[1] + m[1], 16) / 255, + parseInt(m[2] + m[2], 16) / 255, + parseInt(m[3] + m[3], 16) / 255 + ); + } + + return _parseHex(color); + }, + + _layoutTable = function(layout, callback) { + var bitmap, + x, + y, + width, height, + columns, rows, + index, + cell, + html, + w, + h, + colspan, + walked; + + layout.sort(function(a, b) { + if (a.pos[1] == b.pos[1]) { + return a.pos[0] - b.pos[0]; + } + return a.pos[1] - b.pos[1]; + }); + + // Determine dimensions of the table + width = 0; + height = 0; + $.each (layout, function(index, part) { + width = Math.max(width, part.pos[0] + part.pos[2]); + height = Math.max(height, part.pos[1] + part.pos[3]); + }); + + // Initialize bitmap + bitmap = []; + for (x = 0; x < width; ++x) { + bitmap.push([]); + } + + // Mark rows and columns which have layout assigned + rows = []; + columns = []; + $.each(layout, function(index, part) { + // mark columns + for (x = 0; x < part.pos[2]; x += 1) { + columns[part.pos[0] + x] = true; + } + for (y = 0; y < part.pos[3]; y += 1) { + rows[part.pos[1] + y] = true; + } + }); + + // Generate the table + html = ''; + cell = layout[index = 0]; + for (y = 0; y < height; ++y) { + html += ''; + for (x = 0; x < width; x) { + if (typeof cell !== 'undefined' && x == cell.pos[0] && y == cell.pos[1]) { + // Create a "real" cell + html += callback(cell, x, y); + + for (h = 0; h < cell.pos[3]; h +=1) { + for (w = 0; w < cell.pos[2]; w +=1) { + bitmap[x + w][y + h] = true; + } + } + + x += cell.pos[2]; + cell = layout[++index]; + } else { + // Fill in the gaps + colspan = 0; + walked = false; + + while (x < width && bitmap[x][y] === undefined && (cell === undefined || y < cell.pos[1] || (y == cell.pos[1] && x < cell.pos[0]))) { + if (columns[x] === true) { + colspan += 1; + } + walked = true; + x += 1; + } + + if (colspan > 0) { + html += ''; + } else if (!walked) { + x += 1; + } + } + } + html += ''; + } + + return '' + html + '
'; + }, + + _parts = { + header: function (inst) { + var that = this, + e = null, + _html =function() { + var title = inst.options.title || inst._getRegional('title'), + html = '' + title + ''; + + if (!inst.inline && inst.options.showCloseButton) { + html += '' + + 'close'; + } + + return '
' + html + '
'; + }; + + this.init = function() { + e = $(_html()).prependTo(inst.dialog); + + var close = $('.ui-dialog-titlebar-close', e); + inst._hoverable(close); + inst._focusable(close); + close.click(function(event) { + event.preventDefault(); + inst.close(); + }); + + if (!inst.inline && inst.options.draggable) { + inst.dialog.draggable({ + handle: e + }); + } + }; + }, + + map: function (inst) { + var that = this, + e = null, + mousemove_timeout = null, + _mousedown, _mouseup, _mousemove, _html; + + _mousedown = function (event) { + if (!inst.opened) { + return; + } + + var div = $('.ui-colorpicker-map-layer-pointer', e), + offset = div.offset(), + width = div.width(), + height = div.height(), + x = event.pageX - offset.left, + y = event.pageY - offset.top; + + if (x >= 0 && x < width && y >= 0 && y < height) { + event.stopImmediatePropagation(); + event.preventDefault(); + e.unbind('mousedown', _mousedown); + $(document).bind('mouseup', _mouseup); + $(document).bind('mousemove', _mousemove); + _mousemove(event); + } + }; + + _mouseup = function (event) { + event.stopImmediatePropagation(); + event.preventDefault(); + $(document).unbind('mouseup', _mouseup); + $(document).unbind('mousemove', _mousemove); + e.bind('mousedown', _mousedown); + }; + + _mousemove = function (event) { + event.stopImmediatePropagation(); + event.preventDefault(); + + if (event.pageX === that.x && event.pageY === that.y) { + return; + } + that.x = event.pageX; + that.y = event.pageY; + + var div = $('.ui-colorpicker-map-layer-pointer', e), + offset = div.offset(), + width = div.width(), + height = div.height(), + x = event.pageX - offset.left, + y = event.pageY - offset.top; + + x = Math.max(0, Math.min(x / width, 1)); + y = Math.max(0, Math.min(y / height, 1)); + + // interpret values + switch (inst.mode) { + case 'h': + inst.color.setHSV(null, x, 1 - y); + break; + + case 's': + case 'a': + inst.color.setHSV(x, null, 1 - y); + break; + + case 'v': + inst.color.setHSV(x, 1 - y, null); + break; + + case 'r': + inst.color.setRGB(null, 1 - y, x); + break; + + case 'g': + inst.color.setRGB(1 - y, null, x); + break; + + case 'b': + inst.color.setRGB(x, 1 - y, null); + break; + } + + inst._change(); + }; + + _html = function () { + var html = '
' + + ' ' + + ' ' + + (inst.options.alpha ? ' ' : '') + + '
'; + return html; + }; + + this.update = function () { + switch (inst.mode) { + case 'h': + $('.ui-colorpicker-map-layer-1', e).css({'background-position': '0 0', 'opacity': ''}).show(); + $('.ui-colorpicker-map-layer-2', e).hide(); + break; + + case 's': + case 'a': + $('.ui-colorpicker-map-layer-1', e).css({'background-position': '0 -260px', 'opacity': ''}).show(); + $('.ui-colorpicker-map-layer-2', e).css({'background-position': '0 -520px', 'opacity': ''}).show(); + break; + + case 'v': + $(e).css('background-color', 'black'); + $('.ui-colorpicker-map-layer-1', e).css({'background-position': '0 -780px', 'opacity': ''}).show(); + $('.ui-colorpicker-map-layer-2', e).hide(); + break; + + case 'r': + $('.ui-colorpicker-map-layer-1', e).css({'background-position': '0 -1040px', 'opacity': ''}).show(); + $('.ui-colorpicker-map-layer-2', e).css({'background-position': '0 -1300px', 'opacity': ''}).show(); + break; + + case 'g': + $('.ui-colorpicker-map-layer-1', e).css({'background-position': '0 -1560px', 'opacity': ''}).show(); + $('.ui-colorpicker-map-layer-2', e).css({'background-position': '0 -1820px', 'opacity': ''}).show(); + break; + + case 'b': + $('.ui-colorpicker-map-layer-1', e).css({'background-position': '0 -2080px', 'opacity': ''}).show(); + $('.ui-colorpicker-map-layer-2', e).css({'background-position': '0 -2340px', 'opacity': ''}).show(); + break; + } + that.repaint(); + }; + + this.repaint = function () { + var div = $('.ui-colorpicker-map-layer-pointer', e), + x = 0, + y = 0; + + switch (inst.mode) { + case 'h': + x = inst.color.getHSV().s * div.width(); + y = (1 - inst.color.getHSV().v) * div.width(); + $(e).css('background-color', inst.color.copy().normalize().toCSS()); + break; + + case 's': + case 'a': + x = inst.color.getHSV().h * div.width(); + y = (1 - inst.color.getHSV().v) * div.width(); + $('.ui-colorpicker-map-layer-2', e).css('opacity', 1 - inst.color.getHSV().s); + break; + + case 'v': + x = inst.color.getHSV().h * div.width(); + y = (1 - inst.color.getHSV().s) * div.width(); + $('.ui-colorpicker-map-layer-1', e).css('opacity', inst.color.getHSV().v); + break; + + case 'r': + x = inst.color.getRGB().b * div.width(); + y = (1 - inst.color.getRGB().g) * div.width(); + $('.ui-colorpicker-map-layer-2', e).css('opacity', inst.color.getRGB().r); + break; + + case 'g': + x = inst.color.getRGB().b * div.width(); + y = (1 - inst.color.getRGB().r) * div.width(); + $('.ui-colorpicker-map-layer-2', e).css('opacity', inst.color.getRGB().g); + break; + + case 'b': + x = inst.color.getRGB().r * div.width(); + y = (1 - inst.color.getRGB().g) * div.width(); + $('.ui-colorpicker-map-layer-2', e).css('opacity', inst.color.getRGB().b); + break; + } + + if (inst.options.alpha) { + $('.ui-colorpicker-map-layer-alpha', e).css('opacity', 1 - inst.color.getAlpha()); + } + + $('.ui-colorpicker-map-pointer', e).css({ + 'left': x - 7, + 'top': y - 7 + }); + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-map-container', inst.dialog)); + + e.bind('mousedown', _mousedown); + }; + }, + + bar: function (inst) { + var that = this, + e = null, + _mousedown, _mouseup, _mousemove, _html; + + _mousedown = function (event) { + if (!inst.opened) { + return; + } + + var div = $('.ui-colorpicker-bar-layer-pointer', e), + offset = div.offset(), + width = div.width(), + height = div.height(), + x = event.pageX - offset.left, + y = event.pageY - offset.top; + + if (x >= 0 && x < width && y >= 0 && y < height) { + event.stopImmediatePropagation(); + event.preventDefault(); + e.unbind('mousedown', _mousedown); + $(document).bind('mouseup', _mouseup); + $(document).bind('mousemove', _mousemove); + _mousemove(event); + } + }; + + _mouseup = function (event) { + event.stopImmediatePropagation(); + event.preventDefault(); + $(document).unbind('mouseup', _mouseup); + $(document).unbind('mousemove', _mousemove); + e.bind('mousedown', _mousedown); + }; + + _mousemove = function (event) { + event.stopImmediatePropagation(); + event.preventDefault(); + + if (event.pageY === that.y) { + return; + } + that.y = event.pageY; + + var div = $('.ui-colorpicker-bar-layer-pointer', e), + offset = div.offset(), + height = div.height(), + y = event.pageY - offset.top; + + y = Math.max(0, Math.min(y / height, 1)); + + // interpret values + switch (inst.mode) { + case 'h': + inst.color.setHSV(1 - y, null, null); + break; + + case 's': + inst.color.setHSV(null, 1 - y, null); + break; + + case 'v': + inst.color.setHSV(null, null, 1 - y); + break; + + case 'r': + inst.color.setRGB(1 - y, null, null); + break; + + case 'g': + inst.color.setRGB(null, 1 - y, null); + break; + + case 'b': + inst.color.setRGB(null, null, 1 - y); + break; + + case 'a': + inst.color.setAlpha(1 - y); + break; + } + + inst._change(); + }; + + _html = function () { + var html = '
' + + ' ' + + ' ' + + ' ' + + ' '; + + if (inst.options.alpha) { + html += ' ' + + ' '; + } + + html += '
'; + + return html; + }; + + this.update = function () { + switch (inst.mode) { + case 'h': + case 's': + case 'v': + case 'r': + case 'g': + case 'b': + $('.ui-colorpicker-bar-layer-alpha', e).show(); + $('.ui-colorpicker-bar-layer-alphabar', e).hide(); + break; + + case 'a': + $('.ui-colorpicker-bar-layer-alpha', e).hide(); + $('.ui-colorpicker-bar-layer-alphabar', e).show(); + break; + } + + switch (inst.mode) { + case 'h': + $('.ui-colorpicker-bar-layer-1', e).css({'background-position': '0 0', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-2', e).hide(); + $('.ui-colorpicker-bar-layer-3', e).hide(); + $('.ui-colorpicker-bar-layer-4', e).hide(); + break; + + case 's': + $('.ui-colorpicker-bar-layer-1', e).css({'background-position': '0 -260px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-2', e).css({'background-position': '0 -520px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-3', e).hide(); + $('.ui-colorpicker-bar-layer-4', e).hide(); + break; + + case 'v': + $('.ui-colorpicker-bar-layer-1', e).css({'background-position': '0 -520px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-2', e).hide(); + $('.ui-colorpicker-bar-layer-3', e).hide(); + $('.ui-colorpicker-bar-layer-4', e).hide(); + break; + + case 'r': + $('.ui-colorpicker-bar-layer-1', e).css({'background-position': '0 -1560px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-2', e).css({'background-position': '0 -1300px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-3', e).css({'background-position': '0 -780px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-4', e).css({'background-position': '0 -1040px', 'opacity': ''}).show(); + break; + + case 'g': + $('.ui-colorpicker-bar-layer-1', e).css({'background-position': '0 -2600px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-2', e).css({'background-position': '0 -2340px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-3', e).css({'background-position': '0 -1820px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-4', e).css({'background-position': '0 -2080px', 'opacity': ''}).show(); + break; + + case 'b': + $('.ui-colorpicker-bar-layer-1', e).css({'background-position': '0 -3640px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-2', e).css({'background-position': '0 -3380px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-3', e).css({'background-position': '0 -2860px', 'opacity': ''}).show(); + $('.ui-colorpicker-bar-layer-4', e).css({'background-position': '0 -3120px', 'opacity': ''}).show(); + break; + + case 'a': + $('.ui-colorpicker-bar-layer-1', e).hide(); + $('.ui-colorpicker-bar-layer-2', e).hide(); + $('.ui-colorpicker-bar-layer-3', e).hide(); + $('.ui-colorpicker-bar-layer-4', e).hide(); + break; + } + that.repaint(); + }; + + this.repaint = function () { + var div = $('.ui-colorpicker-bar-layer-pointer', e), + y = 0; + + switch (inst.mode) { + case 'h': + y = (1 - inst.color.getHSV().h) * div.height(); + break; + + case 's': + y = (1 - inst.color.getHSV().s) * div.height(); + $('.ui-colorpicker-bar-layer-2', e).css('opacity', 1 - inst.color.getHSV().v); + $(e).css('background-color', inst.color.copy().normalize().toCSS()); + break; + + case 'v': + y = (1 - inst.color.getHSV().v) * div.height(); + $(e).css('background-color', inst.color.copy().normalize().toCSS()); + break; + + case 'r': + y = (1 - inst.color.getRGB().r) * div.height(); + $('.ui-colorpicker-bar-layer-2', e).css('opacity', Math.max(0, (inst.color.getRGB().b - inst.color.getRGB().g))); + $('.ui-colorpicker-bar-layer-3', e).css('opacity', Math.max(0, (inst.color.getRGB().g - inst.color.getRGB().b))); + $('.ui-colorpicker-bar-layer-4', e).css('opacity', Math.min(inst.color.getRGB().b, inst.color.getRGB().g)); + break; + + case 'g': + y = (1 - inst.color.getRGB().g) * div.height(); + $('.ui-colorpicker-bar-layer-2', e).css('opacity', Math.max(0, (inst.color.getRGB().b - inst.color.getRGB().r))); + $('.ui-colorpicker-bar-layer-3', e).css('opacity', Math.max(0, (inst.color.getRGB().r - inst.color.getRGB().b))); + $('.ui-colorpicker-bar-layer-4', e).css('opacity', Math.min(inst.color.getRGB().r, inst.color.getRGB().b)); + break; + + case 'b': + y = (1 - inst.color.getRGB().b) * div.height(); + $('.ui-colorpicker-bar-layer-2', e).css('opacity', Math.max(0, (inst.color.getRGB().r - inst.color.getRGB().g))); + $('.ui-colorpicker-bar-layer-3', e).css('opacity', Math.max(0, (inst.color.getRGB().g - inst.color.getRGB().r))); + $('.ui-colorpicker-bar-layer-4', e).css('opacity', Math.min(inst.color.getRGB().r, inst.color.getRGB().g)); + break; + + case 'a': + y = (1 - inst.color.getAlpha()) * div.height(); + $(e).css('background-color', inst.color.copy().normalize().toCSS()); + break; + } + + if (inst.mode !== 'a') { + $('.ui-colorpicker-bar-layer-alpha', e).css('opacity', 1 - inst.color.getAlpha()); + } + + $('.ui-colorpicker-bar-pointer', e).css('top', y - 3); + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-bar-container', inst.dialog)); + + e.bind('mousedown', _mousedown); + }; + }, + + preview: function (inst) { + var that = this, + e = null, + _html; + + _html = function () { + return '
' + + '
' + + '
' + + '
'; + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-preview-container', inst.dialog)); + + $('.ui-colorpicker-preview-initial', e).click(function () { + inst.color = inst.currentColor.copy(); + inst._change(); + }); + + }; + + this.update = function () { + if (inst.options.alpha) { + $('.ui-colorpicker-preview-initial-alpha, .ui-colorpicker-preview-current-alpha', e).show(); + } else { + $('.ui-colorpicker-preview-initial-alpha, .ui-colorpicker-preview-current-alpha', e).hide(); + } + + this.repaint(); + }; + + this.repaint = function () { + $('.ui-colorpicker-preview-initial', e).css('background-color', inst.currentColor.toCSS()).attr('title', inst.currentColor.toHex()); + $('.ui-colorpicker-preview-initial-alpha', e).css('opacity', 1 - inst.currentColor.getAlpha()); + $('.ui-colorpicker-preview-current', e).css('background-color', inst.color.toCSS()).attr('title', inst.color.toHex()); + $('.ui-colorpicker-preview-current-alpha', e).css('opacity', 1 - inst.color.getAlpha()); + }; + }, + + hsv: function (inst) { + var that = this, + e = null, + _html; + + _html = function () { + var html = ''; + + if (inst.options.hsv) { + html += '
°
' + + '
%
' + + '
%
'; + } + + return '
' + html + '
'; + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-hsv-container', inst.dialog)); + + $('.ui-colorpicker-mode', e).click(function () { + inst.mode = $(this).val(); + inst._updateAllParts(); + }); + + $('.ui-colorpicker-number', e).bind('change keyup', function () { + inst.color.setHSV( + $('.ui-colorpicker-hsv-h .ui-colorpicker-number', e).val() / 360, + $('.ui-colorpicker-hsv-s .ui-colorpicker-number', e).val() / 100, + $('.ui-colorpicker-hsv-v .ui-colorpicker-number', e).val() / 100 + ); + inst._change(); + }); + }; + + this.repaint = function () { + var hsv = inst.color.getHSV(); + hsv.h *= 360; + hsv.s *= 100; + hsv.v *= 100; + + $.each(hsv, function (index, value) { + var input = $('.ui-colorpicker-hsv-' + index + ' .ui-colorpicker-number', e); + value = Math.round(value); + if (input.val() !== value) { + input.val(value); + } + }); + }; + + this.update = function () { + $('.ui-colorpicker-mode', e).each(function () { + $(this).attr('checked', $(this).val() === inst.mode); + }); + this.repaint(); + }; + }, + + rgb: function (inst) { + var that = this, + e = null, + _html; + + _html = function () { + var html = ''; + + if (inst.options.rgb) { + html += '
' + + '
' + + '
'; + } + + return '
' + html + '
'; + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-rgb-container', inst.dialog)); + + $('.ui-colorpicker-mode', e).click(function () { + inst.mode = $(this).val(); + inst._updateAllParts(); + }); + + $('.ui-colorpicker-number', e).bind('change keyup', function () { + inst.color.setRGB( + $('.ui-colorpicker-rgb-r .ui-colorpicker-number', e).val() / 255, + $('.ui-colorpicker-rgb-g .ui-colorpicker-number', e).val() / 255, + $('.ui-colorpicker-rgb-b .ui-colorpicker-number', e).val() / 255 + ); + + inst._change(); + }); + }; + + this.repaint = function () { + $.each(inst.color.getRGB(), function (index, value) { + var input = $('.ui-colorpicker-rgb-' + index + ' .ui-colorpicker-number', e); + value = Math.round(value * 255); + if (input.val() !== value) { + input.val(value); + } + }); + }; + + this.update = function () { + $('.ui-colorpicker-mode', e).each(function () { + $(this).attr('checked', $(this).val() === inst.mode); + }); + this.repaint(); + }; + }, + + lab: function (inst) { + var that = this, + part = null, + html = function () { + var html = ''; + + if (inst.options.hsv) { + html += '
' + + '
' + + '
'; + } + + return '
' + html + '
'; + }; + + this.init = function () { + var data = 0; + + part = $(html()).appendTo($('.ui-colorpicker-lab-container', inst.dialog)); + + $('.ui-colorpicker-number', part).on('change keyup', function (event) { + inst.color.setLAB( + parseInt($('.ui-colorpicker-lab-l .ui-colorpicker-number', part).val(), 10) / 100, + (parseInt($('.ui-colorpicker-lab-a .ui-colorpicker-number', part).val(), 10) + 128) / 255, + (parseInt($('.ui-colorpicker-lab-b .ui-colorpicker-number', part).val(), 10) + 128) / 255 + ); + inst._change(); + }); + }; + + this.repaint = function () { + var lab = inst.color.getLAB(); + lab.l *= 100; + lab.a = (lab.a * 255) - 128; + lab.b = (lab.b * 255) - 128; + + $.each(lab, function (index, value) { + var input = $('.ui-colorpicker-lab-' + index + ' .ui-colorpicker-number', part); + value = Math.round(value); + if (input.val() !== value) { + input.val(value); + } + }); + }; + + this.update = function () { + this.repaint(); + }; + + }, + + cmyk: function (inst) { + var that = this, + part = null, + html = function () { + var html = ''; + + if (inst.options.hsv) { + html += '
%
' + + '
%
' + + '
%
' + + '
%
'; + } + + return '
' + html + '
'; + }; + + this.init = function () { + part = $(html()).appendTo($('.ui-colorpicker-cmyk-container', inst.dialog)); + + $('.ui-colorpicker-number', part).on('change keyup', function (event) { + inst.color.setCMYK( + parseInt($('.ui-colorpicker-cmyk-c .ui-colorpicker-number', part).val(), 10) / 100, + parseInt($('.ui-colorpicker-cmyk-m .ui-colorpicker-number', part).val(), 10) / 100, + parseInt($('.ui-colorpicker-cmyk-y .ui-colorpicker-number', part).val(), 10) / 100, + parseInt($('.ui-colorpicker-cmyk-k .ui-colorpicker-number', part).val(), 10) / 100 + ); + inst._change(); + }); + }; + + this.repaint = function () { + $.each(inst.color.getCMYK(), function (index, value) { + var input = $('.ui-colorpicker-cmyk-' + index + ' .ui-colorpicker-number', part); + value = Math.round(value * 100); + if (input.val() !== value) { + input.val(value); + } + }); + }; + + this.update = function () { + this.repaint(); + }; + + }, + + alpha: function (inst) { + var that = this, + e = null, + _html; + + _html = function () { + var html = ''; + + if (inst.options.alpha) { + html += '
%
'; + } + + return '
' + html + '
'; + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-alpha-container', inst.dialog)); + + $('.ui-colorpicker-mode', e).click(function () { + inst.mode = $(this).val(); + inst._updateAllParts(); + }); + + $('.ui-colorpicker-number', e).bind('change keyup', function () { + inst.color.setAlpha($('.ui-colorpicker-a .ui-colorpicker-number', e).val() / 100); + inst._change(); + }); + }; + + this.update = function () { + $('.ui-colorpicker-mode', e).each(function () { + $(this).attr('checked', $(this).val() === inst.mode); + }); + this.repaint(); + }; + + this.repaint = function () { + var input = $('.ui-colorpicker-a .ui-colorpicker-number', e), + value = Math.round(inst.color.getAlpha() * 100); + if (!input.is(':focus') && input.val() !== value) { + input.val(value); + } + }; + }, + + hex: function (inst) { + var that = this, + e = null, + _html; + + _html = function () { + var html = ''; + + if (inst.options.alpha) { + html += ''; + } + + html += ''; + + return '
' + html + '
'; + }; + + this.init = function () { + e = $(_html()).appendTo($('.ui-colorpicker-hex-container', inst.dialog)); + + // repeat here makes the invalid input disappear faster + $('.ui-colorpicker-hex-input', e).bind('change keydown keyup', function (a, b, c) { + if (/[^a-fA-F0-9]/.test($(this).val())) { + $(this).val($(this).val().replace(/[^a-fA-F0-9]/, '')); + } + }); + + $('.ui-colorpicker-hex-input', e).bind('change keyup', function () { + // repeat here makes sure that the invalid input doesn't get parsed + inst.color = _parseHex($(this).val()).setAlpha(inst.color.getAlpha()); + inst._change(); + }); + + $('.ui-colorpicker-hex-alpha', e).bind('change keydown keyup', function () { + if (/[^a-fA-F0-9]/.test($(this).val())) { + $(this).val($(this).val().replace(/[^a-fA-F0-9]/, '')); + } + }); + + $('.ui-colorpicker-hex-alpha', e).bind('change keyup', function () { + inst.color.setAlpha(parseInt($('.ui-colorpicker-hex-alpha', e).val(), 16) / 255); + inst._change(); + }); + }; + + this.update = function () { + this.repaint(); + }; + + this.repaint = function () { + if (!$('.ui-colorpicker-hex-input', e).is(':focus')) { + $('.ui-colorpicker-hex-input', e).val(inst.color.toHex(true)); + } + + if (!$('.ui-colorpicker-hex-alpha', e).is(':focus')) { + $('.ui-colorpicker-hex-alpha', e).val(_intToHex(inst.color.getAlpha() * 255)); + } + }; + }, + + swatches: function (inst) { + var that = this, + part = null, + html = function () { + var html = ''; + + $.each(inst.options.swatches, function (name, color) { + var c = new Color(color.r, color.g, color.b), + css = c.toCSS(); + html += '
'; + }); + + return '
' + html + '
'; + }; + + this.init = function () { + part = $(html()).appendTo($('.ui-colorpicker-swatches-container', inst.dialog)); + + $('.ui-colorpicker-swatch', part).click(function () { + inst.color = _parseColor($(this).css('background-color')); + inst._change(); + }); + }; + }, + + footer: function (inst) { + var that = this, + part = null, + id_transparent = 'ui-colorpicker-special-transparent-'+_colorpicker_index, + id_none = 'ui-colorpicker-special-none-'+_colorpicker_index, + html = function () { + var html = ''; + + if (inst.options.alpha || (!inst.inline && inst.options.showNoneButton)) { + html += '
'; + + if (inst.options.alpha) { + html += ''; + } + if (!inst.inline && inst.options.showNoneButton) { + html += ''; + } + html += '
'; + } + + if (!inst.inline) { + html += '
'; + if (inst.options.showCancelButton) { + html += ''; + } + html += ''; + html += '
'; + } + + return '
' + html + '
'; + }; + + this.init = function () { + part = $(html()).appendTo(inst.dialog); + + $('.ui-colorpicker-ok', part).button().click(function () { + inst.close(); + }); + + $('.ui-colorpicker-cancel', part).button().click(function () { + inst.color = inst.currentColor.copy(); + inst._change(inst.color.set); + inst.close(); + }); + + //inst._getRegional('transparent') + $('.ui-colorpicker-buttonset', part).buttonset(); + + $('.ui-colorpicker-special-color', part).click(function () { + inst._change(); + }); + + $('#'+id_none, part).click(function () { + inst._change(false); + }); + + $('#'+id_transparent, part).click(function () { + inst.color.setAlpha(0); + inst._change(); + }); + }; + + this.repaint = function () { + if (!inst.color.set) { + $('.ui-colorpicker-special-none', part).attr('checked', true).button( "refresh" ); + } else if (inst.color.getAlpha() == 0) { + $('.ui-colorpicker-special-transparent', part).attr('checked', true).button( "refresh" ); + } else { + $('input', part).attr('checked', false).button( "refresh" ); + } + + $('.ui-colorpicker-cancel', part).button(inst.changed ? 'enable' : 'disable'); + }; + + this.update = function () {}; + } + }, + + Color = function () { + var spaces = { rgb: {r: 0, g: 0, b: 0}, + hsv: {h: 0, s: 0, v: 0}, + hsl: {h: 0, s: 0, l: 0}, + lab: {l: 0, a: 0, b: 0}, + cmyk: {c: 0, m: 0, y: 0, k: 1} + }, + a = 1, + args = arguments, + _clip = function(v) { + if (isNaN(v) || v === null) { + return 0; + } + if (typeof v == 'string') { + v = parseInt(v, 10); + } + return Math.max(0, Math.min(v, 1)); + }, + _hexify = function (number) { + var digits = '0123456789abcdef', + lsd = number % 16, + msd = (number - lsd) / 16, + hexified = digits.charAt(msd) + digits.charAt(lsd); + return hexified; + }, + _rgb_to_xyz = function(rgb) { + var r = (rgb.r > 0.04045) ? Math.pow((rgb.r + 0.055) / 1.055, 2.4) : rgb.r / 12.92, + g = (rgb.g > 0.04045) ? Math.pow((rgb.g + 0.055) / 1.055, 2.4) : rgb.g / 12.92, + b = (rgb.b > 0.04045) ? Math.pow((rgb.b + 0.055) / 1.055, 2.4) : rgb.b / 12.92; + + return { + x: r * 0.4124 + g * 0.3576 + b * 0.1805, + y: r * 0.2126 + g * 0.7152 + b * 0.0722, + z: r * 0.0193 + g * 0.1192 + b * 0.9505 + }; + }, + _xyz_to_rgb = function(xyz) { + var rgb = { + r: xyz.x * 3.2406 + xyz.y * -1.5372 + xyz.z * -0.4986, + g: xyz.x * -0.9689 + xyz.y * 1.8758 + xyz.z * 0.0415, + b: xyz.x * 0.0557 + xyz.y * -0.2040 + xyz.z * 1.0570 + }; + + rgb.r = (rgb.r > 0.0031308) ? 1.055 * Math.pow(rgb.r, (1 / 2.4)) - 0.055 : 12.92 * rgb.r; + rgb.g = (rgb.g > 0.0031308) ? 1.055 * Math.pow(rgb.g, (1 / 2.4)) - 0.055 : 12.92 * rgb.g; + rgb.b = (rgb.b > 0.0031308) ? 1.055 * Math.pow(rgb.b, (1 / 2.4)) - 0.055 : 12.92 * rgb.b; + + return rgb; + }, + _rgb_to_hsv = function(rgb) { + var minVal = Math.min(rgb.r, rgb.g, rgb.b), + maxVal = Math.max(rgb.r, rgb.g, rgb.b), + delta = maxVal - minVal, + del_R, del_G, del_B, + hsv = { + h: 0, + s: 0, + v: maxVal + }; + + if (delta === 0) { + hsv.h = 0; + hsv.s = 0; + } else { + hsv.s = delta / maxVal; + + del_R = (((maxVal - rgb.r) / 6) + (delta / 2)) / delta; + del_G = (((maxVal - rgb.g) / 6) + (delta / 2)) / delta; + del_B = (((maxVal - rgb.b) / 6) + (delta / 2)) / delta; + + if (rgb.r === maxVal) { + hsv.h = del_B - del_G; + } else if (rgb.g === maxVal) { + hsv.h = (1 / 3) + del_R - del_B; + } else if (rgb.b === maxVal) { + hsv.h = (2 / 3) + del_G - del_R; + } + + if (hsv.h < 0) { + hsv.h += 1; + } else if (hsv.h > 1) { + hsv.h -= 1; + } + } + + return hsv; + }, + _hsv_to_rgb = function(hsv) { + var rgb = { + r: 0, + g: 0, + b: 0 + }, + var_h, + var_i, + var_1, + var_2, + var_3; + + if (hsv.s === 0) { + rgb.r = rgb.g = rgb.b = hsv.v; + } else { + var_h = hsv.h === 1 ? 0 : hsv.h * 6; + var_i = Math.floor(var_h); + var_1 = hsv.v * (1 - hsv.s); + var_2 = hsv.v * (1 - hsv.s * (var_h - var_i)); + var_3 = hsv.v * (1 - hsv.s * (1 - (var_h - var_i))); + + if (var_i === 0) { + rgb.r = hsv.v; + rgb.g = var_3; + rgb.b = var_1; + } else if (var_i === 1) { + rgb.r = var_2; + rgb.g = hsv.v; + rgb.b = var_1; + } else if (var_i === 2) { + rgb.r = var_1; + rgb.g = hsv.v; + rgb.b = var_3; + } else if (var_i === 3) { + rgb.r = var_1; + rgb.g = var_2; + rgb.b = hsv.v; + } else if (var_i === 4) { + rgb.r = var_3; + rgb.g = var_1; + rgb.b = hsv.v; + } else { + rgb.r = hsv.v; + rgb.g = var_1; + rgb.b = var_2; + } + } + + return rgb; + }, + _rgb_to_hsl = function(rgb) { + var minVal = Math.min(rgb.r, rgb.g, rgb.b), + maxVal = Math.max(rgb.r, rgb.g, rgb.b), + delta = maxVal - minVal, + del_R, del_G, del_B, + hsl = { + h: 0, + s: 0, + l: (maxVal + minVal) / 2 + }; + + if (delta === 0) { + hsl.h = 0; + hsl.s = 0; + } else { + hsl.s = hsl.l < 0.5 ? delta / (maxVal + minVal) : delta / (2 - maxVal - minVal); + + del_R = (((maxVal - rgb.r) / 6) + (delta / 2)) / delta; + del_G = (((maxVal - rgb.g) / 6) + (delta / 2)) / delta; + del_B = (((maxVal - rgb.b) / 6) + (delta / 2)) / delta; + + if (rgb.r === maxVal) { + hsl.h = del_B - del_G; + } else if (rgb.g === maxVal) { + hsl.h = (1 / 3) + del_R - del_B; + } else if (rgb.b === maxVal) { + hsl.h = (2 / 3) + del_G - del_R; + } + + if (hsl.h < 0) { + hsl.h += 1; + } else if (hsl.h > 1) { + hsl.h -= 1; + } + } + + return hsl; + }, + _hsl_to_rgb = function(hsl) { + var var_1, + var_2, + hue_to_rgb = function(v1, v2, vH) { + if (vH < 0) { + vH += 1; + } + if (vH > 1) { + vH -= 1; + } + if ((6 * vH) < 1) { + return v1 + (v2 - v1) * 6 * vH; + } + if ((2 * vH) < 1) { + return v2; + } + if ((3 * vH) < 2) { + return v1 + (v2 - v1) * ((2 / 3) - vH) * 6; + } + return v1; + }; + + if (hsl.s === 0) { + return { + r: hsl.l, + g: hsl.l, + b: hsl.l + }; + } + + var_2 = (hsl.l < 0.5) ? hsl.l * (1 + hsl.s) : (hsl.l + hsl.s) - (hsl.s * hsl.l); + var_1 = 2 * hsl.l - var_2; + + return { + r: hue_to_rgb(var_1, var_2, hsl.h + (1 / 3)), + g: hue_to_rgb(var_1, var_2, hsl.h), + b: hue_to_rgb(var_1, var_2, hsl.h - (1 / 3)) + }; + }, + _xyz_to_lab = function(xyz) { + // CIE-L*ab D65 1931 + var x = xyz.x / 0.95047, + y = xyz.y, + z = xyz.z / 1.08883; + + x = (x > 0.008856) ? Math.pow(x, (1/3)) : (7.787 * x) + (16/116); + y = (y > 0.008856) ? Math.pow(y, (1/3)) : (7.787 * y) + (16/116); + z = (z > 0.008856) ? Math.pow(z, (1/3)) : (7.787 * z) + (16/116); + + return { + l: ((116 * y) - 16) / 100, // [0,100] + a: ((500 * (x - y)) + 128) / 255, // [-128,127] + b: ((200 * (y - z)) + 128) / 255 // [-128,127] + }; + }, + _lab_to_xyz = function(lab) { + var lab2 = { + l: lab.l * 100, + a: (lab.a * 255) - 128, + b: (lab.b * 255) - 128 + }, + xyz = { + x: 0, + y: (lab2.l + 16) / 116, + z: 0 + }; + + xyz.x = lab2.a / 500 + xyz.y; + xyz.z = xyz.y - lab2.b / 200; + + xyz.x = (Math.pow(xyz.x, 3) > 0.008856) ? Math.pow(xyz.x, 3) : (xyz.x - 16 / 116) / 7.787; + xyz.y = (Math.pow(xyz.y, 3) > 0.008856) ? Math.pow(xyz.y, 3) : (xyz.y - 16 / 116) / 7.787; + xyz.z = (Math.pow(xyz.z, 3) > 0.008856) ? Math.pow(xyz.z, 3) : (xyz.z - 16 / 116) / 7.787; + + xyz.x *= 0.95047; + xyz.y *= 1; + xyz.z *= 1.08883; + + return xyz; + }, + _rgb_to_cmy = function(rgb) { + return { + c: 1 - (rgb.r), + m: 1 - (rgb.g), + y: 1 - (rgb.b) + }; + }, + _cmy_to_rgb = function(cmy) { + return { + r: 1 - (cmy.c), + g: 1 - (cmy.m), + b: 1 - (cmy.y) + }; + }, + _cmy_to_cmyk = function(cmy) { + var K = 1; + + if (cmy.c < K) { + K = cmy.c; + } + if (cmy.m < K) { + K = cmy.m; + } + if (cmy.y < K) { + K = cmy.y; + } + + if (K == 1) { + return { + c: 0, + m: 0, + y: 0, + k: 1 + }; + } + + return { + c: (cmy.c - K) / (1 - K), + m: (cmy.m - K) / (1 - K), + y: (cmy.y - K) / (1 - K), + k: K + }; + }, + _cmyk_to_cmy = function(cmyk) { + return { + c: cmyk.c * (1 - cmyk.k) + cmyk.k, + m: cmyk.m * (1 - cmyk.k) + cmyk.k, + y: cmyk.y * (1 - cmyk.k) + cmyk.k + }; + }; + + this.set = true; + + this.setAlpha = function(_a) { + if (_a !== null) { + a = _clip(_a); + } + + return this; + }; + + this.getAlpha = function() { + return a; + }; + + this.setRGB = function(r, g, b) { + spaces = {rgb: this.getRGB()}; + if (r !== null) { + spaces.rgb.r = _clip(r); + } + if (g !== null) { + spaces.rgb.g = _clip(g); + } + if (b !== null) { + spaces.rgb.b = _clip(b); + } + + return this; + }; + + this.setHSV = function(h, s, v) { + spaces = {hsv: this.getHSV()}; + if (h !== null) { + spaces.hsv.h = _clip(h); + } + if (s !== null) { + spaces.hsv.s = _clip(s); + } + if (v !== null) { + spaces.hsv.v = _clip(v); + } + + return this; + }; + + this.setHSL = function(h, s, l) { + spaces = {hsl: this.getHSL()}; + if (h !== null) { + spaces.hsl.h = _clip(h); + } + if (s !== null) { + spaces.hsl.s = _clip(s); + } + if (l !== null) { + spaces.hsl.l = _clip(l); + } + + return this; + }; + + this.setLAB = function(l, a, b) { + spaces = {lab: this.getLAB()}; + if (l !== null) { + spaces.lab.l = _clip(l); + } + if (a !== null) { + spaces.lab.a = _clip(a); + } + if (b !== null) { + spaces.lab.b = _clip(b); + } + + return this; + }; + + this.setCMYK = function(c, m, y, k) { + spaces = {cmyk: this.getCMYK()}; + if (c !== null) { + spaces.cmyk.c = _clip(c); + } + if (m !== null) { + spaces.cmyk.m = _clip(m); + } + if (y !== null) { + spaces.cmyk.y = _clip(y); + } + if (k !== null) { + spaces.cmyk.k = _clip(k); + } + + return this; + }; + + this.getRGB = function() { + if (!spaces.rgb) { + spaces.rgb = spaces.lab ? _xyz_to_rgb(_lab_to_xyz(spaces.lab)) + : spaces.hsv ? _hsv_to_rgb(spaces.hsv) + : spaces.hsl ? _hsl_to_rgb(spaces.hsl) + : spaces.cmyk ? _cmy_to_rgb(_cmyk_to_cmy(spaces.cmyk)) + : {r: 0, g: 0, b: 0}; + spaces.rgb.r = _clip(spaces.rgb.r); + spaces.rgb.g = _clip(spaces.rgb.g); + spaces.rgb.b = _clip(spaces.rgb.b); + } + return $.extend({}, spaces.rgb); + }; + + this.getHSV = function() { + if (!spaces.hsv) { + spaces.hsv = spaces.lab ? _rgb_to_hsv(this.getRGB()) + : spaces.rgb ? _rgb_to_hsv(spaces.rgb) + : spaces.hsl ? _rgb_to_hsv(this.getRGB()) + : spaces.cmyk ? _rgb_to_hsv(this.getRGB()) + : {h: 0, s: 0, v: 0}; + spaces.hsv.h = _clip(spaces.hsv.h); + spaces.hsv.s = _clip(spaces.hsv.s); + spaces.hsv.v = _clip(spaces.hsv.v); + } + return $.extend({}, spaces.hsv); + }; + + this.getHSL = function() { + if (!spaces.hsl) { + spaces.hsl = spaces.rgb ? _rgb_to_hsl(spaces.rgb) + : spaces.hsv ? _rgb_to_hsl(this.getRGB()) + : spaces.cmyk ? _rgb_to_hsl(this.getRGB()) + : spaces.hsv ? _rgb_to_hsl(this.getRGB()) + : {h: 0, s: 0, l: 0}; + spaces.hsl.h = _clip(spaces.hsl.h); + spaces.hsl.s = _clip(spaces.hsl.s); + spaces.hsl.l = _clip(spaces.hsl.l); + } + return $.extend({}, spaces.hsl); + }; + + this.getCMYK = function() { + if (!spaces.cmyk) { + spaces.cmyk = spaces.rgb ? _cmy_to_cmyk(_rgb_to_cmy(spaces.rgb)) + : spaces.hsv ? _cmy_to_cmyk(_rgb_to_cmy(this.getRGB())) + : spaces.hsl ? _cmy_to_cmyk(_rgb_to_cmy(this.getRGB())) + : spaces.lab ? _cmy_to_cmyk(_rgb_to_cmy(this.getRGB())) + : {c: 0, m: 0, y: 0, k: 1}; + spaces.cmyk.c = _clip(spaces.cmyk.c); + spaces.cmyk.m = _clip(spaces.cmyk.m); + spaces.cmyk.y = _clip(spaces.cmyk.y); + spaces.cmyk.k = _clip(spaces.cmyk.k); + } + return $.extend({}, spaces.cmyk); + }; + + this.getLAB = function() { + if (!spaces.lab) { + spaces.lab = spaces.rgb ? _xyz_to_lab(_rgb_to_xyz(spaces.rgb)) + : spaces.hsv ? _xyz_to_lab(_rgb_to_xyz(this.getRGB())) + : spaces.hsl ? _xyz_to_lab(_rgb_to_xyz(this.getRGB())) + : spaces.cmyk ? _xyz_to_lab(_rgb_to_xyz(this.getRGB())) + : {l: 0, a: 0, b: 0}; + spaces.lab.l = _clip(spaces.lab.l); + spaces.lab.a = _clip(spaces.lab.a); + spaces.lab.b = _clip(spaces.lab.b); + } + return $.extend({}, spaces.lab); + }; + + this.getChannels = function() { + return { + r: this.getRGB().r, + g: this.getRGB().g, + b: this.getRGB().b, + a: this.getAlpha(), + h: this.getHSV().h, + s: this.getHSV().s, + v: this.getHSV().v, + c: this.getCMYK().c, + m: this.getCMYK().m, + y: this.getCMYK().y, + k: this.getCMYK().k, + L: this.getLAB().l, + A: this.getLAB().a, + B: this.getLAB().b + }; + }; + + this.getSpaces = function() { + return $.extend(true, {}, spaces); + }; + + this.setSpaces = function(new_spaces) { + spaces = new_spaces; + return this; + }; + + this.distance = function(color) { + var space = 'lab', + getter = 'get'+space.toUpperCase(), + a = this[getter](), + b = color[getter](), + distance = 0, + channel; + + for (channel in a) { + distance += Math.pow(a[channel] - b[channel], 2); + } + + return distance; + }; + + this.equals = function(color) { + var a = this.getRGB(), + b = color.getRGB(); + + return this.getAlpha() == color.getAlpha() + && a.r == b.r + && a.g == b.g + && a.b == b.b; + }; + + this.limit = function(steps) { + steps -= 1; + var rgb = this.getRGB(); + this.setRGB( + Math.round(rgb.r * steps) / steps, + Math.round(rgb.g * steps) / steps, + Math.round(rgb.b * steps) / steps + ); + }; + + this.toHex = function() { + var rgb = this.getRGB(); + return _hexify(rgb.r * 255) + _hexify(rgb.g * 255) + _hexify(rgb.b * 255); + }; + + this.toCSS = function() { + return '#' + this.toHex(); + }; + + this.normalize = function() { + this.setHSV(null, 1, 1); + return this; + }; + + this.copy = function() { + var spaces = this.getSpaces(), + a = this.getAlpha(); + return new Color(spaces, a); + }; + + // Construct + if (args.length == 2) { + this.setSpaces(args[0]); + this.setAlpha(args[1] === 0 ? 0 : args[1] || 1); + } + if (args.length > 2) { + this.setRGB(args[0], args[1], args[2]); + this.setAlpha(args[3] === 0 ? 0 : args[3] || 1); + } + }; + + $.widget("vanderlee.colorpicker", { + options: { + alpha: false, // Show alpha controls and mode + altAlpha: true, // change opacity of altField as well? + altField: '', // selector for DOM elements which change background color on change. + altOnChange: true, // true to update on each change, false to update only on close. + altProperties: 'background-color', // comma separated list of any of 'background-color', 'color', 'border-color', 'outline-color' + autoOpen: false, // Open dialog automatically upon creation + buttonColorize: false, + buttonImage: 'images/ui-colorpicker.png', + buttonImageOnly: false, + buttonText: null, // Text on the button and/or title of button image. + closeOnEscape: true, // Close the dialog when the escape key is pressed. + closeOnOutside: true, // Close the dialog when clicking outside the dialog (not for inline) + color: '#00FF00', // Initial color (for inline only) + colorFormat: 'HEX', // Format string for output color format + draggable: true, // Make popup dialog draggable if header is visible. + duration: 'fast', + hsv: true, // Show HSV controls and modes + inline: true, // Show any divs as inline by default + layout: { + map: [0, 0, 1, 5], // Left, Top, Width, Height (in table cells). + bar: [1, 0, 1, 5], + preview: [2, 0, 1, 1], + hsv: [2, 1, 1, 1], + rgb: [2, 2, 1, 1], + alpha: [2, 3, 1, 1], + hex: [2, 4, 1, 1], + lab: [3, 1, 1, 1], + cmyk: [3, 2, 1, 2], + swatches: [4, 0, 1, 5] + }, + limit: '', // Limit color "resolution": '', 'websafe', 'nibble', 'binary', 'name' + modal: false, // Modal dialog? + mode: 'h', // Initial editing mode, h, s, v, r, g, b or a + parts: '', // leave empty for automatic selection + regional: '', + rgb: true, // Show RGB controls and modes + showAnim: 'fadeIn', + showCancelButton: true, + showNoneButton: false, + showCloseButton: true, + showOn: 'focus', // 'focus', 'button', 'both' + showOptions: {}, + swatches: null, + title: null, + + close: null, + init: null, + select: null, + open: null + }, + + _create: function () { + var that = this, + text; + + ++_colorpicker_index; + + that.widgetEventPrefix = 'color'; + + that.opened = false; + that.generated = false; + that.inline = false; + that.changed = false; + + that.dialog = null; + that.button = null; + that.image = null; + that.overlay = null; + + that.mode = that.options.mode; + + if (that.options.swatches === null) { + that.options.swatches = _colors; + } + + if (this.element[0].nodeName.toLowerCase() === 'input' || !that.options.inline) { + that._setColor(that.element.val()); + + this._callback('init'); + + $('body').append(_container_popup); + that.dialog = $('.ui-colorpicker:last'); + + // Click outside/inside + $(document).mousedown(function (event) { + if (!that.opened || event.target === that.element[0] || that.overlay) { + return; + } + + // Check if clicked on any part of dialog + if (that.dialog.is(event.target) || that.dialog.has(event.target).length > 0) { + that.element.blur(); // inside window! + return; + } + + // Check if clicked on button + var p, + parents = $(event.target).parents(); + for (p = 0; p <= parents.length; ++p) { + if (that.button !== null && parents[p] === that.button[0]) { + return; + } + } + + // no closeOnOutside + if (!that.options.closeOnOutside) { + return; + } + + that.close(); + }); + + $(document).keydown(function (event) { + if (event.keyCode == 27 && that.opened && that.options.closeOnEscape) { + that.close(); + } + }); + + if (that.options.showOn === 'focus' || that.options.showOn === 'both') { + that.element.on('focus click', function () { + that.open(); + }); + } + if (that.options.showOn === 'button' || that.options.showOn === 'both') { + if (that.options.buttonImage !== '') { + text = that.options.buttonText || that._getRegional('button'); + + that.image = $('').attr({ + 'src': that.options.buttonImage, + 'alt': text, + 'title': text + }); + + that._setImageBackground(); + } + + if (that.options.buttonImageOnly && that.image) { + that.button = that.image; + } else { + that.button = $('').html(that.image || that.options.buttonText).button(); + that.image = that.image ? $('img', that.button).first() : null; + } + that.button.insertAfter(that.element).click(function () { + that[that.opened ? 'close' : 'open'](); + }); + } + + if (that.options.autoOpen) { + that.open(); + } + + that.element.keydown(function (event) { + if (event.keyCode === 9) { + that.close(); + } + }).keyup(function (event) { + var color = _parseColor(that.element.val()); + if (!that.color.equals(color)) { + that.color = color; + that._change(); + } + }); + } else { + that.inline = true; + + $(this.element).html(_container_inline); + that.dialog = $('.ui-colorpicker', this.element); + + that._generate(); + + that.opened = true; + } + + return this; + }, + + _setOption: function(key, value){ + var that = this; + + switch (key) { + case "disabled": + if (value) { + that.dialog.addClass('ui-colorpicker-disabled'); + } else { + that.dialog.removeClass('ui-colorpicker-disabled'); + } + break; + } + + $.Widget.prototype._setOption.apply(that, arguments); + }, + + /* setBackground */ + _setImageBackground: function() { + if (this.image && this.options.buttonColorize) { + this.image.css('background-color', this.color.set? _formatColor('RGBA', this.color) : ''); + } + }, + + /** + * If an alternate field is specified, set it according to the current color. + */ + _setAltField: function () { + if (this.options.altOnChange && this.options.altField && this.options.altProperties) { + var index, + property, + properties = this.options.altProperties.split(','); + + for (index = 0; index <= properties.length; ++index) { + property = $.trim(properties[index]); + switch (property) { + case 'color': + case 'background-color': + case 'outline-color': + case 'border-color': + $(this.options.altField).css(property, this.color.set? this.color.toCSS() : ''); + break; + } + } + + if (this.options.altAlpha) { + $(this.options.altField).css('opacity', this.color.set? this.color.getAlpha() : ''); + } + } + }, + + _setColor: function(text) { + this.color = _parseColor(text); + this.currentColor = this.color.copy(); + + this._setImageBackground(); + this._setAltField(); + }, + + setColor: function(text) { + this._setColor(text); + this._change(this.color.set); + }, + + _generate: function () { + var that = this, + index, + part, + parts_list, + layout_parts; + + // Set color based on element? + that._setColor(that.inline? that.options.color : that.element.val()); + + // Determine the parts to include in this colorpicker + if (typeof that.options.parts === 'string') { + if (_parts_lists[that.options.parts]) { + parts_list = _parts_lists[that.options.parts]; + } else { + // automatic + parts_list = _parts_lists[that.inline ? 'inline' : 'popup']; + } + } else { + parts_list = that.options.parts; + } + + // Add any parts to the internal parts list + that.parts = {}; + $.each(parts_list, function(index, part) { + if (_parts[part]) { + that.parts[part] = new _parts[part](that); + } + }); + + if (!that.generated) { + layout_parts = []; + + $.each(that.options.layout, function(part, pos) { + if (that.parts[part]) { + layout_parts.push({ + 'part': part, + 'pos': pos + }); + } + }); + + $(_layoutTable(layout_parts, function(cell, x, y) { + var classes = ['ui-colorpicker-' + cell.part + '-container']; + + if (x > 0) { + classes.push('ui-colorpicker-padding-left'); + } + + if (y > 0) { + classes.push('ui-colorpicker-padding-top'); + } + + return ' 1 ? ' colspan="' + cell.pos[2] + '"' : '') + + (cell.pos[3] > 1 ? ' rowspan="' + cell.pos[3] + '"' : '') + + ' valign="top">'; + })).appendTo(that.dialog).addClass('ui-dialog-content ui-widget-content'); + + that._initAllParts(); + that._updateAllParts(); + that.generated = true; + } + }, + + _effectGeneric: function (element, show, slide, fade, callback) { + var that = this; + + if ($.effects && $.effects[that.options.showAnim]) { + element[show](that.options.showAnim, that.options.showOptions, that.options.duration, callback); + } else { + element[(that.options.showAnim === 'slideDown' ? + slide + : (that.options.showAnim === 'fadeIn' ? + fade + : show))]((that.options.showAnim ? that.options.duration : null), callback); + if (!that.options.showAnim || !that.options.duration) { + callback(); + } + } + }, + + _effectShow: function(element, callback) { + this._effectGeneric(element, 'show', 'slideDown', 'fadeIn', callback); + }, + + _effectHide: function(element, callback) { + this._effectGeneric(element, 'hide', 'slideUp', 'fadeOut', callback); + }, + + open: function() { + var that = this, + offset, + bottom, + right, + height, + width, + x, + y, + zIndex; + + if (!that.opened) { + that._generate(); + + offset = that.element.offset(); + bottom = $(window).height() + $(window).scrollTop(); + right = $(window).width() + $(window).scrollLeft(); + height = that.dialog.outerHeight(); + width = that.dialog.outerWidth(); + x = offset.left; + y = offset.top + that.element.outerHeight(); + + if (x + width > right) { + x = Math.max(0, right - width); + } + + if (y + height > bottom) { + if (offset.top - height >= $(window).scrollTop()) { + y = offset.top - height; + } else { + y = Math.max(0, bottom - height); + } + } + + that.dialog.css({'left': x, 'top': y}); + + // Automatically find highest z-index. + zIndex = 0; + $(that.element[0]).parents().each(function() { + var z = $(this).css('z-index'); + if ((typeof(z) === 'number' || typeof(z) === 'string') && z !== '' && !isNaN(z)) { + zIndex = z; + return false; + } + }); + + //@todo zIndexOffset option, to raise above other elements? + that.dialog.css('z-index', zIndex += 2); + + that.overlay = that.options.modal ? new $.ui.dialog.overlay(that) : null; + + that._effectShow(this.dialog); + that.opened = true; + that._callback('open', true); + + // Without waiting for domready the width of the map is 0 and we + // wind up with the cursor stuck in the upper left corner + $(function() { + that._repaintAllParts(); + }); + } + }, + + close: function () { + var that = this; + + that.currentColor = that.color.copy(); + that.changed = false; + + // tear down the interface + that._effectHide(that.dialog, function () { + that.dialog.empty(); + that.generated = false; + + that.opened = false; + that._callback('close', true); + }); + + if (that.overlay) { + that.overlay.destroy(); + } + }, + + destroy: function() { + this.element.unbind(); + + if (this.image !== null) { + this.image.remove(); + } + + if (this.button !== null) { + this.button.remove(); + } + + if (this.dialog !== null) { + this.dialog.remove(); + } + + if (this.overlay) { + this.overlay.destroy(); + } + }, + + _callback: function (callback, spaces) { + var that = this, + data, + lab; + + if (that.color.set) { + data = { + formatted: _formatColor(that.options.colorFormat, that.color) + }; + + lab = that.color.getLAB(); + lab.a = (lab.a * 2) - 1; + lab.b = (lab.b * 2) - 1; + + if (spaces === true) { + data.a = that.color.getAlpha(); + data.rgb = that.color.getRGB(); + data.hsv = that.color.getHSV(); + data.cmyk = that.color.getCMYK(); + data.hsl = that.color.getHSL(); + data.lab = lab; + } + + return that._trigger(callback, null, data); + } else { + return that._trigger(callback, null, { + formatted: '' + }); + } + }, + + _initAllParts: function () { + $.each(this.parts, function (index, part) { + if (part.init) { + part.init(); + } + }); + }, + + _updateAllParts: function () { + $.each(this.parts, function (index, part) { + if (part.update) { + part.update(); + } + }); + }, + + _repaintAllParts: function () { + $.each(this.parts, function (index, part) { + if (part.repaint) { + part.repaint(); + } + }); + }, + + _change: function (set /* = true */) { + this.color.set = (set !== false); + + this.changed = true; + + // Limit color palette + switch (this.options.limit) { + case 'websafe': + this.color.limit(6); + break; + + case 'nibble': + this.color.limit(16); + break; + + case 'binary': + this.color.limit(2); + break; + + case 'name': + var name = _closestName(this.color); + this.color.setRGB(_colors[name].r, _colors[name].g, _colors[name].b); + break; + } + + // update input element content + if (!this.inline) { + if (!this.color.set) { + this.element.val(''); + } else if (!this.color.equals(_parseColor(this.element.val()))) { + this.element.val(_formatColor(this.options.colorFormat, this.color)); + } + + this._setImageBackground(); + this._setAltField(); + } + + if (this.opened) { + this._repaintAllParts(); + } + + // callback + this._callback('select'); + }, + + // This will be deprecated by jQueryUI 1.9 widget + _hoverable: function (e) { + e.hover(function () { + e.addClass("ui-state-hover"); + }, function () { + e.removeClass("ui-state-hover"); + }); + }, + + // This will be deprecated by jQueryUI 1.9 widget + _focusable: function (e) { + e.focus(function () { + e.addClass("ui-state-focus"); + }).blur(function () { + e.removeClass("ui-state-focus"); + }); + }, + + _getRegional: function(name) { + return $.colorpicker.regional[this.options.regional][name] !== undefined ? + $.colorpicker.regional[this.options.regional][name] : $.colorpicker.regional[''][name]; + } + }); +}(jQuery)); \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/cursor-highlighter.html b/public/site_assets/test/js/dist/examples/cursor-highlighter.html new file mode 100644 index 00000000..ad6f6cba --- /dev/null +++ b/public/site_assets/test/js/dist/examples/cursor-highlighter.html @@ -0,0 +1,232 @@ + + + + + + Data Point Highlighting, Tooltips and Cursor Tracking + + + + + + + + + + + + + +
+
+
+ + + + +

The Highlighter plugin will highlight data points near the mouse and display an optional tooltip with the data point value. By default, the tooltip values will be formatted with the same formatter as used to display the axes tick values. The text format can be customized with an optional sprintf style format string.

+ +
+ +

+
+

The Cursor plugin changes the mouse cursor when it enters the graph area and displays an optional tooltip with the mouse position. The tooltip can be in a fixed location, or it can follow the mouse. The pointer style, set to "crosshair" by default, can also be customized. Tooltip values are formatted similar to the Highlighter plugin. By default they use the axes formatters, but can be customized with a sprintf format string.

+ +
+ +

+
+

Tooltips can be displayed with Pie Charts. Cursor tracking doesn't work with Pie Charts since they do not have points or axes, so the tooltip is based on the highlighter and always follows the mouse. You may wish to change the background and border colors of the highlighter tooltip for use with Pie Charts, since the default tooltip colors are designed to be displayed on top of a white background, while the Pie Chart slices provide a darker color background for the tooltips. To change the tooltip colors or other attributes, modify the jqplot-highlighter-tooltip class in jquery.jqplot.min.css.

+ +
+ +

+
+
+  
+
+
+
+    
+    
+    
+
+
+
+
+    
+    
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/customHighlighterCursorTrendline.html b/public/site_assets/test/js/dist/examples/customHighlighterCursorTrendline.html new file mode 100644 index 00000000..105a7528 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/customHighlighterCursorTrendline.html @@ -0,0 +1,164 @@ + + + + + + Highlighting, Dragging Points, Cursor and Trend Lines + + + + + + + + + + + + + +
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/dashboardWidget.html b/public/site_assets/test/js/dist/examples/dashboardWidget.html new file mode 100644 index 00000000..4a6fce23 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/dashboardWidget.html @@ -0,0 +1,272 @@ + + + + + + Animated Dashboard Sample - Filled Line with Log Axis + + + + + + + + + + + + + +
+
+
+ + + + + + + +
+
Hi Powered Data
+
+
+
+
+ +

+
+    
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+    
+    
+    
+    
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/dashedLines.html b/public/site_assets/test/js/dist/examples/dashedLines.html new file mode 100644 index 00000000..71b292fa --- /dev/null +++ b/public/site_assets/test/js/dist/examples/dashedLines.html @@ -0,0 +1,287 @@ + + + + + + Dashed Lines with Smoothing + + + + + + + + + + + + + +
+
+
+ + + + + + + +
+ +
+ +
+ +
+ +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/data-renderers.html b/public/site_assets/test/js/dist/examples/data-renderers.html new file mode 100644 index 00000000..188b472f --- /dev/null +++ b/public/site_assets/test/js/dist/examples/data-renderers.html @@ -0,0 +1,204 @@ + + + + + + AJAX and JSON Data Loading via Data Renderers + + + + + + + + + + + + + +
+
+
+ + + + +

Data renderers allow jqPlot to pull data from any external source (e.g. a function implementing an AJAX call). Simply assign the external source to the "dataRenderer" plot option. The only requirement on data renderers is that it must return a valid jqPlot data array.

+ +
+ +

+
+
+

Data renderers get passed options by the plot. The signiture for a data renderer is:

+ + +
+function(userData, plotObject, options) {
+  ...
+  return data;
+}
+
+ + +

Where userData is whatever data was passed into the plot, plotObject is a reference back to the plot itself, and options are any options passed into the plots "dataRendererOption" option. The following example shows a more complicated example which uses ajax pulls data from an external json data source.

+ +
+ +

+
+
+
+
+  
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/date-axes.html b/public/site_assets/test/js/dist/examples/date-axes.html new file mode 100644 index 00000000..199078df --- /dev/null +++ b/public/site_assets/test/js/dist/examples/date-axes.html @@ -0,0 +1,188 @@ + + + + + + Date Axes + + + + + + + + + + + + + +
+
+
+ + + +

Date axes support is provided through the dateAxisRenderer plugin. Date axes expand javascripts native date handling capabilities. This allow dates to be input in almost any unambiguous form, not just in milliseconds!

+ +

Note, although jqPlot will parse most any human readable date, it is safest to use javascript time stamps when possible. Also, it is best to specify a date and time and not just a date alone. This is due to inconsistent browser handling of local time vs. UTC with bare dates.

+ +
+ +

+
+

Date Axes also provide powerful formatting features. This allows custom formatter strings to be used to format axis tick labels precisely the way you want.

+ +
+ +

+  
+
+ +

+  
+
+
+
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+    
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/dateAxisLogAxisZooming.html b/public/site_assets/test/js/dist/examples/dateAxisLogAxisZooming.html new file mode 100644 index 00000000..34b987b8 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/dateAxisLogAxisZooming.html @@ -0,0 +1,161 @@ + + + + + + Zooming with Date and Log Axes + + + + + + + + + + + + + +
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/dateAxisRenderer.html b/public/site_assets/test/js/dist/examples/dateAxisRenderer.html new file mode 100644 index 00000000..d4904796 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/dateAxisRenderer.html @@ -0,0 +1,352 @@ + + + + + + Date Axes 2 + + + + + + + + + + + + + +
+
+
+ + + + +

Date axis renderer with default settings. Ticks are given wider spacing by default since date axes typically have longer tick labels.

+
+

Date axis recognizes rotated tick labels. It will space ticks a little closer when labels are rotated.

+
+

If you want more or less ticks, specify the "numberTicks" options. Date axes will try to produce the desired number of ticks, but may adjust to get a nice interval.

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/draw-rectangles.html b/public/site_assets/test/js/dist/examples/draw-rectangles.html new file mode 100644 index 00000000..5a1d1fdb --- /dev/null +++ b/public/site_assets/test/js/dist/examples/draw-rectangles.html @@ -0,0 +1,194 @@ + + + + + + Draw Rectangles on Plots + + + + + + + + + + + + + +
+
+
+ + + + +

These examples use rectangle overlays to show various ranges. +xmin, xmax, ymin, ymax are all optional -- the rectangle will go to the end of the plot area if they are not specified. +Colors are specified in the canvas drawing format (use rgba for transparency). +

+ +
+ + + +

+
+    
+ +

+  
+    
+ +

+  
+
+  
+
+
+
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+  
+  
+  
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/example.js b/public/site_assets/test/js/dist/examples/example.js new file mode 100644 index 00000000..6529b9bf --- /dev/null +++ b/public/site_assets/test/js/dist/examples/example.js @@ -0,0 +1,114 @@ +$(document).ready(function(){ + if (!$.jqplot._noCodeBlock) { + $('script.code').each(function(index) { + if ($('pre.code').eq(index).length ) { + $('pre.code').eq(index).text($(this).html()); + } + else { + // var str = $(this).text(); + // $('div.jqplot-target').eq(index).after($('
'+str+'
')); + var pre = $('
');
+                $('div.jqplot-target').eq(index).after(pre);
+                pre.text($(this).html());
+                pre = null;
+            }
+        });
+
+        $('script.common').each(function(index) {
+            $('pre.common').eq(index).text($(this).html());
+        });
+
+        var elstr='';
+        if ($('script.include, link.include').length > 0) {
+
+            if ($('pre.include').length == 0) {
+                var temp = [
+                    '
', + '

The charts on this page depend on the following files:

', + '
',
+                    '
' + ]; + + temp = $(temp.join('\n')); + $('div#example-content').append(temp); + temp = null; + } + + + $('script.include').each(function(index) { + if (elstr !== '') { + elstr += '\n'; + } + elstr += ''; + }); + + $('link.include').each(function(index) { + if (elstr !== '') { + elstr += '\n'; + } + elstr += ''; + }) + + $('pre.include').text(elstr); + } + + else { + $('pre.include').remove(); + $('div.include').remove(); + } + } + + if (!$.jqplot.use_excanvas) { + $('div.jqplot-target').each(function(){ + var outerDiv = $(document.createElement('div')); + var header = $(document.createElement('div')); + var div = $(document.createElement('div')); + + outerDiv.append(header); + outerDiv.append(div); + + outerDiv.addClass('jqplot-image-container'); + header.addClass('jqplot-image-container-header'); + div.addClass('jqplot-image-container-content'); + + header.html('Right Click to Save Image As...'); + + var close = $(document.createElement('a')); + close.addClass('jqplot-image-container-close'); + close.html('Close'); + close.attr('href', '#'); + close.click(function() { + $(this).parents('div.jqplot-image-container').hide(500); + }) + header.append(close); + + $(this).after(outerDiv); + outerDiv.hide(); + + outerDiv = header = div = close = null; + + if (!$.jqplot._noToImageButton) { + var btn = $(document.createElement('button')); + btn.text('View Plot Image'); + btn.addClass('jqplot-image-button'); + btn.bind('click', {chart: $(this)}, function(evt) { + var imgelem = evt.data.chart.jqplotToImageElem(); + var div = $(this).nextAll('div.jqplot-image-container').first(); + div.children('div.jqplot-image-container-content').empty(); + div.children('div.jqplot-image-container-content').append(imgelem); + div.show(500); + div = null; + }); + + $(this).after(btn); + btn.after('
'); + btn = null; + } + }); + } + + SyntaxHighlighter.defaults['toolbar'] = true; + SyntaxHighlighter.all(); + + $(document).unload(function() {$('*').unbind(); }); +}); \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/example.min.js b/public/site_assets/test/js/dist/examples/example.min.js new file mode 100644 index 00000000..1c91451a --- /dev/null +++ b/public/site_assets/test/js/dist/examples/example.min.js @@ -0,0 +1 @@ +$(document).ready(function(){if(!$.jqplot._noCodeBlock){$("script.code").each(function(c){if($("pre.code").eq(c).length){$("pre.code").eq(c).text($(this).html())}else{var d=$('
');$("div.jqplot-target").eq(c).after(d);d.text($(this).html());d=null}});$("script.common").each(function(c){$("pre.common").eq(c).text($(this).html())});var b="";if($("script.include, link.include").length>0){if($("pre.include").length==0){var a=['
','

The charts on this page depend on the following files:

','
',"
"];a=$(a.join("\n"));$("div#example-content").append(a);a=null}$("script.include").each(function(c){if(b!==""){b+="\n"}b+=' + + + + + +
+
+
+ + + + + + + +
+ +

Enter 2 series to fill between:

+ + + + + + + +

+
+
+    
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/hiddenPlotsInTabs.html b/public/site_assets/test/js/dist/examples/hiddenPlotsInTabs.html new file mode 100644 index 00000000..1f58a0dd --- /dev/null +++ b/public/site_assets/test/js/dist/examples/hiddenPlotsInTabs.html @@ -0,0 +1,285 @@ + + + + + + Hidden Plots + + + + + + + + + + + + + +
+
+
+ + + + + + +

This page demonstrates placing plots within jQuery UI widgets. Tab 2 and tab 3 contain plots. Using a combination of alternate sizing specification and the jqplot "replot" method the plots are properly displayed when their containers are shown.

+ +

The alternate sizing specifications for setting plot height and width are needed because a hidden element (or child of a hidden element) has no size. The first example in tab 2 uses custom "data-height" and "data-width" attributes on the plot target element. The second example uses "width" and "height" properties specified on the options object passed into the $.jqplot() function.

+ +

The default plot size is 300px wide by 400px high. The default setting can be overridden by specifying different values to the $.jqplot.config.defaultHeight and $.jqplot.config.defaultWidth properties. Height and width values are taken in this order of precedence: +

+ +
    +
  1. The css properties of the plot target if available (not available with display:none;).
  2. +
  3. Options object passed into the $.jqplot() function.
  4. +
  5. Custom data-height and data-width attributes on the plot target.
  6. +
  7. The config defaults.
  8. +
+ +
+ +
+ Tabs 2 and 3 have plots. Since tabs 2 and 3 are initially inactive, their contents (and the plots) are initially hidden. +
+ +
+

This plot was in an initially hidden container. Its height and width are set by the "data-height" and "data-width" properties of the plot container.

+
+
+ +
+

This plot is in an initially hidden container. Its height and width are set by the 'height' and 'width' properties of the options object passed into the plot constructor.

+
+
+ +
+ +

In the accordion below, section 2 contains a plot. Sizing plots in hidden accordion sections is very similar to sizing in a tab widget. Because of the default animation on accordions, however, the plot will not draw itself until the entire accordion panel is shown.

+ +
+ +

Section 1

+
+ Here is section 1 there is no plot. Section 2 has a plot that will display once the section is completely shown. +
+ +

Section 2

+
+

+ This plot also has its height and width set with the data-height and data-width attributes. Note, if you want the accordion widget to properly size itself before the plot is shown, you must also specify a css height and width on the plot target. +

+
+
+ +
+ +

Code for generating the plots follows. It is critical to bind the callback to the UI widgets "show" or "change" method which calls the plots "replot" method. Without this, the plot won't properly redraw itself when its container becomes visible.

+ +

+ Note in the ui.index and plot._drawCount properties in the tabsshow callback. ui.index gives the index of the activated tab. plot._drawCount keeps track of how many times the plot was visibly drawn (or redrawn/replotted). Generally, replot only needs to be called the first time the plot is visibly drawn, hence the check for plot._drawCount === 0. +

+ +

+
+ 
+
+
+
+
+
+
+    
+    
+    
+    
+
+
+
+  
+  
+  
+  
+   
+  
+
+
+
+        
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/images/bar-alpha.png b/public/site_assets/test/js/dist/examples/images/bar-alpha.png new file mode 100644 index 00000000..2950daeb Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/bar-alpha.png differ diff --git a/public/site_assets/test/js/dist/examples/images/bar-opacity.png b/public/site_assets/test/js/dist/examples/images/bar-opacity.png new file mode 100644 index 00000000..e42ad081 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/bar-opacity.png differ diff --git a/public/site_assets/test/js/dist/examples/images/bar-pointer.png b/public/site_assets/test/js/dist/examples/images/bar-pointer.png new file mode 100644 index 00000000..6e980cfa Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/bar-pointer.png differ diff --git a/public/site_assets/test/js/dist/examples/images/bar.png b/public/site_assets/test/js/dist/examples/images/bar.png new file mode 100644 index 00000000..80eb2bbe Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/bar.png differ diff --git a/public/site_assets/test/js/dist/examples/images/logo.jpg b/public/site_assets/test/js/dist/examples/images/logo.jpg new file mode 100644 index 00000000..a12fffcd Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/logo.jpg differ diff --git a/public/site_assets/test/js/dist/examples/images/map-opacity.png b/public/site_assets/test/js/dist/examples/images/map-opacity.png new file mode 100644 index 00000000..6756cee6 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/map-opacity.png differ diff --git a/public/site_assets/test/js/dist/examples/images/map-pointer.png b/public/site_assets/test/js/dist/examples/images/map-pointer.png new file mode 100644 index 00000000..64992968 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/map-pointer.png differ diff --git a/public/site_assets/test/js/dist/examples/images/map.png b/public/site_assets/test/js/dist/examples/images/map.png new file mode 100644 index 00000000..853d38c6 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/map.png differ diff --git a/public/site_assets/test/js/dist/examples/images/preview-opacity.png b/public/site_assets/test/js/dist/examples/images/preview-opacity.png new file mode 100644 index 00000000..0dd9a2f8 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/preview-opacity.png differ diff --git a/public/site_assets/test/js/dist/examples/images/ui-colorpicker.png b/public/site_assets/test/js/dist/examples/images/ui-colorpicker.png new file mode 100644 index 00000000..e244c689 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/images/ui-colorpicker.png differ diff --git a/public/site_assets/test/js/dist/examples/index.html b/public/site_assets/test/js/dist/examples/index.html new file mode 100644 index 00000000..b9615abd --- /dev/null +++ b/public/site_assets/test/js/dist/examples/index.html @@ -0,0 +1,128 @@ + + + + + + Examples + + + + + + + + + + + + + +
+
+
+ + + +There are lots of examples showing basic chart functionality as well as zoom proxies, dynamic replotting, Mekko charts, trend lines, block plots, log axes, filled line (area) plots, and...well you get the picture. When you download a distribution, you'll get over 90 examples of plot types, features and functionality! The examples are a great way to understand what jqPlot is capable of, and to learn how to use the library. + + + + + + + + + + + + + + + + + +
+ +
+
+ + + + + + diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png new file mode 100644 index 00000000..5b5dab2a Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_flat_0_aaaaaa_40x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_flat_75_ffffff_40x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_flat_75_ffffff_40x100.png new file mode 100644 index 00000000..ac8b229a Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_flat_75_ffffff_40x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png new file mode 100644 index 00000000..ad3d6346 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_55_fbf9ee_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_65_ffffff_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 00000000..42ccba26 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_75_dadada_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_75_dadada_1x400.png new file mode 100644 index 00000000..5a46b47c Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_75_dadada_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png new file mode 100644 index 00000000..86c2baa6 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_75_e6e6e6_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png new file mode 100644 index 00000000..4443fdc1 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_glass_95_fef1ec_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png new file mode 100644 index 00000000..7c9fa6c6 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-bg_highlight-soft_75_cccccc_1x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_222222_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_222222_256x240.png new file mode 100644 index 00000000..b273ff11 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_222222_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_2e83ff_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_2e83ff_256x240.png new file mode 100644 index 00000000..09d1cdc8 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_2e83ff_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_454545_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_454545_256x240.png new file mode 100644 index 00000000..59bd45b9 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_454545_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_888888_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_888888_256x240.png new file mode 100644 index 00000000..6d02426c Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_888888_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_cd0a0a_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_cd0a0a_256x240.png new file mode 100644 index 00000000..2ab019b7 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/images/ui-icons_cd0a0a_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/jquery-ui.css b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/jquery-ui.css new file mode 100644 index 00000000..0f1a7e77 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/jquery-ui.css @@ -0,0 +1,568 @@ +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Verdana,Arial,sans-serif&fwDefault=normal&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=cccccc&bgTextureHeader=03_highlight_soft.png&bgImgOpacityHeader=75&borderColorHeader=aaaaaa&fcHeader=222222&iconColorHeader=222222&bgColorContent=ffffff&bgTextureContent=01_flat.png&bgImgOpacityContent=75&borderColorContent=aaaaaa&fcContent=222222&iconColorContent=222222&bgColorDefault=e6e6e6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=75&borderColorDefault=d3d3d3&fcDefault=555555&iconColorDefault=888888&bgColorHover=dadada&bgTextureHover=02_glass.png&bgImgOpacityHover=75&borderColorHover=999999&fcHover=212121&iconColorHover=454545&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=aaaaaa&fcActive=212121&iconColorActive=454545&bgColorHighlight=fbf9ee&bgTextureHighlight=02_glass.png&bgImgOpacityHighlight=55&borderColorHighlight=fcefa1&fcHighlight=363636&iconColorHighlight=2e83ff&bgColorError=fef1ec&bgTextureError=02_glass.png&bgImgOpacityError=95&borderColorError=cd0a0a&fcError=cd0a0a&iconColorError=cd0a0a&bgColorOverlay=aaaaaa&bgTextureOverlay=01_flat.png&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=aaaaaa&bgTextureShadow=01_flat.png&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=8px&offsetTopShadow=-8px&offsetLeftShadow=-8px&cornerRadiusShadow=8px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x; color: #222222; } +.ui-widget-content a { color: #222222; } +.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; } +.ui-widget-header a { color: #222222; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x; color: #cd0a0a; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); } +.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -khtml-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* + * jQuery UI Resizable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.16 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/jquery-ui.min.css b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/jquery-ui.min.css new file mode 100644 index 00000000..08821f53 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/css/smoothness/jquery-ui.min.css @@ -0,0 +1 @@ +.ui-helper-hidden{display:none;}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px);}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none;}.ui-helper-clearfix:after{content:".";display:block;height:0;clear:both;visibility:hidden;}.ui-helper-clearfix{display:inline-block;}/* required comment for clearfix to work in Opera \*/ * html .ui-helper-clearfix{height:1%;}.ui-helper-clearfix{display:block;}/* end clearfix */ .ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0);}.ui-state-disabled{cursor:default!important;}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat;}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%;}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em;}.ui-widget .ui-widget{font-size:1em;}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em;}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222;}.ui-widget-content a{color:#222;}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold;}.ui-widget-header a{color:#222;}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555;}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none;}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121;}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none;}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121;}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none;}.ui-widget :active{outline:none;}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636;}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636;}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a;}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a;}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a;}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold;}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal;}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none;}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png);}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png);}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png);}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png);}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png);}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png);}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png);}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png);}.ui-icon-carat-1-n{background-position:0 0;}.ui-icon-carat-1-ne{background-position:-16px 0;}.ui-icon-carat-1-e{background-position:-32px 0;}.ui-icon-carat-1-se{background-position:-48px 0;}.ui-icon-carat-1-s{background-position:-64px 0;}.ui-icon-carat-1-sw{background-position:-80px 0;}.ui-icon-carat-1-w{background-position:-96px 0;}.ui-icon-carat-1-nw{background-position:-112px 0;}.ui-icon-carat-2-n-s{background-position:-128px 0;}.ui-icon-carat-2-e-w{background-position:-144px 0;}.ui-icon-triangle-1-n{background-position:0 -16px;}.ui-icon-triangle-1-ne{background-position:-16px -16px;}.ui-icon-triangle-1-e{background-position:-32px -16px;}.ui-icon-triangle-1-se{background-position:-48px -16px;}.ui-icon-triangle-1-s{background-position:-64px -16px;}.ui-icon-triangle-1-sw{background-position:-80px -16px;}.ui-icon-triangle-1-w{background-position:-96px -16px;}.ui-icon-triangle-1-nw{background-position:-112px -16px;}.ui-icon-triangle-2-n-s{background-position:-128px -16px;}.ui-icon-triangle-2-e-w{background-position:-144px -16px;}.ui-icon-arrow-1-n{background-position:0 -32px;}.ui-icon-arrow-1-ne{background-position:-16px -32px;}.ui-icon-arrow-1-e{background-position:-32px -32px;}.ui-icon-arrow-1-se{background-position:-48px -32px;}.ui-icon-arrow-1-s{background-position:-64px -32px;}.ui-icon-arrow-1-sw{background-position:-80px -32px;}.ui-icon-arrow-1-w{background-position:-96px -32px;}.ui-icon-arrow-1-nw{background-position:-112px -32px;}.ui-icon-arrow-2-n-s{background-position:-128px -32px;}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px;}.ui-icon-arrow-2-e-w{background-position:-160px -32px;}.ui-icon-arrow-2-se-nw{background-position:-176px -32px;}.ui-icon-arrowstop-1-n{background-position:-192px -32px;}.ui-icon-arrowstop-1-e{background-position:-208px -32px;}.ui-icon-arrowstop-1-s{background-position:-224px -32px;}.ui-icon-arrowstop-1-w{background-position:-240px -32px;}.ui-icon-arrowthick-1-n{background-position:0 -48px;}.ui-icon-arrowthick-1-ne{background-position:-16px -48px;}.ui-icon-arrowthick-1-e{background-position:-32px -48px;}.ui-icon-arrowthick-1-se{background-position:-48px -48px;}.ui-icon-arrowthick-1-s{background-position:-64px -48px;}.ui-icon-arrowthick-1-sw{background-position:-80px -48px;}.ui-icon-arrowthick-1-w{background-position:-96px -48px;}.ui-icon-arrowthick-1-nw{background-position:-112px -48px;}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px;}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px;}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px;}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px;}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px;}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px;}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px;}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px;}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px;}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px;}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px;}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px;}.ui-icon-arrowreturn-1-w{background-position:-64px -64px;}.ui-icon-arrowreturn-1-n{background-position:-80px -64px;}.ui-icon-arrowreturn-1-e{background-position:-96px -64px;}.ui-icon-arrowreturn-1-s{background-position:-112px -64px;}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px;}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px;}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px;}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px;}.ui-icon-arrow-4{background-position:0 -80px;}.ui-icon-arrow-4-diag{background-position:-16px -80px;}.ui-icon-extlink{background-position:-32px -80px;}.ui-icon-newwin{background-position:-48px -80px;}.ui-icon-refresh{background-position:-64px -80px;}.ui-icon-shuffle{background-position:-80px -80px;}.ui-icon-transfer-e-w{background-position:-96px -80px;}.ui-icon-transferthick-e-w{background-position:-112px -80px;}.ui-icon-folder-collapsed{background-position:0 -96px;}.ui-icon-folder-open{background-position:-16px -96px;}.ui-icon-document{background-position:-32px -96px;}.ui-icon-document-b{background-position:-48px -96px;}.ui-icon-note{background-position:-64px -96px;}.ui-icon-mail-closed{background-position:-80px -96px;}.ui-icon-mail-open{background-position:-96px -96px;}.ui-icon-suitcase{background-position:-112px -96px;}.ui-icon-comment{background-position:-128px -96px;}.ui-icon-person{background-position:-144px -96px;}.ui-icon-print{background-position:-160px -96px;}.ui-icon-trash{background-position:-176px -96px;}.ui-icon-locked{background-position:-192px -96px;}.ui-icon-unlocked{background-position:-208px -96px;}.ui-icon-bookmark{background-position:-224px -96px;}.ui-icon-tag{background-position:-240px -96px;}.ui-icon-home{background-position:0 -112px;}.ui-icon-flag{background-position:-16px -112px;}.ui-icon-calendar{background-position:-32px -112px;}.ui-icon-cart{background-position:-48px -112px;}.ui-icon-pencil{background-position:-64px -112px;}.ui-icon-clock{background-position:-80px -112px;}.ui-icon-disk{background-position:-96px -112px;}.ui-icon-calculator{background-position:-112px -112px;}.ui-icon-zoomin{background-position:-128px -112px;}.ui-icon-zoomout{background-position:-144px -112px;}.ui-icon-search{background-position:-160px -112px;}.ui-icon-wrench{background-position:-176px -112px;}.ui-icon-gear{background-position:-192px -112px;}.ui-icon-heart{background-position:-208px -112px;}.ui-icon-star{background-position:-224px -112px;}.ui-icon-link{background-position:-240px -112px;}.ui-icon-cancel{background-position:0 -128px;}.ui-icon-plus{background-position:-16px -128px;}.ui-icon-plusthick{background-position:-32px -128px;}.ui-icon-minus{background-position:-48px -128px;}.ui-icon-minusthick{background-position:-64px -128px;}.ui-icon-close{background-position:-80px -128px;}.ui-icon-closethick{background-position:-96px -128px;}.ui-icon-key{background-position:-112px -128px;}.ui-icon-lightbulb{background-position:-128px -128px;}.ui-icon-scissors{background-position:-144px -128px;}.ui-icon-clipboard{background-position:-160px -128px;}.ui-icon-copy{background-position:-176px -128px;}.ui-icon-contact{background-position:-192px -128px;}.ui-icon-image{background-position:-208px -128px;}.ui-icon-video{background-position:-224px -128px;}.ui-icon-script{background-position:-240px -128px;}.ui-icon-alert{background-position:0 -144px;}.ui-icon-info{background-position:-16px -144px;}.ui-icon-notice{background-position:-32px -144px;}.ui-icon-help{background-position:-48px -144px;}.ui-icon-check{background-position:-64px -144px;}.ui-icon-bullet{background-position:-80px -144px;}.ui-icon-radio-off{background-position:-96px -144px;}.ui-icon-radio-on{background-position:-112px -144px;}.ui-icon-pin-w{background-position:-128px -144px;}.ui-icon-pin-s{background-position:-144px -144px;}.ui-icon-play{background-position:0 -160px;}.ui-icon-pause{background-position:-16px -160px;}.ui-icon-seek-next{background-position:-32px -160px;}.ui-icon-seek-prev{background-position:-48px -160px;}.ui-icon-seek-end{background-position:-64px -160px;}.ui-icon-seek-start{background-position:-80px -160px;}.ui-icon-seek-first{background-position:-80px -160px;}.ui-icon-stop{background-position:-96px -160px;}.ui-icon-eject{background-position:-112px -160px;}.ui-icon-volume-off{background-position:-128px -160px;}.ui-icon-volume-on{background-position:-144px -160px;}.ui-icon-power{background-position:0 -176px;}.ui-icon-signal-diag{background-position:-16px -176px;}.ui-icon-signal{background-position:-32px -176px;}.ui-icon-battery-0{background-position:-48px -176px;}.ui-icon-battery-1{background-position:-64px -176px;}.ui-icon-battery-2{background-position:-80px -176px;}.ui-icon-battery-3{background-position:-96px -176px;}.ui-icon-circle-plus{background-position:0 -192px;}.ui-icon-circle-minus{background-position:-16px -192px;}.ui-icon-circle-close{background-position:-32px -192px;}.ui-icon-circle-triangle-e{background-position:-48px -192px;}.ui-icon-circle-triangle-s{background-position:-64px -192px;}.ui-icon-circle-triangle-w{background-position:-80px -192px;}.ui-icon-circle-triangle-n{background-position:-96px -192px;}.ui-icon-circle-arrow-e{background-position:-112px -192px;}.ui-icon-circle-arrow-s{background-position:-128px -192px;}.ui-icon-circle-arrow-w{background-position:-144px -192px;}.ui-icon-circle-arrow-n{background-position:-160px -192px;}.ui-icon-circle-zoomin{background-position:-176px -192px;}.ui-icon-circle-zoomout{background-position:-192px -192px;}.ui-icon-circle-check{background-position:-208px -192px;}.ui-icon-circlesmall-plus{background-position:0 -208px;}.ui-icon-circlesmall-minus{background-position:-16px -208px;}.ui-icon-circlesmall-close{background-position:-32px -208px;}.ui-icon-squaresmall-plus{background-position:-48px -208px;}.ui-icon-squaresmall-minus{background-position:-64px -208px;}.ui-icon-squaresmall-close{background-position:-80px -208px;}.ui-icon-grip-dotted-vertical{background-position:0 -224px;}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px;}.ui-icon-grip-solid-vertical{background-position:-32px -224px;}.ui-icon-grip-solid-horizontal{background-position:-48px -224px;}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px;}.ui-icon-grip-diagonal-se{background-position:-80px -224px;}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px;}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px;}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px;}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px;}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.30;filter:Alpha(Opacity=30);}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.30;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px;}.ui-resizable{position:relative;}.ui-resizable-handle{position:absolute;font-size:.1px;z-index:99999;display:block;}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none;}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0;}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0;}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%;}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%;}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px;}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px;}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px;}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px;}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black;}.ui-accordion{width:100%;}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1;}.ui-accordion .ui-accordion-li-fix{display:inline;}.ui-accordion .ui-accordion-header-active{border-bottom:0!important;}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em;}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em;}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px;}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1;}.ui-accordion .ui-accordion-content-active{display:block;}.ui-autocomplete{position:absolute;cursor:default;}* html .ui-autocomplete{width:1px;}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left;}.ui-menu .ui-menu{margin-top:-3px;}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%;}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1;}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px;}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible;}.ui-button-icon-only{width:2.2em;}button.ui-button-icon-only{width:2.4em;}.ui-button-icons-only{width:3.4em;}button.ui-button-icons-only{width:3.7em;}.ui-button .ui-button-text{display:block;line-height:1.4;}.ui-button-text-only .ui-button-text{padding:.4em 1em;}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px;}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em;}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em;}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em;}input.ui-button{padding:.4em 1em;}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px;}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px;}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em;}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em;}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em;}.ui-buttonset{margin-right:7px;}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em;}button.ui-button::-moz-focus-inner{border:0;padding:0;}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden;}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative;}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0;}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px;}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px;}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0;}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1;}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em;}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right;}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer;}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px;}.ui-draggable .ui-dialog-titlebar{cursor:move;}.ui-slider{position:relative;text-align:left;}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default;}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0;}.ui-slider-horizontal{height:.8em;}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em;}.ui-slider-horizontal .ui-slider-range{top:0;height:100%;}.ui-slider-horizontal .ui-slider-range-min{left:0;}.ui-slider-horizontal .ui-slider-range-max{right:0;}.ui-slider-vertical{width:.8em;height:100px;}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em;}.ui-slider-vertical .ui-slider-range{left:0;width:100%;}.ui-slider-vertical .ui-slider-range-min{bottom:0;}.ui-slider-vertical .ui-slider-range-max{top:0;}.ui-tabs{position:relative;padding:.2em;zoom:1;}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0;}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap;}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none;}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px;}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text;}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer;}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none;}.ui-tabs .ui-tabs-hide{display:none!important;}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none;}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0;}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em;}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px;}.ui-datepicker .ui-datepicker-prev{left:2px;}.ui-datepicker .ui-datepicker-next{right:2px;}.ui-datepicker .ui-datepicker-prev-hover{left:1px;}.ui-datepicker .ui-datepicker-next-hover{right:1px;}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px;}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center;}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0;}.ui-datepicker select.ui-datepicker-month-year{width:100%;}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%;}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em;}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0;}.ui-datepicker td{border:0;padding:1px;}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none;}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0;}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible;}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left;}.ui-datepicker.ui-datepicker-multi{width:auto;}.ui-datepicker-multi .ui-datepicker-group{float:left;}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em;}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%;}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%;}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%;}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0;}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0;}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left;}.ui-datepicker-row-break{clear:both;width:100%;font-size:0;}.ui-datepicker-rtl{direction:rtl;}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto;}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto;}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto;}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto;}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right;}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left;}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right;}.ui-datepicker-rtl .ui-datepicker-group{float:right;}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px;}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px;}.ui-datepicker-cover{display:none;display:block;position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px;}.ui-progressbar{height:2em;text-align:left;}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%;} \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png new file mode 100644 index 00000000..954e22db Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png new file mode 100644 index 00000000..64ece570 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png new file mode 100644 index 00000000..abdc0108 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png new file mode 100644 index 00000000..9b383f4d Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png new file mode 100644 index 00000000..a23baad2 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png new file mode 100644 index 00000000..42ccba26 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png new file mode 100644 index 00000000..39d5824d Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png new file mode 100644 index 00000000..f1273672 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png new file mode 100644 index 00000000..359397ac Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_228ef1_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_228ef1_256x240.png new file mode 100644 index 00000000..a641a371 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_228ef1_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png new file mode 100644 index 00000000..85e63e9f Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ef8c08_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png new file mode 100644 index 00000000..e117effa Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ffd27a_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ffffff_256x240.png b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ffffff_256x240.png new file mode 100644 index 00000000..42f8f992 Binary files /dev/null and b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/images/ui-icons_ffffff_256x240.png differ diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui-1.9pre.css b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui-1.9pre.css new file mode 100644 index 00000000..cd66d537 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui-1.9pre.css @@ -0,0 +1,612 @@ +/* + * jQuery UI CSS Framework 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } +/* + * jQuery UI Accordion 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-heading { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-heading { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-accordion-header-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ +/* + * jQuery UI Button 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Datepicker 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Dialog 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Menu 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { list-style:none; padding: 2px; margin: 0; display:block; outline: none; } +.ui-menu .ui-menu { margin-top: -3px; position: absolute; } +.ui-menu .ui-menu-item { margin: 0; padding: 0; zoom: 1; width: 100%; } +.ui-menu .ui-menu-item a { text-decoration: none; display: block; padding: 2px .4em; line-height: 1.5; zoom: 1; font-weight: normal; } +.ui-menu .ui-menu-item a.ui-state-focus, +.ui-menu .ui-menu-item a.ui-state-active { font-weight: normal; margin: -1px; } + +.ui-menu li.ui-state-disabled { font-weight: normal; padding: .0em .4em; margin: .4em 0 .2em; line-height: 1.5; } + +/* icon support */ +.ui-menu-icons { position: relative; } +.ui-menu-icons .ui-menu-item a { position: relative; padding-left: 2em; } + +/* left-aligned */ +.ui-menu .ui-icon { position: absolute; top: .2em; left: .2em; } + +/* right-aligned */ +.ui-menu .ui-menu-icon { position: static; float: right; } +/* + * jQuery UI Menubar 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + */ +.ui-menubar { list-style: none; margin: 0; padding-left: 0; } + +.ui-menubar-item { float: left; } + +.ui-menubar .ui-button { float: left; font-weight: normal; border-top-width: 0 !important; border-bottom-width: 0 !important; margin: 0; outline: none; } +.ui-menubar .ui-menubar-link { border-right: 1px dashed transparent; border-left: 1px dashed transparent; } + +.ui-menubar .ui-menu { width: 200px; position: absolute; z-index: 9999; } +/* + * jQuery UI Progressbar 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; overflow: hidden; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* + * jQuery UI Resizable 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Slider 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Spinner 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Spinner#theming + */ +.ui-spinner { position:relative; display: inline-block; overflow: hidden; padding: 0; vertical-align: middle; } +.ui-spinner-input { border: none; background: none; padding: 0; margin: .2em 0; vertical-align: middle; margin-left: .4em; margin-right: 22px; } +.ui-spinner-button { width: 16px; height: 50%; font-size: .5em; padding: 0; margin: 0; z-index: 100; text-align: center; vertical-align: middle; position: absolute; cursor: default; display: block; overflow: hidden; right: 0; } +.ui-spinner a.ui-spinner-button { border-top: none; border-bottom: none; border-right: none; } /* more specificity required here to overide default borders */ +.ui-spinner .ui-icon { position: absolute; margin-top: -8px; top: 50%; left: 0; } /* vertical centre icon */ +.ui-spinner-up { top: 0; } +.ui-spinner-down { bottom: 0; } + +/* TR overrides */ +span.ui-spinner { background: none; } +.ui-spinner .ui-icon-triangle-1-s { + /* need to fix icons sprite */ + background-position:-65px -16px; +} +/* + * jQuery UI Tabs 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 0; margin: 1px .2em 0 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-active { margin-bottom: -1px; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-active a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-tabs-loading a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +/* + * jQuery UI Tooltip 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tooltip#theming + */ +.ui-tooltip { + padding:8px; + position:absolute; + z-index:9999; + -o-box-shadow: 0 0 5px #aaa; + -moz-box-shadow: 0 0 5px #aaa; + -webkit-box-shadow: 0 0 5px #aaa; + box-shadow: 0 0 5px #aaa; +} +/* Fades and background-images don't work well together in IE6, drop the image */ +* html .ui-tooltip { + background-image: none; +} +body .ui-tooltip { border-width:2px; } +/* + * jQuery UI CSS Framework 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-on { background-position: -96px -144px; } +.ui-icon-radio-off { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; -khtml-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; -khtml-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; -khtml-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -khtml-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui-1.9pre.min.css b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui-1.9pre.min.css new file mode 100644 index 00000000..56a9be11 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui-1.9pre.min.css @@ -0,0 +1,10 @@ +/* + * jQuery UI CSS Framework 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ +.ui-helper-hidden{display:none;}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px);}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none;}.ui-helper-clearfix:after{content:".";display:block;height:0;clear:both;visibility:hidden;}.ui-helper-clearfix{display:inline-block;}/* required comment for clearfix to work in Opera \*/ * html .ui-helper-clearfix{height:1%;}.ui-helper-clearfix{display:block;}/* end clearfix */ .ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0);}.ui-state-disabled{cursor:default!important;}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat;}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%;}.ui-accordion{width:100%;}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1;}.ui-accordion .ui-accordion-header-active{border-bottom:0!important;}.ui-accordion .ui-accordion-heading{display:block;font-size:1em;padding:.5em .5em .5em .7em;}.ui-accordion-icons .ui-accordion-heading{padding-left:2.2em;}.ui-accordion .ui-accordion-header .ui-accordion-header-icon{position:absolute;left:.5em;top:50%;margin-top:-8px;}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1;}.ui-accordion .ui-accordion-content-active{display:block;}.ui-autocomplete{position:absolute;cursor:default;}* html .ui-autocomplete{width:1px;}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible;}.ui-button-icon-only{width:2.2em;}button.ui-button-icon-only{width:2.4em;}.ui-button-icons-only{width:3.4em;}button.ui-button-icons-only{width:3.7em;}.ui-button .ui-button-text{display:block;line-height:1.4;}.ui-button-text-only .ui-button-text{padding:.4em 1em;}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px;}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em;}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em;}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em;}input.ui-button{padding:.4em 1em;}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px;}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px;}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em;}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em;}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em;}.ui-buttonset{margin-right:7px;}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em;}button.ui-button::-moz-focus-inner{border:0;padding:0;}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none;}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0;}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em;}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px;}.ui-datepicker .ui-datepicker-prev{left:2px;}.ui-datepicker .ui-datepicker-next{right:2px;}.ui-datepicker .ui-datepicker-prev-hover{left:1px;}.ui-datepicker .ui-datepicker-next-hover{right:1px;}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px;}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center;}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0;}.ui-datepicker select.ui-datepicker-month-year{width:100%;}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%;}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em;}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0;}.ui-datepicker td{border:0;padding:1px;}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none;}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0;}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible;}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left;}.ui-datepicker.ui-datepicker-multi{width:auto;}.ui-datepicker-multi .ui-datepicker-group{float:left;}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em;}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%;}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%;}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%;}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0;}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0;}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left;}.ui-datepicker-row-break{clear:both;width:100%;font-size:0;}.ui-datepicker-rtl{direction:rtl;}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto;}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto;}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto;}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto;}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right;}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left;}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right;}.ui-datepicker-rtl .ui-datepicker-group{float:right;}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px;}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px;}.ui-datepicker-cover{display:none;display:block;position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px;}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden;}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative;}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0;}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px;}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px;}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0;}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1;}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em;}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right;}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer;}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px;}.ui-draggable .ui-dialog-titlebar{cursor:move;}.ui-menu{list-style:none;padding:2px;margin:0;display:block;outline:none;}.ui-menu .ui-menu{margin-top:-3px;position:absolute;}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;width:100%;}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:2px .4em;line-height:1.5;zoom:1;font-weight:normal;}.ui-menu .ui-menu-item a.ui-state-focus,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px;}.ui-menu li.ui-state-disabled{font-weight:normal;padding:.0em .4em;margin:.4em 0 .2em;line-height:1.5;}.ui-menu-icons{position:relative;}.ui-menu-icons .ui-menu-item a{position:relative;padding-left:2em;}.ui-menu .ui-icon{position:absolute;top:.2em;left:.2em;}.ui-menu .ui-menu-icon{position:static;float:right;}.ui-menubar{list-style:none;margin:0;padding-left:0;}.ui-menubar-item{float:left;}.ui-menubar .ui-button{float:left;font-weight:normal;border-top-width:0!important;border-bottom-width:0!important;margin:0;outline:none;}.ui-menubar .ui-menubar-link{border-right:1px dashed transparent;border-left:1px dashed transparent;}.ui-menubar .ui-menu{width:200px;position:absolute;z-index:9999;}.ui-progressbar{height:2em;text-align:left;overflow:hidden;}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%;}.ui-resizable{position:relative;}.ui-resizable-handle{position:absolute;font-size:.1px;z-index:99999;display:block;}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none;}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0;}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0;}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%;}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%;}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px;}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px;}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px;}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px;}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black;}.ui-slider{position:relative;text-align:left;}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default;}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0;}.ui-slider-horizontal{height:.8em;}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em;}.ui-slider-horizontal .ui-slider-range{top:0;height:100%;}.ui-slider-horizontal .ui-slider-range-min{left:0;}.ui-slider-horizontal .ui-slider-range-max{right:0;}.ui-slider-vertical{width:.8em;height:100px;}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em;}.ui-slider-vertical .ui-slider-range{left:0;width:100%;}.ui-slider-vertical .ui-slider-range-min{bottom:0;}.ui-slider-vertical .ui-slider-range-max{top:0;}.ui-spinner{position:relative;display:inline-block;overflow:hidden;padding:0;vertical-align:middle;}.ui-spinner-input{border:none;background:none;padding:0;margin:.2em 0;vertical-align:middle;margin-left:.4em;margin-right:22px;}.ui-spinner-button{width:16px;height:50%;font-size:.5em;padding:0;margin:0;z-index:100;text-align:center;vertical-align:middle;position:absolute;cursor:default;display:block;overflow:hidden;right:0;}.ui-spinner a.ui-spinner-button{border-top:none;border-bottom:none;border-right:none;}.ui-spinner .ui-icon{position:absolute;margin-top:-8px;top:50%;left:0;}.ui-spinner-up{top:0;}.ui-spinner-down{bottom:0;}span.ui-spinner{background:none;}.ui-spinner .ui-icon-triangle-1-s{background-position:-65px -16px;}.ui-tabs{position:relative;padding:.2em;zoom:1;}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0;}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:0;margin:1px .2em 0 0;border-bottom:0!important;padding:0;white-space:nowrap;}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none;}.ui-tabs .ui-tabs-nav li.ui-tabs-active{margin-bottom:-1px;padding-bottom:1px;}.ui-tabs .ui-tabs-nav li.ui-tabs-active a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-tabs-loading a{cursor:text;}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a{cursor:pointer;}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none;}.ui-tooltip{padding:8px;position:absolute;z-index:9999;-o-box-shadow:0 0 5px #aaa;-moz-box-shadow:0 0 5px #aaa;-webkit-box-shadow:0 0 5px #aaa;box-shadow:0 0 5px #aaa;}* html .ui-tooltip{background-image:none;}body .ui-tooltip{border-width:2px;}.ui-widget{font-family:Verdana,Arial,sans-serif;font-size:1.1em;}.ui-widget .ui-widget{font-size:1em;}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Verdana,Arial,sans-serif;font-size:1em;}.ui-widget-content{border:1px solid #aaa;background:#fff url(images/ui-bg_flat_75_ffffff_40x100.png) 50% 50% repeat-x;color:#222;}.ui-widget-content a{color:#222;}.ui-widget-header{border:1px solid #aaa;background:#ccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x;color:#222;font-weight:bold;}.ui-widget-header a{color:#222;}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #d3d3d3;background:#e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#555;}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#555;text-decoration:none;}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #999;background:#dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121;}.ui-state-hover a,.ui-state-hover a:hover{color:#212121;text-decoration:none;}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #aaa;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:normal;color:#212121;}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#212121;text-decoration:none;}.ui-widget :active{outline:none;}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fcefa1;background:#fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x;color:#363636;}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636;}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#fef1ec url(images/ui-bg_glass_95_fef1ec_1x400.png) 50% 50% repeat-x;color:#cd0a0a;}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#cd0a0a;}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#cd0a0a;}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold;}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal;}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none;}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png);}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png);}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_222222_256x240.png);}.ui-state-default .ui-icon{background-image:url(images/ui-icons_888888_256x240.png);}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_454545_256x240.png);}.ui-state-active .ui-icon{background-image:url(images/ui-icons_454545_256x240.png);}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_2e83ff_256x240.png);}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_cd0a0a_256x240.png);}.ui-icon-carat-1-n{background-position:0 0;}.ui-icon-carat-1-ne{background-position:-16px 0;}.ui-icon-carat-1-e{background-position:-32px 0;}.ui-icon-carat-1-se{background-position:-48px 0;}.ui-icon-carat-1-s{background-position:-64px 0;}.ui-icon-carat-1-sw{background-position:-80px 0;}.ui-icon-carat-1-w{background-position:-96px 0;}.ui-icon-carat-1-nw{background-position:-112px 0;}.ui-icon-carat-2-n-s{background-position:-128px 0;}.ui-icon-carat-2-e-w{background-position:-144px 0;}.ui-icon-triangle-1-n{background-position:0 -16px;}.ui-icon-triangle-1-ne{background-position:-16px -16px;}.ui-icon-triangle-1-e{background-position:-32px -16px;}.ui-icon-triangle-1-se{background-position:-48px -16px;}.ui-icon-triangle-1-s{background-position:-64px -16px;}.ui-icon-triangle-1-sw{background-position:-80px -16px;}.ui-icon-triangle-1-w{background-position:-96px -16px;}.ui-icon-triangle-1-nw{background-position:-112px -16px;}.ui-icon-triangle-2-n-s{background-position:-128px -16px;}.ui-icon-triangle-2-e-w{background-position:-144px -16px;}.ui-icon-arrow-1-n{background-position:0 -32px;}.ui-icon-arrow-1-ne{background-position:-16px -32px;}.ui-icon-arrow-1-e{background-position:-32px -32px;}.ui-icon-arrow-1-se{background-position:-48px -32px;}.ui-icon-arrow-1-s{background-position:-64px -32px;}.ui-icon-arrow-1-sw{background-position:-80px -32px;}.ui-icon-arrow-1-w{background-position:-96px -32px;}.ui-icon-arrow-1-nw{background-position:-112px -32px;}.ui-icon-arrow-2-n-s{background-position:-128px -32px;}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px;}.ui-icon-arrow-2-e-w{background-position:-160px -32px;}.ui-icon-arrow-2-se-nw{background-position:-176px -32px;}.ui-icon-arrowstop-1-n{background-position:-192px -32px;}.ui-icon-arrowstop-1-e{background-position:-208px -32px;}.ui-icon-arrowstop-1-s{background-position:-224px -32px;}.ui-icon-arrowstop-1-w{background-position:-240px -32px;}.ui-icon-arrowthick-1-n{background-position:0 -48px;}.ui-icon-arrowthick-1-ne{background-position:-16px -48px;}.ui-icon-arrowthick-1-e{background-position:-32px -48px;}.ui-icon-arrowthick-1-se{background-position:-48px -48px;}.ui-icon-arrowthick-1-s{background-position:-64px -48px;}.ui-icon-arrowthick-1-sw{background-position:-80px -48px;}.ui-icon-arrowthick-1-w{background-position:-96px -48px;}.ui-icon-arrowthick-1-nw{background-position:-112px -48px;}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px;}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px;}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px;}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px;}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px;}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px;}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px;}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px;}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px;}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px;}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px;}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px;}.ui-icon-arrowreturn-1-w{background-position:-64px -64px;}.ui-icon-arrowreturn-1-n{background-position:-80px -64px;}.ui-icon-arrowreturn-1-e{background-position:-96px -64px;}.ui-icon-arrowreturn-1-s{background-position:-112px -64px;}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px;}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px;}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px;}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px;}.ui-icon-arrow-4{background-position:0 -80px;}.ui-icon-arrow-4-diag{background-position:-16px -80px;}.ui-icon-extlink{background-position:-32px -80px;}.ui-icon-newwin{background-position:-48px -80px;}.ui-icon-refresh{background-position:-64px -80px;}.ui-icon-shuffle{background-position:-80px -80px;}.ui-icon-transfer-e-w{background-position:-96px -80px;}.ui-icon-transferthick-e-w{background-position:-112px -80px;}.ui-icon-folder-collapsed{background-position:0 -96px;}.ui-icon-folder-open{background-position:-16px -96px;}.ui-icon-document{background-position:-32px -96px;}.ui-icon-document-b{background-position:-48px -96px;}.ui-icon-note{background-position:-64px -96px;}.ui-icon-mail-closed{background-position:-80px -96px;}.ui-icon-mail-open{background-position:-96px -96px;}.ui-icon-suitcase{background-position:-112px -96px;}.ui-icon-comment{background-position:-128px -96px;}.ui-icon-person{background-position:-144px -96px;}.ui-icon-print{background-position:-160px -96px;}.ui-icon-trash{background-position:-176px -96px;}.ui-icon-locked{background-position:-192px -96px;}.ui-icon-unlocked{background-position:-208px -96px;}.ui-icon-bookmark{background-position:-224px -96px;}.ui-icon-tag{background-position:-240px -96px;}.ui-icon-home{background-position:0 -112px;}.ui-icon-flag{background-position:-16px -112px;}.ui-icon-calendar{background-position:-32px -112px;}.ui-icon-cart{background-position:-48px -112px;}.ui-icon-pencil{background-position:-64px -112px;}.ui-icon-clock{background-position:-80px -112px;}.ui-icon-disk{background-position:-96px -112px;}.ui-icon-calculator{background-position:-112px -112px;}.ui-icon-zoomin{background-position:-128px -112px;}.ui-icon-zoomout{background-position:-144px -112px;}.ui-icon-search{background-position:-160px -112px;}.ui-icon-wrench{background-position:-176px -112px;}.ui-icon-gear{background-position:-192px -112px;}.ui-icon-heart{background-position:-208px -112px;}.ui-icon-star{background-position:-224px -112px;}.ui-icon-link{background-position:-240px -112px;}.ui-icon-cancel{background-position:0 -128px;}.ui-icon-plus{background-position:-16px -128px;}.ui-icon-plusthick{background-position:-32px -128px;}.ui-icon-minus{background-position:-48px -128px;}.ui-icon-minusthick{background-position:-64px -128px;}.ui-icon-close{background-position:-80px -128px;}.ui-icon-closethick{background-position:-96px -128px;}.ui-icon-key{background-position:-112px -128px;}.ui-icon-lightbulb{background-position:-128px -128px;}.ui-icon-scissors{background-position:-144px -128px;}.ui-icon-clipboard{background-position:-160px -128px;}.ui-icon-copy{background-position:-176px -128px;}.ui-icon-contact{background-position:-192px -128px;}.ui-icon-image{background-position:-208px -128px;}.ui-icon-video{background-position:-224px -128px;}.ui-icon-script{background-position:-240px -128px;}.ui-icon-alert{background-position:0 -144px;}.ui-icon-info{background-position:-16px -144px;}.ui-icon-notice{background-position:-32px -144px;}.ui-icon-help{background-position:-48px -144px;}.ui-icon-check{background-position:-64px -144px;}.ui-icon-bullet{background-position:-80px -144px;}.ui-icon-radio-on{background-position:-96px -144px;}.ui-icon-radio-off{background-position:-112px -144px;}.ui-icon-pin-w{background-position:-128px -144px;}.ui-icon-pin-s{background-position:-144px -144px;}.ui-icon-play{background-position:0 -160px;}.ui-icon-pause{background-position:-16px -160px;}.ui-icon-seek-next{background-position:-32px -160px;}.ui-icon-seek-prev{background-position:-48px -160px;}.ui-icon-seek-end{background-position:-64px -160px;}.ui-icon-seek-start{background-position:-80px -160px;}.ui-icon-seek-first{background-position:-80px -160px;}.ui-icon-stop{background-position:-96px -160px;}.ui-icon-eject{background-position:-112px -160px;}.ui-icon-volume-off{background-position:-128px -160px;}.ui-icon-volume-on{background-position:-144px -160px;}.ui-icon-power{background-position:0 -176px;}.ui-icon-signal-diag{background-position:-16px -176px;}.ui-icon-signal{background-position:-32px -176px;}.ui-icon-battery-0{background-position:-48px -176px;}.ui-icon-battery-1{background-position:-64px -176px;}.ui-icon-battery-2{background-position:-80px -176px;}.ui-icon-battery-3{background-position:-96px -176px;}.ui-icon-circle-plus{background-position:0 -192px;}.ui-icon-circle-minus{background-position:-16px -192px;}.ui-icon-circle-close{background-position:-32px -192px;}.ui-icon-circle-triangle-e{background-position:-48px -192px;}.ui-icon-circle-triangle-s{background-position:-64px -192px;}.ui-icon-circle-triangle-w{background-position:-80px -192px;}.ui-icon-circle-triangle-n{background-position:-96px -192px;}.ui-icon-circle-arrow-e{background-position:-112px -192px;}.ui-icon-circle-arrow-s{background-position:-128px -192px;}.ui-icon-circle-arrow-w{background-position:-144px -192px;}.ui-icon-circle-arrow-n{background-position:-160px -192px;}.ui-icon-circle-zoomin{background-position:-176px -192px;}.ui-icon-circle-zoomout{background-position:-192px -192px;}.ui-icon-circle-check{background-position:-208px -192px;}.ui-icon-circlesmall-plus{background-position:0 -208px;}.ui-icon-circlesmall-minus{background-position:-16px -208px;}.ui-icon-circlesmall-close{background-position:-32px -208px;}.ui-icon-squaresmall-plus{background-position:-48px -208px;}.ui-icon-squaresmall-minus{background-position:-64px -208px;}.ui-icon-squaresmall-close{background-position:-80px -208px;}.ui-icon-grip-dotted-vertical{background-position:0 -224px;}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px;}.ui-icon-grip-solid-vertical{background-position:-32px -224px;}.ui-icon-grip-solid-horizontal{background-position:-48px -224px;}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px;}.ui-icon-grip-diagonal-se{background-position:-80px -224px;}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px;}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px;}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px;}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px;}.ui-widget-overlay{background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);}.ui-widget-shadow{margin:-8px 0 0 -8px;padding:8px;background:#aaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x;opacity:.3;filter:Alpha(Opacity=30);-moz-border-radius:8px;-khtml-border-radius:8px;-webkit-border-radius:8px;border-radius:8px;} \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui.css b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui.css new file mode 100644 index 00000000..5547c7b9 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui.css @@ -0,0 +1,568 @@ +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; } +.ui-widget-content a { color: #333333; } +.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; } +.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -khtml-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* + * jQuery UI Resizable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.16 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; } \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui.min.css b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui.min.css new file mode 100644 index 00000000..78f7d3d0 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/css/ui-lightness/jquery-ui.min.css @@ -0,0 +1 @@ +.ui-helper-hidden{display:none;}.ui-helper-hidden-accessible{position:absolute!important;clip:rect(1px 1px 1px 1px);clip:rect(1px,1px,1px,1px);}.ui-helper-reset{margin:0;padding:0;border:0;outline:0;line-height:1.3;text-decoration:none;font-size:100%;list-style:none;}.ui-helper-clearfix:after{content:".";display:block;height:0;clear:both;visibility:hidden;}.ui-helper-clearfix{display:inline-block;}/* required comment for clearfix to work in Opera \*/ * html .ui-helper-clearfix{height:1%;}.ui-helper-clearfix{display:block;}/* end clearfix */ .ui-helper-zfix{width:100%;height:100%;top:0;left:0;position:absolute;opacity:0;filter:Alpha(Opacity=0);}.ui-state-disabled{cursor:default!important;}.ui-icon{display:block;text-indent:-99999px;overflow:hidden;background-repeat:no-repeat;}.ui-widget-overlay{position:absolute;top:0;left:0;width:100%;height:100%;}.ui-widget{font-family:Trebuchet MS,Tahoma,Verdana,Arial,sans-serif;font-size:1.1em;}.ui-widget .ui-widget{font-size:1em;}.ui-widget input,.ui-widget select,.ui-widget textarea,.ui-widget button{font-family:Trebuchet MS,Tahoma,Verdana,Arial,sans-serif;font-size:1em;}.ui-widget-content{border:1px solid #ddd;background:#eee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x;color:#333;}.ui-widget-content a{color:#333;}.ui-widget-header{border:1px solid #e78f08;background:#f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x;color:#fff;font-weight:bold;}.ui-widget-header a{color:#fff;}.ui-state-default,.ui-widget-content .ui-state-default,.ui-widget-header .ui-state-default{border:1px solid #ccc;background:#f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x;font-weight:bold;color:#1c94c4;}.ui-state-default a,.ui-state-default a:link,.ui-state-default a:visited{color:#1c94c4;text-decoration:none;}.ui-state-hover,.ui-widget-content .ui-state-hover,.ui-widget-header .ui-state-hover,.ui-state-focus,.ui-widget-content .ui-state-focus,.ui-widget-header .ui-state-focus{border:1px solid #fbcb09;background:#fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x;font-weight:bold;color:#c77405;}.ui-state-hover a,.ui-state-hover a:hover{color:#c77405;text-decoration:none;}.ui-state-active,.ui-widget-content .ui-state-active,.ui-widget-header .ui-state-active{border:1px solid #fbd850;background:#fff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x;font-weight:bold;color:#eb8f00;}.ui-state-active a,.ui-state-active a:link,.ui-state-active a:visited{color:#eb8f00;text-decoration:none;}.ui-widget :active{outline:none;}.ui-state-highlight,.ui-widget-content .ui-state-highlight,.ui-widget-header .ui-state-highlight{border:1px solid #fed22f;background:#ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x;color:#363636;}.ui-state-highlight a,.ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a{color:#363636;}.ui-state-error,.ui-widget-content .ui-state-error,.ui-widget-header .ui-state-error{border:1px solid #cd0a0a;background:#b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat;color:#fff;}.ui-state-error a,.ui-widget-content .ui-state-error a,.ui-widget-header .ui-state-error a{color:#fff;}.ui-state-error-text,.ui-widget-content .ui-state-error-text,.ui-widget-header .ui-state-error-text{color:#fff;}.ui-priority-primary,.ui-widget-content .ui-priority-primary,.ui-widget-header .ui-priority-primary{font-weight:bold;}.ui-priority-secondary,.ui-widget-content .ui-priority-secondary,.ui-widget-header .ui-priority-secondary{opacity:.7;filter:Alpha(Opacity=70);font-weight:normal;}.ui-state-disabled,.ui-widget-content .ui-state-disabled,.ui-widget-header .ui-state-disabled{opacity:.35;filter:Alpha(Opacity=35);background-image:none;}.ui-icon{width:16px;height:16px;background-image:url(images/ui-icons_222222_256x240.png);}.ui-widget-content .ui-icon{background-image:url(images/ui-icons_222222_256x240.png);}.ui-widget-header .ui-icon{background-image:url(images/ui-icons_ffffff_256x240.png);}.ui-state-default .ui-icon{background-image:url(images/ui-icons_ef8c08_256x240.png);}.ui-state-hover .ui-icon,.ui-state-focus .ui-icon{background-image:url(images/ui-icons_ef8c08_256x240.png);}.ui-state-active .ui-icon{background-image:url(images/ui-icons_ef8c08_256x240.png);}.ui-state-highlight .ui-icon{background-image:url(images/ui-icons_228ef1_256x240.png);}.ui-state-error .ui-icon,.ui-state-error-text .ui-icon{background-image:url(images/ui-icons_ffd27a_256x240.png);}.ui-icon-carat-1-n{background-position:0 0;}.ui-icon-carat-1-ne{background-position:-16px 0;}.ui-icon-carat-1-e{background-position:-32px 0;}.ui-icon-carat-1-se{background-position:-48px 0;}.ui-icon-carat-1-s{background-position:-64px 0;}.ui-icon-carat-1-sw{background-position:-80px 0;}.ui-icon-carat-1-w{background-position:-96px 0;}.ui-icon-carat-1-nw{background-position:-112px 0;}.ui-icon-carat-2-n-s{background-position:-128px 0;}.ui-icon-carat-2-e-w{background-position:-144px 0;}.ui-icon-triangle-1-n{background-position:0 -16px;}.ui-icon-triangle-1-ne{background-position:-16px -16px;}.ui-icon-triangle-1-e{background-position:-32px -16px;}.ui-icon-triangle-1-se{background-position:-48px -16px;}.ui-icon-triangle-1-s{background-position:-64px -16px;}.ui-icon-triangle-1-sw{background-position:-80px -16px;}.ui-icon-triangle-1-w{background-position:-96px -16px;}.ui-icon-triangle-1-nw{background-position:-112px -16px;}.ui-icon-triangle-2-n-s{background-position:-128px -16px;}.ui-icon-triangle-2-e-w{background-position:-144px -16px;}.ui-icon-arrow-1-n{background-position:0 -32px;}.ui-icon-arrow-1-ne{background-position:-16px -32px;}.ui-icon-arrow-1-e{background-position:-32px -32px;}.ui-icon-arrow-1-se{background-position:-48px -32px;}.ui-icon-arrow-1-s{background-position:-64px -32px;}.ui-icon-arrow-1-sw{background-position:-80px -32px;}.ui-icon-arrow-1-w{background-position:-96px -32px;}.ui-icon-arrow-1-nw{background-position:-112px -32px;}.ui-icon-arrow-2-n-s{background-position:-128px -32px;}.ui-icon-arrow-2-ne-sw{background-position:-144px -32px;}.ui-icon-arrow-2-e-w{background-position:-160px -32px;}.ui-icon-arrow-2-se-nw{background-position:-176px -32px;}.ui-icon-arrowstop-1-n{background-position:-192px -32px;}.ui-icon-arrowstop-1-e{background-position:-208px -32px;}.ui-icon-arrowstop-1-s{background-position:-224px -32px;}.ui-icon-arrowstop-1-w{background-position:-240px -32px;}.ui-icon-arrowthick-1-n{background-position:0 -48px;}.ui-icon-arrowthick-1-ne{background-position:-16px -48px;}.ui-icon-arrowthick-1-e{background-position:-32px -48px;}.ui-icon-arrowthick-1-se{background-position:-48px -48px;}.ui-icon-arrowthick-1-s{background-position:-64px -48px;}.ui-icon-arrowthick-1-sw{background-position:-80px -48px;}.ui-icon-arrowthick-1-w{background-position:-96px -48px;}.ui-icon-arrowthick-1-nw{background-position:-112px -48px;}.ui-icon-arrowthick-2-n-s{background-position:-128px -48px;}.ui-icon-arrowthick-2-ne-sw{background-position:-144px -48px;}.ui-icon-arrowthick-2-e-w{background-position:-160px -48px;}.ui-icon-arrowthick-2-se-nw{background-position:-176px -48px;}.ui-icon-arrowthickstop-1-n{background-position:-192px -48px;}.ui-icon-arrowthickstop-1-e{background-position:-208px -48px;}.ui-icon-arrowthickstop-1-s{background-position:-224px -48px;}.ui-icon-arrowthickstop-1-w{background-position:-240px -48px;}.ui-icon-arrowreturnthick-1-w{background-position:0 -64px;}.ui-icon-arrowreturnthick-1-n{background-position:-16px -64px;}.ui-icon-arrowreturnthick-1-e{background-position:-32px -64px;}.ui-icon-arrowreturnthick-1-s{background-position:-48px -64px;}.ui-icon-arrowreturn-1-w{background-position:-64px -64px;}.ui-icon-arrowreturn-1-n{background-position:-80px -64px;}.ui-icon-arrowreturn-1-e{background-position:-96px -64px;}.ui-icon-arrowreturn-1-s{background-position:-112px -64px;}.ui-icon-arrowrefresh-1-w{background-position:-128px -64px;}.ui-icon-arrowrefresh-1-n{background-position:-144px -64px;}.ui-icon-arrowrefresh-1-e{background-position:-160px -64px;}.ui-icon-arrowrefresh-1-s{background-position:-176px -64px;}.ui-icon-arrow-4{background-position:0 -80px;}.ui-icon-arrow-4-diag{background-position:-16px -80px;}.ui-icon-extlink{background-position:-32px -80px;}.ui-icon-newwin{background-position:-48px -80px;}.ui-icon-refresh{background-position:-64px -80px;}.ui-icon-shuffle{background-position:-80px -80px;}.ui-icon-transfer-e-w{background-position:-96px -80px;}.ui-icon-transferthick-e-w{background-position:-112px -80px;}.ui-icon-folder-collapsed{background-position:0 -96px;}.ui-icon-folder-open{background-position:-16px -96px;}.ui-icon-document{background-position:-32px -96px;}.ui-icon-document-b{background-position:-48px -96px;}.ui-icon-note{background-position:-64px -96px;}.ui-icon-mail-closed{background-position:-80px -96px;}.ui-icon-mail-open{background-position:-96px -96px;}.ui-icon-suitcase{background-position:-112px -96px;}.ui-icon-comment{background-position:-128px -96px;}.ui-icon-person{background-position:-144px -96px;}.ui-icon-print{background-position:-160px -96px;}.ui-icon-trash{background-position:-176px -96px;}.ui-icon-locked{background-position:-192px -96px;}.ui-icon-unlocked{background-position:-208px -96px;}.ui-icon-bookmark{background-position:-224px -96px;}.ui-icon-tag{background-position:-240px -96px;}.ui-icon-home{background-position:0 -112px;}.ui-icon-flag{background-position:-16px -112px;}.ui-icon-calendar{background-position:-32px -112px;}.ui-icon-cart{background-position:-48px -112px;}.ui-icon-pencil{background-position:-64px -112px;}.ui-icon-clock{background-position:-80px -112px;}.ui-icon-disk{background-position:-96px -112px;}.ui-icon-calculator{background-position:-112px -112px;}.ui-icon-zoomin{background-position:-128px -112px;}.ui-icon-zoomout{background-position:-144px -112px;}.ui-icon-search{background-position:-160px -112px;}.ui-icon-wrench{background-position:-176px -112px;}.ui-icon-gear{background-position:-192px -112px;}.ui-icon-heart{background-position:-208px -112px;}.ui-icon-star{background-position:-224px -112px;}.ui-icon-link{background-position:-240px -112px;}.ui-icon-cancel{background-position:0 -128px;}.ui-icon-plus{background-position:-16px -128px;}.ui-icon-plusthick{background-position:-32px -128px;}.ui-icon-minus{background-position:-48px -128px;}.ui-icon-minusthick{background-position:-64px -128px;}.ui-icon-close{background-position:-80px -128px;}.ui-icon-closethick{background-position:-96px -128px;}.ui-icon-key{background-position:-112px -128px;}.ui-icon-lightbulb{background-position:-128px -128px;}.ui-icon-scissors{background-position:-144px -128px;}.ui-icon-clipboard{background-position:-160px -128px;}.ui-icon-copy{background-position:-176px -128px;}.ui-icon-contact{background-position:-192px -128px;}.ui-icon-image{background-position:-208px -128px;}.ui-icon-video{background-position:-224px -128px;}.ui-icon-script{background-position:-240px -128px;}.ui-icon-alert{background-position:0 -144px;}.ui-icon-info{background-position:-16px -144px;}.ui-icon-notice{background-position:-32px -144px;}.ui-icon-help{background-position:-48px -144px;}.ui-icon-check{background-position:-64px -144px;}.ui-icon-bullet{background-position:-80px -144px;}.ui-icon-radio-off{background-position:-96px -144px;}.ui-icon-radio-on{background-position:-112px -144px;}.ui-icon-pin-w{background-position:-128px -144px;}.ui-icon-pin-s{background-position:-144px -144px;}.ui-icon-play{background-position:0 -160px;}.ui-icon-pause{background-position:-16px -160px;}.ui-icon-seek-next{background-position:-32px -160px;}.ui-icon-seek-prev{background-position:-48px -160px;}.ui-icon-seek-end{background-position:-64px -160px;}.ui-icon-seek-start{background-position:-80px -160px;}.ui-icon-seek-first{background-position:-80px -160px;}.ui-icon-stop{background-position:-96px -160px;}.ui-icon-eject{background-position:-112px -160px;}.ui-icon-volume-off{background-position:-128px -160px;}.ui-icon-volume-on{background-position:-144px -160px;}.ui-icon-power{background-position:0 -176px;}.ui-icon-signal-diag{background-position:-16px -176px;}.ui-icon-signal{background-position:-32px -176px;}.ui-icon-battery-0{background-position:-48px -176px;}.ui-icon-battery-1{background-position:-64px -176px;}.ui-icon-battery-2{background-position:-80px -176px;}.ui-icon-battery-3{background-position:-96px -176px;}.ui-icon-circle-plus{background-position:0 -192px;}.ui-icon-circle-minus{background-position:-16px -192px;}.ui-icon-circle-close{background-position:-32px -192px;}.ui-icon-circle-triangle-e{background-position:-48px -192px;}.ui-icon-circle-triangle-s{background-position:-64px -192px;}.ui-icon-circle-triangle-w{background-position:-80px -192px;}.ui-icon-circle-triangle-n{background-position:-96px -192px;}.ui-icon-circle-arrow-e{background-position:-112px -192px;}.ui-icon-circle-arrow-s{background-position:-128px -192px;}.ui-icon-circle-arrow-w{background-position:-144px -192px;}.ui-icon-circle-arrow-n{background-position:-160px -192px;}.ui-icon-circle-zoomin{background-position:-176px -192px;}.ui-icon-circle-zoomout{background-position:-192px -192px;}.ui-icon-circle-check{background-position:-208px -192px;}.ui-icon-circlesmall-plus{background-position:0 -208px;}.ui-icon-circlesmall-minus{background-position:-16px -208px;}.ui-icon-circlesmall-close{background-position:-32px -208px;}.ui-icon-squaresmall-plus{background-position:-48px -208px;}.ui-icon-squaresmall-minus{background-position:-64px -208px;}.ui-icon-squaresmall-close{background-position:-80px -208px;}.ui-icon-grip-dotted-vertical{background-position:0 -224px;}.ui-icon-grip-dotted-horizontal{background-position:-16px -224px;}.ui-icon-grip-solid-vertical{background-position:-32px -224px;}.ui-icon-grip-solid-horizontal{background-position:-48px -224px;}.ui-icon-gripsmall-diagonal-se{background-position:-64px -224px;}.ui-icon-grip-diagonal-se{background-position:-80px -224px;}.ui-corner-all,.ui-corner-top,.ui-corner-left,.ui-corner-tl{-moz-border-radius-topleft:4px;-webkit-border-top-left-radius:4px;-khtml-border-top-left-radius:4px;border-top-left-radius:4px;}.ui-corner-all,.ui-corner-top,.ui-corner-right,.ui-corner-tr{-moz-border-radius-topright:4px;-webkit-border-top-right-radius:4px;-khtml-border-top-right-radius:4px;border-top-right-radius:4px;}.ui-corner-all,.ui-corner-bottom,.ui-corner-left,.ui-corner-bl{-moz-border-radius-bottomleft:4px;-webkit-border-bottom-left-radius:4px;-khtml-border-bottom-left-radius:4px;border-bottom-left-radius:4px;}.ui-corner-all,.ui-corner-bottom,.ui-corner-right,.ui-corner-br{-moz-border-radius-bottomright:4px;-webkit-border-bottom-right-radius:4px;-khtml-border-bottom-right-radius:4px;border-bottom-right-radius:4px;}.ui-widget-overlay{background:#666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat;opacity:.50;filter:Alpha(Opacity=50);}.ui-widget-shadow{margin:-5px 0 0 -5px;padding:5px;background:#000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x;opacity:.20;filter:Alpha(Opacity=20);-moz-border-radius:5px;-khtml-border-radius:5px;-webkit-border-radius:5px;border-radius:5px;}.ui-resizable{position:relative;}.ui-resizable-handle{position:absolute;font-size:.1px;z-index:99999;display:block;}.ui-resizable-disabled .ui-resizable-handle,.ui-resizable-autohide .ui-resizable-handle{display:none;}.ui-resizable-n{cursor:n-resize;height:7px;width:100%;top:-5px;left:0;}.ui-resizable-s{cursor:s-resize;height:7px;width:100%;bottom:-5px;left:0;}.ui-resizable-e{cursor:e-resize;width:7px;right:-5px;top:0;height:100%;}.ui-resizable-w{cursor:w-resize;width:7px;left:-5px;top:0;height:100%;}.ui-resizable-se{cursor:se-resize;width:12px;height:12px;right:1px;bottom:1px;}.ui-resizable-sw{cursor:sw-resize;width:9px;height:9px;left:-5px;bottom:-5px;}.ui-resizable-nw{cursor:nw-resize;width:9px;height:9px;left:-5px;top:-5px;}.ui-resizable-ne{cursor:ne-resize;width:9px;height:9px;right:-5px;top:-5px;}.ui-selectable-helper{position:absolute;z-index:100;border:1px dotted black;}.ui-accordion{width:100%;}.ui-accordion .ui-accordion-header{cursor:pointer;position:relative;margin-top:1px;zoom:1;}.ui-accordion .ui-accordion-li-fix{display:inline;}.ui-accordion .ui-accordion-header-active{border-bottom:0!important;}.ui-accordion .ui-accordion-header a{display:block;font-size:1em;padding:.5em .5em .5em .7em;}.ui-accordion-icons .ui-accordion-header a{padding-left:2.2em;}.ui-accordion .ui-accordion-header .ui-icon{position:absolute;left:.5em;top:50%;margin-top:-8px;}.ui-accordion .ui-accordion-content{padding:1em 2.2em;border-top:0;margin-top:-2px;position:relative;top:1px;margin-bottom:2px;overflow:auto;display:none;zoom:1;}.ui-accordion .ui-accordion-content-active{display:block;}.ui-autocomplete{position:absolute;cursor:default;}* html .ui-autocomplete{width:1px;}.ui-menu{list-style:none;padding:2px;margin:0;display:block;float:left;}.ui-menu .ui-menu{margin-top:-3px;}.ui-menu .ui-menu-item{margin:0;padding:0;zoom:1;float:left;clear:left;width:100%;}.ui-menu .ui-menu-item a{text-decoration:none;display:block;padding:.2em .4em;line-height:1.5;zoom:1;}.ui-menu .ui-menu-item a.ui-state-hover,.ui-menu .ui-menu-item a.ui-state-active{font-weight:normal;margin:-1px;}.ui-button{display:inline-block;position:relative;padding:0;margin-right:.1em;text-decoration:none!important;cursor:pointer;text-align:center;zoom:1;overflow:visible;}.ui-button-icon-only{width:2.2em;}button.ui-button-icon-only{width:2.4em;}.ui-button-icons-only{width:3.4em;}button.ui-button-icons-only{width:3.7em;}.ui-button .ui-button-text{display:block;line-height:1.4;}.ui-button-text-only .ui-button-text{padding:.4em 1em;}.ui-button-icon-only .ui-button-text,.ui-button-icons-only .ui-button-text{padding:.4em;text-indent:-9999999px;}.ui-button-text-icon-primary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 1em .4em 2.1em;}.ui-button-text-icon-secondary .ui-button-text,.ui-button-text-icons .ui-button-text{padding:.4em 2.1em .4em 1em;}.ui-button-text-icons .ui-button-text{padding-left:2.1em;padding-right:2.1em;}input.ui-button{padding:.4em 1em;}.ui-button-icon-only .ui-icon,.ui-button-text-icon-primary .ui-icon,.ui-button-text-icon-secondary .ui-icon,.ui-button-text-icons .ui-icon,.ui-button-icons-only .ui-icon{position:absolute;top:50%;margin-top:-8px;}.ui-button-icon-only .ui-icon{left:50%;margin-left:-8px;}.ui-button-text-icon-primary .ui-button-icon-primary,.ui-button-text-icons .ui-button-icon-primary,.ui-button-icons-only .ui-button-icon-primary{left:.5em;}.ui-button-text-icon-secondary .ui-button-icon-secondary,.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em;}.ui-button-text-icons .ui-button-icon-secondary,.ui-button-icons-only .ui-button-icon-secondary{right:.5em;}.ui-buttonset{margin-right:7px;}.ui-buttonset .ui-button{margin-left:0;margin-right:-.3em;}button.ui-button::-moz-focus-inner{border:0;padding:0;}.ui-dialog{position:absolute;padding:.2em;width:300px;overflow:hidden;}.ui-dialog .ui-dialog-titlebar{padding:.4em 1em;position:relative;}.ui-dialog .ui-dialog-title{float:left;margin:.1em 16px .1em 0;}.ui-dialog .ui-dialog-titlebar-close{position:absolute;right:.3em;top:50%;width:19px;margin:-10px 0 0 0;padding:1px;height:18px;}.ui-dialog .ui-dialog-titlebar-close span{display:block;margin:1px;}.ui-dialog .ui-dialog-titlebar-close:hover,.ui-dialog .ui-dialog-titlebar-close:focus{padding:0;}.ui-dialog .ui-dialog-content{position:relative;border:0;padding:.5em 1em;background:none;overflow:auto;zoom:1;}.ui-dialog .ui-dialog-buttonpane{text-align:left;border-width:1px 0 0 0;background-image:none;margin:.5em 0 0 0;padding:.3em 1em .5em .4em;}.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset{float:right;}.ui-dialog .ui-dialog-buttonpane button{margin:.5em .4em .5em 0;cursor:pointer;}.ui-dialog .ui-resizable-se{width:14px;height:14px;right:3px;bottom:3px;}.ui-draggable .ui-dialog-titlebar{cursor:move;}.ui-slider{position:relative;text-align:left;}.ui-slider .ui-slider-handle{position:absolute;z-index:2;width:1.2em;height:1.2em;cursor:default;}.ui-slider .ui-slider-range{position:absolute;z-index:1;font-size:.7em;display:block;border:0;background-position:0 0;}.ui-slider-horizontal{height:.8em;}.ui-slider-horizontal .ui-slider-handle{top:-.3em;margin-left:-.6em;}.ui-slider-horizontal .ui-slider-range{top:0;height:100%;}.ui-slider-horizontal .ui-slider-range-min{left:0;}.ui-slider-horizontal .ui-slider-range-max{right:0;}.ui-slider-vertical{width:.8em;height:100px;}.ui-slider-vertical .ui-slider-handle{left:-.3em;margin-left:0;margin-bottom:-.6em;}.ui-slider-vertical .ui-slider-range{left:0;width:100%;}.ui-slider-vertical .ui-slider-range-min{bottom:0;}.ui-slider-vertical .ui-slider-range-max{top:0;}.ui-tabs{position:relative;padding:.2em;zoom:1;}.ui-tabs .ui-tabs-nav{margin:0;padding:.2em .2em 0;}.ui-tabs .ui-tabs-nav li{list-style:none;float:left;position:relative;top:1px;margin:0 .2em 1px 0;border-bottom:0!important;padding:0;white-space:nowrap;}.ui-tabs .ui-tabs-nav li a{float:left;padding:.5em 1em;text-decoration:none;}.ui-tabs .ui-tabs-nav li.ui-tabs-selected{margin-bottom:0;padding-bottom:1px;}.ui-tabs .ui-tabs-nav li.ui-tabs-selected a,.ui-tabs .ui-tabs-nav li.ui-state-disabled a,.ui-tabs .ui-tabs-nav li.ui-state-processing a{cursor:text;}.ui-tabs .ui-tabs-nav li a,.ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a{cursor:pointer;}.ui-tabs .ui-tabs-panel{display:block;border-width:0;padding:1em 1.4em;background:none;}.ui-tabs .ui-tabs-hide{display:none!important;}.ui-datepicker{width:17em;padding:.2em .2em 0;display:none;}.ui-datepicker .ui-datepicker-header{position:relative;padding:.2em 0;}.ui-datepicker .ui-datepicker-prev,.ui-datepicker .ui-datepicker-next{position:absolute;top:2px;width:1.8em;height:1.8em;}.ui-datepicker .ui-datepicker-prev-hover,.ui-datepicker .ui-datepicker-next-hover{top:1px;}.ui-datepicker .ui-datepicker-prev{left:2px;}.ui-datepicker .ui-datepicker-next{right:2px;}.ui-datepicker .ui-datepicker-prev-hover{left:1px;}.ui-datepicker .ui-datepicker-next-hover{right:1px;}.ui-datepicker .ui-datepicker-prev span,.ui-datepicker .ui-datepicker-next span{display:block;position:absolute;left:50%;margin-left:-8px;top:50%;margin-top:-8px;}.ui-datepicker .ui-datepicker-title{margin:0 2.3em;line-height:1.8em;text-align:center;}.ui-datepicker .ui-datepicker-title select{font-size:1em;margin:1px 0;}.ui-datepicker select.ui-datepicker-month-year{width:100%;}.ui-datepicker select.ui-datepicker-month,.ui-datepicker select.ui-datepicker-year{width:49%;}.ui-datepicker table{width:100%;font-size:.9em;border-collapse:collapse;margin:0 0 .4em;}.ui-datepicker th{padding:.7em .3em;text-align:center;font-weight:bold;border:0;}.ui-datepicker td{border:0;padding:1px;}.ui-datepicker td span,.ui-datepicker td a{display:block;padding:.2em;text-align:right;text-decoration:none;}.ui-datepicker .ui-datepicker-buttonpane{background-image:none;margin:.7em 0 0 0;padding:0 .2em;border-left:0;border-right:0;border-bottom:0;}.ui-datepicker .ui-datepicker-buttonpane button{float:right;margin:.5em .2em .4em;cursor:pointer;padding:.2em .6em .3em .6em;width:auto;overflow:visible;}.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current{float:left;}.ui-datepicker.ui-datepicker-multi{width:auto;}.ui-datepicker-multi .ui-datepicker-group{float:left;}.ui-datepicker-multi .ui-datepicker-group table{width:95%;margin:0 auto .4em;}.ui-datepicker-multi-2 .ui-datepicker-group{width:50%;}.ui-datepicker-multi-3 .ui-datepicker-group{width:33.3%;}.ui-datepicker-multi-4 .ui-datepicker-group{width:25%;}.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header{border-left-width:0;}.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header{border-left-width:0;}.ui-datepicker-multi .ui-datepicker-buttonpane{clear:left;}.ui-datepicker-row-break{clear:both;width:100%;font-size:0;}.ui-datepicker-rtl{direction:rtl;}.ui-datepicker-rtl .ui-datepicker-prev{right:2px;left:auto;}.ui-datepicker-rtl .ui-datepicker-next{left:2px;right:auto;}.ui-datepicker-rtl .ui-datepicker-prev:hover{right:1px;left:auto;}.ui-datepicker-rtl .ui-datepicker-next:hover{left:1px;right:auto;}.ui-datepicker-rtl .ui-datepicker-buttonpane{clear:right;}.ui-datepicker-rtl .ui-datepicker-buttonpane button{float:left;}.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current{float:right;}.ui-datepicker-rtl .ui-datepicker-group{float:right;}.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header{border-right-width:0;border-left-width:1px;}.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header{border-right-width:0;border-left-width:1px;}.ui-datepicker-cover{display:none;display:block;position:absolute;z-index:-1;filter:mask();top:-4px;left:-4px;width:200px;height:200px;}.ui-progressbar{height:2em;text-align:left;}.ui-progressbar .ui-progressbar-value{margin:-1px;height:100%;} \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery-ui.min.js b/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery-ui.min.js new file mode 100644 index 00000000..14c9064f --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery-ui.min.js @@ -0,0 +1,791 @@ +/*! + * jQuery UI 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= +this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, +"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": +"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, +outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, +"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& +a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; +this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; +d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& +c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j"); +this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? +(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- +m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= +this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= +this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); +c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= +this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- +g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, +b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
  • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout", +function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); +b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, +setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, +"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== +"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): +d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, +b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= +1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ +2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= +d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= +a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, +"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== +a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", +a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= +"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); +c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= +true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); +a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& +!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), +h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= +this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); +this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): +0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? +"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); +this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); +if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? +b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", +COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: +null)||this._defaults.monthNames;var i=function(o){(o=k+1 +12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& +a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? +new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); +n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, +g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& +a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&& +x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
    ';var z=j?'":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, +z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+ +r.getDate()+"":''+r.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'': +"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, +e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ +(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? +a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, +e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, +"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; +if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== +"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Effects 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), +d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; +if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); +return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, +arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ +2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, +d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, +a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, +d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery.effects.blind.min.js b/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery.effects.blind.min.js new file mode 100644 index 00000000..101c15d4 --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery.effects.blind.min.js @@ -0,0 +1,14 @@ +/* + * jQuery UI Effects Blind 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function(b){var n=/up|down|vertical/,o=/up|left|vertical|horizontal/;b.effects.effect.blind=function(g,p){var a=b(this),i=["position","top","bottom","left","right","height","width"],l=b.effects.setMode(a,g.mode||"hide"),e=g.direction||"up",f=n.test(e),h=f?"height":"width",m=f?"top":"left";e=o.test(e);var j={},k=l==="show",c,d;a.parent().is(".ui-effects-wrapper")?b.effects.save(a.parent(),i):b.effects.save(a,i);a.show();d=parseInt(a.css("top"),10);c=b.effects.createWrapper(a).css({overflow:"hidden"}); +d=f?c[h]()+d:c[h]();j[h]=k?d:0;if(!e){a.css(f?"bottom":"right",0).css(f?"top":"left","").css({position:"absolute"});j[m]=k?0:d}if(k){c.css(h,0);e||c.css(m,d)}c.animate(j,{duration:g.duration,easing:g.easing,queue:false,complete:function(){l==="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);p()}})}})(jQuery); diff --git a/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery.effects.core.min.js b/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery.effects.core.min.js new file mode 100644 index 00000000..9e92123a --- /dev/null +++ b/public/site_assets/test/js/dist/examples/jquery-ui/js/jquery.effects.core.min.js @@ -0,0 +1,32 @@ +/* + * jQuery UI Effects 1.9pre + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,m){function r(c){var a;if(c&&c.constructor===Array&&c.length===3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return s.transparent;return s[f.trim(c).toLowerCase()]}function t(){var c=this.ownerDocument.defaultView?this.ownerDocument.defaultView.getComputedStyle(this,null):this.currentStyle,a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(d=c.length;d--;){b=c[d];if(typeof c[b]==="string")a[f.camelCase(b)]=c[b]}else for(b in c)if(typeof c[b]=== +"string")a[b]=c[b];return a}function o(c,a,b,d){if(f.isPlainObject(c))return c;c={effect:c};if(a===m)a={};if(f.isFunction(a)){d=a;b=null;a={}}if(f.type(a)==="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a&&f.extend(c,a);b=b||a.duration;c.duration=f.fx.off?0:typeof b==="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;c.complete=d||a.complete;return c}function q(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects.effect[c]){if(u&& +f.effects[c])return false;return true}return false}var u=f.uiBackCompat!==false;f.effects={effect:{}};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){var d;d=b.elem;var e=a,g;do{g=f.curCSS(d,e);if(g!=""&&g!=="transparent"||f.nodeName(d,"body"))break;e="backgroundColor"}while(d=d.parentNode);d=r(g);b.start=d;b.end=r(b.end);b.colorInit=true}b.elem.style[a]= +"rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var s={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139, +0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192, +203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},w=["add","remove","toggle"],x={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.each(["borderLeftStyle","borderRightStyle","borderBottomStyle","borderTopStyle"],function(c,a){f.fx.step[a]=function(b){if(b.end!=="none"&&!b.setAttr||b.pos===1&&!b.setAttr){jQuery.style(b.elem,a,b.end);b.setAttr= +true}}});f.effects.animateClass=function(c,a,b,d){var e=f.speed(a,b,d);return this.queue(function(){var g=f(this),h=g.attr("class")||"",n,j=e.children?g.find("*").andSelf():g;j=j.map(function(){var k=f(this);return{el:k,originalStyleAttr:k.attr("style")||" ",start:t.call(this)}});f.each(w,function(k,i){if(c[i])g[i+"Class"](c[i])});n=g.attr("class");j=j.map(function(){this.end=t.call(this.el[0]);var k=this.start,i=this.end,v={},l,p;for(l in i){p=i[l];if(k[l]!=p)if(!x[l])if(f.fx.step[l]||!isNaN(parseFloat(p)))v[l]= +p}this.diff=v;return this});g.attr("class",h);j=j.map(function(){var k=this,i=f.Deferred();this.el.animate(this.diff,{duration:e.duration,easing:e.easing,queue:false,complete:function(){i.resolve(k)}});return i.promise()});f.when.apply(f,j.get()).done(function(){g.attr("class",n);f.each(arguments,function(){if(typeof this.el.attr("style")==="object"){this.el.attr("style").cssText="";this.el.attr("style").cssText=this.originalStyleAttr}else this.el.attr("style",this.originalStyleAttr)});e.complete.call(g[0])})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a==="boolean"||a===m?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.9pre",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), +d={width:c.width(),height:c.height()},e=document.activeElement;c.wrap(b);if(c[0]===e||f.contains(c[0],e))f(e).focus();b=c.parent();if(c.css("position")==="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(g,h){a[h]=c.css(h);if(isNaN(parseInt(a[h],10)))a[h]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}c.css(d);return b.css(a).show()}, +removeWrapper:function(c){var a=document.activeElement;if(c.parent().is(".ui-effects-wrapper")){c.parent().replaceWith(c);if(c[0]===a||f.contains(c[0],a))f(a).focus()}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){var h=c.cssUnit(g);if(h[0]>0)d[g]=h[0]*b+h[1]});return d}});f.fn.extend({effect:function(){function c(h){function n(){f.isFunction(k)&&k.call(j[0]);f.isFunction(h)&&h()}var j=f(this),k=a.complete,i=a.mode;(j.is(":hidden")?i==="hide":i==="show")?n():e.call(j[0], +a,n)}var a=o.apply(this,arguments),b=a.mode,d=a.queue,e=f.effects.effect[a.effect],g=!e&&u&&f.effects[a.effect];if(f.fx.off||!(e||g))return b?this[b](a.duration,a.complete):this.each(function(){a.complete&&a.complete.call(this)});return e?d===false?this.each(c):this.queue(d||"fx",c):g.call(this,{options:a,duration:a.duration,callback:a.complete,mode:a.mode})},_show:f.fn.show,show:function(c){if(q(c))return this._show.apply(this,arguments);else{var a=o.apply(this,arguments);a.mode="show";return this.effect.call(this, +a)}},_hide:f.fn.hide,hide:function(c){if(q(c))return this._hide.apply(this,arguments);else{var a=o.apply(this,arguments);a.mode="hide";return this.effect.call(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(q(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=o.apply(this,arguments);a.mode="toggle";return this.effect.call(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a), +e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a, +b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2* +((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+ +b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=e*0.3,h=d;if(a==0)return b;if((a/=e)==1)return b+d;if(h + + +// Create a jquery plugin that prints the given element. +jQuery.fn.print = function(){ + // NOTE: We are trimming the jQuery collection down to the + // first element in the collection. + if (this.size() > 1){ + this.eq( 0 ).print(); + return; + } else if (!this.size()){ + return; + } + + var chart = $(this).closest('div.quintile-outer-container').find('div.jqplot-target'); + // var imgelem = chart.jqplotToImageElem(); + var imageElemStr = chart.jqplotToImageElemStr(); + // var statsrows = $(this).closest('div.quintile-outer-container').find('table.stats-table tr'); + var statsTable = $('
    ').append($(this).closest('div.quintile-outer-container').find('table.stats-table').clone()); + // var rowstyles = window.getComputedStyle(statsrows.get(0), ''); + + // ASSERT: At this point, we know that the current jQuery + // collection (as defined by THIS), contains only one + // printable element. + + // Create a random name for the print frame. + var strFrameName = ("printer-" + (new Date()).getTime()); + + // Create an iFrame with the new name. + var jFrame = $( "